| | | (1,2-dibromoethyl)benzene C8H8Br23, 64 |
 | | Compound Data | | Melting point | 73.50 °C | 346.65 K | | CSID | 6878 | H bond acceptors | 0 | Rule of 5 violations | 0 | | Molecular weight | 263.9571 | H bond donors | 0 | ACD/LogP | 3.69 | | Phase 25 °C | solid | Rotatable bonds | 2 | Predicted density | 1.77 g/cm3 | | SMILES | BrCC(Br)c1ccccc1 | | STD InChIKey | SHKKTLSDGJRCTR-UHFFFAOYAP | | Melting Points | | mp °C | source | |
|---|
| 72.00 | Alfa Aesar | | 75.00 | PHYSPROP |
|
|
| | | (2-chlorobenzylidene)malononitrile C10H5ClN261, 64 |
 | | Compound Data | | Melting point | 95.25 °C | 368.40 K | | CSID | 16644 | H bond acceptors | 2 | Rule of 5 violations | 0 | | Molecular weight | 188.6131 | H bond donors | 0 | ACD/LogP | 2.35 | | Phase 25 °C | solid | Rotatable bonds | 1 | Predicted density | 1.30 g/cm3 | | SMILES | Clc1ccccc1\C=C(/C#N)C#N | | STD InChIKey | JJNZXLAFIPKXIG-UHFFFAOYAA | | Melting Points | | mp °C | source | |
|---|
| 95.00 | Oxford University MSDS | | 95.50 | PHYSPROP |
|
|
| | | (2,4-dichlorophenoxy)acetic acid C8H6Cl2O33, 61, 64 |
 | | Compound Data | | Melting point | 138.83 °C | 411.98 K | | CSID | 1441 | H bond acceptors | 3 | Rule of 5 violations | 0 | | Molecular weight | 221.0374 | H bond donors | 1 | ACD/LogP | 2.58 | | Phase 25 °C | solid | Rotatable bonds | 3 | Predicted density | 1.49 g/cm3 | | SMILES | Clc1cc(Cl)ccc1OCC(=O)O | | STD InChIKey | OVSKIKFHRZPJSS-UHFFFAOYAM | | Melting Points | | mp °C | source | |
|---|
| 138.00 | Alfa Aesar | | 138.00 | Oxford University MSDS | | 140.50 | PHYSPROP |
|
|
| | | (4-bromobutoxy)benzene C10H13BrO3, 64 |
 | | Compound Data | | Melting point | 41.50 °C | 314.65 K | | CSID | 64147 | H bond acceptors | 1 | Rule of 5 violations | 0 | | Molecular weight | 229.1136 | H bond donors | 0 | ACD/LogP | 3.72 | | Phase 25 °C | solid | Rotatable bonds | 5 | Predicted density | 1.30 g/cm3 | | SMILES | BrCCCCOc1ccccc1 | | STD InChIKey | QBLISOIWPZSVIK-UHFFFAOYAM | | Melting Points | | mp °C | source | |
|---|
| 42.00 | Alfa Aesar | | 41.00 | PHYSPROP |
|
|
| | | 1-(2-methoxyphenyl)piperazine C11H16N2O3, 64 |
 | | Compound Data | | Melting point | 37.75 °C | 310.90 K | | CSID | 1306 | H bond acceptors | 3 | Rule of 5 violations | 0 | | Molecular weight | 192.2575 | H bond donors | 1 | ACD/LogP | 1.13 | | Phase 25 °C | solid | Rotatable bonds | 2 | Predicted density | 1.06 g/cm3 | | SMILES | O(c1ccccc1N2CCNCC2)C | | STD InChIKey | VNZLQLYBRIOLFZ-UHFFFAOYAH | | Melting Points | | mp °C | source | |
|---|
| 37.00 | Alfa Aesar | | 38.50 | PHYSPROP |
|
|
| | | 1-(2-pyridylazo)-2-naphthol C15H11N3O3, 61 |
 | | Compound Data | | Melting point | 139.75 °C | 412.90 K | | CSID | 17967090 | H bond acceptors | 4 | Rule of 5 violations | 0 | | Molecular weight | 249.2673 | H bond donors | 1 | ACD/LogP | 2.74 | | Phase 25 °C | solid | Rotatable bonds | 3 | Predicted density | 1.24 g/cm3 | | SMILES | Oc2ccc3ccccc3c2/N=N/c1ccccn1 | | STD InChIKey | LLYOXZQVOKALCD-UHFFFAOYAM | | Melting Points | | mp °C | source | |
|---|
| 140.00 | Alfa Aesar | | 139.50 | Oxford University MSDS |
|
|
| | | 1-(2-thenoyl)-3,3,3-trifluoroacetone C8H5F3O2S3, 32, 64 |
 | | Compound Data | | Melting point | 42.33 °C | 315.48 K | | CSID | 5399 | H bond acceptors | 2 | Rule of 5 violations | 0 | | Molecular weight | 222.1843 | H bond donors | 0 | ACD/LogP | 3.76 | | Phase 25 °C | solid | Rotatable bonds | 3 | Predicted density | 1.42 g/cm3 | | SMILES | O=C(c1sccc1)CC(=O)C(F)(F)F | | STD InChIKey | TXBBUSUXYMIVOS-UHFFFAOYAR | | Melting Points | | mp °C | source | |
|---|
| 43.00 | Alfa Aesar | | 42.00 | DrugBank | | 42.00 | PHYSPROP |
|
|
| | | 1-(3,5-difluoro-4-hydroxyphenyl)propan-1-one C9H8F2O23, 61 |
 | | Compound Data | | Melting point | 128.50 °C | 401.65 K | | CSID | 453123 | H bond acceptors | 2 | Rule of 5 violations | 0 | | Molecular weight | 186.1554 | H bond donors | 1 | ACD/LogP | 2.55 | | Phase 25 °C | solid | Rotatable bonds | 3 | Predicted density | 1.29 g/cm3 | | SMILES | Fc1cc(C(=O)CC)cc(F)c1O | | STD InChIKey | PJIDRPUAOWTRGM-UHFFFAOYAC | | Melting Points | | mp °C | source | |
|---|
| 130.00 | Alfa Aesar | | 127.00 | Oxford University MSDS |
|
|
| | | 1-(4-fluorophenyl)piperazine C10H13FN23, 64 |
 | | Compound Data | | Melting point | 31.75 °C | 304.90 K | | CSID | 67803 | H bond acceptors | 2 | Rule of 5 violations | 0 | | Molecular weight | 180.222 | H bond donors | 1 | ACD/LogP | 1.20 | | Phase 25 °C | solid | Rotatable bonds | 1 | Predicted density | 1.11 g/cm3 | | SMILES | Fc1ccc(cc1)N2CCNCC2 | | STD InChIKey | AVJKDKWRVSSJPK-UHFFFAOYAS | | Melting Points | | mp °C | source | |
|---|
| 32.00 | Alfa Aesar | | 31.50 | PHYSPROP |
|
|
| | | 1-(chloromethyl)-2-nitrobenzene C7H6ClNO22, 3, 61, 64 |
 | |
|
| | | 1-(hydroxymethyl)-3-methylthiourea C3H8N2OS9, 48, 64 |
 | |
|
| | | 1-acetamidoadamantane C12H19NO3, 64 |
 | | Compound Data | | Melting point | 148.25 °C | 421.40 K | | CSID | 57727 | H bond acceptors | 2 | Rule of 5 violations | 0 | | Molecular weight | 193.2854 | H bond donors | 1 | ACD/LogP | 1.83 | | Phase 25 °C | solid | Rotatable bonds | 1 | Predicted density | 1.08 g/cm3 | | SMILES | O=C(NC13CC2CC(CC(C1)C2)C3)C | | STD InChIKey | BCVXYGJCDZPKGV-UHFFFAOYAJ | | Melting Points | | mp °C | source | |
|---|
| 148.00 | Alfa Aesar | | 148.50 | PHYSPROP |
|
|
| | | 1-amino-2-methyl-anthraquinone C15H11NO261, 64 |
 | | Compound Data | | Melting point | 205.25 °C | 478.40 K | | CSID | 6447 | H bond acceptors | 3 | Rule of 5 violations | 0 | | Molecular weight | 237.2533 | H bond donors | 2 | ACD/LogP | 3.81 | | Phase 25 °C | solid | Rotatable bonds | 1 | Predicted density | 1.33 g/cm3 | | SMILES | O=C2c1ccccc1C(=O)c3c2ccc(c3N)C | | STD InChIKey | ZLCUIOWQYBYEBG-UHFFFAOYAP | | Melting Points | | mp °C | source | |
|---|
| 205.00 | Oxford University MSDS | | 205.50 | PHYSPROP |
|
|
| | | 1-aminoanthraquinone C14H9NO23, 61, 64 |
 | | Compound Data | | Melting point | 252.50 °C | 525.65 K | | CSID | 6454 | H bond acceptors | 3 | Rule of 5 violations | 0 | | Molecular weight | 223.2268 | H bond donors | 2 | ACD/LogP | 3.35 | | Phase 25 °C | solid | Rotatable bonds | 1 | Predicted density | 1.38 g/cm3 | | SMILES | O=C2c1ccccc1C(=O)c3c2cccc3N | | STD InChIKey | KHUFHLFHOQVFGB-UHFFFAOYAK | | Melting Points | | mp °C | source | |
|---|
| 254.00 | Alfa Aesar | | 250.00 | Oxford University MSDS | | 253.50 | PHYSPROP |
|
|
| | | 1-aminonaphthalene C10H9N2, 2, 64 |
 | |
|
| | | 1-aminopyrene C16H11N3, 35, 61 |
 | | Compound Data | | Melting point | 116.67 °C | 389.82 K | | CSID | 14613 | H bond acceptors | 1 | Rule of 5 violations | 0 | | Molecular weight | 217.2652 | H bond donors | 2 | ACD/LogP | 3.89 | | Phase 25 °C | solid | Rotatable bonds | 1 | Predicted density | 1.32 g/cm3 | | SMILES | c4cc2ccc1ccc(N)c3c1c2c(cc3)c4 | | STD InChIKey | YZVWKHVRBDQPMQ-UHFFFAOYAB | | Melting Points | | mp °C | source | |
|---|
| 118.00 | Alfa Aesar | | 116.00 | EPISuite-ChemSpider | | 116.00 | Oxford University MSDS |
|
|
| | | 1-benzylimidazole C10H10N23, 64 |
 | | Compound Data | | Melting point | 70.00 °C | 343.15 K | | CSID | 70309 | H bond acceptors | 2 | Rule of 5 violations | 0 | | Molecular weight | 158.1998 | H bond donors | 0 | ACD/LogP | 1.46 | | Phase 25 °C | solid | Rotatable bonds | 2 | Predicted density | 1.04 g/cm3 | | SMILES | n1ccn(c1)Cc2ccccc2 | | STD InChIKey | KKKDZZRICRFGSD-UHFFFAOYAO | | Melting Points | | mp °C | source | |
|---|
| 71.00 | Alfa Aesar | | 69.00 | PHYSPROP |
|
|
| | | 1-bromo-2-chlorobenzene C6H4BrCl3, 64 |
 | | Compound Data | | Melting point | -12.65 °C | 260.50 K | | CSID | 12230 | H bond acceptors | 0 | Rule of 5 violations | 0 | | Molecular weight | 191.453 | H bond donors | 0 | ACD/LogP | 3.50 | | Phase 25 °C | liquid/gas | Rotatable bonds | 0 | Predicted density | 1.63 g/cm3 | | SMILES | Clc1ccccc1Br | | STD InChIKey | QBELEDRHMPMKHP-UHFFFAOYAF | | Melting Points | | mp °C | source | |
|---|
| -13.00 | Alfa Aesar | | -12.30 | PHYSPROP |
|
|
| | | 1-bromo-2-chloroethane C2H4BrCl2, 3, 64 |
 | |
|
| | | 1-bromo-2-ethylbenzene C8H9Br3, 31, 64 |
 | |
|
| | | 1-bromo-2-iodobenzene C6H4BrI2, 3, 64 |
 | |
|
| | | 1-bromo-2-methylpropane C4H9Br3, 31, 64 |
 | |
|
| | | 1-bromo-2-nitrobenzene C6H4BrNO23, 7, 64 |
 | |
|
| | | 1-bromo-2,3-dichlorobenzene C6H3BrCl23, 64 |
 | | Compound Data | | Melting point | 59.00 °C | 332.15 K | | CSID | 38364 | H bond acceptors | 0 | Rule of 5 violations | 0 | | Molecular weight | 225.898 | H bond donors | 0 | ACD/LogP | 3.92 | | Phase 25 °C | solid | Rotatable bonds | 0 | Predicted density | 1.74 g/cm3 | | SMILES | Clc1cccc(Br)c1Cl | | STD InChIKey | HVKCZUVMQPUWSX-UHFFFAOYAV | | Melting Points | | mp °C | source | |
|---|
| 58.00 | Alfa Aesar | | 60.00 | PHYSPROP |
|
|
| | | 1-bromo-2,4-dichlorobenzene C6H3BrCl23, 64 |
 | | Compound Data | | Melting point | 26.50 °C | 299.65 K | | CSID | 21170125 | H bond acceptors | 0 | Rule of 5 violations | 0 | | Molecular weight | 225.898 | H bond donors | 0 | ACD/LogP | 4.04 | | Phase 25 °C | solid | Rotatable bonds | 0 | Predicted density | 1.74 g/cm3 | | SMILES | Clc1ccc(Br)c(Cl)c1 | | STD InChIKey | ISHYFWKKWKXXPL-UHFFFAOYAP | | Melting Points | | mp °C | source | |
|---|
| 27.00 | Alfa Aesar | | 26.00 | PHYSPROP |
|
|
| | | 1-bromo-2,4-dimethoxybenzene C8H9BrO22, 3 |
 | | Compound Data | | Melting point | 25.50 °C | 298.65 K | | CSID | 78722 | H bond acceptors | 2 | Rule of 5 violations | 0 | | Molecular weight | 217.0599 | H bond donors | 0 | ACD/LogP | 2.76 | | Phase 25 °C | solid | Rotatable bonds | 2 | Predicted density | 1.41 g/cm3 | | SMILES | Brc1ccc(OC)cc1OC | | STD InChIKey | NIUZVSQOXJIHBL-UHFFFAOYAB | | Melting Points | | mp °C | source | |
|---|
| 26.00 | Aldrich Chemical Company; Aldrich Catalog-Handbook of Fine C... | | 25.00 | Alfa Aesar |
|
|
| | | 1-bromo-2,4,5-trimethylbenzene C9H11Br2, 3, 64 |
 | |
|
| | | 1-bromo-2,6-dichlorobenzene C6H3BrCl22, 3, 64 |
 | |
|
| | | 1-bromo-3-chlorobenzene C6H4BrCl3, 64 |
 | | Compound Data | | Melting point | -21.75 °C | 251.40 K | | CSID | 13875377 | H bond acceptors | 0 | Rule of 5 violations | 0 | | Molecular weight | 191.453 | H bond donors | 0 | ACD/LogP | 3.54 | | Phase 25 °C | liquid/gas | Rotatable bonds | 0 | Predicted density | 1.63 g/cm3 | | SMILES | Clc1cc(Br)ccc1 | | STD InChIKey | JRGGUPZKKTVKOV-UHFFFAOYAS | | Melting Points | | mp °C | source | |
|---|
| -22.00 | Alfa Aesar | | -21.50 | PHYSPROP |
|
|
| | | 1-bromo-3-chloropropane C3H6BrCl3, 64 |
 | | Compound Data | | Melting point | -58.95 °C | 214.20 K | | CSID | 7715 | H bond acceptors | 0 | Rule of 5 violations | 0 | | Molecular weight | 157.4367 | H bond donors | 0 | ACD/LogP | 2.18 | | Phase 25 °C | liquid/gas | Rotatable bonds | 2 | Predicted density | 1.53 g/cm3 | | SMILES | BrCCCCl | | STD InChIKey | MFESCIUQSIBMSM-UHFFFAOYAL | | Melting Points | | mp °C | source | |
|---|
| -59.00 | Alfa Aesar | | -58.90 | PHYSPROP |
|
|
| | | 1-bromo-3-iodobenzene C6H4BrI2, 3, 64 |
 | |
|
| | | 1-bromo-4-ethylbenzene C8H9Br31, 64 |
 | | Compound Data | | Melting point | -43.25 °C | 229.90 K | | CSID | 21106562 | H bond acceptors | 0 | Rule of 5 violations | 0 | | Molecular weight | 185.0611 | H bond donors | 0 | ACD/LogP | 3.98 | | Phase 25 °C | liquid/gas | Rotatable bonds | 1 | Predicted density | 1.34 g/cm3 | | SMILES | CCc1ccc(Br)cc1 | | STD InChIKey | URFPRAHGGBYNPW-UHFFFAOYAF | | Melting Points | | mp °C | source | |
|---|
| -43.00 | Dreisbach R. R. Physical Properties of Chemical Compounds; V... | | -43.50 | PHYSPROP |
|
|
| | | 1-bromo-4-fluorobenzene C6H4BrF3, 64 |
 | | Compound Data | | Melting point | -16.70 °C | 256.45 K | | CSID | 13875180 | H bond acceptors | 0 | Rule of 5 violations | 0 | | Molecular weight | 174.9984 | H bond donors | 0 | ACD/LogP | 2.98 | | Phase 25 °C | liquid/gas | Rotatable bonds | 0 | Predicted density | 1.59 g/cm3 | | SMILES | Fc1ccc(Br)cc1 | | STD InChIKey | AITNMTXHTIIIBB-UHFFFAOYAZ | | Melting Points | | mp °C | source | |
|---|
| -16.00 | Alfa Aesar | | -17.40 | PHYSPROP |
|
|
| | | 1-bromo-4-methylbenzene C7H7Br3, 31, 61, 64 |
 | |
|
| | | 1-bromo-4-t-butylbenzene C10H13Br2, 3, 64 |
 | |
|
| | | 1-bromobutane C4H9Br3, 31, 64 |
 | |
|
| | | 1-bromodecane C10H21Br3, 31, 64 |
 | |
|
| | | 1-bromododecane C12H25Br3, 31, 64 |
 | |
|
| | | 1-bromoheptane C7H15Br3, 31, 64 |
 | |
|
| | | 1-bromohexadecane C16H33Br3, 64 |
 | | Compound Data | | Melting point | 17.50 °C | 290.65 K | | CSID | 7921 | H bond acceptors | 0 | Rule of 5 violations | 1 | | Molecular weight | 305.3372 | H bond donors | 0 | ACD/LogP | 9.12 | | Phase 25 °C | liquid/gas | Rotatable bonds | 14 | Predicted density | 1.00 g/cm3 | | SMILES | BrCCCCCCCCCCCCCCCC | | STD InChIKey | HNTGIJLWHDPAFN-UHFFFAOYAL | | Melting Points | | mp °C | source | |
|---|
| 17.00 | Alfa Aesar | | 18.00 | PHYSPROP |
|
|
| | | 1-bromohexane C6H13Br3, 31, 64 |
 | |
|
| | | 1-bromonaphthalene C10H7Br2, 3, 64 |
 | |
|
| | | 1-bromooctadecane C18H37Br3, 64 |
 | | Compound Data | | Melting point | 28.10 °C | 301.25 K | | CSID | 7926 | H bond acceptors | 0 | Rule of 5 violations | 1 | | Molecular weight | 333.3904 | H bond donors | 0 | ACD/LogP | 10.18 | | Phase 25 °C | solid | Rotatable bonds | 16 | Predicted density | 0.98 g/cm3 | | SMILES | BrCCCCCCCCCCCCCCCCCC | | STD InChIKey | WSULSMOGMLRGKU-UHFFFAOYAU | | Melting Points | | mp °C | source | |
|---|
| 28.00 | Alfa Aesar | | 28.20 | PHYSPROP |
|
|
| | | 1-bromotetradecane C14H29Br3, 64 |
 | | Compound Data | | Melting point | 5.30 °C | 278.45 K | | CSID | 7916 | H bond acceptors | 0 | Rule of 5 violations | 1 | | Molecular weight | 277.2841 | H bond donors | 0 | ACD/LogP | 8.06 | | Phase 25 °C | liquid/gas | Rotatable bonds | 12 | Predicted density | 1.02 g/cm3 | | SMILES | BrCCCCCCCCCCCCCC | | STD InChIKey | KOFZTCSTGIWCQG-UHFFFAOYAB | | Melting Points | | mp °C | source | |
|---|
| 5.00 | Alfa Aesar | | 5.60 | PHYSPROP |
|
|
| | | 1-bromoundecane C11H23Br3, 31, 64 |
 | |
|
| | | 1-butanethiol C4H10S3, 4, 61, 64 |
 | |
|
| | | 1-butanol C4H10O3, 4, 32, 61, 64 |
 | |
|
| | | 1-butene C4H861, 64, 64, 85 |
 | |
|
| | | 1-butylamine C4H11N31, 32, 61, 64 |
 | |
|
| | | 1-chloro-1,1-difluoroethane C2H3ClF261, 64 |
 | | Compound Data | | Melting point | -130.90 °C | 142.25 K | | CSID | 6148 | H bond acceptors | 0 | Rule of 5 violations | 0 | | Molecular weight | 100.495 | H bond donors | 0 | ACD/LogP | 1.33 | | Phase 25 °C | liquid/gas | Rotatable bonds | 0 | Predicted density | 1.20 g/cm3 | | SMILES | ClC(F)(F)C | | STD InChIKey | BHNZEZWIUMJCGF-UHFFFAOYAO | | Melting Points | | mp °C | source | |
|---|
| -131.00 | Oxford University MSDS | | -130.80 | PHYSPROP |
|
|
| | | 1-chloro-2-(trifluoromethyl)benzene C7H4ClF33, 61, 64 |
 | | Compound Data | | Melting point | -6.47 °C | 266.68 K | | CSID | 6655 | H bond acceptors | 0 | Rule of 5 violations | 0 | | Molecular weight | 180.5549 | H bond donors | 0 | ACD/LogP | 3.52 | | Phase 25 °C | liquid/gas | Rotatable bonds | 0 | Predicted density | 1.34 g/cm3 | | SMILES | FC(F)(F)c1ccccc1Cl | | STD InChIKey | DGRVQOKCSKDWIH-UHFFFAOYAA | | Melting Points | | mp °C | source | |
|---|
| -6.00 | Alfa Aesar | | -7.40 | Oxford University MSDS | | -6.00 | PHYSPROP |
|
|
| | | 1-chloro-2-ethylbenzene C8H9Cl31, 64 |
 | | Compound Data | | Melting point | -82.85 °C | 190.30 K | | CSID | 21111805 | H bond acceptors | 0 | Rule of 5 violations | 0 | | Molecular weight | 140.6101 | H bond donors | 0 | ACD/LogP | 3.81 | | Phase 25 °C | liquid/gas | Rotatable bonds | 1 | Predicted density | 1.05 g/cm3 | | SMILES | CCc1ccccc1Cl | | STD InChIKey | CVGAWKYSRYXQOI-UHFFFAOYAS | | Melting Points | | mp °C | source | |
|---|
| -83.00 | Dreisbach R. R. Physical Properties of Chemical Compounds; V... | | -82.70 | PHYSPROP |
|
|
| | | 1-chloro-2-iodobenzene C6H4ClI2, 3, 64 |
 | |
|
| | | 1-chloro-2-isopropylbenzene C9H11Cl31, 64 |
 | | Compound Data | | Melting point | -74.20 °C | 198.95 K | | CSID | 15532 | H bond acceptors | 0 | Rule of 5 violations | 0 | | Molecular weight | 154.6366 | H bond donors | 0 | ACD/LogP | 4.15 | | Phase 25 °C | liquid/gas | Rotatable bonds | 1 | Predicted density | 1.02 g/cm3 | | SMILES | Clc1ccccc1C(C)C | | STD InChIKey | RNEMUWDQJSRDMQ-UHFFFAOYAN | | Melting Points | | mp °C | source | |
|---|
| -74.00 | Dreisbach R. R. Physical Properties of Chemical Compounds; V... | | -74.40 | PHYSPROP |
|
|
| | | 1-chloro-2-nitrobenzene C6H4ClNO22, 3, 61, 64 |
 | |
|
| | | 1-chloro-2,4-dinitrobenzene C6H3ClN2O42, 3, 61, 64 |
 | |
|
| | | 1-chloro-3-methylbutane C5H11Cl3, 64 |
 | | Compound Data | | Melting point | -104.20 °C | 168.95 K | | CSID | 7605 | H bond acceptors | 0 | Rule of 5 violations | 0 | | Molecular weight | 106.5938 | H bond donors | 0 | ACD/LogP | 2.91 | | Phase 25 °C | liquid/gas | Rotatable bonds | 2 | Predicted density | 0.87 g/cm3 | | SMILES | ClCCC(C)C | | STD InChIKey | CZHLPWNZCJEPJB-UHFFFAOYAJ | | Melting Points | | mp °C | source | |
|---|
| -104.00 | Alfa Aesar | | -104.40 | PHYSPROP |
|
|
| | | 1-chloro-3-nitrobenzene C6H4ClNO22, 3, 61, 64 |
 | |
|
| | | 1-chloro-4-(trifluoromethyl)benzene C7H4ClF33, 61, 64 |
 | | Compound Data | | Melting point | -35.00 °C | 238.15 K | | CSID | 7116 | H bond acceptors | 0 | Rule of 5 violations | 0 | | Molecular weight | 180.5549 | H bond donors | 0 | ACD/LogP | 3.46 | | Phase 25 °C | liquid/gas | Rotatable bonds | 0 | Predicted density | 1.34 g/cm3 | | SMILES | FC(F)(F)c1ccc(Cl)cc1 | | STD InChIKey | QULYNCCPRWKEMF-UHFFFAOYAI | | Melting Points | | mp °C | source | |
|---|
| -36.00 | Alfa Aesar | | -36.00 | Oxford University MSDS | | -33.00 | PHYSPROP |
|
|
| | | 1-chloro-4-ethylbenzene C8H9Cl31, 64 |
 | | Compound Data | | Melting point | -62.80 °C | 210.35 K | | CSID | 21242799 | H bond acceptors | 0 | Rule of 5 violations | 0 | | Molecular weight | 140.6101 | H bond donors | 0 | ACD/LogP | 3.81 | | Phase 25 °C | liquid/gas | Rotatable bonds | 1 | Predicted density | 1.05 g/cm3 | | SMILES | CCc1ccc(Cl)cc1 | | STD InChIKey | GPOFSFLJOIAMSA-UHFFFAOYAC | | Melting Points | | mp °C | source | |
|---|
| -63.00 | Dreisbach R. R. Physical Properties of Chemical Compounds; V... | | -62.60 | PHYSPROP |
|
|
| | | 1-chloro-4-fluorobenzene C6H4ClF3, 64 |
 | | Compound Data | | Melting point | -24.40 °C | 248.75 K | | CSID | 9228 | H bond acceptors | 0 | Rule of 5 violations | 0 | | Molecular weight | 130.5474 | H bond donors | 0 | ACD/LogP | 2.81 | | Phase 25 °C | liquid/gas | Rotatable bonds | 0 | Predicted density | 1.24 g/cm3 | | SMILES | Fc1ccc(Cl)cc1 | | STD InChIKey | RJCGZNCCVKIBHO-UHFFFAOYAG | | Melting Points | | mp °C | source | |
|---|
| -22.00 | Alfa Aesar | | -26.80 | PHYSPROP |
|
|
| | | 1-chloro-4-isopropylbenzene C9H11Cl31, 64 |
 | | Compound Data | | Melting point | -12.15 °C | 261.00 K | | CSID | 21159680 | H bond acceptors | 0 | Rule of 5 violations | 0 | | Molecular weight | 154.6366 | H bond donors | 0 | ACD/LogP | 4.15 | | Phase 25 °C | liquid/gas | Rotatable bonds | 1 | Predicted density | 1.02 g/cm3 | | SMILES | CC(C)c1ccc(Cl)cc1 | | STD InChIKey | FHBSIIZALGOVLM-UHFFFAOYAM | | Melting Points | | mp °C | source | |
|---|
| -12.00 | Dreisbach R. R. Physical Properties of Chemical Compounds; V... | | -12.30 | PHYSPROP |
|
|
| | | 1-chloro-4-methylbenzene C7H7Cl2, 3, 61, 64 |
 | |
|
| | | 1-chloro-4-nitrobenzene C6H4ClNO22, 3, 61, 64 |
 | |
|
| | | 1-chloroanthraquinone C14H7ClO23, 64 |
 | | Compound Data | | Melting point | 161.50 °C | 434.65 K | | CSID | 6453 | H bond acceptors | 2 | Rule of 5 violations | 0 | | Molecular weight | 242.6572 | H bond donors | 0 | ACD/LogP | 3.98 | | Phase 25 °C | solid | Rotatable bonds | 0 | Predicted density | 1.42 g/cm3 | | SMILES | O=C2c1ccccc1C(=O)c3c2cccc3Cl | | STD InChIKey | BOCJQSFSGAZAPQ-UHFFFAOYAU | | Melting Points | | mp °C | source | |
|---|
| 160.00 | Alfa Aesar | | 163.00 | PHYSPROP |
|
|
| | | 1-chlorobutane C4H9Cl3, 31, 61, 64 |
 | |
|
| | | 1-chlorodecane C10H21Cl31, 64 |
 | | Compound Data | | Melting point | -31.15 °C | 242.00 K | | CSID | 13248 | H bond acceptors | 0 | Rule of 5 violations | 1 | | Molecular weight | 176.7267 | H bond donors | 0 | ACD/LogP | 5.75 | | Phase 25 °C | liquid/gas | Rotatable bonds | 8 | Predicted density | 0.86 g/cm3 | | SMILES | ClCCCCCCCCCC | | STD InChIKey | ZTEHOZMYMCEYRM-UHFFFAOYAM | | Melting Points | | mp °C | source | |
|---|
| -31.00 | Dreisbach R. R. Physical Properties of Chemical Compounds; V... | | -31.30 | PHYSPROP |
|
|
| | | 1-chlorododecane C12H25Cl31, 64 |
 | | Compound Data | | Melting point | -9.15 °C | 264.00 K | | CSID | 7900 | H bond acceptors | 0 | Rule of 5 violations | 1 | | Molecular weight | 204.7799 | H bond donors | 0 | ACD/LogP | 6.81 | | Phase 25 °C | liquid/gas | Rotatable bonds | 10 | Predicted density | 0.86 g/cm3 | | SMILES | ClCCCCCCCCCCCC | | STD InChIKey | YAYNEUUHHLGGAH-UHFFFAOYAM | | Melting Points | | mp °C | source | |
|---|
| -9.00 | Dreisbach R. R. Physical Properties of Chemical Compounds; V... | | -9.30 | PHYSPROP |
|
|
| | | 1-chloroheptane C7H15Cl31, 64 |
 | | Compound Data | | Melting point | -69.75 °C | 203.40 K | | CSID | 11865 | H bond acceptors | 0 | Rule of 5 violations | 0 | | Molecular weight | 134.647 | H bond donors | 0 | ACD/LogP | 4.16 | | Phase 25 °C | liquid/gas | Rotatable bonds | 5 | Predicted density | 0.87 g/cm3 | | SMILES | ClCCCCCCC | | STD InChIKey | DZMDPHNGKBEVRE-UHFFFAOYAG | | Melting Points | | mp °C | source | |
|---|
| -70.00 | Dreisbach R. R. Physical Properties of Chemical Compounds; V... | | -69.50 | PHYSPROP |
|
|
| | | 1-chlorononane C9H19Cl31, 64 |
 | | Compound Data | | Melting point | -39.20 °C | 233.95 K | | CSID | 16268 | H bond acceptors | 0 | Rule of 5 violations | 1 | | Molecular weight | 162.7002 | H bond donors | 0 | ACD/LogP | 5.22 | | Phase 25 °C | liquid/gas | Rotatable bonds | 7 | Predicted density | 0.86 g/cm3 | | SMILES | ClCCCCCCCCC | | STD InChIKey | RKAMCQVGHFRILV-UHFFFAOYAW | | Melting Points | | mp °C | source | |
|---|
| -39.00 | Dreisbach R. R. Physical Properties of Chemical Compounds; V... | | -39.40 | PHYSPROP |
|
|
| | | 1-chlorooctane C8H17Cl3, 31, 64 |
 | |
|
| | | 1-chloropropane C3H7Cl31, 61, 64 |
 | |
|
| | | 1-decanol C10H22O3, 4, 61, 64 |
 | |
|
| | | 1-decene C10H203, 4, 59, 61, 64, 64 |
 | |
|
| | | 1-decylamine C10H23N31, 61, 64 |
 | |
|
| | | 1-docosanol C22H46O61, 64 |
 | | Compound Data | | Melting point | 71.25 °C | 344.40 K | | CSID | 12100 | H bond acceptors | 1 | Rule of 5 violations | 1 | | Molecular weight | 326.6 | H bond donors | 1 | ACD/LogP | 10.44 | | Phase 25 °C | solid | Rotatable bonds | 21 | Predicted density | 0.84 g/cm3 | | SMILES | OCCCCCCCCCCCCCCCCCCCCCC | | STD InChIKey | NOPFSRXAKWQILS-UHFFFAOYAB | | Melting Points | | mp °C | source | |
|---|
| 70.00 | Oxford University MSDS | | 72.50 | PHYSPROP |
|
|
| | | 1-dodecanethiol C12H26S3, 64 |
 | | Compound Data | | Melting point | -7.50 °C | 265.65 K | | CSID | 7903 | H bond acceptors | 0 | Rule of 5 violations | 1 | | Molecular weight | 202.3998 | H bond donors | 0 | ACD/LogP | 6.54 | | Phase 25 °C | liquid/gas | Rotatable bonds | 11 | Predicted density | 0.84 g/cm3 | | SMILES | CCCCCCCCCCCCS | | STD InChIKey | WNAHIZMDSQCWRP-UHFFFAOYAL | | Melting Points | | mp °C | source | |
|---|
| -7.00 | Alfa Aesar | | -8.00 | PHYSPROP |
|
|
| | | 1-dodecanol C12H26O3, 4, 61, 64 |
 | |
|
| | | 1-dodecene C12H243, 4, 61, 64, 64 |
 | |
|
| | | 1-eicosanol C20H42O3, 64 |
 | | Compound Data | | Melting point | 65.05 °C | 338.20 K | | CSID | 11898 | H bond acceptors | 1 | Rule of 5 violations | 1 | | Molecular weight | 298.5469 | H bond donors | 1 | ACD/LogP | 9.38 | | Phase 25 °C | solid | Rotatable bonds | 19 | Predicted density | 0.84 g/cm3 | | SMILES | OCCCCCCCCCCCCCCCCCCCC | | STD InChIKey | BTFJIXJJCSYFAL-UHFFFAOYAC | | Melting Points | | mp °C | source | |
|---|
| 64.00 | Alfa Aesar | | 66.10 | PHYSPROP |
|
|
| | | 1-eicosene C20H404, 64 |
 | | Compound Data | | Melting point | 28.75 °C | 301.90 K | | CSID | 17879 | H bond acceptors | 0 | Rule of 5 violations | 1 | | Molecular weight | 280.5316 | H bond donors | 0 | ACD/LogP | 10.87 | | Phase 25 °C | solid | Rotatable bonds | 17 | Predicted density | 0.79 g/cm3 | | SMILES | C=C\CCCCCCCCCCCCCCCCCC | | STD InChIKey | VAMFXQBUQXONLZ-UHFFFAOYAX | | Melting Points | | mp °C | source | |
|---|
| 29.00 | American Petroleum Institute. Research Project 44; Selected ... | | 28.50 | PHYSPROP |
|
|
| | | 1-ethoxy-2-(2-ethoxyethoxy)ethane C8H18O33, 61, 64 |
 | | Compound Data | | Melting point | -44.33 °C | 228.82 K | | CSID | 21106583 | H bond acceptors | 3 | Rule of 5 violations | 0 | | Molecular weight | 162.2267 | H bond donors | 0 | ACD/LogP | 0.27 | | Phase 25 °C | liquid/gas | Rotatable bonds | 8 | Predicted density | 0.90 g/cm3 | | SMILES | CCOCCOCCOCC | | STD InChIKey | RRQYJINTUHWNHW-UHFFFAOYAF | | Melting Points | | mp °C | source | |
|---|
| -44.00 | Alfa Aesar | | -44.00 | Oxford University MSDS | | -45.00 | PHYSPROP |
|
|
| | | 1-ethoxy-4-nitrobenzene C8H9NO361, 64 |
 | | Compound Data | | Melting point | 59.00 °C | 332.15 K | | CSID | 7214 | H bond acceptors | 4 | Rule of 5 violations | 0 | | Molecular weight | 167.162 | H bond donors | 0 | ACD/LogP | 2.56 | | Phase 25 °C | solid | Rotatable bonds | 3 | Predicted density | 1.18 g/cm3 | | SMILES | [O-][N+](=O)c1ccc(OCC)cc1 | | STD InChIKey | NWPKEYHUZKMWKJ-UHFFFAOYAK | | Melting Points | | mp °C | source | |
|---|
| 58.00 | Oxford University MSDS | | 60.00 | PHYSPROP |
|
|
| | | 1-ethyl-2,4,5-trimethylbenzene C11H164, 64 |
 | | Compound Data | | Melting point | -13.75 °C | 259.40 K | | CSID | 26801 | H bond acceptors | 0 | Rule of 5 violations | 0 | | Molecular weight | 148.2447 | H bond donors | 0 | ACD/LogP | 4.59 | | Phase 25 °C | liquid/gas | Rotatable bonds | 1 | Predicted density | 0.87 g/cm3 | | SMILES | c1c(c(cc(c1CC)C)C)C | | STD InChIKey | IYFUQKGDILUVJG-UHFFFAOYAW | | Melting Points | | mp °C | source | |
|---|
| -14.00 | American Petroleum Institute. Research Project 44; Selected ... | | -13.50 | PHYSPROP |
|
|
| | | 1-ethyl-3,5-dimethylbenzene C10H144, 64 |
 | | Compound Data | | Melting point | -84.15 °C | 189.00 K | | CSID | 13038 | H bond acceptors | 0 | Rule of 5 violations | 0 | | Molecular weight | 134.2182 | H bond donors | 0 | ACD/LogP | 4.13 | | Phase 25 °C | liquid/gas | Rotatable bonds | 1 | Predicted density | 0.87 g/cm3 | | SMILES | c1c(cc(cc1CC)C)C | | STD InChIKey | LMAUULKNZLEMGN-UHFFFAOYAP | | Melting Points | | mp °C | source | |
|---|
| -84.00 | American Petroleum Institute. Research Project 44; Selected ... | | -84.30 | PHYSPROP |
|
|
| | | 1-ethylcyclohexene C8H144, 64 |
 | | Compound Data | | Melting point | -109.95 °C | 163.20 K | | CSID | 66568 | H bond acceptors | 0 | Rule of 5 violations | 0 | | Molecular weight | 110.1968 | H bond donors | 0 | ACD/LogP | 4.02 | | Phase 25 °C | liquid/gas | Rotatable bonds | 1 | Predicted density | 0.81 g/cm3 | | SMILES | C1(=C/CCCC1)\CC | | STD InChIKey | IFVMAGPISVKRAR-UHFFFAOYAL | | Melting Points | | mp °C | source | |
|---|
| -110.00 | American Petroleum Institute. Research Project 44; Selected ... | | -109.90 | PHYSPROP |
|
|
| | | 1-ethylcyclopentene C7H124, 64 |
 | | Compound Data | | Melting point | -118.25 °C | 154.90 K | | CSID | 121113 | H bond acceptors | 0 | Rule of 5 violations | 0 | | Molecular weight | 96.1702 | H bond donors | 0 | ACD/LogP | 3.45 | | Phase 25 °C | liquid/gas | Rotatable bonds | 1 | Predicted density | 0.82 g/cm3 | | SMILES | C\1=C(/CC)CCC/1 | | STD InChIKey | QYYQTLLGVAPKPN-UHFFFAOYAS | | Melting Points | | mp °C | source | |
|---|
| -118.00 | American Petroleum Institute. Research Project 44; Selected ... | | -118.50 | PHYSPROP |
|
|
| | | 1-ethylpiperazine-2,3-dione C6H10N2O23, 64 |
 | | Compound Data | | Melting point | 109.00 °C | 382.15 K | | CSID | 97850 | H bond acceptors | 4 | Rule of 5 violations | 0 | | Molecular weight | 142.1558 | H bond donors | 1 | ACD/LogP | -1.56 | | Phase 25 °C | solid | Rotatable bonds | 1 | Predicted density | 1.15 g/cm3 | | SMILES | O=C1C(=O)N(CC)CCN1 | | STD InChIKey | ZBEKOEYCWKIMGU-UHFFFAOYAD | | Melting Points | | mp °C | source | |
|---|
| 110.00 | Alfa Aesar | | 108.00 | PHYSPROP |
|
|
| | | 1-ethynyl-1-cyclohexanol C8H12O2, 3, 64 |
 | |
|
| | | 1-ethynylcyclopentanol C7H10O3, 64 |
 | | Compound Data | | Melting point | 26.00 °C | 299.15 K | | CSID | 78543 | H bond acceptors | 1 | Rule of 5 violations | 0 | | Molecular weight | 110.1537 | H bond donors | 1 | ACD/LogP | 1.17 | | Phase 25 °C | solid | Rotatable bonds | 1 | Predicted density | 1.01 g/cm3 | | SMILES | C#CC1(O)CCCC1 | | STD InChIKey | LQMDOONLLAJAPZ-UHFFFAOYAX | | Melting Points | | mp °C | source | |
|---|
| 25.00 | Alfa Aesar | | 27.00 | PHYSPROP |
|
|
| | | 1-fluoro-2-iodobenzene C6H4FI3, 64 |
 | | Compound Data | | Melting point | -41.75 °C | 231.40 K | | CSID | 21168731 | H bond acceptors | 0 | Rule of 5 violations | 0 | | Molecular weight | 221.9988 | H bond donors | 0 | ACD/LogP | 3.21 | | Phase 25 °C | liquid/gas | Rotatable bonds | 0 | Predicted density | 1.92 g/cm3 | | SMILES | Fc1ccccc1I | | STD InChIKey | TYHUGKGZNOULKD-UHFFFAOYAT | | Melting Points | | mp °C | source | |
|---|
| -42.00 | Alfa Aesar | | -41.50 | PHYSPROP |
|
|
| | | 1-fluoro-2-nitrobenzene C6H4FNO23, 64 |
 | | Compound Data | | Melting point | -7.00 °C | 266.15 K | | CSID | 66528 | H bond acceptors | 3 | Rule of 5 violations | 0 | | Molecular weight | 141.0999 | H bond donors | 0 | ACD/LogP | 1.69 | | Phase 25 °C | liquid/gas | Rotatable bonds | 1 | Predicted density | 1.34 g/cm3 | | SMILES | O=[N+]([O-])c1ccccc1F | | STD InChIKey | PWKNBLFSJAVFAB-UHFFFAOYAW | | Melting Points | | mp °C | source | |
|---|
| -8.00 | Alfa Aesar | | -6.00 | PHYSPROP |
|
|
| | | 1-fluoro-2,4-dinitrobenzene C6H3FN2O43, 61, 64 |
 | | Compound Data | | Melting point | 26.60 °C | 299.75 K | | CSID | 21106037 | H bond acceptors | 6 | Rule of 5 violations | 0 | | Molecular weight | 186.0974 | H bond donors | 0 | ACD/LogP | 1.16 | | Phase 25 °C | solid | Rotatable bonds | 2 | Predicted density | 1.59 g/cm3 | | SMILES | O=[N+]([O-])c1cc(ccc1F)[N+]([O-])=O | | STD InChIKey | LOTKRQAVGJMPNV-UHFFFAOYAZ | | Melting Points | | mp °C | source | |
|---|
| 27.00 | Alfa Aesar | | 27.00 | Oxford University MSDS | | 25.80 | PHYSPROP |
|
|
| | | 1-fluoro-4-nitrobenzene C6H4FNO23, 61, 64 |
 | | Compound Data | | Melting point | 21.67 °C | 294.82 K | | CSID | 13856885 | H bond acceptors | 3 | Rule of 5 violations | 0 | | Molecular weight | 141.0999 | H bond donors | 0 | ACD/LogP | 1.80 | | Phase 25 °C | liquid/gas | Rotatable bonds | 1 | Predicted density | 1.34 g/cm3 | | SMILES | O=[N+]([O-])c1ccc(F)cc1 | | STD InChIKey | WFQDTOYDVUWQMS-UHFFFAOYAC | | Melting Points | | mp °C | source | |
|---|
| 23.00 | Alfa Aesar | | 21.00 | Oxford University MSDS | | 21.00 | PHYSPROP |
|
|
| | | 1-fluoronaphthalene C10H7F3, 61, 64 |
 | | Compound Data | | Melting point | -10.67 °C | 262.48 K | | CSID | 9078 | H bond acceptors | 0 | Rule of 5 violations | 0 | | Molecular weight | 146.161 | H bond donors | 0 | ACD/LogP | 3.50 | | Phase 25 °C | liquid/gas | Rotatable bonds | 0 | Predicted density | 1.14 g/cm3 | | SMILES | Fc2cccc1ccccc12 | | STD InChIKey | CWLKTJOTWITYSI-UHFFFAOYAY | | Melting Points | | mp °C | source | |
|---|
| -10.00 | Alfa Aesar | | -13.00 | Oxford University MSDS | | -9.00 | PHYSPROP |
|
|
| | | 1-formylpiperidine C6H11NO3, 64 |
 | | Compound Data | | Melting point | -30.90 °C | 242.25 K | | CSID | 16486 | H bond acceptors | 2 | Rule of 5 violations | 0 | | Molecular weight | 113.1576 | H bond donors | 0 | ACD/LogP | 0.24 | | Phase 25 °C | liquid/gas | Rotatable bonds | 0 | Predicted density | 1.09 g/cm3 | | SMILES | O=CN1CCCCC1 | | STD InChIKey | FEWLNYSYJNLUOO-UHFFFAOYAJ | | Melting Points | | mp °C | source | |
|---|
| -31.00 | Alfa Aesar | | -30.80 | PHYSPROP |
|
|
| | | 1-heptadecanol C17H36O2, 3, 61, 64 |
 | |
|
| | | 1-heptadecene C17H344, 64 |
 | | Compound Data | | Melting point | 11.25 °C | 284.40 K | | CSID | 21723 | H bond acceptors | 0 | Rule of 5 violations | 1 | | Molecular weight | 238.4519 | H bond donors | 0 | ACD/LogP | 9.28 | | Phase 25 °C | liquid/gas | Rotatable bonds | 14 | Predicted density | 0.78 g/cm3 | | SMILES | C(=C)\CCCCCCCCCCCCCCC | | STD InChIKey | ADOBXTDBFNCOBN-UHFFFAOYAF | | Melting Points | | mp °C | source | |
|---|
| 11.00 | American Petroleum Institute. Research Project 44; Selected ... | | 11.50 | PHYSPROP |
|
|
| | | 1-heptanol C7H16O3, 4, 28, 61, 64 |
 | |
|
| | | 1-heptene C7H143, 4, 59, 64 |
 | |
|
| | | 1-heptylamine C7H17N3, 31, 64 |
 | |
|
| | | 1-hexadecanethiol C16H34S3, 64 |
 | | Compound Data | | Melting point | 20.00 °C | 293.15 K | | CSID | 17019 | H bond acceptors | 0 | Rule of 5 violations | 1 | | Molecular weight | 258.5062 | H bond donors | 0 | ACD/LogP | 8.69 | | Phase 25 °C | liquid/gas | Rotatable bonds | 15 | Predicted density | 0.84 g/cm3 | | SMILES | SCCCCCCCCCCCCCCCC | | STD InChIKey | ORTRWBYBJVGVQC-UHFFFAOYAT | | Melting Points | | mp °C | source | |
|---|
| 21.00 | Alfa Aesar | | 19.00 | PHYSPROP |
|
|
| | | 1-hexadecene C16H323, 4, 64 |
 | |
|
| | | 1-hexanethiol C6H14S3, 4, 64 |
 | |
|
| | | 1-hexene C6H123, 4, 59, 61, 64 |
 | |
|
| | | 1-hexylamine C6H15N3, 31, 61, 64 |
 | |
|
| | | 1-hexyltheobromine C13H20N4O23, 64 |
 | | Compound Data | | Melting point | 81.75 °C | 354.90 K | | CSID | 63738 | H bond acceptors | 6 | Rule of 5 violations | 0 | | Molecular weight | 264.3235 | H bond donors | 0 | ACD/LogP | 2.53 | | Phase 25 °C | solid | Rotatable bonds | 5 | Predicted density | 1.23 g/cm3 | | SMILES | O=C2N(c1ncn(c1C(=O)N2CCCCCC)C)C | | STD InChIKey | MRWQRJMESRRJJB-UHFFFAOYAV | | Melting Points | | mp °C | source | |
|---|
| 81.00 | Alfa Aesar | | 82.50 | PHYSPROP |
|
|
| | | 1-hexyne C6H103, 4, 64 |
 | |
|
| | | 1-hydroxybenzotriazole C6H5N3O61, 64 |
 | | Compound Data | | Melting point | 158.25 °C | 431.40 K | | CSID | 68282 | H bond acceptors | 4 | Rule of 5 violations | 0 | | Molecular weight | 135.1234 | H bond donors | 1 | ACD/LogP | 0.69 | | Phase 25 °C | solid | Rotatable bonds | 1 | Predicted density | 1.51 g/cm3 | | SMILES | n1nn(O)c2ccccc12 | | STD InChIKey | ASOKPJOREAFHNY-UHFFFAOYAP | | Melting Points | | mp °C | source | |
|---|
| 159.00 | Oxford University MSDS | | 157.50 | PHYSPROP |
|
|
| | | 1-hydroxymethyl-5,5-dimethylhydantoin C6H10N2O33, 64 |
 | | Compound Data | | Melting point | 102.50 °C | 375.65 K | | CSID | 60357 | H bond acceptors | 5 | Rule of 5 violations | 0 | | Molecular weight | 158.1552 | H bond donors | 2 | ACD/LogP | -0.92 | | Phase 25 °C | solid | Rotatable bonds | 2 | Predicted density | 1.26 g/cm3 | | SMILES | O=C1NC(=O)N(CO)C1(C)C | | STD InChIKey | SIQZJFKTROUNPI-UHFFFAOYAW | | Melting Points | | mp °C | source | |
|---|
| 105.00 | Alfa Aesar | | 100.00 | PHYSPROP |
|
|
| | | 1-indanol C9H10O3, 64 |
 | | Compound Data | | Melting point | 53.40 °C | 326.55 K | | CSID | 21394 | H bond acceptors | 1 | Rule of 5 violations | 0 | | Molecular weight | 134.1751 | H bond donors | 1 | ACD/LogP | 1.49 | | Phase 25 °C | solid | Rotatable bonds | 1 | Predicted density | 1.16 g/cm3 | | SMILES | OC2c1ccccc1CC2 | | STD InChIKey | YIAPLDFPUUJILH-UHFFFAOYAX | | Melting Points | | mp °C | source | |
|---|
| 52.00 | Alfa Aesar | | 54.80 | PHYSPROP |
|
|
| | | 1-indanone C9H8O3, 64 |
 | | Compound Data | | Melting point | 41.00 °C | 314.15 K | | CSID | 6479 | H bond acceptors | 1 | Rule of 5 violations | 0 | | Molecular weight | 132.1592 | H bond donors | 0 | ACD/LogP | 2.10 | | Phase 25 °C | solid | Rotatable bonds | 0 | Predicted density | 1.15 g/cm3 | | SMILES | O=C2c1ccccc1CC2 | | STD InChIKey | QNXSIUBBGPHDDE-UHFFFAOYAP | | Melting Points | | mp °C | source | |
|---|
| 40.00 | Alfa Aesar | | 42.00 | PHYSPROP |
|
|
| | | 1-iodo-3-nitrobenzene C6H4INO22, 3, 61, 64 |
 | |
|
| | | 1-iodo-4-nitrobenzene C6H4INO22, 3, 61, 64 |
 | |
|
| | | 1-iododecane C10H21I3, 31, 64 |
 | |
|
| | | 1-iodododecane C12H25I3, 31, 64 |
 | |
|
| | | 1-iodoheptane C7H15I3, 31, 64 |
 | |
|
| | | 1-iodohexane C6H13I3, 31, 64 |
 | |
|
| | | 1-iodooctane C8H17I3, 31, 64 |
 | |
|
| | | 1-iodopentane C5H11I3, 31, 64 |
 | |
|
| | | 1-iodopropane C3H7I3, 31, 61, 64 |
 | |
|
| | | 1-isopropyl-3-methylbenzene C10H144, 64 |
 | | Compound Data | | Melting point | -63.85 °C | 209.30 K | | CSID | 10355 | H bond acceptors | 0 | Rule of 5 violations | 0 | | Molecular weight | 134.2182 | H bond donors | 0 | ACD/LogP | 4.02 | | Phase 25 °C | liquid/gas | Rotatable bonds | 1 | Predicted density | 0.86 g/cm3 | | SMILES | c1ccc(cc1C(C)C)C | | STD InChIKey | XCYJPXQACVEIOS-UHFFFAOYAE | | Melting Points | | mp °C | source | |
|---|
| -64.00 | American Petroleum Institute. Research Project 44; Selected ... | | -63.70 | PHYSPROP |
|
|
| | | 1-isopropyl-3-methylbenzene C10H144, 64 |
 | | Compound Data | | Melting point | -71.75 °C | 201.40 K | | CSID | 10253 | H bond acceptors | 0 | Rule of 5 violations | 0 | | Molecular weight | 134.2182 | H bond donors | 0 | ACD/LogP | 4.02 | | Phase 25 °C | liquid/gas | Rotatable bonds | 1 | Predicted density | 0.86 g/cm3 | | SMILES | c1cccc(c1C(C)C)C | | STD InChIKey | WWRCMNKATXZARA-UHFFFAOYAL | | Melting Points | | mp °C | source | |
|---|
| -72.00 | American Petroleum Institute. Research Project 44; Selected ... | | -71.50 | PHYSPROP |
|
|
| | | 1-isopropyl-4-methylbenzene C10H143, 4, 61, 64, 64 |
 | |
|
| | | 1-isothiocyanatonaphthalene C11H7NS3, 61, 64 |
 | | Compound Data | | Melting point | 57.33 °C | 330.48 K | | CSID | 10609 | H bond acceptors | 1 | Rule of 5 violations | 0 | | Molecular weight | 185.245 | H bond donors | 0 | ACD/LogP | 4.47 | | Phase 25 °C | solid | Rotatable bonds | 1 | Predicted density | 1.11 g/cm3 | | SMILES | S=C=N/c2cccc1ccccc12 | | STD InChIKey | JBDOSUUXMYMWQH-UHFFFAOYAA | | Melting Points | | mp °C | source | |
|---|
| 56.00 | Alfa Aesar | | 58.00 | Oxford University MSDS | | 58.00 | PHYSPROP |
|
|
| | | 1-methoxy-2-nitrobenzene C7H7NO32, 3, 61, 64 |
 | |
|
| | | 1-methyl-1-ethylcyclopentane C8H164, 64 |
 | | Compound Data | | Melting point | -143.90 °C | 129.25 K | | CSID | 26072 | H bond acceptors | 0 | Rule of 5 violations | 0 | | Molecular weight | 112.2126 | H bond donors | 0 | ACD/LogP | 4.39 | | Phase 25 °C | liquid/gas | Rotatable bonds | 1 | Predicted density | 0.78 g/cm3 | | SMILES | CC1(CC)CCCC1 | | STD InChIKey | LETYIFNDQBJGPJ-UHFFFAOYAU | | Melting Points | | mp °C | source | |
|---|
| -144.00 | American Petroleum Institute. Research Project 44; Selected ... | | -143.80 | PHYSPROP |
|
|
| | | 1-methyl-1-ethylcyclopropane C6H124, 64 |
 | | Compound Data | | Melting point | -130.10 °C | 143.05 K | | CSID | 84221 | H bond acceptors | 0 | Rule of 5 violations | 0 | | Molecular weight | 84.1595 | H bond donors | 0 | ACD/LogP | 3.26 | | Phase 25 °C | liquid/gas | Rotatable bonds | 1 | Predicted density | 0.77 g/cm3 | | SMILES | CC1(CC)CC1 | | STD InChIKey | CXYUCHDVLWUDNS-UHFFFAOYAK | | Melting Points | | mp °C | source | |
|---|
| -130.00 | American Petroleum Institute. Research Project 44; Selected ... | | -130.20 | PHYSPROP |
|
|
| | | 1-methyl-2-propylbenzene C10H144, 64 |
 | | Compound Data | | Melting point | -60.15 °C | 213.00 K | | CSID | 13471 | H bond acceptors | 0 | Rule of 5 violations | 0 | | Molecular weight | 134.2182 | H bond donors | 0 | ACD/LogP | 4.20 | | Phase 25 °C | liquid/gas | Rotatable bonds | 2 | Predicted density | 0.86 g/cm3 | | SMILES | c1cccc(c1CCC)C | | STD InChIKey | YQZBFMJOASEONC-UHFFFAOYAW | | Melting Points | | mp °C | source | |
|---|
| -60.00 | American Petroleum Institute. Research Project 44; Selected ... | | -60.30 | PHYSPROP |
|
|
| | | 1-methyl-2,4-dinitrobenzene C7H6N2O42, 3, 61, 64 |
 | |
|
| | | 1-methyl-3-nitrobenzene C7H7NO22, 3, 61, 64 |
 | |
|
| | | 1-methyl-4-nitrobenzene C7H7NO22, 3, 61, 64, 72 |
 | |
|
| | | 1-methyl-4-propylbenzene C10H144, 64 |
 | | Compound Data | | Melting point | -63.80 °C | 209.35 K | | CSID | 13473 | H bond acceptors | 0 | Rule of 5 violations | 0 | | Molecular weight | 134.2182 | H bond donors | 0 | ACD/LogP | 4.20 | | Phase 25 °C | liquid/gas | Rotatable bonds | 2 | Predicted density | 0.86 g/cm3 | | SMILES | c1cc(ccc1CCC)C | | STD InChIKey | JXFVMNFKABWTHD-UHFFFAOYAL | | Melting Points | | mp °C | source | |
|---|
| -64.00 | American Petroleum Institute. Research Project 44; Selected ... | | -63.60 | PHYSPROP |
|
|
| | | 1-methylbenzotriazole C7H7N33, 64 |
 | | Compound Data | | Melting point | 64.75 °C | 337.90 K | | CSID | 24133 | H bond acceptors | 3 | Rule of 5 violations | 0 | | Molecular weight | 133.1506 | H bond donors | 0 | ACD/LogP | 1.06 | | Phase 25 °C | solid | Rotatable bonds | 0 | Predicted density | 1.24 g/cm3 | | SMILES | n1nn(c2ccccc12)C | | STD InChIKey | HXQHRUJXQJEGER-UHFFFAOYAL | | Melting Points | | mp °C | source | |
|---|
| 65.00 | Alfa Aesar | | 64.50 | PHYSPROP |
|
|
| | | 1-methylcarbostyril C10H9NO3, 64 |
 | | Compound Data | | Melting point | 74.50 °C | 347.65 K | | CSID | 11327 | H bond acceptors | 2 | Rule of 5 violations | 0 | | Molecular weight | 159.1846 | H bond donors | 0 | ACD/LogP | 1.55 | | Phase 25 °C | solid | Rotatable bonds | 0 | Predicted density | 1.16 g/cm3 | | SMILES | O=C2/C=C\c1c(cccc1)N2C | | STD InChIKey | QYEMNJMSULGQRD-UHFFFAOYAE | | Melting Points | | mp °C | source | |
|---|
| 75.00 | Alfa Aesar | | 74.00 | PHYSPROP |
|
|
| | | 1-methylcyclohexanecarboxylic acid C8H14O23, 48, 64 |
 | |
|
| | | 1-methylcyclohexanol C7H14O2, 3, 64 |
 | |
|
| | | 1-methylcyclohexene C7H124, 59, 61, 64 |
 | |
|
| | | 1-methylcyclopentanol C6H12O2, 3, 64 |
 | |
|
| | | 1-methylisatin C9H7NO23, 64 |
 | | Compound Data | | Melting point | 131.25 °C | 404.40 K | | CSID | 15517 | H bond acceptors | 3 | Rule of 5 violations | 0 | | Molecular weight | 161.1574 | H bond donors | 0 | ACD/LogP | 0.58 | | Phase 25 °C | solid | Rotatable bonds | 0 | Predicted density | 1.31 g/cm3 | | SMILES | O=C2c1ccccc1N(C2=O)C | | STD InChIKey | VCYBVWFTGAZHGH-UHFFFAOYAR | | Melting Points | | mp °C | source | |
|---|
| 131.00 | Alfa Aesar | | 131.50 | PHYSPROP |
|
|
| | | 1-methylpyrrolidin-2-one C5H9NO3, 61, 64 |
 | | Compound Data | | Melting point | -23.67 °C | 249.48 K | | CSID | 12814 | H bond acceptors | 2 | Rule of 5 violations | 0 | | Molecular weight | 99.1311 | H bond donors | 0 | ACD/LogP | 0.00 | | Phase 25 °C | liquid/gas | Rotatable bonds | 0 | Predicted density | 1.03 g/cm3 | | SMILES | CN1CCCC1=O | | STD InChIKey | SECXISVLQFMRJM-UHFFFAOYAL | | Melting Points | | mp °C | source | |
|---|
| -24.00 | Alfa Aesar | | -23.00 | Oxford University MSDS | | -24.00 | PHYSPROP |
|
|
| | | 1-naphthalenemethanol C11H10O3, 64 |
 | | Compound Data | | Melting point | 62.50 °C | 335.65 K | | CSID | 19669 | H bond acceptors | 1 | Rule of 5 violations | 0 | | Molecular weight | 158.1965 | H bond donors | 1 | ACD/LogP | 2.27 | | Phase 25 °C | solid | Rotatable bonds | 2 | Predicted density | 1.15 g/cm3 | | SMILES | OCc2cccc1ccccc12 | | STD InChIKey | PBLNHHSDYFYZNC-UHFFFAOYAF | | Melting Points | | mp °C | source | |
|---|
| 61.00 | Alfa Aesar | | 64.00 | PHYSPROP |
|
|
| | | 1-naphthamide C11H9NO3, 64 |
 | | Compound Data | | Melting point | 206.90 °C | 480.05 K | | CSID | 67788 | H bond acceptors | 2 | Rule of 5 violations | 0 | | Molecular weight | 171.1953 | H bond donors | 2 | ACD/LogP | 1.97 | | Phase 25 °C | solid | Rotatable bonds | 1 | Predicted density | 1.20 g/cm3 | | SMILES | O=C(N)c2cccc1ccccc12 | | STD InChIKey | RMHJJUOPOWPRBP-UHFFFAOYAG | | Melting Points | | mp °C | source | |
|---|
| 208.00 | Alfa Aesar | | 205.80 | PHYSPROP |
|
|
| | | 1-naphthoic acid C11H8O23, 61, 64 |
 | | Compound Data | | Melting point | 161.33 °C | 434.48 K | | CSID | 6586 | H bond acceptors | 2 | Rule of 5 violations | 0 | | Molecular weight | 172.18 | H bond donors | 1 | ACD/LogP | 3.12 | | Phase 25 °C | solid | Rotatable bonds | 1 | Predicted density | 1.26 g/cm3 | | SMILES | O=C(O)c2cccc1ccccc12 | | STD InChIKey | LNETULKMXZVUST-UHFFFAOYAH | | Melting Points | | mp °C | source | |
|---|
| 161.00 | Alfa Aesar | | 162.00 | Oxford University MSDS | | 161.00 | PHYSPROP |
|
|
| | | 1-naphthol C10H8O2, 3, 61, 64 |
 | |
|
| | | 1-naphthyl acetate C12H10O23, 64 |
 | | Compound Data | | Melting point | 44.75 °C | 317.90 K | | CSID | 12691 | H bond acceptors | 2 | Rule of 5 violations | 0 | | Molecular weight | 186.2066 | H bond donors | 0 | ACD/LogP | 2.79 | | Phase 25 °C | solid | Rotatable bonds | 2 | Predicted density | 1.16 g/cm3 | | SMILES | O=C(Oc2cccc1ccccc12)C | | STD InChIKey | VGKONPUVOVVNSU-UHFFFAOYAE | | Melting Points | | mp °C | source | |
|---|
| 45.00 | Alfa Aesar | | 44.50 | PHYSPROP |
|
|
| | | 1-naphthylacetic acid C12H10O23, 32, 64 |
 | | Compound Data | | Melting point | 133.33 °C | 406.48 K | | CSID | 6601 | H bond acceptors | 2 | Rule of 5 violations | 0 | | Molecular weight | 186.2066 | H bond donors | 1 | ACD/LogP | 2.74 | | Phase 25 °C | solid | Rotatable bonds | 2 | Predicted density | 1.23 g/cm3 | | SMILES | O=C(O)Cc2cccc1ccccc12 | | STD InChIKey | PRPINYUDVPFIRX-UHFFFAOYAF | | Melting Points | | mp °C | source | |
|---|
| 130.00 | Alfa Aesar | | 135.00 | DrugBank | | 135.00 | PHYSPROP |
|
|
| | | 1-naphthylacetonitrile C12H9N3, 64 |
 | | Compound Data | | Melting point | 33.25 °C | 306.40 K | | CSID | 8277 | H bond acceptors | 1 | Rule of 5 violations | 0 | | Molecular weight | 167.2066 | H bond donors | 0 | ACD/LogP | 2.68 | | Phase 25 °C | solid | Rotatable bonds | 1 | Predicted density | 1.12 g/cm3 | | SMILES | N#CCc2cccc1ccccc12 | | STD InChIKey | OQRMWUNUKVUHQO-UHFFFAOYAB | | Melting Points | | mp °C | source | |
|---|
| 34.00 | Alfa Aesar | | 32.50 | PHYSPROP |
|
|
| | | 1-nitronaphthalene C10H7NO23, 61, 64 |
 | | Compound Data | | Melting point | 59.83 °C | 332.98 K | | CSID | 6588 | H bond acceptors | 3 | Rule of 5 violations | 0 | | Molecular weight | 173.1681 | H bond donors | 0 | ACD/LogP | 3.18 | | Phase 25 °C | solid | Rotatable bonds | 1 | Predicted density | 1.28 g/cm3 | | SMILES | [O-][N+](=O)c2cccc1ccccc12 | | STD InChIKey | RJKGJBPXVHTNJL-UHFFFAOYAZ | | Melting Points | | mp °C | source | |
|---|
| 57.00 | Alfa Aesar | | 61.50 | Oxford University MSDS | | 61.00 | PHYSPROP |
|
|
| | | 1-nonanethiol C9H20S4, 64 |
 | | Compound Data | | Melting point | -20.05 °C | 253.10 K | | CSID | 14349 | H bond acceptors | 0 | Rule of 5 violations | 1 | | Molecular weight | 160.3201 | H bond donors | 0 | ACD/LogP | 5.01 | | Phase 25 °C | liquid/gas | Rotatable bonds | 8 | Predicted density | 0.84 g/cm3 | | SMILES | CCCCCCCCCS | | STD InChIKey | ZVEZMVFBMOOHAT-UHFFFAOYAL | | Melting Points | | mp °C | source | |
|---|
| -20.00 | American Petroleum Institute. Research Project 44; Selected ... | | -20.10 | PHYSPROP |
|
|
| | | 1-nonanol C9H20O3, 4, 61, 64, 86 |
 | |
|
| | | 1-nonene C9H184, 59, 64 |
 | |
|
| | | 1-octadecanethiol C18H38S3, 64 |
 | | Compound Data | | Melting point | 31.00 °C | 304.15 K | | CSID | 16913 | H bond acceptors | 0 | Rule of 5 violations | 1 | | Molecular weight | 286.5593 | H bond donors | 0 | ACD/LogP | 9.59 | | Phase 25 °C | solid | Rotatable bonds | 17 | Predicted density | 0.84 g/cm3 | | SMILES | CCCCCCCCCCCCCCCCCCS | | STD InChIKey | QJAOYSPHSNGHNC-UHFFFAOYAP | | Melting Points | | mp °C | source | |
|---|
| 32.00 | Alfa Aesar | | 30.00 | PHYSPROP |
|
|
| | | 1-octadecanol C18H38O2, 3, 64 |
 | |
|
| | | 1-octadecene C18H363, 4, 64 |
 | |
|
| | | 1-octadecyne C18H344, 64 |
 | | Compound Data | | Melting point | 24.75 °C | 297.90 K | | CSID | 62633 | H bond acceptors | 0 | Rule of 5 violations | 1 | | Molecular weight | 250.4626 | H bond donors | 0 | ACD/LogP | 8.97 | | Phase 25 °C | liquid/gas | Rotatable bonds | 14 | Predicted density | 0.81 g/cm3 | | SMILES | C#CCCCCCCCCCCCCCCCC | | STD InChIKey | IYDNQWWOZQLMRH-UHFFFAOYAJ | | Melting Points | | mp °C | source | |
|---|
| 27.00 | American Petroleum Institute. Research Project 44; Selected ... | | 22.50 | PHYSPROP |
|
|
| | | 1-octanethiol C8H18S3, 4, 64 |
 | |
|
| | | 1-octanol C8H18O3, 4, 64 |
 | |
|
| | | 1-octene C8H163, 4, 59, 64, 64 |
 | |
|
| | | 1-octylamine C8H19N3, 31, 35, 64 |
 | |
|
| | | 1-pentadecanol C15H32O2, 3, 64 |
 | |
|
| | | 1-pentadecene C15H303, 4, 64 |
 | |
|
| | | 1-pentanethiol C5H12S3, 4, 64 |
 | |
|
| | | 1-pentanol C5H12O3, 4, 61, 64 |
 | |
|
| | | 1-pentene C5H104, 28, 61, 64 |
 | |
|
| | | 1-phenylcyclohexanol C12H16O3, 64 |
 | | Compound Data | | Melting point | 61.75 °C | 334.90 K | | CSID | 14582 | H bond acceptors | 1 | Rule of 5 violations | 0 | | Molecular weight | 176.2548 | H bond donors | 1 | ACD/LogP | 2.94 | | Phase 25 °C | solid | Rotatable bonds | 2 | Predicted density | 1.06 g/cm3 | | SMILES | OC2(c1ccccc1)CCCCC2 | | STD InChIKey | DTTDXHDYTWQDCS-UHFFFAOYAO | | Melting Points | | mp °C | source | |
|---|
| 60.00 | Alfa Aesar | | 63.50 | PHYSPROP |
|
|
| | | 1-piperidineethanol C7H15NO3, 64 |
 | | Compound Data | | Melting point | 16.95 °C | 290.10 K | | CSID | 17221 | H bond acceptors | 2 | Rule of 5 violations | 0 | | Molecular weight | 129.2001 | H bond donors | 1 | ACD/LogP | 1.06 | | Phase 25 °C | liquid/gas | Rotatable bonds | 3 | Predicted density | 0.97 g/cm3 | | SMILES | OCCN1CCCCC1 | | STD InChIKey | KZTWONRVIPPDKH-UHFFFAOYAQ | | Melting Points | | mp °C | source | |
|---|
| 16.00 | Alfa Aesar | | 17.90 | PHYSPROP |
|
|
| | | 1-propanethiol C3H8S3, 4, 64 |
 | |
|
| | | 1-propanol C3H8O3, 4, 61, 64 |
 | |
|
| | | 1-tetradecanol C14H30O2, 3, 64 |
 | |
|
| | | 1-tetradecene C14H283, 4, 61, 64 |
 | |
|
| | | 1-tridecanol C13H28O2, 64 |
 | | Compound Data | | Melting point | 33.25 °C | 306.40 K | | CSID | 7915 | H bond acceptors | 1 | Rule of 5 violations | 1 | | Molecular weight | 200.3608 | H bond donors | 1 | ACD/LogP | 5.66 | | Phase 25 °C | solid | Rotatable bonds | 12 | Predicted density | 0.83 g/cm3 | | SMILES | OCCCCCCCCCCCCC | | STD InChIKey | XFRVVPUIAFSTFO-UHFFFAOYAK | | Melting Points | | mp °C | source | |
|---|
| 34.00 | Aldrich Chemical Company; Aldrich Catalog-Handbook of Fine C... | | 32.50 | PHYSPROP |
|
|
| | | 1,1-dichloroethane C2H4Cl231, 64 |
 | | Compound Data | | Melting point | -96.95 °C | 176.20 K | | CSID | 6125 | H bond acceptors | 0 | Rule of 5 violations | 0 | | Molecular weight | 98.9592 | H bond donors | 0 | ACD/LogP | 1.53 | | Phase 25 °C | liquid/gas | Rotatable bonds | 0 | Predicted density | 1.17 g/cm3 | | SMILES | ClC(Cl)C | | STD InChIKey | SCYULBFZEHDVBN-UHFFFAOYAY | | Melting Points | | mp °C | source | |
|---|
| -97.00 | Dreisbach R. R. Physical Properties of Chemical Compounds; V... | | -96.90 | PHYSPROP |
|
|
| | | 1,1-dimethylallene C5H83, 64 |
 | | Compound Data | | Melting point | -113.80 °C | 159.35 K | | CSID | 11222 | H bond acceptors | 0 | Rule of 5 violations | 0 | | Molecular weight | 68.117 | H bond donors | 0 | ACD/LogP | 2.52 | | Phase 25 °C | liquid/gas | Rotatable bonds | 0 | Predicted density | 0.65 g/cm3 | | SMILES | C(=C)=C(\C)C | | STD InChIKey | PAKGDPSCXSUALC-UHFFFAOYAM | | Melting Points | | mp °C | source | |
|---|
| -114.00 | Alfa Aesar | | -113.60 | PHYSPROP |
|
|
| | | 1,1-dimethylcyclohexane C8H164, 64 |
 | | Compound Data | | Melting point | -33.15 °C | 240.00 K | | CSID | 11062 | H bond acceptors | 0 | Rule of 5 violations | 0 | | Molecular weight | 112.2126 | H bond donors | 0 | ACD/LogP | 4.42 | | Phase 25 °C | liquid/gas | Rotatable bonds | 0 | Predicted density | 0.77 g/cm3 | | SMILES | CC1(C)CCCCC1 | | STD InChIKey | QEGNUYASOUJEHD-UHFFFAOYAZ | | Melting Points | | mp °C | source | |
|---|
| -33.00 | American Petroleum Institute. Research Project 44; Selected ... | | -33.30 | PHYSPROP |
|
|
| | | 1,1-dimethylcyclopentane C7H144, 64 |
 | | Compound Data | | Melting point | -69.90 °C | 203.25 K | | CSID | 14679 | H bond acceptors | 0 | Rule of 5 violations | 0 | | Molecular weight | 98.1861 | H bond donors | 0 | ACD/LogP | 3.85 | | Phase 25 °C | liquid/gas | Rotatable bonds | 0 | Predicted density | 0.77 g/cm3 | | SMILES | CC1(C)CCCC1 | | STD InChIKey | QWHNJUXXYKPLQM-UHFFFAOYAY | | Melting Points | | mp °C | source | |
|---|
| -70.00 | American Petroleum Institute. Research Project 44; Selected ... | | -69.80 | PHYSPROP |
|
|
| | | 1,1-diphenylethane C14H144, 64, 70 |
 | |
|
| | | 1,1-diphenylethylene C14H123, 4, 64 |
 | |
|
| | | 1,1-diphenylpropane C15H164, 64 |
 | | Compound Data | | Melting point | 13.65 °C | 286.80 K | | CSID | 66369 | H bond acceptors | 0 | Rule of 5 violations | 1 | | Molecular weight | 196.2875 | H bond donors | 0 | ACD/LogP | 5.09 | | Phase 25 °C | liquid/gas | Rotatable bonds | 3 | Predicted density | 0.97 g/cm3 | | SMILES | c1ccccc1C(c2ccccc2)CC | | STD InChIKey | BUZMJVBOGDBMGI-UHFFFAOYAC | | Melting Points | | mp °C | source | |
|---|
| 14.00 | American Petroleum Institute. Research Project 44; Selected ... | | 13.30 | PHYSPROP |
|
|
| | | 1,1,1-trichloroethane C2H3Cl331, 61, 64 |
 | |
|
| | | 1,1,1-trifluoroethane C2H3F361, 64 |
 | | Compound Data | | Melting point | -111.15 °C | 162.00 K | | CSID | 9484 | H bond acceptors | 0 | Rule of 5 violations | 0 | | Molecular weight | 84.0404 | H bond donors | 0 | ACD/LogP | 0.83 | | Phase 25 °C | liquid/gas | Rotatable bonds | 0 | Predicted density | 1.08 g/cm3 | | SMILES | FC(F)(F)C | | STD InChIKey | UJPMYEOUBPIPHQ-UHFFFAOYAD | | Melting Points | | mp °C | source | |
|---|
| -111.00 | Oxford University MSDS | | -111.30 | PHYSPROP |
|
|
| | | 1,1,1,2-tetrachloroethane C2H2Cl431, 61, 64 |
 | |
|
| | | 1,1,1,2,2-pentachloroethane C2HCl53, 61, 64 |
 | | Compound Data | | Melting point | -28.93 °C | 244.22 K | | CSID | 6179 | H bond acceptors | 0 | Rule of 5 violations | 0 | | Molecular weight | 202.2943 | H bond donors | 0 | ACD/LogP | 3.20 | | Phase 25 °C | liquid/gas | Rotatable bonds | 0 | Predicted density | 1.70 g/cm3 | | SMILES | ClC(Cl)C(Cl)(Cl)Cl | | STD InChIKey | BNIXVQGCZULYKV-UHFFFAOYAS | | Melting Points | | mp °C | source | |
|---|
| -29.00 | Alfa Aesar | | -29.00 | Oxford University MSDS | | -28.78 | PHYSPROP |
|
|
| | | 1,1,1,2,3,3,3-heptafluoropropane C3HF761, 64 |
 | | Compound Data | | Melting point | -129.05 °C | 144.10 K | | CSID | 61257 | H bond acceptors | 0 | Rule of 5 violations | 0 | | Molecular weight | 170.0289 | H bond donors | 0 | ACD/LogP | 1.61 | | Phase 25 °C | liquid/gas | Rotatable bonds | 0 | Predicted density | 1.46 g/cm3 | | SMILES | FC(F)(F)C(F)C(F)(F)F | | STD InChIKey | YFMFNYKEUDLDTL-UHFFFAOYAL | | Melting Points | | mp °C | source | |
|---|
| -131.00 | Oxford University MSDS | | -127.10 | PHYSPROP |
|
|
| | | 1,1,1,3,3,3-hexafluoropropan-2-ol C3H2F6O3, 61, 64 |
 | | Compound Data | | Melting point | -3.33 °C | 269.82 K | | CSID | 12941 | H bond acceptors | 1 | Rule of 5 violations | 0 | | Molecular weight | 168.0378 | H bond donors | 1 | ACD/LogP | 1.91 | | Phase 25 °C | liquid/gas | Rotatable bonds | 1 | Predicted density | 1.54 g/cm3 | | SMILES | FC(F)(F)C(O)C(F)(F)F | | STD InChIKey | BYEAHWXPCBROCE-UHFFFAOYAH | | Melting Points | | mp °C | source | |
|---|
| -3.00 | Alfa Aesar | | -3.00 | Oxford University MSDS | | -4.00 | PHYSPROP |
|
|
| | | 1,1,1,3,3,3-hexafluoropropane C3H2F661, 64 |
 | | Compound Data | | Melting point | -96.10 °C | 177.05 K | | CSID | 12199 | H bond acceptors | 0 | Rule of 5 violations | 0 | | Molecular weight | 152.0384 | H bond donors | 0 | ACD/LogP | 1.14 | | Phase 25 °C | liquid/gas | Rotatable bonds | 0 | Predicted density | 1.37 g/cm3 | | SMILES | FC(F)(F)CC(F)(F)F | | STD InChIKey | NSGXIBWMJZWTPY-UHFFFAOYAC | | Melting Points | | mp °C | source | |
|---|
| -98.00 | Oxford University MSDS | | -94.20 | PHYSPROP |
|
|
| | | 1,1,2-tribromoethane C2H3Br331, 64 |
 | | Compound Data | | Melting point | -29.15 °C | 244.00 K | | CSID | 59607 | H bond acceptors | 0 | Rule of 5 violations | 0 | | Molecular weight | 266.7572 | H bond donors | 0 | ACD/LogP | 2.83 | | Phase 25 °C | liquid/gas | Rotatable bonds | 1 | Predicted density | 2.63 g/cm3 | | SMILES | BrC(Br)CBr | | STD InChIKey | QUMDOMSJJIFTCA-UHFFFAOYAQ | | Melting Points | | mp °C | source | |
|---|
| -29.00 | Dreisbach R. R. Physical Properties of Chemical Compounds; V... | | -29.30 | PHYSPROP |
|
|
| | | 1,1,2-trichloroethane C2H3Cl331, 61, 64 |
 | |
|
| | | 1,1,2-trichloroethene C2HCl33, 61, 64 |
 | | Compound Data | | Melting point | -84.90 °C | 188.25 K | | CSID | 13837280 | H bond acceptors | 0 | Rule of 5 violations | 0 | | Molecular weight | 131.3883 | H bond donors | 0 | ACD/LogP | 2.26 | | Phase 25 °C | liquid/gas | Rotatable bonds | 0 | Predicted density | 1.47 g/cm3 | | SMILES | Cl\C=C(/Cl)Cl | | STD InChIKey | XSTXAVWGXDQKEL-UHFFFAOYAI | | Melting Points | | mp °C | source | |
|---|
| -85.00 | Alfa Aesar | | -85.00 | Oxford University MSDS | | -84.70 | PHYSPROP |
|
|
| | | 1,1,2,2-tetrachloroethane C2H2Cl43, 31, 61, 64 |
 | |
|
| | | 1,1'-methylenebis(4-isocyanatobenzene) C15H10N2O261, 64 |
 | | Compound Data | | Melting point | 37.60 °C | 310.75 K | | CSID | 7289 | H bond acceptors | 4 | Rule of 5 violations | 0 | | Molecular weight | 250.2521 | H bond donors | 0 | ACD/LogP | 4.93 | | Phase 25 °C | solid | Rotatable bonds | 4 | Predicted density | 1.13 g/cm3 | | SMILES | O=C=N\c1ccc(cc1)Cc2ccc(\N=C=O)cc2 | | STD InChIKey | UPMLOUAZCHDJJD-UHFFFAOYAD | | Melting Points | | mp °C | source | |
|---|
| 37.20 | Oxford University MSDS | | 38.00 | PHYSPROP |
|
|
| | | 1,1',1''-(bromomethanetriyl)tribenzene C19H15Br3, 61, 64 |
 | | Compound Data | | Melting point | 153.33 °C | 426.48 K | | CSID | 11200 | H bond acceptors | 0 | Rule of 5 violations | 1 | | Molecular weight | 323.2264 | H bond donors | 0 | ACD/LogP | 6.51 | | Phase 25 °C | solid | Rotatable bonds | 3 | Predicted density | 1.31 g/cm3 | | SMILES | BrC(c1ccccc1)(c2ccccc2)c3ccccc3 | | STD InChIKey | NZHXEWZGTQSYJM-UHFFFAOYAC | | Melting Points | | mp °C | source | |
|---|
| 154.00 | Alfa Aesar | | 153.00 | Oxford University MSDS | | 153.00 | PHYSPROP |
|
|
| | | 1,10-decanediol C10H22O23, 61, 64 |
 | | Compound Data | | Melting point | 73.00 °C | 346.15 K | | CSID | 34095 | H bond acceptors | 2 | Rule of 5 violations | 0 | | Molecular weight | 174.2805 | H bond donors | 2 | ACD/LogP | 2.06 | | Phase 25 °C | solid | Rotatable bonds | 11 | Predicted density | 0.92 g/cm3 | | SMILES | OCCCCCCCCCCO | | STD InChIKey | FOTKYAAJKYLFFN-UHFFFAOYAW | | Melting Points | | mp °C | source | |
|---|
| 73.00 | Alfa Aesar | | 72.00 | Oxford University MSDS | | 74.00 | PHYSPROP |
|
|
| | | 1,12-dibromododecane C12H24Br23, 64 |
 | | Compound Data | | Melting point | 40.50 °C | 313.65 K | | CSID | 17720 | H bond acceptors | 0 | Rule of 5 violations | 1 | | Molecular weight | 328.127 | H bond donors | 0 | ACD/LogP | 6.85 | | Phase 25 °C | solid | Rotatable bonds | 11 | Predicted density | 1.30 g/cm3 | | SMILES | BrCCCCCCCCCCCCBr | | STD InChIKey | ZJJATABWMGVVRZ-UHFFFAOYAU | | Melting Points | | mp °C | source | |
|---|
| 40.00 | Alfa Aesar | | 41.00 | PHYSPROP |
|
|
| | | 1,12-dodecanediol C12H26O23, 64 |
 | | Compound Data | | Melting point | 82.15 °C | 355.30 K | | CSID | 72056 | H bond acceptors | 2 | Rule of 5 violations | 0 | | Molecular weight | 202.3336 | H bond donors | 2 | ACD/LogP | 3.12 | | Phase 25 °C | solid | Rotatable bonds | 13 | Predicted density | 0.91 g/cm3 | | SMILES | OCCCCCCCCCCCCO | | STD InChIKey | GHLKSLMMWAKNBM-UHFFFAOYAY | | Melting Points | | mp °C | source | |
|---|
| 83.00 | Alfa Aesar | | 81.30 | PHYSPROP |
|
|
| | | 1,18-octadecanedicarboxylic acid C20H38O43, 64 |
 | | Compound Data | | Melting point | 126.25 °C | 399.40 K | | CSID | 68030 | H bond acceptors | 4 | Rule of 5 violations | 1 | | Molecular weight | 342.5133 | H bond donors | 2 | ACD/LogP | 7.17 | | Phase 25 °C | solid | Rotatable bonds | 19 | Predicted density | 0.98 g/cm3 | | SMILES | O=C(O)CCCCCCCCCCCCCCCCCCC(=O)O | | STD InChIKey | JJOJFIHJIRWASH-UHFFFAOYAR | | Melting Points | | mp °C | source | |
|---|
| 127.00 | Alfa Aesar | | 125.50 | PHYSPROP |
|
|
| | | 1,2-benzenedimethanol C8H10O22, 3 |
 | |
|
| | | 1,2-bis-(chloromethyl)xylene C8H8Cl22, 3, 64 |
 | |
|
| | | 1,2-bis(2-chloroethoxy)ethane C6H12Cl2O23, 64 |
 | | Compound Data | | Melting point | -31.75 °C | 241.40 K | | CSID | 7879 | H bond acceptors | 2 | Rule of 5 violations | 0 | | Molecular weight | 187.0643 | H bond donors | 0 | ACD/LogP | 0.83 | | Phase 25 °C | liquid/gas | Rotatable bonds | 7 | Predicted density | 1.15 g/cm3 | | SMILES | ClCCOCCOCCCl | | STD InChIKey | AGYUOJIYYGGHKV-UHFFFAOYAM | | Melting Points | | mp °C | source | |
|---|
| -32.00 | Alfa Aesar | | -31.50 | PHYSPROP |
|
|
| | | 1,2-bis(bromomethyl)benzene C8H8Br23, 64 |
 | | Compound Data | | Melting point | 94.50 °C | 367.65 K | | CSID | 60032 | H bond acceptors | 0 | Rule of 5 violations | 0 | | Molecular weight | 263.9571 | H bond donors | 0 | ACD/LogP | 3.70 | | Phase 25 °C | solid | Rotatable bonds | 2 | Predicted density | 1.78 g/cm3 | | SMILES | BrCc1ccccc1CBr | | STD InChIKey | KGKAYWMGPDWLQZ-UHFFFAOYAZ | | Melting Points | | mp °C | source | |
|---|
| 94.00 | Alfa Aesar | | 95.00 | PHYSPROP |
|
|
| | | 1,2-cyclohexanedione C6H8O23, 64 |
 | | Compound Data | | Melting point | 38.50 °C | 311.65 K | | CSID | 12465 | H bond acceptors | 2 | Rule of 5 violations | 0 | | Molecular weight | 112.1265 | H bond donors | 0 | ACD/LogP | 0.11 | | Phase 25 °C | solid | Rotatable bonds | 0 | Predicted density | 1.13 g/cm3 | | SMILES | O=C1C(=O)CCCC1 | | STD InChIKey | OILAIQUEIWYQPH-UHFFFAOYAM | | Melting Points | | mp °C | source | |
|---|
| 37.00 | Alfa Aesar | | 40.00 | PHYSPROP |
|
|
| | | 1,2-diacetoxybenzene C10H10O47, 64 |
 | | Compound Data | | Melting point | 64.25 °C | 337.40 K | | CSID | 11969 | H bond acceptors | 4 | Rule of 5 violations | 0 | | Molecular weight | 194.184 | H bond donors | 0 | ACD/LogP | 0.54 | | Phase 25 °C | solid | Rotatable bonds | 4 | Predicted density | 1.18 g/cm3 | | SMILES | O=C(Oc1ccccc1OC(=O)C)C | | STD InChIKey | FBSAITBEAPNWJG-UHFFFAOYAE | | Melting Points | | mp °C | source | |
|---|
| 64.00 | Beilstein F. K.; Beilsteins Handbuch der Organischen Chemie.... | | 64.50 | PHYSPROP |
|
|
| | | 1,2-dibenzoylethane C16H14O23, 48 |
 | | Compound Data | | Melting point | 145.00 °C | 418.15 K | | CSID | 120096 | H bond acceptors | 2 | Rule of 5 violations | 0 | | Molecular weight | 238.2812 | H bond donors | 0 | ACD/LogP | 3.27 | | Phase 25 °C | solid | Rotatable bonds | 5 | Predicted density | 1.12 g/cm3 | | SMILES | O=C(c1ccccc1)CCC(=O)c2ccccc2 | | STD InChIKey | OSWWFLDIIGGSJV-UHFFFAOYAU | | Melting Points | | mp °C | source | |
|---|
| 146.00 | Alfa Aesar | | 144.00 | Karthikeyan M.; Glen R.C.; Bender A. General melting point p... |
|
|
| | | 1,2-dibromo-2,4-dicyanobutane C6H6Br2N23, 64 |
 | | Compound Data | | Melting point | 51.00 °C | 324.15 K | | CSID | 55806 | H bond acceptors | 2 | Rule of 5 violations | 0 | | Molecular weight | 265.9332 | H bond donors | 0 | ACD/LogP | 1.71 | | Phase 25 °C | solid | Rotatable bonds | 3 | Predicted density | 1.89 g/cm3 | | SMILES | N#CCCC(Br)(C#N)CBr | | STD InChIKey | DHVLDKHFGIVEIP-UHFFFAOYAK | | Melting Points | | mp °C | source | |
|---|
| 50.00 | Alfa Aesar | | 52.00 | PHYSPROP |
|
|
| | | 1,2-dibromobenzene C6H4Br23, 31, 64 |
 | |
|
| | | 1,2-dibromoethane C2H4Br23, 31, 64 |
 | |
|
| | | 1,2-dibromopropane C3H6Br23, 31, 64 |
 | |
|
| | | 1,2-dichloro-4-nitrobenzene C6H3Cl2NO22, 3, 61, 64, 70 |
 | |
|
| | | 1,2-dichlorobenzene C6H4Cl23, 31, 64 |
 | |
|
| | | 1,2-dichloroethane C2H4Cl23, 31, 64 |
 | |
|
| | | 1,2-diethoxybenzene C10H14O23, 7, 64 |
 | |
|
| | | 1,2-diethylbenzene C10H143, 4, 64 |
 | |
|
| | | 1,2-diiodoethane C2H4I23, 31, 61, 64 |
 | |
|
| | | 1,2-dimethoxy-4-nitrobenzene C8H9NO42, 3, 64 |
 | |
|
| | | 1,2-dimethyl-3-ethylbenzene C10H144, 64 |
 | | Compound Data | | Melting point | -49.75 °C | 223.40 K | | CSID | 13032 | H bond acceptors | 0 | Rule of 5 violations | 0 | | Molecular weight | 134.2182 | H bond donors | 0 | ACD/LogP | 4.13 | | Phase 25 °C | liquid/gas | Rotatable bonds | 1 | Predicted density | 0.87 g/cm3 | | SMILES | c1(cccc(c1C)CC)C | | STD InChIKey | QUBBAXISAHIDNM-UHFFFAOYAP | | Melting Points | | mp °C | source | |
|---|
| -50.00 | American Petroleum Institute. Research Project 44; Selected ... | | -49.50 | PHYSPROP |
|
|
| | | 1,2-dimethyl-4-ethylbenzene C10H144, 64 |
 | | Compound Data | | Melting point | -66.95 °C | 206.20 K | | CSID | 13040 | H bond acceptors | 0 | Rule of 5 violations | 0 | | Molecular weight | 134.2182 | H bond donors | 0 | ACD/LogP | 4.13 | | Phase 25 °C | liquid/gas | Rotatable bonds | 1 | Predicted density | 0.87 g/cm3 | | SMILES | c1c(ccc(c1C)C)CC | | STD InChIKey | SBUYFICWQNHBCM-UHFFFAOYAE | | Melting Points | | mp °C | source | |
|---|
| -67.00 | American Petroleum Institute. Research Project 44; Selected ... | | -66.90 | PHYSPROP |
|
|
| | | 1,2-dimethyl-4-nitrobenzene C8H9NO22, 3, 61, 64 |
 | |
|
| | | 1,2-dimethylbenzene C8H103, 4, 64 |
 | |
|
| | | 1,2-dimethylcyclohexene C8H144, 64 |
 | | Compound Data | | Melting point | -84.05 °C | 189.10 K | | CSID | 14729 | H bond acceptors | 0 | Rule of 5 violations | 0 | | Molecular weight | 110.1968 | H bond donors | 0 | ACD/LogP | 4.08 | | Phase 25 °C | liquid/gas | Rotatable bonds | 0 | Predicted density | 0.81 g/cm3 | | SMILES | C1(=C(\C)CCCC1)\C | | STD InChIKey | TXNWMICHNKMOBR-UHFFFAOYAI | | Melting Points | | mp °C | source | |
|---|
| -84.00 | American Petroleum Institute. Research Project 44; Selected ... | | -84.10 | PHYSPROP |
|
|
| | | 1,2-dimethylcyclopentene C7H124, 64 |
 | | Compound Data | | Melting point | -90.20 °C | 182.95 K | | CSID | 63026 | H bond acceptors | 0 | Rule of 5 violations | 0 | | Molecular weight | 96.1702 | H bond donors | 0 | ACD/LogP | 3.51 | | Phase 25 °C | liquid/gas | Rotatable bonds | 0 | Predicted density | 0.81 g/cm3 | | SMILES | C1(=C(\C)CCC1)\C | | STD InChIKey | SZZWLAZADBEDQP-UHFFFAOYAX | | Melting Points | | mp °C | source | |
|---|
| -90.00 | American Petroleum Institute. Research Project 44; Selected ... | | -90.40 | PHYSPROP |
|
|
| | | 1,2-dinitrobenzene C6H4N2O42, 64 |
 | | Compound Data | | Melting point | 118.25 °C | 391.40 K | | CSID | 10257 | H bond acceptors | 6 | Rule of 5 violations | 0 | | Molecular weight | 168.107 | H bond donors | 0 | ACD/LogP | 1.84 | | Phase 25 °C | solid | Rotatable bonds | 2 | Predicted density | 1.49 g/cm3 | | SMILES | O=[N+]([O-])c1ccccc1[N+]([O-])=O | | STD InChIKey | IZUKQUVSCNEFMJ-UHFFFAOYAA | | Melting Points | | mp °C | source | |
|---|
| 118.00 | Aldrich Chemical Company; Aldrich Catalog-Handbook of Fine C... | | 118.50 | PHYSPROP |
|
|
| | | 1,2-diphenoxyethane C14H14O22, 3, 64 |
 | |
|
| | | 1,2-diphenylethane C14H143, 4, 48, 64, 70 |
 | |
|
| | | 1,2-ethanedithiol C2H6S23, 61, 64 |
 | | Compound Data | | Melting point | -41.07 °C | 232.08 K | | CSID | 13865015 | H bond acceptors | 0 | Rule of 5 violations | 0 | | Molecular weight | 94.199 | H bond donors | 0 | ACD/LogP | 1.31 | | Phase 25 °C | liquid/gas | Rotatable bonds | 3 | Predicted density | 1.05 g/cm3 | | SMILES | SCCS | | STD InChIKey | VYMPLPIFKRHAAC-UHFFFAOYAA | | Melting Points | | mp °C | source | |
|---|
| -41.00 | Alfa Aesar | | -41.00 | Oxford University MSDS | | -41.20 | PHYSPROP |
|
|
| | | 1,2,2,3-tetrabromopropane C3H4Br431, 64 |
 | | Compound Data | | Melting point | 10.75 °C | 283.90 K | | CSID | 37466 | H bond acceptors | 0 | Rule of 5 violations | 0 | | Molecular weight | 359.6799 | H bond donors | 0 | ACD/LogP | 4.60 | | Phase 25 °C | liquid/gas | Rotatable bonds | 2 | Predicted density | 2.75 g/cm3 | | SMILES | BrC(Br)(CBr)CBr | | STD InChIKey | SNLFZAHVOKOBOP-UHFFFAOYAP | | Melting Points | | mp °C | source | |
|---|
| 11.00 | Dreisbach R. R. Physical Properties of Chemical Compounds; V... | | 10.50 | PHYSPROP |
|
|
| | | 1,2,3-triazole C2H3N33, 61, 64, 72 |
 | | Compound Data | | Melting point | 23.67 °C | 296.82 K | | CSID | 60839 | H bond acceptors | 3 | Rule of 5 violations | 0 | | Molecular weight | 69.0653 | H bond donors | 1 | ACD/LogP | 0.00 | | Phase 25 °C | liquid/gas | Rotatable bonds | 0 | Predicted density | 1.27 g/cm3 | | SMILES | c1cnn[nH]1 | | STD InChIKey | QWENRTYMTSOGBR-UHFFFAOYAF | | Melting Points | | mp °C | source | |
|---|
| 24.00 | Alfa Aesar | | 23.00 | PHYSPROP | | 24.00 | Sigma-Aldrich | | Values not used in calculating the average melting point | | 167.00 | Oxford University MSDS1 | | 1. clearly out of range JCB |
|
|
| | | 1,2,3-tribromopropane C3H5Br33, 31, 64 |
 | |
|
| | | 1,2,3-trichloro-4-nitrobenzene C6H2Cl3NO23, 64, 70 |
 | | Compound Data | | Melting point | 55.50 °C | 328.65 K | | CSID | 26691 | H bond acceptors | 3 | Rule of 5 violations | 0 | | Molecular weight | 226.4446 | H bond donors | 0 | ACD/LogP | 3.44 | | Phase 25 °C | solid | Rotatable bonds | 1 | Predicted density | 1.65 g/cm3 | | SMILES | Clc1ccc([N+]([O-])=O)c(Cl)c1Cl | | STD InChIKey | BGKIECJVXXHLDP-UHFFFAOYAO | | Melting Points | | mp °C | source | |
|---|
| 55.00 | Alfa Aesar | | 55.50 | PHYSPROP | | 56.00 | Sepassi K; Yalkowsky SH. AAPS PharmSciTech 7(1) E1-E8 (2006) |
|
|
| | | 1,2,3-trichloro-5-nitrobenzene C6H2Cl3NO23, 64 |
 | | Compound Data | | Melting point | 71.25 °C | 344.40 K | | CSID | 79719 | H bond acceptors | 3 | Rule of 5 violations | 0 | | Molecular weight | 226.4446 | H bond donors | 0 | ACD/LogP | 3.74 | | Phase 25 °C | solid | Rotatable bonds | 1 | Predicted density | 1.65 g/cm3 | | SMILES | Clc1cc([N+]([O-])=O)cc(Cl)c1Cl | | STD InChIKey | HHLCSFGOTLUREE-UHFFFAOYAS | | Melting Points | | mp °C | source | |
|---|
| 70.00 | Alfa Aesar | | 72.50 | PHYSPROP |
|
|
| | | 1,2,3-trichlorobenzene C6H3Cl32, 3, 44, 64, 70 |
 | |
|
| | | 1,2,3-trichloropropane C3H5Cl33, 31, 64 |
 | |
|
| | | 1,2,3-trimethoxybenzene C9H12O32, 3, 64 |
 | |
|
| | | 1,2,3-trimethylbenzene C9H122, 4, 61, 64 |
 | |
|
| | | 1,2,3-triphenylguanidine C19H17N33, 64 |
 | | Compound Data | | Melting point | 145.25 °C | 418.40 K | | CSID | 7258 | H bond acceptors | 3 | Rule of 5 violations | 0 | | Molecular weight | 287.3584 | H bond donors | 2 | ACD/LogP | 4.94 | | Phase 25 °C | solid | Rotatable bonds | 3 | Predicted density | 1.07 g/cm3 | | SMILES | N(=C(/Nc1ccccc1)Nc2ccccc2)\c3ccccc3 | | STD InChIKey | FUPAJKKAHDLPAZ-UHFFFAOYAR | | Melting Points | | mp °C | source | |
|---|
| 144.00 | Alfa Aesar | | 146.50 | PHYSPROP |
|
|
| | | 1,2,3,4-tetrachlorobenzene C6H2Cl42, 64 |
 | | Compound Data | | Melting point | 47.25 °C | 320.40 K | | CSID | 21106540 | H bond acceptors | 0 | Rule of 5 violations | 0 | | Molecular weight | 215.8921 | H bond donors | 0 | ACD/LogP | 4.17 | | Phase 25 °C | solid | Rotatable bonds | 0 | Predicted density | 1.57 g/cm3 | | SMILES | Clc1ccc(Cl)c(Cl)c1Cl | | STD InChIKey | GBDZXPJXOMHESU-UHFFFAOYAT | | Melting Points | | mp °C | source | |
|---|
| 47.00 | Aldrich Chemical Company; Aldrich Catalog-Handbook of Fine C... | | 47.50 | PHYSPROP |
|
|
| | | 1,2,3,4-tetramethylbenzene C10H144, 64 |
 | | Compound Data | | Melting point | -6.10 °C | 267.05 K | | CSID | 9844 | H bond acceptors | 0 | Rule of 5 violations | 0 | | Molecular weight | 134.2182 | H bond donors | 0 | ACD/LogP | 4.06 | | Phase 25 °C | liquid/gas | Rotatable bonds | 0 | Predicted density | 0.87 g/cm3 | | SMILES | c1(ccc(c(c1C)C)C)C | | STD InChIKey | UOHMMEJUHBCKEE-UHFFFAOYAP | | Melting Points | | mp °C | source | |
|---|
| -6.00 | American Petroleum Institute. Research Project 44; Selected ... | | -6.20 | PHYSPROP |
|
|
| | | 1,2,3,4,5-pentachloro-6-nitrobenzene C6Cl5NO261, 64 |
 | | Compound Data | | Melting point | 142.75 °C | 415.90 K | | CSID | 6464 | H bond acceptors | 3 | Rule of 5 violations | 0 | | Molecular weight | 295.3347 | H bond donors | 0 | ACD/LogP | 4.16 | | Phase 25 °C | solid | Rotatable bonds | 1 | Predicted density | 1.83 g/cm3 | | SMILES | Clc1c(c(Cl)c(Cl)c(Cl)c1Cl)[N+]([O-])=O | | STD InChIKey | LKPLKUMXSAEKID-UHFFFAOYAW | | Melting Points | | mp °C | source | |
|---|
| 141.50 | Oxford University MSDS | | 144.00 | PHYSPROP |
|
|
| | | 1,2,3,4,5-pentafluorobenzene C6HF561, 64 |
 | | Compound Data | | Melting point | -47.65 °C | 225.50 K | | CSID | 13866746 | H bond acceptors | 0 | Rule of 5 violations | 0 | | Molecular weight | 168.0642 | H bond donors | 0 | ACD/LogP | 2.40 | | Phase 25 °C | liquid/gas | Rotatable bonds | 0 | Predicted density | 1.52 g/cm3 | | SMILES | Fc1cc(F)c(F)c(F)c1F | | STD InChIKey | WACNXHCZHTVBJM-UHFFFAOYAM | | Melting Points | | mp °C | source | |
|---|
| -48.00 | Oxford University MSDS | | -47.30 | PHYSPROP |
|
|
| | | 1,2,3,5-tetrachlorobenzene C6H2Cl42, 64, 70 |
 | |
|
| | | 1,2,3,5-tetramethylbenzene C10H144, 64 |
 | | Compound Data | | Melting point | -23.85 °C | 249.30 K | | CSID | 10245 | H bond acceptors | 0 | Rule of 5 violations | 0 | | Molecular weight | 134.2182 | H bond donors | 0 | ACD/LogP | 4.06 | | Phase 25 °C | liquid/gas | Rotatable bonds | 0 | Predicted density | 0.87 g/cm3 | | SMILES | c1(cc(cc(c1C)C)C)C | | STD InChIKey | BFIMMTCNYPIMRN-UHFFFAOYAG | | Melting Points | | mp °C | source | |
|---|
| -24.00 | American Petroleum Institute. Research Project 44; Selected ... | | -23.70 | PHYSPROP |
|
|
| | | 1,2,4-benzenetricarboxylic anhydride C9H4O53, 64 |
 | | Compound Data | | Melting point | 164.50 °C | 437.65 K | | CSID | 10618 | H bond acceptors | 5 | Rule of 5 violations | 0 | | Molecular weight | 192.1251 | H bond donors | 1 | ACD/LogP | 1.28 | | Phase 25 °C | solid | Rotatable bonds | 1 | Predicted density | 1.67 g/cm3 | | SMILES | O=C(O)c1ccc2C(=O)OC(=O)c2c1 | | STD InChIKey | SRPWOOOHEPICQU-UHFFFAOYAL | | Melting Points | | mp °C | source | |
|---|
| 167.00 | Alfa Aesar | | 162.00 | PHYSPROP |
|
|
| | | 1,2,4-tribromobenzene C6H3Br32, 3, 64, 70 |
 | |
|
| | | 1,2,4-trimethylbenzene C9H123, 4, 61, 64 |
 | |
|
| | | 1,2,4,5-tetrabromobenzene C6H2Br43, 64, 70 |
 | |
|
| | | 1,2,4,5-tetrachlorobenzene C6H2Cl42, 3, 61, 64, 70, 70 |
 | |
|
| | | 1,2,4,5-tetrafluorobenzene C6H2F43, 64 |
 | | Compound Data | | Melting point | 4.25 °C | 277.40 K | | CSID | 21108549 | H bond acceptors | 0 | Rule of 5 violations | 0 | | Molecular weight | 150.0737 | H bond donors | 0 | ACD/LogP | 2.46 | | Phase 25 °C | liquid/gas | Rotatable bonds | 0 | Predicted density | 1.41 g/cm3 | | SMILES | Fc1c(F)cc(F)c(F)c1 | | STD InChIKey | SDXUIOOHCIQXRP-UHFFFAOYAJ | | Melting Points | | mp °C | source | |
|---|
| 4.00 | Alfa Aesar | | 4.50 | PHYSPROP |
|
|
| | | 1,2,4,5-tetraisopropylbenzene C18H307, 64 |
 | | Compound Data | | Melting point | 118.70 °C | 391.85 K | | CSID | 62663 | H bond acceptors | 0 | Rule of 5 violations | 1 | | Molecular weight | 246.4308 | H bond donors | 0 | ACD/LogP | 7.57 | | Phase 25 °C | solid | Rotatable bonds | 4 | Predicted density | 0.85 g/cm3 | | SMILES | c1c(c(cc(c1C(C)C)C(C)C)C(C)C)C(C)C | | STD InChIKey | ROXLYQQDLJJEBE-UHFFFAOYAD | | Melting Points | | mp °C | source | |
|---|
| 119.00 | Beilstein F. K.; Beilsteins Handbuch der Organischen Chemie.... | | 118.40 | PHYSPROP |
|
|
| | | 1,2,4,5-tetramethylbenzene C10H142, 3, 64 |
 | |
|
| | | 1,3-benzenediacetonitrile C10H8N22, 3, 64 |
 | |
|
| | | 1,3-benzenedimethanol C8H10O22, 3, 64 |
 | |
|
| | | 1,3-benzenedimethanol C8H8Br23, 64 |
 | | Compound Data | | Melting point | 76.00 °C | 349.15 K | | CSID | 62581 | H bond acceptors | 0 | Rule of 5 violations | 0 | | Molecular weight | 263.9571 | H bond donors | 0 | ACD/LogP | 3.62 | | Phase 25 °C | solid | Rotatable bonds | 2 | Predicted density | 1.78 g/cm3 | | SMILES | BrCc1cccc(c1)CBr | | STD InChIKey | OXHOPZLBSSTTBU-UHFFFAOYAU | | Melting Points | | mp °C | source | |
|---|
| 75.00 | Alfa Aesar | | 77.00 | PHYSPROP |
|
|
| | | 1,3-benzothiazole-2-thiol C7H5NS23, 61, 64 |
 | | Compound Data | | Melting point | 180.00 °C | 453.15 K | | CSID | 608157 | H bond acceptors | 1 | Rule of 5 violations | 0 | | Molecular weight | 167.2513 | H bond donors | 1 | ACD/LogP | 2.38 | | Phase 25 °C | solid | Rotatable bonds | 0 | Predicted density | 1.46 g/cm3 | | SMILES | S=C2Sc1ccccc1N2 | | STD InChIKey | YXIWHUQXZSMYRE-UHFFFAOYAK | | Melting Points | | mp °C | source | |
|---|
| 180.00 | Alfa Aesar | | 179.00 | Oxford University MSDS | | 181.00 | PHYSPROP |
|
|
| | | 1,3-bis(4-piperidinyl)propane C13H26N23, 64 |
 | | Compound Data | | Melting point | 66.55 °C | 339.70 K | | CSID | 77230 | H bond acceptors | 2 | Rule of 5 violations | 0 | | Molecular weight | 210.3589 | H bond donors | 2 | ACD/LogP | 2.62 | | Phase 25 °C | solid | Rotatable bonds | 4 | Predicted density | 0.89 g/cm3 | | SMILES | N2CCC(CCCC1CCNCC1)CC2 | | STD InChIKey | OXEZLYIDQPBCBB-UHFFFAOYAP | | Melting Points | | mp °C | source | |
|---|
| 66.00 | Alfa Aesar | | 67.10 | PHYSPROP |
|
|
| | | 1,3-bis(chlormethyl)benzene C8H8Cl22, 3, 64 |
 | |
|
| | | 1,3-bis(diphenylphosphino)propane C27H26P23, 48 |
 | | Compound Data | | Melting point | 60.50 °C | 333.65 K | | CSID | 73276 | H bond acceptors | 0 | Rule of 5 violations | 1 | | Molecular weight | 412.4429 | H bond donors | 0 | ACD/LogP | 6.98 | | Phase 25 °C | solid | Rotatable bonds | 8 | Predicted density | 0.00 g/cm3 | | SMILES | c1ccc(cc1)P(CCCP(c2ccccc2)c3ccccc3)c4ccccc4 | | STD InChIKey | LVEYOSJUKRVCCF-UHFFFAOYAP | | Melting Points | | mp °C | source | |
|---|
| 61.00 | Alfa Aesar | | 60.00 | Karthikeyan M.; Glen R.C.; Bender A. General melting point p... |
|
|
| | | 1,3-cyclohexanedione C6H8O23, 64 |
 | | Compound Data | | Melting point | 104.25 °C | 377.40 K | | CSID | 10004 | H bond acceptors | 2 | Rule of 5 violations | 0 | | Molecular weight | 112.1265 | H bond donors | 0 | ACD/LogP | -0.89 | | Phase 25 °C | solid | Rotatable bonds | 0 | Predicted density | 1.13 g/cm3 | | SMILES | O=C1CCCC(=O)C1 | | STD InChIKey | HJSLFCCWAKVHIW-UHFFFAOYAR | | Melting Points | | mp °C | source | |
|---|
| 103.00 | Alfa Aesar | | 105.50 | PHYSPROP |
|
|
| | | 1,3-diacetylbenzene C10H10O22, 3, 48, 64 |
 | |
|
| | | 1,3-diaminobenzene C6H8N22, 3, 64 |
 | |
|
| | | 1,3-dibenzoyloxybenzene C20H14O43, 41, 64 |
 | | Compound Data | | Melting point | 117.00 °C | 390.15 K | | CSID | 60108 | H bond acceptors | 4 | Rule of 5 violations | 0 | | Molecular weight | 318.3228 | H bond donors | 0 | ACD/LogP | 4.96 | | Phase 25 °C | solid | Rotatable bonds | 6 | Predicted density | 1.24 g/cm3 | | SMILES | O=C(Oc2cccc(OC(=O)c1ccccc1)c2)c3ccccc3 | | STD InChIKey | SUQGLJRNDJRARS-UHFFFAOYAL | | Melting Points | | mp °C | source | |
|---|
| 118.00 | Alfa Aesar | | 116.00 | GlobalChems | | Values not used in calculating the average melting point | | -90.00 | PHYSPROP1 | | 1. clearly out of range JCB |
|
|
| | | 1,3-dibromopropane C3H6Br23, 31, 61, 64 |
 | |
|
| | | 1,3-dichloro-5-iodobenzene C6H3Cl2I2, 3 |
 | | Compound Data | | Melting point | 56.50 °C | 329.65 K | | CSID | 68896 | H bond acceptors | 0 | Rule of 5 violations | 0 | | Molecular weight | 272.8985 | H bond donors | 0 | ACD/LogP | 3.54 | | Phase 25 °C | solid | Rotatable bonds | 0 | Predicted density | 2.02 g/cm3 | | SMILES | Ic1cc(Cl)cc(Cl)c1 | | STD InChIKey | AATPRMRVLQZEHB-UHFFFAOYAC | | Melting Points | | mp °C | source | |
|---|
| 56.00 | Aldrich Chemical Company; Aldrich Catalog-Handbook of Fine C... | | 57.00 | Alfa Aesar |
|
|
| | | 1,3-dichloro-5-nitrobenzene C6H3Cl2NO23, 64 |
 | | Compound Data | | Melting point | 64.70 °C | 337.85 K | | CSID | 11567 | H bond acceptors | 3 | Rule of 5 violations | 0 | | Molecular weight | 191.9995 | H bond donors | 0 | ACD/LogP | 3.34 | | Phase 25 °C | solid | Rotatable bonds | 1 | Predicted density | 1.53 g/cm3 | | SMILES | Clc1cc([N+]([O-])=O)cc(Cl)c1 | | STD InChIKey | RNABGKOKSBUFHW-UHFFFAOYAF | | Melting Points | | mp °C | source | |
|---|
| 64.00 | Alfa Aesar | | 65.40 | PHYSPROP |
|
|
| | | 1,3-dichloro-5,5-dimethylhydantoin C5H6Cl2N2O23, 61, 64 |
 | | Compound Data | | Melting point | 133.00 °C | 406.15 K | | CSID | 8057 | H bond acceptors | 4 | Rule of 5 violations | 0 | | Molecular weight | 197.0193 | H bond donors | 0 | ACD/LogP | 1.35 | | Phase 25 °C | solid | Rotatable bonds | 0 | Predicted density | 1.58 g/cm3 | | SMILES | O=C1N(Cl)C(=O)N(Cl)C1(C)C | | STD InChIKey | KEQGZUUPPQEDPF-UHFFFAOYAB | | Melting Points | | mp °C | source | |
|---|
| 132.00 | Alfa Aesar | | 135.00 | Oxford University MSDS | | 132.00 | PHYSPROP |
|
|
| | | 1,3-dichloroacetone C3H4Cl2O3, 64 |
 | | Compound Data | | Melting point | 44.50 °C | 317.65 K | | CSID | 21106513 | H bond acceptors | 1 | Rule of 5 violations | 0 | | Molecular weight | 126.9693 | H bond donors | 0 | ACD/LogP | 1.29 | | Phase 25 °C | solid | Rotatable bonds | 2 | Predicted density | 1.30 g/cm3 | | SMILES | ClCC(=O)CCl | | STD InChIKey | SUNMBRGCANLOEG-UHFFFAOYAE | | Melting Points | | mp °C | source | |
|---|
| 44.00 | Alfa Aesar | | 45.00 | PHYSPROP |
|
|
| | | 1,3-dichlorobenzene C6H4Cl23, 31, 61, 64 |
 | |
|
| | | 1,3-dichloropropane C3H6Cl231, 64 |
 | | Compound Data | | Melting point | -99.75 °C | 173.40 K | | CSID | 8543 | H bond acceptors | 0 | Rule of 5 violations | 0 | | Molecular weight | 112.9857 | H bond donors | 0 | ACD/LogP | 2.00 | | Phase 25 °C | liquid/gas | Rotatable bonds | 2 | Predicted density | 1.12 g/cm3 | | SMILES | ClCCCCl | | STD InChIKey | YHRUOJUYPBUZOS-UHFFFAOYAZ | | Melting Points | | mp °C | source | |
|---|
| -100.00 | Dreisbach R. R. Physical Properties of Chemical Compounds; V... | | -99.50 | PHYSPROP |
|
|
| | | 1,3-dicyanobenzene C8H4N22, 3, 64 |
 | |
|
| | | 1,3-diethoxybenzene C10H14O23, 64 |
 | | Compound Data | | Melting point | 11.70 °C | 284.85 K | | CSID | 67462 | H bond acceptors | 2 | Rule of 5 violations | 0 | | Molecular weight | 166.217 | H bond donors | 0 | ACD/LogP | 2.99 | | Phase 25 °C | liquid/gas | Rotatable bonds | 4 | Predicted density | 0.97 g/cm3 | | SMILES | O(c1cccc(OCC)c1)CC | | STD InChIKey | MKGFYMKFBCWNCP-UHFFFAOYAG | | Melting Points | | mp °C | source | |
|---|
| 11.00 | Alfa Aesar | | 12.40 | PHYSPROP |
|
|
| | | 1,3-diethyl-5-methylbenzene C11H164, 64 |
 | | Compound Data | | Melting point | -74.05 °C | 199.10 K | | CSID | 15468 | H bond acceptors | 0 | Rule of 5 violations | 0 | | Molecular weight | 148.2447 | H bond donors | 0 | ACD/LogP | 4.66 | | Phase 25 °C | liquid/gas | Rotatable bonds | 2 | Predicted density | 0.86 g/cm3 | | SMILES | c1c(cc(cc1CC)CC)C | | STD InChIKey | HILAULICMJUOLK-UHFFFAOYAE | | Melting Points | | mp °C | source | |
|---|
| -74.00 | American Petroleum Institute. Research Project 44; Selected ... | | -74.10 | PHYSPROP |
|
|
| | | 1,3-diethylbenzene C10H144, 64 |
 | | Compound Data | | Melting point | -83.95 °C | 189.20 K | | CSID | 8531 | H bond acceptors | 0 | Rule of 5 violations | 0 | | Molecular weight | 134.2182 | H bond donors | 0 | ACD/LogP | 4.20 | | Phase 25 °C | liquid/gas | Rotatable bonds | 2 | Predicted density | 0.86 g/cm3 | | SMILES | c1ccc(cc1CC)CC | | STD InChIKey | AFZZYIJIWUTJFO-UHFFFAOYAI | | Melting Points | | mp °C | source | |
|---|
| -84.00 | American Petroleum Institute. Research Project 44; Selected ... | | -83.90 | PHYSPROP |
|
|
| | | 1,3-diiodobenzene C6H4I23, 7, 64 |
 | |
|
| | | 1,3-diisocyanatobenzene C8H4N2O23, 64 |
 | | Compound Data | | Melting point | 49.00 °C | 322.15 K | | CSID | 29002 | H bond acceptors | 4 | Rule of 5 violations | 0 | | Molecular weight | 160.1296 | H bond donors | 0 | ACD/LogP | 3.01 | | Phase 25 °C | solid | Rotatable bonds | 2 | Predicted density | 1.17 g/cm3 | | SMILES | O=C=N/c1cccc(\N=C=O)c1 | | STD InChIKey | VGHSXKTVMPXHNG-UHFFFAOYAI | | Melting Points | | mp °C | source | |
|---|
| 48.00 | Alfa Aesar | | 50.00 | PHYSPROP |
|
|
| | | 1,3-diisopropylbenzene C12H182, 3, 64 |
 | |
|
| | | 1,3-dimethyl-2-ethylbenzene C10H144, 64 |
 | | Compound Data | | Melting point | -16.10 °C | 257.05 K | | CSID | 16887 | H bond acceptors | 0 | Rule of 5 violations | 0 | | Molecular weight | 134.2182 | H bond donors | 0 | ACD/LogP | 4.13 | | Phase 25 °C | liquid/gas | Rotatable bonds | 1 | Predicted density | 0.87 g/cm3 | | SMILES | c1(cccc(c1CC)C)C | | STD InChIKey | CHIKRULMSSADAF-UHFFFAOYAK | | Melting Points | | mp °C | source | |
|---|
| -16.00 | American Petroleum Institute. Research Project 44; Selected ... | | -16.20 | PHYSPROP |
|
|
| | | 1,3-dimethyl-2-imidazolidinone C5H10N2O3, 64 |
 | | Compound Data | | Melting point | 8.10 °C | 281.25 K | | CSID | 6409 | H bond acceptors | 3 | Rule of 5 violations | 0 | | Molecular weight | 114.1457 | H bond donors | 0 | ACD/LogP | 0.55 | | Phase 25 °C | liquid/gas | Rotatable bonds | 0 | Predicted density | 1.06 g/cm3 | | SMILES | CN1CCN(C1=O)C | | STD InChIKey | CYSGHNMQYZDMIA-UHFFFAOYAB | | Melting Points | | mp °C | source | |
|---|
| 8.00 | Alfa Aesar | | 8.20 | PHYSPROP |
|
|
| | | 1,3-dimethyl-2-nitrobenzene C8H9NO22, 3, 61, 64 |
 | |
|
| | | 1,3-dimethyl-4-ethylbenzene C10H144, 64 |
 | | Compound Data | | Melting point | -62.95 °C | 210.20 K | | CSID | 12829 | H bond acceptors | 0 | Rule of 5 violations | 0 | | Molecular weight | 134.2182 | H bond donors | 0 | ACD/LogP | 4.13 | | Phase 25 °C | liquid/gas | Rotatable bonds | 1 | Predicted density | 0.87 g/cm3 | | SMILES | c1cc(cc(c1CC)C)C | | STD InChIKey | MEMBJMDZWKVOTB-UHFFFAOYAK | | Melting Points | | mp °C | source | |
|---|
| -63.00 | American Petroleum Institute. Research Project 44; Selected ... | | -62.90 | PHYSPROP |
|
|
| | | 1,3-dimethylbenzene C8H103, 4, 64 |
 | |
|
| | | 1,3-dimethyluracil C6H8N2O23, 64 |
 | | Compound Data | | Melting point | 120.50 °C | 393.65 K | | CSID | 63310 | H bond acceptors | 4 | Rule of 5 violations | 0 | | Molecular weight | 140.1399 | H bond donors | 0 | ACD/LogP | 0.40 | | Phase 25 °C | solid | Rotatable bonds | 0 | Predicted density | 1.22 g/cm3 | | SMILES | O=C1N(C(=O)\C=C/N1C)C | | STD InChIKey | JSDBKAHWADVXFU-UHFFFAOYAJ | | Melting Points | | mp °C | source | |
|---|
| 121.00 | Alfa Aesar | | 120.00 | PHYSPROP |
|
|
| | | 1,3-dinitrobenzene C6H4N2O42, 3, 61, 64 |
 | |
|
| | | 1,3-dinitronaphthalene C10H6N2O461, 64 |
 | | Compound Data | | Melting point | 147.50 °C | 420.65 K | | CSID | 11325 | H bond acceptors | 6 | Rule of 5 violations | 0 | | Molecular weight | 218.1656 | H bond donors | 0 | ACD/LogP | 2.77 | | Phase 25 °C | solid | Rotatable bonds | 2 | Predicted density | 1.48 g/cm3 | | SMILES | c1ccc2c(c1)cc(cc2N(=O)=O)N(=O)=O | | STD InChIKey | ULALSFRIGPMWRS-UHFFFAOYAZ | | Melting Points | | mp °C | source | |
|---|
| 147.00 | Oxford University MSDS | | 148.00 | PHYSPROP |
|
|
| | | 1,3-dioxane C4H8O261, 64 |
 | | Compound Data | | Melting point | -43.50 °C | 229.65 K | | CSID | 10018 | H bond acceptors | 2 | Rule of 5 violations | 0 | | Molecular weight | 88.1051 | H bond donors | 0 | ACD/LogP | -0.44 | | Phase 25 °C | liquid/gas | Rotatable bonds | 0 | Predicted density | 0.99 g/cm3 | | SMILES | O1CCCOC1 | | STD InChIKey | VDFVNEFVBPFDSB-UHFFFAOYAD | | Melting Points | | mp °C | source | |
|---|
| -42.00 | Oxford University MSDS | | -45.00 | PHYSPROP |
|
|
| | | 1,3-diphenoxy-2-propanol C15H16O33, 64 |
 | | Compound Data | | Melting point | 81.75 °C | 354.90 K | | CSID | 11641 | H bond acceptors | 3 | Rule of 5 violations | 0 | | Molecular weight | 244.2857 | H bond donors | 1 | ACD/LogP | 3.07 | | Phase 25 °C | solid | Rotatable bonds | 7 | Predicted density | 1.15 g/cm3 | | SMILES | O(c1ccccc1)CC(O)COc2ccccc2 | | STD InChIKey | NKCVHIPHZCIEFC-UHFFFAOYAO | | Melting Points | | mp °C | source | |
|---|
| 82.00 | Alfa Aesar | | 81.50 | PHYSPROP |
|
|
| | | 1,3-diphenylacetone C15H14O2, 3, 61, 64 |
 | |
|
| | | 1,3-diphenylguanidine C13H13N33, 64 |
 | | Compound Data | | Melting point | 149.50 °C | 422.65 K | | CSID | 7313 | H bond acceptors | 3 | Rule of 5 violations | 0 | | Molecular weight | 211.2624 | H bond donors | 3 | ACD/LogP | 2.85 | | Phase 25 °C | solid | Rotatable bonds | 2 | Predicted density | 1.10 g/cm3 | | SMILES | N(=C(/Nc1ccccc1)N)\c2ccccc2 | | STD InChIKey | OWRCNXZUPFZXOS-UHFFFAOYAB | | Melting Points | | mp °C | source | |
|---|
| 149.00 | Alfa Aesar | | 150.00 | PHYSPROP |
|
|
| | | 1,3-diphenylthiourea C13H12N2S3, 61, 64 |
 | | Compound Data | | Melting point | 153.50 °C | 426.65 K | | CSID | 610932 | H bond acceptors | 2 | Rule of 5 violations | 0 | | Molecular weight | 228.3128 | H bond donors | 2 | ACD/LogP | 2.34 | | Phase 25 °C | solid | Rotatable bonds | 2 | Predicted density | 1.28 g/cm3 | | SMILES | S=C(Nc1ccccc1)Nc2ccccc2 | | STD InChIKey | FCSHMCFRCYZTRQ-UHFFFAOYAC | | Melting Points | | mp °C | source | |
|---|
| 152.00 | Alfa Aesar | | 154.00 | Oxford University MSDS | | 154.50 | PHYSPROP |
|
|
| | | 1,3-propanediol C3H8O22, 3, 64 |
 | |
|
| | | 1,3-thiazolidine-4-carboxylic acid C4H7NO2S61, 64 |
 | | Compound Data | | Melting point | 195.75 °C | 468.90 K | | CSID | 9546 | H bond acceptors | 3 | Rule of 5 violations | 0 | | Molecular weight | 133.1689 | H bond donors | 2 | ACD/LogP | -0.39 | | Phase 25 °C | solid | Rotatable bonds | 1 | Predicted density | 1.38 g/cm3 | | SMILES | O=C(O)C1NCSC1 | | STD InChIKey | DZLNHFMRPBPULJ-UHFFFAOYAN | | Melting Points | | mp °C | source | |
|---|
| 195.00 | Oxford University MSDS | | 196.50 | PHYSPROP |
|
|
| | | 1,3,5-benzenetricarbonyl chloride C9H3Cl3O33, 64 |
 | | Compound Data | | Melting point | 36.15 °C | 309.30 K | | CSID | 70514 | H bond acceptors | 3 | Rule of 5 violations | 0 | | Molecular weight | 265.4773 | H bond donors | 0 | ACD/LogP | 3.02 | | Phase 25 °C | solid | Rotatable bonds | 3 | Predicted density | 1.57 g/cm3 | | SMILES | O=C(Cl)c1cc(cc(C(Cl)=O)c1)C(Cl)=O | | STD InChIKey | UWCPYKQBIPYOLX-UHFFFAOYAM | | Melting Points | | mp °C | source | |
|---|
| 36.00 | Alfa Aesar | | 36.30 | PHYSPROP |
|
|
| | | 1,3,5-tribromobenzene C6H3Br32, 3, 64, 70 |
 | |
|
| | | 1,3,5-trichloro-2-nitrobenzene C6H2Cl3NO23, 61, 64 |
 | | Compound Data | | Melting point | 71.67 °C | 344.82 K | | CSID | 27183 | H bond acceptors | 3 | Rule of 5 violations | 0 | | Molecular weight | 226.4446 | H bond donors | 0 | ACD/LogP | 3.41 | | Phase 25 °C | solid | Rotatable bonds | 1 | Predicted density | 1.65 g/cm3 | | SMILES | O=[N+]([O-])c1c(Cl)cc(Cl)cc1Cl | | STD InChIKey | AEBJDOTVYMITIA-UHFFFAOYAF | | Melting Points | | mp °C | source | |
|---|
| 71.00 | Alfa Aesar | | 72.00 | Oxford University MSDS | | 72.00 | PHYSPROP |
|
|
| | | 1,3,5-trichlorobenzene C6H3Cl32, 3, 44, 64, 70 |
 | |
|
| | | 1,3,5-trifluoro-2-nitrobenzene C6H2F3NO23, 64 |
 | | Compound Data | | Melting point | 3.75 °C | 276.90 K | | CSID | 60889 | H bond acceptors | 3 | Rule of 5 violations | 0 | | Molecular weight | 177.0808 | H bond donors | 0 | ACD/LogP | 1.40 | | Phase 25 °C | liquid/gas | Rotatable bonds | 1 | Predicted density | 1.55 g/cm3 | | SMILES | O=[N+]([O-])c1c(F)cc(F)cc1F | | STD InChIKey | PWRFDGYYJWQIAB-UHFFFAOYAT | | Melting Points | | mp °C | source | |
|---|
| 4.00 | Alfa Aesar | | 3.50 | PHYSPROP |
|
|
| | | 1,3,5-trifluorobenzene C6H3F33, 64 |
 | | Compound Data | | Melting point | -5.75 °C | 267.40 K | | CSID | 21111798 | H bond acceptors | 0 | Rule of 5 violations | 0 | | Molecular weight | 132.0832 | H bond donors | 0 | ACD/LogP | 2.49 | | Phase 25 °C | liquid/gas | Rotatable bonds | 0 | Predicted density | 1.29 g/cm3 | | SMILES | Fc1cc(F)cc(F)c1 | | STD InChIKey | JXUKFFRPLNTYIV-UHFFFAOYAT | | Melting Points | | mp °C | source | |
|---|
| -6.00 | Alfa Aesar | | -5.50 | PHYSPROP |
|
|
| | | 1,3,5-triisopropylbenzene C15H243, 64 |
 | | Compound Data | | Melting point | -7.20 °C | 265.95 K | | CSID | 12329 | H bond acceptors | 0 | Rule of 5 violations | 1 | | Molecular weight | 204.3511 | H bond donors | 0 | ACD/LogP | 6.24 | | Phase 25 °C | liquid/gas | Rotatable bonds | 3 | Predicted density | 0.85 g/cm3 | | SMILES | c1c(cc(cc1C(C)C)C(C)C)C(C)C | | STD InChIKey | VUMCUSHVMYIRMB-UHFFFAOYAA | | Melting Points | | mp °C | source | |
|---|
| -7.00 | Alfa Aesar | | -7.40 | PHYSPROP |
|
|
| | | 1,3,5-trimethoxybenzene C9H12O32, 3, 64 |
 | |
|
| | | 1,3,5-trimethylcyanuric acid C6H9N3O347, 64 |
 | | Compound Data | | Melting point | 176.18 °C | 449.32 K | | CSID | 12670 | H bond acceptors | 6 | Rule of 5 violations | 0 | | Molecular weight | 171.154 | H bond donors | 0 | ACD/LogP | -2.92 | | Phase 25 °C | solid | Rotatable bonds | 0 | Predicted density | 1.32 g/cm3 | | SMILES | O=C1N(C(=O)N(C(=O)N1C)C)C | | STD InChIKey | AHWDQDMGFXRVFB-UHFFFAOYAW | | Melting Points | | mp °C | source | |
|---|
| 175.85 | IUCr | | 176.50 | PHYSPROP |
|
|
| | | 1,3,5-trinitro-1,3,5-triazinane C3H6N6O661, 64 |
 | | Compound Data | | Melting point | 205.25 °C | 478.40 K | | CSID | 8177 | H bond acceptors | 12 | Rule of 5 violations | 1 | | Molecular weight | 222.1163 | H bond donors | 0 | ACD/LogP | 0.00 | | Phase 25 °C | solid | Rotatable bonds | 3 | Predicted density | 1.90 g/cm3 | | SMILES | C1N(CN(CN1[N+](=O)[O-])[N+](=O)[O-])[N+](=O)[O-] | | STD InChIKey | XTFIVUDBNACUBN-UHFFFAOYAY | | Melting Points | | mp °C | source | |
|---|
| 205.00 | Oxford University MSDS | | 205.50 | PHYSPROP |
|
|
| | | 1,3,5-trioxane C3H6O33, 64 |
 | | Compound Data | | Melting point | 60.60 °C | 333.75 K | | CSID | 7790 | H bond acceptors | 3 | Rule of 5 violations | 0 | | Molecular weight | 90.0779 | H bond donors | 0 | ACD/LogP | -0.62 | | Phase 25 °C | solid | Rotatable bonds | 0 | Predicted density | 1.13 g/cm3 | | SMILES | O1COCOC1 | | STD InChIKey | BGJSXRVXTHVRSN-UHFFFAOYAW | | Melting Points | | mp °C | source | |
|---|
| 61.00 | Alfa Aesar | | 60.20 | PHYSPROP |
|
|
| | | 1,4-benzenediacetonitrile C10H8N22, 3, 48 |
 | |
|
| | | 1,4-benzenedimethanol C8H10O22, 3, 64 |
 | |
|
| | | 1,4-bis(5-phenyloxazol-2-yl)benzene C24H16N2O23, 64 |
 | | Compound Data | | Melting point | 243.50 °C | 516.65 K | | CSID | 14960 | H bond acceptors | 4 | Rule of 5 violations | 1 | | Molecular weight | 364.396 | H bond donors | 0 | ACD/LogP | 6.45 | | Phase 25 °C | solid | Rotatable bonds | 4 | Predicted density | 1.20 g/cm3 | | SMILES | n1cc(oc1c4ccc(c2ncc(o2)c3ccccc3)cc4)c5ccccc5 | | STD InChIKey | MASVCBBIUQRUKL-UHFFFAOYAO | | Melting Points | | mp °C | source | |
|---|
| 242.00 | Alfa Aesar | | 245.00 | PHYSPROP |
|
|
| | | 1,4-bis(bromomethyl)benzene C8H8Br248, 64 |
 | | Compound Data | | Melting point | 143.25 °C | 416.40 K | | CSID | 21125563 | H bond acceptors | 0 | Rule of 5 violations | 0 | | Molecular weight | 263.9571 | H bond donors | 0 | ACD/LogP | 3.62 | | Phase 25 °C | solid | Rotatable bonds | 2 | Predicted density | 1.78 g/cm3 | | SMILES | BrCc1ccc(CBr)cc1 | | STD InChIKey | RBZMSGOBSOCYHR-UHFFFAOYAL | | Melting Points | | mp °C | source | |
|---|
| 142.00 | Karthikeyan M.; Glen R.C.; Bender A. General melting point p... | | 144.50 | PHYSPROP |
|
|
| | | 1,4-cyclohexadiene C6H83, 64 |
 | | Compound Data | | Melting point | -49.10 °C | 224.05 K | | CSID | 11838 | H bond acceptors | 0 | Rule of 5 violations | 0 | | Molecular weight | 80.1277 | H bond donors | 0 | ACD/LogP | 2.30 | | Phase 25 °C | liquid/gas | Rotatable bonds | 0 | Predicted density | 0.86 g/cm3 | | SMILES | C\1=C\C/C=C\C/1 | | STD InChIKey | UVJHQYIOXKWHFD-UHFFFAOYAM | | Melting Points | | mp °C | source | |
|---|
| -49.00 | Alfa Aesar | | -49.20 | PHYSPROP |
|
|
| | | 1,4-diacetoxybenzene C10H10O43, 7, 64 |
 | |
|
| | | 1,4-diacetoxybutane C8H14O43, 64 |
 | | Compound Data | | Melting point | 12.50 °C | 285.65 K | | CSID | 62618 | H bond acceptors | 4 | Rule of 5 violations | 0 | | Molecular weight | 174.1944 | H bond donors | 0 | ACD/LogP | 0.96 | | Phase 25 °C | liquid/gas | Rotatable bonds | 7 | Predicted density | 1.04 g/cm3 | | SMILES | O=C(OCCCCOC(=O)C)C | | STD InChIKey | XUKSWKGOQKREON-UHFFFAOYAS | | Melting Points | | mp °C | source | |
|---|
| 13.00 | Alfa Aesar | | 12.00 | PHYSPROP |
|
|
| | | 1,4-diaminoanthraquinone C14H10N2O23, 64 |
 | | Compound Data | | Melting point | 265.50 °C | 538.65 K | | CSID | 29150 | H bond acceptors | 4 | Rule of 5 violations | 0 | | Molecular weight | 238.2414 | H bond donors | 4 | ACD/LogP | 2.98 | | Phase 25 °C | solid | Rotatable bonds | 2 | Predicted density | 1.46 g/cm3 | | SMILES | O=C2c1ccccc1C(=O)c3c2c(ccc3N)N | | STD InChIKey | FBMQNRKSAWNXBT-UHFFFAOYAJ | | Melting Points | | mp °C | source | |
|---|
| 263.00 | Alfa Aesar | | 268.00 | PHYSPROP |
|
|
| | | 1,4-diazepane C5H12N23, 64 |
 | | Compound Data | | Melting point | 42.25 °C | 315.40 K | | CSID | 61471 | H bond acceptors | 2 | Rule of 5 violations | 0 | | Molecular weight | 100.1622 | H bond donors | 2 | ACD/LogP | -0.48 | | Phase 25 °C | solid | Rotatable bonds | 0 | Predicted density | 0.86 g/cm3 | | SMILES | N1CCCNCC1 | | STD InChIKey | FQUYSHZXSKYCSY-UHFFFAOYAL | | Melting Points | | mp °C | source | |
|---|
| 41.00 | Alfa Aesar | | 43.50 | PHYSPROP |
|
|
| | | 1,4-dibenzyloxybenzene C20H18O23, 48 |
 | | Compound Data | | Melting point | 127.50 °C | 400.65 K | | CSID | 62525 | H bond acceptors | 2 | Rule of 5 violations | 1 | | Molecular weight | 290.3557 | H bond donors | 0 | ACD/LogP | 5.41 | | Phase 25 °C | solid | Rotatable bonds | 6 | Predicted density | 1.12 g/cm3 | | SMILES | O(c2ccc(OCc1ccccc1)cc2)Cc3ccccc3 | | STD InChIKey | DYULYMCXVSRUPB-UHFFFAOYAS | | Melting Points | | mp °C | source | |
|---|
| 127.00 | Alfa Aesar | | 128.00 | Karthikeyan M.; Glen R.C.; Bender A. General melting point p... |
|
|
| | | 1,4-dibenzyloxybenzene C14H14O2S3, 64 |
 | | Compound Data | | Melting point | 151.50 °C | 424.65 K | | CSID | 62493 | H bond acceptors | 2 | Rule of 5 violations | 0 | | Molecular weight | 246.3248 | H bond donors | 0 | ACD/LogP | 2.52 | | Phase 25 °C | solid | Rotatable bonds | 4 | Predicted density | 1.21 g/cm3 | | SMILES | O=S(=O)(Cc1ccccc1)Cc2ccccc2 | | STD InChIKey | AWHNUHMUCGRKRA-UHFFFAOYAM | | Melting Points | | mp °C | source | |
|---|
| 151.00 | Alfa Aesar | | 152.00 | PHYSPROP |
|
|
| | | 1,4-dibromobenzene C6H4Br22, 3, 44, 61, 64, 70 |
 | |
|
| | | 1,4-dibromobutane C4H8Br23, 31, 61, 64 |
 | |
|
| | | 1,4-dibromonaphthalene C10H6Br23, 64 |
 | | Compound Data | | Melting point | 82.00 °C | 355.15 K | | CSID | 59892 | H bond acceptors | 0 | Rule of 5 violations | 1 | | Molecular weight | 285.9626 | H bond donors | 0 | ACD/LogP | 5.02 | | Phase 25 °C | solid | Rotatable bonds | 0 | Predicted density | 1.83 g/cm3 | | SMILES | Brc2c1ccccc1c(Br)cc2 | | STD InChIKey | IBGUDZMIAZLJNY-UHFFFAOYAE | | Melting Points | | mp °C | source | |
|---|
| 81.00 | Alfa Aesar | | 83.00 | PHYSPROP |
|
|
| | | 1,4-dichloro-2-iodobenzene C6H3Cl2I2, 3, 64 |
 | |
|
| | | 1,4-dichlorobenzene C6H4Cl23, 31, 61, 64, 70, 70, 70 |
 | |
|
| | | 1,4-dichlorobutane C4H8Cl23, 31, 61, 64 |
 | |
|
| | | 1,4-dicyanobutane C6H8N22, 3, 64 |
 | |
|
| | | 1,4-diethoxybenzene C10H14O23, 7, 64 |
 | |
|
| | | 1,4-diethylbenzene C10H143, 4, 64 |
 | |
|
| | | 1,4-difluoro-2-nitrobenzene C6H3F2NO23, 64 |
 | | Compound Data | | Melting point | -11.85 °C | 261.30 K | | CSID | 61086 | H bond acceptors | 3 | Rule of 5 violations | 0 | | Molecular weight | 159.0903 | H bond donors | 0 | ACD/LogP | 1.71 | | Phase 25 °C | liquid/gas | Rotatable bonds | 1 | Predicted density | 1.45 g/cm3 | | SMILES | O=[N+]([O-])c1cc(F)ccc1F | | STD InChIKey | XNJAYQHWXYJBBD-UHFFFAOYAS | | Melting Points | | mp °C | source | |
|---|
| -12.00 | Alfa Aesar | | -11.70 | PHYSPROP |
|
|
| | | 1,4-dihydroxyanthraquinone C14H8O43, 64 |
 | | Compound Data | | Melting point | 198.50 °C | 471.65 K | | CSID | 6433 | H bond acceptors | 4 | Rule of 5 violations | 0 | | Molecular weight | 240.2109 | H bond donors | 2 | ACD/LogP | 4.46 | | Phase 25 °C | solid | Rotatable bonds | 2 | Predicted density | 1.54 g/cm3 | | SMILES | O=C2c1ccccc1C(=O)c3c2c(O)ccc3O | | STD InChIKey | GUEIZVNYDFNHJU-UHFFFAOYAX | | Melting Points | | mp °C | source | |
|---|
| 197.00 | Alfa Aesar | | 200.00 | PHYSPROP |
|
|
| | | 1,4-diiodobenzene C6H4I22, 3, 64 |
 | |
|
| | | 1,4-diiodobutane C4H8I23, 64 |
 | | Compound Data | | Melting point | 5.90 °C | 279.05 K | | CSID | 11832 | H bond acceptors | 0 | Rule of 5 violations | 0 | | Molecular weight | 309.9153 | H bond donors | 0 | ACD/LogP | 3.44 | | Phase 25 °C | liquid/gas | Rotatable bonds | 3 | Predicted density | 2.34 g/cm3 | | SMILES | ICCCCI | | STD InChIKey | ROUYUBHVBIKMQO-UHFFFAOYAC | | Melting Points | | mp °C | source | |
|---|
| 6.00 | Alfa Aesar | | 5.80 | PHYSPROP |
|
|
| | | 1,4-diisocyanatobenzene C8H4N2O261, 64 |
 | | Compound Data | | Melting point | 95.75 °C | 368.90 K | | CSID | 54970 | H bond acceptors | 4 | Rule of 5 violations | 0 | | Molecular weight | 160.1296 | H bond donors | 0 | ACD/LogP | 2.85 | | Phase 25 °C | solid | Rotatable bonds | 2 | Predicted density | 1.17 g/cm3 | | SMILES | O=C=N/c1ccc(/N=C=O)cc1 | | STD InChIKey | ALQLPWJFHRMHIU-UHFFFAOYAR | | Melting Points | | mp °C | source | |
|---|
| 94.00 | Oxford University MSDS | | 97.50 | PHYSPROP |
|
|
| | | 1,4-dimethoxy-2-nitrobenzene C8H9NO47, 64 |
 | | Compound Data | | Melting point | 71.75 °C | 344.90 K | | CSID | 60006 | H bond acceptors | 5 | Rule of 5 violations | 0 | | Molecular weight | 183.1614 | H bond donors | 0 | ACD/LogP | 2.00 | | Phase 25 °C | solid | Rotatable bonds | 3 | Predicted density | 1.23 g/cm3 | | SMILES | [O-][N+](=O)c1cc(OC)ccc1OC | | STD InChIKey | UPTOWXNJLZJTGD-UHFFFAOYAH | | Melting Points | | mp °C | source | |
|---|
| 71.00 | Beilstein F. K.; Beilsteins Handbuch der Organischen Chemie.... | | 72.50 | PHYSPROP |
|
|
| | | 1,4-dimethoxybenzene C8H10O22, 3, 61, 64 |
 | |
|
| | | 1,4-dimethylbenzene C8H103, 4, 64 |
 | |
|
| | | 1,4-dinitrobenzene C6H4N2O42, 3, 64 |
 | |
|
| | | 1,4-dioxane C4H8O23, 61, 64 |
 | | Compound Data | | Melting point | 11.87 °C | 285.02 K | | CSID | 29015 | H bond acceptors | 2 | Rule of 5 violations | 0 | | Molecular weight | 88.1051 | H bond donors | 0 | ACD/LogP | -0.27 | | Phase 25 °C | liquid/gas | Rotatable bonds | 0 | Predicted density | 0.99 g/cm3 | | SMILES | O1CCOCC1 | | STD InChIKey | RYHBNJHYFVUHQT-UHFFFAOYAN | | Melting Points | | mp °C | source | |
|---|
| 12.00 | Alfa Aesar | | 11.80 | Oxford University MSDS | | 11.80 | PHYSPROP |
|
|
| | | 1,4-dithiane C4H8S261, 64 |
 | | Compound Data | | Melting point | 111.65 °C | 384.80 K | | CSID | 10020 | H bond acceptors | 0 | Rule of 5 violations | 0 | | Molecular weight | 120.2363 | H bond donors | 0 | ACD/LogP | 1.12 | | Phase 25 °C | solid | Rotatable bonds | 0 | Predicted density | 1.14 g/cm3 | | SMILES | S1CCSCC1 | | STD InChIKey | LOZWAPSEEHRYPG-UHFFFAOYAR | | Melting Points | | mp °C | source | |
|---|
| 111.00 | Oxford University MSDS | | 112.30 | PHYSPROP |
|
|
| | | 1,4-pentadiene C5H84, 61, 64 |
 | |
|
| | | 1,4-phenylene diisothiocyanate C8H4N2S23, 64 |
 | | Compound Data | | Melting point | 131.50 °C | 404.65 K | | CSID | 18799 | H bond acceptors | 2 | Rule of 5 violations | 0 | | Molecular weight | 192.2608 | H bond donors | 0 | ACD/LogP | 4.16 | | Phase 25 °C | solid | Rotatable bonds | 2 | Predicted density | 1.20 g/cm3 | | SMILES | S=C=N/c1ccc(/N=C=S)cc1 | | STD InChIKey | OMWQUXGVXQELIX-UHFFFAOYAS | | Melting Points | | mp °C | source | |
|---|
| 131.00 | Alfa Aesar | | 132.00 | PHYSPROP |
|
|
| | | 1,4-piperazinedipropanamine C10H24N43, 64 |
 | | Compound Data | | Melting point | 14.50 °C | 287.65 K | | CSID | 73658 | H bond acceptors | 4 | Rule of 5 violations | 0 | | Molecular weight | 200.3244 | H bond donors | 4 | ACD/LogP | -1.43 | | Phase 25 °C | liquid/gas | Rotatable bonds | 8 | Predicted density | 0.98 g/cm3 | | SMILES | N1(CCN(CCCN)CC1)CCCN | | STD InChIKey | XUSNPFGLKGCWGN-UHFFFAOYAN | | Melting Points | | mp °C | source | |
|---|
| 14.00 | Alfa Aesar | | 15.00 | PHYSPROP |
|
|
| | | 1,5-dichloropentane C5H10Cl23, 31, 64 |
 | |
|
| | | 1,5-difluoro-2,4-dinitrobenzene C6H2F2N2O43, 64 |
 | | Compound Data | | Melting point | 73.50 °C | 346.65 K | | CSID | 60919 | H bond acceptors | 6 | Rule of 5 violations | 0 | | Molecular weight | 204.0879 | H bond donors | 0 | ACD/LogP | 0.74 | | Phase 25 °C | solid | Rotatable bonds | 2 | Predicted density | 1.68 g/cm3 | | SMILES | O=[N+]([O-])c1cc(c(F)cc1F)[N+]([O-])=O | | STD InChIKey | VILFTWLXLYIEMV-UHFFFAOYAH | | Melting Points | | mp °C | source | |
|---|
| 74.00 | Alfa Aesar | | 73.00 | PHYSPROP |
|
|
| | | 1,5-dimethylnaphthalene C12H123, 64 |
 | | Compound Data | | Melting point | 81.00 °C | 354.15 K | | CSID | 10831 | H bond acceptors | 0 | Rule of 5 violations | 0 | | Molecular weight | 156.2237 | H bond donors | 0 | ACD/LogP | 4.37 | | Phase 25 °C | solid | Rotatable bonds | 0 | Predicted density | 1.00 g/cm3 | | SMILES | c1ccc(c2cccc(c12)C)C | | STD InChIKey | SDDBCEWUYXVGCQ-UHFFFAOYAA | | Melting Points | | mp °C | source | |
|---|
| 80.00 | Alfa Aesar | | 82.00 | PHYSPROP |
|
|
| | | 1,5-dinitronaphthalene C10H6N2O43, 64 |
 | | Compound Data | | Melting point | 217.50 °C | 490.65 K | | CSID | 11310 | H bond acceptors | 6 | Rule of 5 violations | 0 | | Molecular weight | 218.1656 | H bond donors | 0 | ACD/LogP | 2.58 | | Phase 25 °C | solid | Rotatable bonds | 2 | Predicted density | 1.48 g/cm3 | | SMILES | [O-][N+](=O)c1cccc2c1cccc2[N+]([O-])=O | | STD InChIKey | ZUTCJXFCHHDFJS-UHFFFAOYAT | | Melting Points | | mp °C | source | |
|---|
| 216.00 | Alfa Aesar | | 219.00 | PHYSPROP |
|
|
| | | 1,5-diphenylcarbazide C13H14N4O61, 64 |
 | | Compound Data | | Melting point | 171.50 °C | 444.65 K | | CSID | 8459 | H bond acceptors | 5 | Rule of 5 violations | 0 | | Molecular weight | 242.2765 | H bond donors | 4 | ACD/LogP | 2.24 | | Phase 25 °C | solid | Rotatable bonds | 4 | Predicted density | 1.29 g/cm3 | | SMILES | O=C(NNc1ccccc1)NNc2ccccc2 | | STD InChIKey | KSPIHGBHKVISFI-UHFFFAOYAZ | | Melting Points | | mp °C | source | |
|---|
| 173.00 | Oxford University MSDS | | 170.00 | PHYSPROP |
|
|
| | | 1,5-hexadiene C6H103, 4, 64 |
 | |
|
| | | 1,5-pentanediol C5H12O23, 64 |
 | | Compound Data | | Melting point | -17.00 °C | 256.15 K | | CSID | 13839441 | H bond acceptors | 2 | Rule of 5 violations | 0 | | Molecular weight | 104.1476 | H bond donors | 2 | ACD/LogP | 0.00 | | Phase 25 °C | liquid/gas | Rotatable bonds | 6 | Predicted density | 0.98 g/cm3 | | SMILES | C(CCO)CCO | | STD InChIKey | ALQSHHUCVQOPAS-UHFFFAOYAE | | Melting Points | | mp °C | source | |
|---|
| -16.00 | Alfa Aesar | | -18.00 | PHYSPROP |
|
|
| | | 1,6-dibromohexane C6H12Br23, 61, 64 |
 | | Compound Data | | Melting point | -0.77 °C | 272.38 K | | CSID | 11862 | H bond acceptors | 0 | Rule of 5 violations | 0 | | Molecular weight | 243.9675 | H bond donors | 0 | ACD/LogP | 3.67 | | Phase 25 °C | liquid/gas | Rotatable bonds | 5 | Predicted density | 1.58 g/cm3 | | SMILES | BrCCCCCCBr | | STD InChIKey | SGRHVVLXEBNBDV-UHFFFAOYAK | | Melting Points | | mp °C | source | |
|---|
| -2.00 | Alfa Aesar | | 2.00 | Oxford University MSDS | | -2.30 | PHYSPROP |
|
|
| | | 1,6-dicyanohexane C8H12N22, 3, 64 |
 | |
|
| | | 1,6-hexanediamine C6H16N23, 61, 64 |
 | | Compound Data | | Melting point | 40.50 °C | 313.65 K | | CSID | 13835579 | H bond acceptors | 2 | Rule of 5 violations | 0 | | Molecular weight | 116.2046 | H bond donors | 4 | ACD/LogP | 0.04 | | Phase 25 °C | solid | Rotatable bonds | 7 | Predicted density | 0.86 g/cm3 | | SMILES | NCCCCCCN | | STD InChIKey | NAQMVNRVTILPCV-UHFFFAOYAS | | Melting Points | | mp °C | source | |
|---|
| 41.00 | Alfa Aesar | | 39.00 | Oxford University MSDS | | 41.50 | PHYSPROP |
|
|
| | | 1,6-hexanediol C6H14O22, 3, 32, 64 |
 | |
|
| | | 1,7-heptanediol C7H16O23, 64 |
 | | Compound Data | | Melting point | 20.25 °C | 293.40 K | | CSID | 11875 | H bond acceptors | 2 | Rule of 5 violations | 0 | | Molecular weight | 132.2007 | H bond donors | 2 | ACD/LogP | 0.46 | | Phase 25 °C | liquid/gas | Rotatable bonds | 8 | Predicted density | 0.95 g/cm3 | | SMILES | OCCCCCCCO | | STD InChIKey | SXCBDZAEHILGLM-UHFFFAOYAS | | Melting Points | | mp °C | source | |
|---|
| 18.00 | Alfa Aesar | | 22.50 | PHYSPROP |
|
|
| | | 1,7-naphthalenediol C10H8O23, 64 |
 | | Compound Data | | Melting point | 181.25 °C | 454.40 K | | CSID | 61739 | H bond acceptors | 2 | Rule of 5 violations | 0 | | Molecular weight | 160.1693 | H bond donors | 2 | ACD/LogP | 1.94 | | Phase 25 °C | solid | Rotatable bonds | 2 | Predicted density | 1.33 g/cm3 | | SMILES | Oc1c2c(ccc1)ccc(O)c2 | | STD InChIKey | ZUVBIBLYOCVYJU-UHFFFAOYAO | | Melting Points | | mp °C | source | |
|---|
| 182.00 | Alfa Aesar | | 180.50 | PHYSPROP |
|
|
| | | 1,8-cineole C10H18O3, 64 |
 | | Compound Data | | Melting point | 1.25 °C | 274.40 K | | CSID | 2656 | H bond acceptors | 1 | Rule of 5 violations | 0 | | Molecular weight | 154.2493 | H bond donors | 0 | ACD/LogP | 2.82 | | Phase 25 °C | liquid/gas | Rotatable bonds | 0 | Predicted density | 0.92 g/cm3 | | SMILES | O2C1(CCC(CC1)C2(C)C)C | | STD InChIKey | WEEGYLXZBRQIMU-UHFFFAOYAY | | Melting Points | | mp °C | source | |
|---|
| 1.00 | Alfa Aesar | | 1.50 | PHYSPROP |
|
|
| | | 1,8-diaminonaphthalene C10H10N23, 64 |
 | | Compound Data | | Melting point | 64.75 °C | 337.90 K | | CSID | 61381 | H bond acceptors | 2 | Rule of 5 violations | 0 | | Molecular weight | 158.1998 | H bond donors | 4 | ACD/LogP | 0.89 | | Phase 25 °C | solid | Rotatable bonds | 2 | Predicted density | 1.23 g/cm3 | | SMILES | c1(cccc2cccc(N)c12)N | | STD InChIKey | YFOOEYJGMMJJLS-UHFFFAOYAU | | Melting Points | | mp °C | source | |
|---|
| 63.00 | Alfa Aesar | | 66.50 | PHYSPROP |
|
|
| | | 1,8-dibromooctane C8H16Br23, 61, 64 |
 | | Compound Data | | Melting point | 15.67 °C | 288.82 K | | CSID | 70682 | H bond acceptors | 0 | Rule of 5 violations | 0 | | Molecular weight | 272.0206 | H bond donors | 0 | ACD/LogP | 4.73 | | Phase 25 °C | liquid/gas | Rotatable bonds | 7 | Predicted density | 1.46 g/cm3 | | SMILES | BrCCCCCCCCBr | | STD InChIKey | DKEGCUDAFWNSSO-UHFFFAOYAR | | Melting Points | | mp °C | source | |
|---|
| 16.00 | Alfa Aesar | | 15.50 | Oxford University MSDS | | 15.50 | PHYSPROP |
|
|
| | | 1,8-dinitronaphthalene C10H6N2O461, 64 |
 | | Compound Data | | Melting point | 172.25 °C | 445.40 K | | CSID | 11271 | H bond acceptors | 6 | Rule of 5 violations | 0 | | Molecular weight | 218.1656 | H bond donors | 0 | ACD/LogP | 2.52 | | Phase 25 °C | solid | Rotatable bonds | 2 | Predicted density | 1.48 g/cm3 | | SMILES | [O-][N+](=O)c1cccc2cccc([N+]([O-])=O)c12 | | STD InChIKey | AVCSMMMOCOTIHF-UHFFFAOYAR | | Melting Points | | mp °C | source | |
|---|
| 171.50 | Oxford University MSDS | | 173.00 | PHYSPROP |
|
|
| | | 1,8-octanediol C8H18O23, 64 |
 | | Compound Data | | Melting point | 61.50 °C | 334.65 K | | CSID | 62628 | H bond acceptors | 2 | Rule of 5 violations | 0 | | Molecular weight | 146.2273 | H bond donors | 2 | ACD/LogP | 0.99 | | Phase 25 °C | solid | Rotatable bonds | 9 | Predicted density | 0.94 g/cm3 | | SMILES | OCCCCCCCCO | | STD InChIKey | OEIJHBUUFURJLI-UHFFFAOYAW | | Melting Points | | mp °C | source | |
|---|
| 60.00 | Alfa Aesar | | 63.00 | PHYSPROP |
|
|
| | | 1,9-nonanediol C9H20O23, 64 |
 | | Compound Data | | Melting point | 46.40 °C | 319.55 K | | CSID | 18685 | H bond acceptors | 2 | Rule of 5 violations | 0 | | Molecular weight | 160.2539 | H bond donors | 2 | ACD/LogP | 1.53 | | Phase 25 °C | solid | Rotatable bonds | 10 | Predicted density | 0.93 g/cm3 | | SMILES | OCCCCCCCCCO | | STD InChIKey | ALVZNPYWJMLXKV-UHFFFAOYAQ | | Melting Points | | mp °C | source | |
|---|
| 47.00 | Alfa Aesar | | 45.80 | PHYSPROP |
|
|
| | | 10-undecen-1-ol C11H22O3, 64 |
 | | Compound Data | | Melting point | -2.50 °C | 270.65 K | | CSID | 7893 | H bond acceptors | 1 | Rule of 5 violations | 0 | | Molecular weight | 170.2918 | H bond donors | 1 | ACD/LogP | 4.00 | | Phase 25 °C | liquid/gas | Rotatable bonds | 10 | Predicted density | 0.84 g/cm3 | | SMILES | C=CCCCCCCCCCO | | STD InChIKey | GIEMHYCMBGELGY-UHFFFAOYAA | | Melting Points | | mp °C | source | |
|---|
| -3.00 | Alfa Aesar | | -2.00 | PHYSPROP |
|
|
| | | 10-undecenoic acid C11H20O23, 64 |
 | | Compound Data | | Melting point | 24.25 °C | 297.40 K | | CSID | 10771160 | H bond acceptors | 2 | Rule of 5 violations | 0 | | Molecular weight | 184.2753 | H bond donors | 1 | ACD/LogP | 3.85 | | Phase 25 °C | liquid/gas | Rotatable bonds | 9 | Predicted density | 0.92 g/cm3 | | SMILES | C=CCCCCCCCCC(=O)O | | STD InChIKey | FRPZMMHWLSIFAZ-UHFFFAOYAJ | | Melting Points | | mp °C | source | |
|---|
| 24.00 | Alfa Aesar | | 24.50 | PHYSPROP |
|
|
| | | 12-tricosanone C23H46O3, 64 |
 | | Compound Data | | Melting point | 68.60 °C | 341.75 K | | CSID | 10426 | H bond acceptors | 1 | Rule of 5 violations | 1 | | Molecular weight | 338.6107 | H bond donors | 0 | ACD/LogP | 10.47 | | Phase 25 °C | solid | Rotatable bonds | 20 | Predicted density | 0.83 g/cm3 | | SMILES | O=C(CCCCCCCCCCC)CCCCCCCCCCC | | STD InChIKey | VARQGBHBYZTYLJ-UHFFFAOYAG | | Melting Points | | mp °C | source | |
|---|
| 67.00 | Alfa Aesar | | 70.20 | PHYSPROP |
|
|
| | | 14-heptacosanone C27H54O3, 64 |
 | | Compound Data | | Melting point | 77.75 °C | 350.90 K | | CSID | 10490 | H bond acceptors | 1 | Rule of 5 violations | 1 | | Molecular weight | 394.7171 | H bond donors | 0 | ACD/LogP | 12.60 | | Phase 25 °C | solid | Rotatable bonds | 24 | Predicted density | 0.84 g/cm3 | | SMILES | O=C(CCCCCCCCCCCCC)CCCCCCCCCCCCC | | STD InChIKey | VCZMOZVQLARCOE-UHFFFAOYAR | | Melting Points | | mp °C | source | |
|---|
| 78.00 | Alfa Aesar | | 77.50 | PHYSPROP |
|
|
| | | 16-hydroxyhexadecanoic acid C16H32O33, 64 |
 | | Compound Data | | Melting point | 98.50 °C | 371.65 K | | CSID | 10034 | H bond acceptors | 3 | Rule of 5 violations | 1 | | Molecular weight | 272.4235 | H bond donors | 2 | ACD/LogP | 5.15 | | Phase 25 °C | solid | Rotatable bonds | 16 | Predicted density | 0.96 g/cm3 | | SMILES | O=C(O)CCCCCCCCCCCCCCCO | | STD InChIKey | UGAGPNKCDRTDHP-UHFFFAOYAB | | Melting Points | | mp °C | source | |
|---|
| 99.00 | Alfa Aesar | | 98.00 | PHYSPROP |
|
|
| | | 2-(2-hydroxyethyl)pyridine C7H9NO3, 64 |
 | | Compound Data | | Melting point | -7.90 °C | 265.25 K | | CSID | 7392 | H bond acceptors | 2 | Rule of 5 violations | 0 | | Molecular weight | 123.1525 | H bond donors | 1 | ACD/LogP | -0.13 | | Phase 25 °C | liquid/gas | Rotatable bonds | 3 | Predicted density | 1.09 g/cm3 | | SMILES | OCCc1ncccc1 | | STD InChIKey | BXGYBSJAZFGIPX-UHFFFAOYAP | | Melting Points | | mp °C | source | |
|---|
| -8.00 | Alfa Aesar | | -7.80 | PHYSPROP |
|
|
| | | 2-(2-hydroxyphenyl)benzothiazole C13H9NOS3, 64 |
 | | Compound Data | | Melting point | 131.50 °C | 404.65 K | | CSID | 10181821 | H bond acceptors | 2 | Rule of 5 violations | 0 | | Molecular weight | 227.2817 | H bond donors | 1 | ACD/LogP | 4.53 | | Phase 25 °C | solid | Rotatable bonds | 2 | Predicted density | 1.34 g/cm3 | | SMILES | Oc3ccccc3c1nc2ccccc2s1 | | STD InChIKey | MVVGSPCXHRFDDR-UHFFFAOYAD | | Melting Points | | mp °C | source | |
|---|
| 132.00 | Alfa Aesar | | 131.00 | PHYSPROP |
|
|
| | | 2-(2-naphthoxy)ethanol C12H12O23, 64 |
 | | Compound Data | | Melting point | 75.35 °C | 348.50 K | | CSID | 6864 | H bond acceptors | 2 | Rule of 5 violations | 0 | | Molecular weight | 188.2225 | H bond donors | 1 | ACD/LogP | 2.39 | | Phase 25 °C | solid | Rotatable bonds | 4 | Predicted density | 1.16 g/cm3 | | SMILES | OCCOc2ccc1c(cccc1)c2 | | STD InChIKey | BQPBZDSDFCDSAO-UHFFFAOYAT | | Melting Points | | mp °C | source | |
|---|
| 74.00 | Alfa Aesar | | 76.70 | PHYSPROP |
|
|
| | | 2-(bromomethyl)naphthalene C11H9Br3, 64 |
 | | Compound Data | | Melting point | 54.50 °C | 327.65 K | | CSID | 63503 | H bond acceptors | 0 | Rule of 5 violations | 0 | | Molecular weight | 221.0932 | H bond donors | 0 | ACD/LogP | 4.15 | | Phase 25 °C | solid | Rotatable bonds | 1 | Predicted density | 1.44 g/cm3 | | SMILES | BrCc2ccc1c(cccc1)c2 | | STD InChIKey | RUHJZSZTSCSTCC-UHFFFAOYAS | | Melting Points | | mp °C | source | |
|---|
| 53.00 | Alfa Aesar | | 56.00 | PHYSPROP |
|
|
| | | 2-(hexyloxy)ethanol C8H18O23, 64 |
 | | Compound Data | | Melting point | -43.55 °C | 229.60 K | | CSID | 7878 | H bond acceptors | 2 | Rule of 5 violations | 0 | | Molecular weight | 146.2273 | H bond donors | 1 | ACD/LogP | 1.86 | | Phase 25 °C | liquid/gas | Rotatable bonds | 8 | Predicted density | 0.89 g/cm3 | | SMILES | OCCOCCCCCC | | STD InChIKey | UPGSWASWQBLSKZ-UHFFFAOYAH | | Melting Points | | mp °C | source | |
|---|
| -42.00 | Alfa Aesar | | -45.10 | PHYSPROP |
|
|
| | | 2-(methylamino)ethanol C3H9NO3, 61, 64 |
 | | Compound Data | | Melting point | -4.67 °C | 268.48 K | | CSID | 13836021 | H bond acceptors | 2 | Rule of 5 violations | 0 | | Molecular weight | 75.1097 | H bond donors | 2 | ACD/LogP | 0.00 | | Phase 25 °C | liquid/gas | Rotatable bonds | 3 | Predicted density | 0.89 g/cm3 | | SMILES | CNCCO | | STD InChIKey | OPKOKAMJFNKNAS-UHFFFAOYAK | | Melting Points | | mp °C | source | |
|---|
| -5.00 | Alfa Aesar | | -4.50 | Oxford University MSDS | | -4.50 | PHYSPROP |
|
|
| | | 2-(trifluoromethyl)acrylic acid C4H3F3O23, 64 |
 | | Compound Data | | Melting point | 50.75 °C | 323.90 K | | CSID | 510851 | H bond acceptors | 2 | Rule of 5 violations | 0 | | Molecular weight | 140.0606 | H bond donors | 1 | ACD/LogP | 2.14 | | Phase 25 °C | solid | Rotatable bonds | 1 | Predicted density | 1.39 g/cm3 | | SMILES | FC(F)(F)C(=C)\C(=O)O | | STD InChIKey | VLSRKCIBHNJFHA-UHFFFAOYAY | | Melting Points | | mp °C | source | |
|---|
| 50.00 | Alfa Aesar | | 51.50 | PHYSPROP |
|
|
| | | 2-(trifluoromethyl)aniline C7H6F3N3, 38, 64, 72 |
 | | Compound Data | | Melting point | -31.00 °C | 242.15 K | | CSID | 6656 | H bond acceptors | 1 | Rule of 5 violations | 0 | | Molecular weight | 161.1244 | H bond donors | 2 | ACD/LogP | 2.41 | | Phase 25 °C | liquid/gas | Rotatable bonds | 1 | Predicted density | 1.29 g/cm3 | | SMILES | FC(F)(F)c1ccccc1N | | STD InChIKey | VBLXCTYLWZJBKA-UHFFFAOYAE | | Melting Points | | mp °C | source | |
|---|
| -34.00 | Alfa Aesar | | -30.00 | Fluoryx | | -29.00 | Sigma-Aldrich | | Values not used in calculating the average melting point | | 35.50 | PHYSPROP1 | | 1. out of range and index of refraction reported at 20C JCB |
|
|
| | | 2-(trifluoromethyl)benzoic acid C8H5F3O23, 64 |
 | | Compound Data | | Melting point | 110.00 °C | 383.15 K | | CSID | 9515 | H bond acceptors | 2 | Rule of 5 violations | 0 | | Molecular weight | 190.1193 | H bond donors | 1 | ACD/LogP | 2.87 | | Phase 25 °C | solid | Rotatable bonds | 1 | Predicted density | 1.40 g/cm3 | | SMILES | FC(F)(F)c1ccccc1C(=O)O | | STD InChIKey | FBRJYBGLCHWYOE-UHFFFAOYAQ | | Melting Points | | mp °C | source | |
|---|
| 109.00 | Alfa Aesar | | 111.00 | PHYSPROP |
|
|
| | | 2-(trifluoromethyl)benzophenone C14H9F3O3, 64 |
 | | Compound Data | | Melting point | 60.50 °C | 333.65 K | | CSID | 62963 | H bond acceptors | 1 | Rule of 5 violations | 0 | | Molecular weight | 250.2159 | H bond donors | 0 | ACD/LogP | 4.15 | | Phase 25 °C | solid | Rotatable bonds | 2 | Predicted density | 1.24 g/cm3 | | SMILES | FC(F)(F)c2ccccc2C(=O)c1ccccc1 | | STD InChIKey | JXIWJBWMQXDALU-UHFFFAOYAU | | Melting Points | | mp °C | source | |
|---|
| 60.00 | Alfa Aesar | | 61.00 | PHYSPROP |
|
|
| | | 2-(trifluoromethyl)phenol C7H5F3O3, 61, 64 |
 | | Compound Data | | Melting point | 45.67 °C | 318.82 K | | CSID | 61273 | H bond acceptors | 1 | Rule of 5 violations | 0 | | Molecular weight | 162.1092 | H bond donors | 1 | ACD/LogP | 2.67 | | Phase 25 °C | solid | Rotatable bonds | 1 | Predicted density | 1.33 g/cm3 | | SMILES | FC(F)(F)c1ccccc1O | | STD InChIKey | ZOQOPXVJANRGJZ-UHFFFAOYAM | | Melting Points | | mp °C | source | |
|---|
| 46.00 | Alfa Aesar | | 45.50 | Oxford University MSDS | | 45.50 | PHYSPROP |
|
|
| | | 2-(trifluoromethyl)phenylacetonitrile C9H6F3N3, 64 |
 | | Compound Data | | Melting point | 31.50 °C | 304.65 K | | CSID | 68907 | H bond acceptors | 1 | Rule of 5 violations | 0 | | Molecular weight | 185.1458 | H bond donors | 0 | ACD/LogP | 2.02 | | Phase 25 °C | solid | Rotatable bonds | 1 | Predicted density | 1.24 g/cm3 | | SMILES | FC(F)(F)c1ccccc1CC#N | | STD InChIKey | QXDCZSJGEUSERL-UHFFFAOYAD | | Melting Points | | mp °C | source | |
|---|
| 30.00 | Alfa Aesar | | 33.00 | PHYSPROP |
|
|
| | | 2-acetamidobenzoic acid C9H9NO32, 3, 64 |
 | |
|
| | | 2-acetyl-1-naphthol C12H10O23, 64 |
 | | Compound Data | | Melting point | 100.00 °C | 373.15 K | | CSID | 62933 | H bond acceptors | 2 | Rule of 5 violations | 0 | | Molecular weight | 186.2066 | H bond donors | 1 | ACD/LogP | 3.19 | | Phase 25 °C | solid | Rotatable bonds | 2 | Predicted density | 1.21 g/cm3 | | SMILES | O=C(c2ccc1ccccc1c2O)C | | STD InChIKey | JBGJVMVWYWUVOW-UHFFFAOYAT | | Melting Points | | mp °C | source | |
|---|
| 99.00 | Alfa Aesar | | 101.00 | PHYSPROP |
|
|
| | | 2-acetyl-5-bromothiophene C6H5BrOS3, 64 |
 | | Compound Data | | Melting point | 94.75 °C | 367.90 K | | CSID | 71655 | H bond acceptors | 1 | Rule of 5 violations | 0 | | Molecular weight | 205.0723 | H bond donors | 0 | ACD/LogP | 2.25 | | Phase 25 °C | solid | Rotatable bonds | 1 | Predicted density | 1.62 g/cm3 | | SMILES | O=C(c1sc(Br)cc1)C | | STD InChIKey | IGBZCOWXSCWSHO-UHFFFAOYAH | | Melting Points | | mp °C | source | |
|---|
| 95.00 | Alfa Aesar | | 94.50 | PHYSPROP |
|
|
| | | 2-acetyl-5-methoxy-phenol C9H10O33, 64 |
 | | Compound Data | | Melting point | 50.75 °C | 323.90 K | | CSID | 10621 | H bond acceptors | 3 | Rule of 5 violations | 0 | | Molecular weight | 166.1739 | H bond donors | 1 | ACD/LogP | 2.16 | | Phase 25 °C | solid | Rotatable bonds | 3 | Predicted density | 1.16 g/cm3 | | SMILES | O=C(c1ccc(OC)cc1O)C | | STD InChIKey | UILPJVPSNHJFIK-UHFFFAOYAG | | Melting Points | | mp °C | source | |
|---|
| 49.00 | Alfa Aesar | | 52.50 | PHYSPROP |
|
|
| | | 2-acetyl-5-methylthiophene C7H8OS3, 64 |
 | | Compound Data | | Melting point | 26.75 °C | 299.90 K | | CSID | 75479 | H bond acceptors | 1 | Rule of 5 violations | 0 | | Molecular weight | 140.2028 | H bond donors | 0 | ACD/LogP | 1.71 | | Phase 25 °C | solid | Rotatable bonds | 1 | Predicted density | 1.11 g/cm3 | | SMILES | O=C(c1sc(cc1)C)C | | STD InChIKey | YOSDTJYMDAEEAZ-UHFFFAOYAY | | Melting Points | | mp °C | source | |
|---|
| 26.00 | Alfa Aesar | | 27.50 | PHYSPROP |
|
|
| | | 2-acetylbenzo[b]furan C10H8O23, 64 |
 | | Compound Data | | Melting point | 73.50 °C | 346.65 K | | CSID | 14690 | H bond acceptors | 2 | Rule of 5 violations | 0 | | Molecular weight | 160.1693 | H bond donors | 0 | ACD/LogP | 2.12 | | Phase 25 °C | solid | Rotatable bonds | 1 | Predicted density | 1.16 g/cm3 | | SMILES | O=C(c2oc1ccccc1c2)C | | STD InChIKey | YUTFQTAITWWGFH-UHFFFAOYAN | | Melting Points | | mp °C | source | |
|---|
| 71.00 | Alfa Aesar | | 76.00 | PHYSPROP |
|
|
| | | 2-acetylbenzoic acid C9H8O32, 3, 64 |
 | |
|
| | | 2-acetylfuran C6H6O23, 61, 64 |
 | | Compound Data | | Melting point | 30.50 °C | 303.65 K | | CSID | 13849 | H bond acceptors | 2 | Rule of 5 violations | 0 | | Molecular weight | 110.1106 | H bond donors | 0 | ACD/LogP | 0.52 | | Phase 25 °C | solid | Rotatable bonds | 1 | Predicted density | 1.06 g/cm3 | | SMILES | O=C(c1occc1)C | | STD InChIKey | IEMMBWWQXVXBEU-UHFFFAOYAG | | Melting Points | | mp °C | source | |
|---|
| 29.00 | Alfa Aesar | | 29.50 | Oxford University MSDS | | 33.00 | PHYSPROP |
|
|
| | | 2-acetylnaphthalene C12H10O2, 3, 48, 64 |
 | |
|
| | | 2-acetylthiophene C6H6OS3, 64 |
 | | Compound Data | | Melting point | 10.25 °C | 283.40 K | | CSID | 6654 | H bond acceptors | 1 | Rule of 5 violations | 0 | | Molecular weight | 126.1762 | H bond donors | 0 | ACD/LogP | 1.25 | | Phase 25 °C | liquid/gas | Rotatable bonds | 1 | Predicted density | 1.14 g/cm3 | | SMILES | O=C(c1sccc1)C | | STD InChIKey | WYJOVVXUZNRJQY-UHFFFAOYAB | | Melting Points | | mp °C | source | |
|---|
| 10.00 | Alfa Aesar | | 10.50 | PHYSPROP |
|
|
| | | 2-amino-2-methyl-1-propanol C4H11NO3, 61, 64 |
 | | Compound Data | | Melting point | 27.17 °C | 300.32 K | | CSID | 13835861 | H bond acceptors | 2 | Rule of 5 violations | 0 | | Molecular weight | 89.1362 | H bond donors | 3 | ACD/LogP | 0.00 | | Phase 25 °C | solid | Rotatable bonds | 3 | Predicted density | 0.93 g/cm3 | | SMILES | CC(C)(N)CO | | STD InChIKey | CBTVGIZVANVGBH-UHFFFAOYAK | | Melting Points | | mp °C | source | |
|---|
| 26.00 | Alfa Aesar | | 30.00 | Oxford University MSDS | | 25.50 | PHYSPROP |
|
|
| | | 2-amino-2-methyl-1,3-propanediol C4H11NO261, 64 |
 | | Compound Data | | Melting point | 110.50 °C | 383.65 K | | CSID | 1477 | H bond acceptors | 3 | Rule of 5 violations | 0 | | Molecular weight | 105.1356 | H bond donors | 4 | ACD/LogP | -1.17 | | Phase 25 °C | solid | Rotatable bonds | 5 | Predicted density | 1.13 g/cm3 | | SMILES | OCC(N)(C)CO | | STD InChIKey | UXFQFBNBSPQBJW-UHFFFAOYAW | | Melting Points | | mp °C | source | |
|---|
| 111.00 | Oxford University MSDS | | 110.00 | PHYSPROP |
|
|
| | | 2-amino-3-methylpyridine C6H8N23, 64 |
 | | Compound Data | | Melting point | 32.25 °C | 305.40 K | | CSID | 14608 | H bond acceptors | 2 | Rule of 5 violations | 0 | | Molecular weight | 108.1411 | H bond donors | 2 | ACD/LogP | 1.08 | | Phase 25 °C | solid | Rotatable bonds | 0 | Predicted density | 1.07 g/cm3 | | SMILES | n1cccc(c1N)C | | STD InChIKey | RGDQRXPEZUNWHX-UHFFFAOYAS | | Melting Points | | mp °C | source | |
|---|
| 31.00 | Alfa Aesar | | 33.50 | PHYSPROP |
|
|
| | | 2-amino-3,6-dichlorobenzoic acid C7H5Cl2NO23, 64 |
 | | Compound Data | | Melting point | 153.50 °C | 426.65 K | | CSID | 525531 | H bond acceptors | 3 | Rule of 5 violations | 0 | | Molecular weight | 206.0261 | H bond donors | 3 | ACD/LogP | 2.95 | | Phase 25 °C | solid | Rotatable bonds | 2 | Predicted density | 1.61 g/cm3 | | SMILES | Clc1ccc(Cl)c(C(=O)O)c1N | | STD InChIKey | MMIREQFMYZQWLU-UHFFFAOYAF | | Melting Points | | mp °C | source | |
|---|
| 152.00 | Alfa Aesar | | 155.00 | PHYSPROP |
|
|
| | | 2-amino-4-methylpyridine C6H8N23, 64 |
 | | Compound Data | | Melting point | 99.50 °C | 372.65 K | | CSID | 1479 | H bond acceptors | 2 | Rule of 5 violations | 0 | | Molecular weight | 108.1411 | H bond donors | 2 | ACD/LogP | 1.08 | | Phase 25 °C | solid | Rotatable bonds | 0 | Predicted density | 1.07 g/cm3 | | SMILES | n1ccc(cc1N)C | | STD InChIKey | ORLGLBZRQYOWNA-UHFFFAOYAS | | Melting Points | | mp °C | source | |
|---|
| 99.00 | Alfa Aesar | | 100.00 | PHYSPROP |
|
|
| | | 2-amino-4-methylpyrimidine C5H7N33, 64 |
 | | Compound Data | | Melting point | 160.15 °C | 433.30 K | | CSID | 7651 | H bond acceptors | 3 | Rule of 5 violations | 0 | | Molecular weight | 109.1292 | H bond donors | 2 | ACD/LogP | 0.24 | | Phase 25 °C | solid | Rotatable bonds | 0 | Predicted density | 1.16 g/cm3 | | SMILES | n1c(ccnc1N)C | | STD InChIKey | GHCFWKFREBNSPC-UHFFFAOYAO | | Melting Points | | mp °C | source | |
|---|
| 160.00 | Alfa Aesar | | 160.30 | PHYSPROP |
|
|
| | | 2-amino-4-methylthiazole C4H6N2S3, 64 |
 | | Compound Data | | Melting point | 44.75 °C | 317.90 K | | CSID | 66754 | H bond acceptors | 2 | Rule of 5 violations | 0 | | Molecular weight | 114.1688 | H bond donors | 2 | ACD/LogP | 1.77 | | Phase 25 °C | solid | Rotatable bonds | 0 | Predicted density | 1.26 g/cm3 | | SMILES | Cc1csc(n1)N | | STD InChIKey | OUQMXTJYCAJLGO-UHFFFAOYAM | | Melting Points | | mp °C | source | |
|---|
| 44.00 | Alfa Aesar | | 45.50 | PHYSPROP |
|
|
| | | 2-amino-4-nitrophenol C6H6N2O32, 2, 3, 64 |
 | |
|
| | | 2-amino-4-t-butylphenol C10H15NO3, 64 |
 | | Compound Data | | Melting point | 162.00 °C | 435.15 K | | CSID | 64143 | H bond acceptors | 2 | Rule of 5 violations | 0 | | Molecular weight | 165.2322 | H bond donors | 3 | ACD/LogP | 2.13 | | Phase 25 °C | solid | Rotatable bonds | 3 | Predicted density | 1.05 g/cm3 | | SMILES | Oc1ccc(cc1N)C(C)(C)C | | STD InChIKey | RPJUVNYXHUCRMG-UHFFFAOYAH | | Melting Points | | mp °C | source | |
|---|
| 163.00 | Alfa Aesar | | 161.00 | PHYSPROP |
|
|
| | | 2-amino-4,6-dichloropyrimidine C4H3Cl2N33, 64 |
 | | Compound Data | | Melting point | 220.25 °C | 493.40 K | | CSID | 58968 | H bond acceptors | 3 | Rule of 5 violations | 0 | | Molecular weight | 163.9927 | H bond donors | 2 | ACD/LogP | 0.98 | | Phase 25 °C | solid | Rotatable bonds | 0 | Predicted density | 1.61 g/cm3 | | SMILES | Clc1nc(nc(Cl)c1)N | | STD InChIKey | JPZOAVGMSDSWSW-UHFFFAOYAI | | Melting Points | | mp °C | source | |
|---|
| 220.00 | Alfa Aesar | | 220.50 | PHYSPROP |
|
|
| | | 2-amino-4,6-dimethylpyrimidine C6H9N33, 64 |
 | | Compound Data | | Melting point | 152.50 °C | 425.65 K | | CSID | 12480 | H bond acceptors | 3 | Rule of 5 violations | 0 | | Molecular weight | 123.1558 | H bond donors | 2 | ACD/LogP | 0.70 | | Phase 25 °C | solid | Rotatable bonds | 0 | Predicted density | 1.11 g/cm3 | | SMILES | n1c(cc(nc1N)C)C | | STD InChIKey | IDQNBVFPZMCDDN-UHFFFAOYAZ | | Melting Points | | mp °C | source | |
|---|
| 153.00 | Alfa Aesar | | 152.00 | PHYSPROP |
|
|
| | | 2-amino-5-chlorobenzonitrile C7H5ClN23, 64 |
 | | Compound Data | | Melting point | 96.50 °C | 369.65 K | | CSID | 72274 | H bond acceptors | 2 | Rule of 5 violations | 0 | | Molecular weight | 152.581 | H bond donors | 2 | ACD/LogP | 2.32 | | Phase 25 °C | solid | Rotatable bonds | 1 | Predicted density | 1.33 g/cm3 | | SMILES | Clc1cc(C#N)c(N)cc1 | | STD InChIKey | QYRDWARBHMCOAG-UHFFFAOYAW | | Melting Points | | mp °C | source | |
|---|
| 96.00 | Alfa Aesar | | 97.00 | PHYSPROP |
|
|
| | | 2-amino-5-chlorobenzophenone C13H10ClNO3, 61, 64 |
 | | Compound Data | | Melting point | 97.67 °C | 370.82 K | | CSID | 12339 | H bond acceptors | 2 | Rule of 5 violations | 0 | | Molecular weight | 231.6776 | H bond donors | 2 | ACD/LogP | 3.52 | | Phase 25 °C | solid | Rotatable bonds | 3 | Predicted density | 1.27 g/cm3 | | SMILES | Clc2cc(C(=O)c1ccccc1)c(N)cc2 | | STD InChIKey | ZUWXHHBROGLWNH-UHFFFAOYAQ | | Melting Points | | mp °C | source | |
|---|
| 98.00 | Alfa Aesar | | 96.00 | Oxford University MSDS | | 99.00 | PHYSPROP |
|
|
| | | 2-amino-5-ethyl-1,3,4-thiadiazole C4H7N3S3, 47 |
 | | Compound Data | | Melting point | 200.68 °C | 473.82 K | | CSID | 24633 | H bond acceptors | 3 | Rule of 5 violations | 0 | | Molecular weight | 129.1835 | H bond donors | 2 | ACD/LogP | 0.37 | | Phase 25 °C | solid | Rotatable bonds | 1 | Predicted density | 1.28 g/cm3 | | SMILES | n1nc(sc1CC)N | | STD InChIKey | QXTRPGAMVIONMK-UHFFFAOYAZ | | Melting Points | | mp °C | source | |
|---|
| 200.00 | Alfa Aesar | | 201.35 | IUCr |
|
|
| | | 2-amino-5-methyl-1,3,4-thiadiazole C3H5N3S47, 64 |
 | | Compound Data | | Melting point | 224.68 °C | 497.82 K | | CSID | 60308 | H bond acceptors | 3 | Rule of 5 violations | 0 | | Molecular weight | 115.1569 | H bond donors | 2 | ACD/LogP | -0.16 | | Phase 25 °C | solid | Rotatable bonds | 0 | Predicted density | 1.37 g/cm3 | | SMILES | n1nc(sc1C)N | | STD InChIKey | HMPUHXCGUHDVBI-UHFFFAOYAV | | Melting Points | | mp °C | source | |
|---|
| 224.85 | IUCr | | 224.50 | PHYSPROP |
|
|
| | | 2-amino-5-methylpyridine C6H8N23, 64 |
 | | Compound Data | | Melting point | 76.25 °C | 349.40 K | | CSID | 14609 | H bond acceptors | 2 | Rule of 5 violations | 0 | | Molecular weight | 108.1411 | H bond donors | 2 | ACD/LogP | 1.08 | | Phase 25 °C | solid | Rotatable bonds | 0 | Predicted density | 1.07 g/cm3 | | SMILES | n1cc(ccc1N)C | | STD InChIKey | CMBSSVKZOPZBKW-UHFFFAOYAR | | Melting Points | | mp °C | source | |
|---|
| 76.00 | Alfa Aesar | | 76.50 | PHYSPROP |
|
|
| | | 2-amino-5-nitrobenzophenone C13H10N2O33, 64 |
 | | Compound Data | | Melting point | 165.00 °C | 438.15 K | | CSID | 14916 | H bond acceptors | 5 | Rule of 5 violations | 0 | | Molecular weight | 242.2301 | H bond donors | 2 | ACD/LogP | 3.05 | | Phase 25 °C | solid | Rotatable bonds | 4 | Predicted density | 1.33 g/cm3 | | SMILES | O=C(c1cc(ccc1N)[N+]([O-])=O)c2ccccc2 | | STD InChIKey | PZPZDEIASIKHPY-UHFFFAOYAO | | Melting Points | | mp °C | source | |
|---|
| 167.00 | Alfa Aesar | | 163.00 | PHYSPROP |
|
|
| | | 2-amino-5-nitropyridine C5H5N3O23, 64 |
 | | Compound Data | | Melting point | 187.50 °C | 460.65 K | | CSID | 70280 | H bond acceptors | 5 | Rule of 5 violations | 0 | | Molecular weight | 139.1121 | H bond donors | 2 | ACD/LogP | 1.18 | | Phase 25 °C | solid | Rotatable bonds | 1 | Predicted density | 1.44 g/cm3 | | SMILES | c1cc(ncc1[N+](=O)[O-])N | | STD InChIKey | UGSBCCAHDVCHGI-UHFFFAOYAS | | Melting Points | | mp °C | source | |
|---|
| 188.00 | Alfa Aesar | | 187.00 | PHYSPROP |
|
|
| | | 2-amino-6-methoxybenzothiazole C8H8N2OS3, 61, 64 |
 | | Compound Data | | Melting point | 165.00 °C | 438.15 K | | CSID | 14869 | H bond acceptors | 3 | Rule of 5 violations | 0 | | Molecular weight | 180.2269 | H bond donors | 2 | ACD/LogP | 1.87 | | Phase 25 °C | solid | Rotatable bonds | 1 | Predicted density | 1.36 g/cm3 | | SMILES | COc1ccc2c(c1)sc(n2)N | | STD InChIKey | KZHGPDSVHSDCMX-UHFFFAOYAT | | Melting Points | | mp °C | source | |
|---|
| 163.00 | Alfa Aesar | | 166.00 | Oxford University MSDS | | 166.00 | PHYSPROP |
|
|
| | | 2-amino-6-methylpyridine C6H8N23, 64 |
 | | Compound Data | | Melting point | 42.00 °C | 315.15 K | | CSID | 14991 | H bond acceptors | 2 | Rule of 5 violations | 0 | | Molecular weight | 108.1411 | H bond donors | 2 | ACD/LogP | 1.08 | | Phase 25 °C | solid | Rotatable bonds | 0 | Predicted density | 1.07 g/cm3 | | SMILES | n1c(cccc1N)C | | STD InChIKey | QUXLCYFNVNNRBE-UHFFFAOYAI | | Melting Points | | mp °C | source | |
|---|
| 43.00 | Alfa Aesar | | 41.00 | PHYSPROP |
|
|
| | | 2-aminobenzaldehyde C7H7NO2, 64 |
 | | Compound Data | | Melting point | 38.50 °C | 311.65 K | | CSID | 61553 | H bond acceptors | 2 | Rule of 5 violations | 0 | | Molecular weight | 121.1366 | H bond donors | 2 | ACD/LogP | 1.31 | | Phase 25 °C | solid | Rotatable bonds | 2 | Predicted density | 1.17 g/cm3 | | SMILES | O=Cc1ccccc1N | | STD InChIKey | FXWFZIRWWNPPOV-UHFFFAOYAM | | Melting Points | | mp °C | source | |
|---|
| 38.00 | Aldrich Chemical Company; Aldrich Catalog-Handbook of Fine C... | | 39.00 | PHYSPROP |
|
|
| | | 2-aminobenzamide C7H8N2O2, 2, 3 |
 | |
|
| | | 2-aminobenzonitrile C7H6N22, 3, 64 |
 | |
|
| | | 2-aminobenzothiazole C7H6N2S3, 64 |
 | | Compound Data | | Melting point | 130.00 °C | 403.15 K | | CSID | 8382 | H bond acceptors | 2 | Rule of 5 violations | 0 | | Molecular weight | 150.2009 | H bond donors | 2 | ACD/LogP | 1.89 | | Phase 25 °C | solid | Rotatable bonds | 0 | Predicted density | 1.38 g/cm3 | | SMILES | n1c2ccccc2sc1N | | STD InChIKey | UHGULLIUJBCTEF-UHFFFAOYAA | | Melting Points | | mp °C | source | |
|---|
| 128.00 | Alfa Aesar | | 132.00 | PHYSPROP |
|
|
| | | 2-aminodiphenylamine C12H12N23, 64 |
 | | Compound Data | | Melting point | 79.25 °C | 352.40 K | | CSID | 61594 | H bond acceptors | 2 | Rule of 5 violations | 0 | | Molecular weight | 184.2371 | H bond donors | 3 | ACD/LogP | 2.02 | | Phase 25 °C | solid | Rotatable bonds | 3 | Predicted density | 1.17 g/cm3 | | SMILES | c2c(Nc1ccccc1N)cccc2 | | STD InChIKey | NFCPRRWCTNLGSN-UHFFFAOYAG | | Melting Points | | mp °C | source | |
|---|
| 79.00 | Alfa Aesar | | 79.50 | PHYSPROP |
|
|
| | | 2-aminoethanethiol C2H7NS61, 64 |
 | | Compound Data | | Melting point | 97.00 °C | 370.15 K | | CSID | 5834 | H bond acceptors | 1 | Rule of 5 violations | 0 | | Molecular weight | 77.1487 | H bond donors | 2 | ACD/LogP | 0.03 | | Phase 25 °C | solid | Rotatable bonds | 3 | Predicted density | 0.97 g/cm3 | | SMILES | SCCN | | STD InChIKey | UFULAYFCSOUIOV-UHFFFAOYAX | | Melting Points | | mp °C | source | |
|---|
| 96.00 | Oxford University MSDS | | 98.00 | PHYSPROP |
|
|
| | | 2-aminoethanol C2H7NO3, 61, 64 |
 | | Compound Data | | Melting point | 10.43 °C | 283.58 K | | CSID | 13835336 | H bond acceptors | 2 | Rule of 5 violations | 0 | | Molecular weight | 61.0831 | H bond donors | 3 | ACD/LogP | 0.00 | | Phase 25 °C | liquid/gas | Rotatable bonds | 3 | Predicted density | 0.97 g/cm3 | | SMILES | C(CO)N | | STD InChIKey | HZAXFHJVJLSVMW-UHFFFAOYAD | | Melting Points | | mp °C | source | |
|---|
| 10.00 | Alfa Aesar | | 11.00 | Oxford University MSDS | | 10.30 | PHYSPROP |
|
|
| | | 2-aminoethyl diphenylborinate C14H16BNO3, 64 |
 | | Compound Data | | Melting point | 191.00 °C | 464.15 K | | CSID | 1540 | H bond acceptors | 2 | Rule of 5 violations | 0 | | Molecular weight | 225.0939 | H bond donors | 2 | ACD/LogP | 3.48 | | Phase 25 °C | solid | Rotatable bonds | 6 | Predicted density | 1.04 g/cm3 | | SMILES | O(B(c1ccccc1)c2ccccc2)CCN | | STD InChIKey | BLZVCIGGICSWIG-UHFFFAOYAJ | | Melting Points | | mp °C | source | |
|---|
| 189.00 | Alfa Aesar | | 193.00 | PHYSPROP |
|
|
| | | 2-aminofluorene C13H11N3, 64 |
 | | Compound Data | | Melting point | 128.50 °C | 401.65 K | | CSID | 1484 | H bond acceptors | 1 | Rule of 5 violations | 0 | | Molecular weight | 181.2331 | H bond donors | 2 | ACD/LogP | 2.88 | | Phase 25 °C | solid | Rotatable bonds | 1 | Predicted density | 1.20 g/cm3 | | SMILES | c1cccc3c1c2c(cc(N)cc2)C3 | | STD InChIKey | CFRFHWQYWJMEJN-UHFFFAOYAE | | Melting Points | | mp °C | source | |
|---|
| 128.00 | Alfa Aesar | | 129.00 | PHYSPROP |
|
|
| | | 2-aminophenol C6H7NO2, 3, 32, 64 |
 | |
|
| | | 2-aminopyridine C5H6N23, 64 |
 | | Compound Data | | Melting point | 57.75 °C | 330.90 K | | CSID | 10008 | H bond acceptors | 2 | Rule of 5 violations | 0 | | Molecular weight | 94.1145 | H bond donors | 2 | ACD/LogP | 0.53 | | Phase 25 °C | solid | Rotatable bonds | 0 | Predicted density | 1.11 g/cm3 | | SMILES | c1ccnc(c1)N | | STD InChIKey | ICSNLGPSRYBMBD-UHFFFAOYAM | | Melting Points | | mp °C | source | |
|---|
| 58.00 | Alfa Aesar | | 57.50 | PHYSPROP |
|
|
| | | 2-aminopyrimidine C4H5N33, 64 |
 | | Compound Data | | Melting point | 126.25 °C | 399.40 K | | CSID | 7690 | H bond acceptors | 3 | Rule of 5 violations | 0 | | Molecular weight | 95.1026 | H bond donors | 2 | ACD/LogP | -0.22 | | Phase 25 °C | solid | Rotatable bonds | 0 | Predicted density | 1.22 g/cm3 | | SMILES | c1cnc(nc1)N | | STD InChIKey | LJXQPZWIHJMPQQ-UHFFFAOYAJ | | Melting Points | | mp °C | source | |
|---|
| 125.00 | Alfa Aesar | | 127.50 | PHYSPROP |
|
|
| | | 2-aminothiazole C3H4N2S3, 64 |
 | | Compound Data | | Melting point | 91.50 °C | 364.65 K | | CSID | 2070 | H bond acceptors | 2 | Rule of 5 violations | 0 | | Molecular weight | 100.1423 | H bond donors | 2 | ACD/LogP | 0.00 | | Phase 25 °C | solid | Rotatable bonds | 0 | Predicted density | 1.35 g/cm3 | | SMILES | c1csc(n1)N | | STD InChIKey | RAIPHJJURHTUIC-UHFFFAOYAZ | | Melting Points | | mp °C | source | |
|---|
| 90.00 | Alfa Aesar | | 93.00 | PHYSPROP |
|
|
| | | 2-aminotoluene C8H9NO2, 64 |
 | | Compound Data | | Melting point | 144.50 °C | 417.65 K | | CSID | 10254 | H bond acceptors | 2 | Rule of 5 violations | 0 | | Molecular weight | 135.1632 | H bond donors | 2 | ACD/LogP | 1.20 | | Phase 25 °C | solid | Rotatable bonds | 1 | Predicted density | 1.09 g/cm3 | | SMILES | O=C(c1ccccc1C)N | | STD InChIKey | XXUNIGZDNWWYED-UHFFFAOYAM | | Melting Points | | mp °C | source | |
|---|
| 142.00 | Aldrich Chemical Company; Aldrich Catalog-Handbook of Fine C... | | 147.00 | PHYSPROP |
|
|
| | | 2-anthracenamine C14H11N3, 61, 64 |
 | | Compound Data | | Melting point | 236.93 °C | 510.08 K | | CSID | 11443 | H bond acceptors | 1 | Rule of 5 violations | 0 | | Molecular weight | 193.2438 | H bond donors | 2 | ACD/LogP | 3.40 | | Phase 25 °C | solid | Rotatable bonds | 1 | Predicted density | 1.21 g/cm3 | | SMILES | c3ccc2cc1ccc(N)cc1cc2c3 | | STD InChIKey | YCSBALJAGZKWFF-UHFFFAOYAR | | Melting Points | | mp °C | source | |
|---|
| 237.00 | Alfa Aesar | | 235.00 | Oxford University MSDS | | 238.80 | PHYSPROP |
|
|
| | | 2-benzofurancarboxylic acid C9H6O33, 64 |
 | | Compound Data | | Melting point | 193.25 °C | 466.40 K | | CSID | 10778469 | H bond acceptors | 3 | Rule of 5 violations | 0 | | Molecular weight | 162.1421 | H bond donors | 1 | ACD/LogP | 1.84 | | Phase 25 °C | solid | Rotatable bonds | 1 | Predicted density | 1.36 g/cm3 | | SMILES | c1ccc2c(c1)cc(o2)C(=O)O | | STD InChIKey | OFFSPAZVIVZPHU-UHFFFAOYAU | | Melting Points | | mp °C | source | |
|---|
| 194.00 | Alfa Aesar | | 192.50 | PHYSPROP |
|
|
| | | 2-benzoxazolinone C7H5NO23, 64 |
 | | Compound Data | | Melting point | 139.00 °C | 412.15 K | | CSID | 5820 | H bond acceptors | 3 | Rule of 5 violations | 0 | | Molecular weight | 135.1201 | H bond donors | 1 | ACD/LogP | 1.16 | | Phase 25 °C | solid | Rotatable bonds | 0 | Predicted density | 1.32 g/cm3 | | SMILES | O=C2Oc1ccccc1N2 | | STD InChIKey | ASSKVPFEZFQQNQ-UHFFFAOYAD | | Melting Points | | mp °C | source | |
|---|
| 140.00 | Alfa Aesar | | 138.00 | PHYSPROP |
|
|
| | | 2-benzoylbenzoic acid C14H10O33, 64 |
 | | Compound Data | | Melting point | 128.00 °C | 401.15 K | | CSID | 6554 | H bond acceptors | 3 | Rule of 5 violations | 0 | | Molecular weight | 226.2274 | H bond donors | 1 | ACD/LogP | 2.31 | | Phase 25 °C | solid | Rotatable bonds | 3 | Predicted density | 1.26 g/cm3 | | SMILES | O=C(O)c2ccccc2C(=O)c1ccccc1 | | STD InChIKey | FGTYTUFKXYPTML-UHFFFAOYAN | | Melting Points | | mp °C | source | |
|---|
| 129.00 | Alfa Aesar | | 127.00 | PHYSPROP |
|
|
| | | 2-benzoylpyridine C12H9NO3, 64 |
 | | Compound Data | | Melting point | 42.50 °C | 315.65 K | | CSID | 6771 | H bond acceptors | 2 | Rule of 5 violations | 0 | | Molecular weight | 183.206 | H bond donors | 0 | ACD/LogP | 1.88 | | Phase 25 °C | solid | Rotatable bonds | 2 | Predicted density | 1.14 g/cm3 | | SMILES | O=C(c1ccccc1)c2ncccc2 | | STD InChIKey | GCSHUYKULREZSJ-UHFFFAOYAK | | Melting Points | | mp °C | source | |
|---|
| 43.00 | Alfa Aesar | | 42.00 | PHYSPROP |
|
|
| | | 2-benzyl-4-chlorophenol C13H11ClO3, 64 |
 | | Compound Data | | Melting point | 48.25 °C | 321.40 K | | CSID | 8118 | H bond acceptors | 1 | Rule of 5 violations | 0 | | Molecular weight | 218.6788 | H bond donors | 1 | ACD/LogP | 4.42 | | Phase 25 °C | solid | Rotatable bonds | 3 | Predicted density | 1.22 g/cm3 | | SMILES | Clc1cc(c(O)cc1)Cc2ccccc2 | | STD InChIKey | NCKMMSIFQUPKCK-UHFFFAOYAC | | Melting Points | | mp °C | source | |
|---|
| 48.00 | Alfa Aesar | | 48.50 | PHYSPROP |
|
|
| | | 2-benzylpyridine C12H11N3, 64 |
 | | Compound Data | | Melting point | 11.25 °C | 284.40 K | | CSID | 7300 | H bond acceptors | 1 | Rule of 5 violations | 0 | | Molecular weight | 169.2224 | H bond donors | 0 | ACD/LogP | 2.71 | | Phase 25 °C | liquid/gas | Rotatable bonds | 2 | Predicted density | 1.04 g/cm3 | | SMILES | n1ccccc1Cc2ccccc2 | | STD InChIKey | PCFUWBOSXMKGIP-UHFFFAOYAU | | Melting Points | | mp °C | source | |
|---|
| 10.00 | Alfa Aesar | | 12.50 | PHYSPROP |
|
|
| | | 2-biphenylamine C12H11N3, 7, 61, 64 |
 | |
|
| | | 2-biphenylmethanol C13H12O3, 7 |
 | | Compound Data | | Melting point | 49.50 °C | 322.65 K | | CSID | 68709 | H bond acceptors | 1 | Rule of 5 violations | 0 | | Molecular weight | 184.2338 | H bond donors | 1 | ACD/LogP | 2.79 | | Phase 25 °C | solid | Rotatable bonds | 3 | Predicted density | 1.09 g/cm3 | | SMILES | OCc2ccccc2c1ccccc1 | | STD InChIKey | VKTQADPEPIVMHK-UHFFFAOYAA | | Melting Points | | mp °C | source | |
|---|
| 49.00 | Alfa Aesar | | 50.00 | Beilstein F. K.; Beilsteins Handbuch der Organischen Chemie.... |
|
|
| | | 2-bromo-1-(4-bromophenyl)ethanone C8H6Br2O3, 61, 64 |
 | | Compound Data | | Melting point | 110.00 °C | 383.15 K | | CSID | 7174 | H bond acceptors | 1 | Rule of 5 violations | 0 | | Molecular weight | 277.9406 | H bond donors | 0 | ACD/LogP | 2.96 | | Phase 25 °C | solid | Rotatable bonds | 2 | Predicted density | 1.85 g/cm3 | | SMILES | O=C(c1ccc(Br)cc1)CBr | | STD InChIKey | FKJSFKCZZIXQIP-UHFFFAOYAM | | Melting Points | | mp °C | source | |
|---|
| 110.00 | Alfa Aesar | | 109.00 | Oxford University MSDS | | 111.00 | PHYSPROP |
|
|
| | | 2-bromo-1-butene C4H7Br31, 64 |
 | | Compound Data | | Melting point | -133.20 °C | 139.95 K | | CSID | 81237 | H bond acceptors | 0 | Rule of 5 violations | 0 | | Molecular weight | 135.0024 | H bond donors | 0 | ACD/LogP | 2.69 | | Phase 25 °C | liquid/gas | Rotatable bonds | 1 | Predicted density | 1.31 g/cm3 | | SMILES | Br/C(=C)CC | | STD InChIKey | HQMXRIGBXOFKIU-UHFFFAOYAJ | | Melting Points | | mp °C | source | |
|---|
| -133.00 | Dreisbach R. R. Physical Properties of Chemical Compounds; V... | | -133.40 | PHYSPROP |
|
|
| | | 2-bromo-1,4-dichlorobenzene C6H3BrCl23, 64 |
 | | Compound Data | | Melting point | 34.50 °C | 307.65 K | | CSID | 14309 | H bond acceptors | 0 | Rule of 5 violations | 0 | | Molecular weight | 225.898 | H bond donors | 0 | ACD/LogP | 3.97 | | Phase 25 °C | solid | Rotatable bonds | 0 | Predicted density | 1.74 g/cm3 | | SMILES | Clc1cc(Br)c(Cl)cc1 | | STD InChIKey | OVXVQBCRONSPDC-UHFFFAOYAH | | Melting Points | | mp °C | source | |
|---|
| 34.00 | Alfa Aesar | | 35.00 | PHYSPROP |
|
|
| | | 2-bromo-1,4-dimethylbenzene C8H9Br2, 3, 64 |
 | |
|
| | | 2-bromo-4-nitrotoluene C7H6BrNO22, 3, 64 |
 | |
|
| | | 2-bromo-4,6-dichloroaniline C6H4BrCl2N3, 64 |
 | | Compound Data | | Melting point | 81.75 °C | 354.90 K | | CSID | 21168862 | H bond acceptors | 1 | Rule of 5 violations | 0 | | Molecular weight | 240.9127 | H bond donors | 2 | ACD/LogP | 3.90 | | Phase 25 °C | solid | Rotatable bonds | 1 | Predicted density | 1.83 g/cm3 | | SMILES | Clc1cc(Cl)cc(Br)c1N | | STD InChIKey | DTPADCOGQUOGHT-UHFFFAOYAD | | Melting Points | | mp °C | source | |
|---|
| 80.00 | Alfa Aesar | | 83.50 | PHYSPROP |
|
|
| | | 2-bromo-4,6-dinitroaniline C6H4BrN3O43, 64 |
 | | Compound Data | | Melting point | 152.75 °C | 425.90 K | | CSID | 14979 | H bond acceptors | 7 | Rule of 5 violations | 0 | | Molecular weight | 262.0177 | H bond donors | 2 | ACD/LogP | 3.09 | | Phase 25 °C | solid | Rotatable bonds | 3 | Predicted density | 1.99 g/cm3 | | SMILES | Brc1cc(cc([N+]([O-])=O)c1N)[N+]([O-])=O | | STD InChIKey | KWMDHCLJYMVBNS-UHFFFAOYAM | | Melting Points | | mp °C | source | |
|---|
| 152.00 | Alfa Aesar | | 153.50 | PHYSPROP |
|
|
| | | 2-bromo-4'-chloroacetophenone C8H6BrClO3, 64 |
 | | Compound Data | | Melting point | 96.25 °C | 369.40 K | | CSID | 61599 | H bond acceptors | 1 | Rule of 5 violations | 0 | | Molecular weight | 233.4896 | H bond donors | 0 | ACD/LogP | 2.88 | | Phase 25 °C | solid | Rotatable bonds | 2 | Predicted density | 1.60 g/cm3 | | SMILES | O=C(c1ccc(Cl)cc1)CBr | | STD InChIKey | FLAYZKKEOIAALB-UHFFFAOYAA | | Melting Points | | mp °C | source | |
|---|
| 96.00 | Alfa Aesar | | 96.50 | PHYSPROP |
|
|
| | | 2-bromoaniline C6H6BrN2, 3, 64 |
 | |
|
| | | 2-bromoanisole C7H7BrO2, 3, 64 |
 | |
|
| | | 2-bromobenzaldehyde C7H5BrO2, 3, 64 |
 | |
|
| | | 2-bromobenzamide C7H6BrNO2, 3, 64 |
 | |
|
| | | 2-bromobenzoic acid C7H5BrO22, 3, 64, 70 |
 | |
|
| | | 2-bromobenzonitrile C7H4BrN2, 3, 64 |
 | |
|
| | | 2-bromobenzoyl chloride C7H4BrClO3, 64 |
 | | Compound Data | | Melting point | 10.50 °C | 283.65 K | | CSID | 22012 | H bond acceptors | 1 | Rule of 5 violations | 0 | | Molecular weight | 219.4631 | H bond donors | 0 | ACD/LogP | 2.56 | | Phase 25 °C | liquid/gas | Rotatable bonds | 1 | Predicted density | 1.66 g/cm3 | | SMILES | O=C(Cl)c1ccccc1Br | | STD InChIKey | NZCKTGCKFJDGFD-UHFFFAOYAT | | Melting Points | | mp °C | source | |
|---|
| 10.00 | Alfa Aesar | | 11.00 | PHYSPROP |
|
|
| | | 2-bromobenzyl alcohol C7H7BrO2, 3 |
 | |
|
| | | 2-bromobiphenyl C12H9Br2, 3, 64 |
 | |
|
| | | 2-bromofluorene C13H9Br3, 64 |
 | | Compound Data | | Melting point | 112.75 °C | 385.90 K | | CSID | 13697 | H bond acceptors | 0 | Rule of 5 violations | 0 | | Molecular weight | 245.1146 | H bond donors | 0 | ACD/LogP | 4.93 | | Phase 25 °C | solid | Rotatable bonds | 0 | Predicted density | 1.49 g/cm3 | | SMILES | Brc3ccc2c1ccccc1Cc2c3 | | STD InChIKey | FXSCJZNMWILAJO-UHFFFAOYAS | | Melting Points | | mp °C | source | |
|---|
| 112.00 | Alfa Aesar | | 113.50 | PHYSPROP |
|
|
| | | 2-bromoisobutyric acid C4H7BrO23, 64 |
 | | Compound Data | | Melting point | 46.25 °C | 319.40 K | | CSID | 10790335 | H bond acceptors | 2 | Rule of 5 violations | 0 | | Molecular weight | 167.0012 | H bond donors | 1 | ACD/LogP | 1.20 | | Phase 25 °C | solid | Rotatable bonds | 1 | Predicted density | 1.63 g/cm3 | | SMILES | BrC(C)(C)C(O)=O | | STD InChIKey | XXSPGBOGLXKMDU-UHFFFAOYAO | | Melting Points | | mp °C | source | |
|---|
| 44.00 | Alfa Aesar | | 48.50 | PHYSPROP |
|
|
| | | 2-bromomesitylene C9H11Br2, 3, 64 |
 | |
|
| | | 2-bromonaphthalene C10H7Br2, 3, 64 |
 | |
|
| | | 2-bromophenol C6H5BrO2, 3, 32, 64 |
 | |
|
| | | 2-bromostyrene C8H7Br3, 64 |
 | | Compound Data | | Melting point | -52.75 °C | 220.40 K | | CSID | 15432 | H bond acceptors | 0 | Rule of 5 violations | 0 | | Molecular weight | 183.0452 | H bond donors | 0 | ACD/LogP | 3.58 | | Phase 25 °C | liquid/gas | Rotatable bonds | 1 | Predicted density | 1.39 g/cm3 | | SMILES | C=Cc1ccccc1Br | | STD InChIKey | SSZOCHFYWWVSAI-UHFFFAOYAV | | Melting Points | | mp °C | source | |
|---|
| -53.00 | Alfa Aesar | | -52.50 | PHYSPROP |
|
|
| | | 2-bromotoluene C7H7Br3, 31, 64 |
 | |
|
| | | 2-butoxyethanol C6H14O23, 61, 64 |
 | | Compound Data | | Melting point | -76.27 °C | 196.88 K | | CSID | 13836399 | H bond acceptors | 2 | Rule of 5 violations | 0 | | Molecular weight | 118.1742 | H bond donors | 1 | ACD/LogP | 0.80 | | Phase 25 °C | liquid/gas | Rotatable bonds | 6 | Predicted density | 0.90 g/cm3 | | SMILES | CCCCOCCO | | STD InChIKey | POAOYUHQDCAZBD-UHFFFAOYAB | | Melting Points | | mp °C | source | |
|---|
| -79.00 | Alfa Aesar | | -75.00 | Oxford University MSDS | | -74.80 | PHYSPROP |
|
|
| | | 2-butyn-1-ol C4H6O3, 61, 64 |
 | | Compound Data | | Melting point | -2.13 °C | 271.02 K | | CSID | 12450 | H bond acceptors | 1 | Rule of 5 violations | 0 | | Molecular weight | 70.0898 | H bond donors | 1 | ACD/LogP | 0.12 | | Phase 25 °C | liquid/gas | Rotatable bonds | 1 | Predicted density | 0.93 g/cm3 | | SMILES | C(#CCO)C | | STD InChIKey | NEEDEQSZOUAJMU-UHFFFAOYAV | | Melting Points | | mp °C | source | |
|---|
| -2.00 | Alfa Aesar | | -2.20 | Oxford University MSDS | | -2.20 | PHYSPROP |
|
|
| | | 2-butyne C4H62, 3, 64 |
 | |
|
| | | 2-butynoic acid C4H4O23, 64 |
 | | Compound Data | | Melting point | 77.50 °C | 350.65 K | | CSID | 61810 | H bond acceptors | 2 | Rule of 5 violations | 0 | | Molecular weight | 84.0734 | H bond donors | 1 | ACD/LogP | 0.85 | | Phase 25 °C | solid | Rotatable bonds | 0 | Predicted density | 1.16 g/cm3 | | SMILES | O=C(C#CC)O | | STD InChIKey | LUEHNHVFDCZTGL-UHFFFAOYAN | | Melting Points | | mp °C | source | |
|---|
| 77.00 | Alfa Aesar | | 78.00 | PHYSPROP |
|
|
| | | 2-carboxyphenyl phosphate C7H7O6P3, 9, 48, 64 |
 | |
|
| | | 2-chloro-1,3-dimethylbenzene C8H9Cl3, 64 |
 | | Compound Data | | Melting point | -35.50 °C | 237.65 K | | CSID | 13875381 | H bond acceptors | 0 | Rule of 5 violations | 0 | | Molecular weight | 140.6101 | H bond donors | 0 | ACD/LogP | 3.73 | | Phase 25 °C | liquid/gas | Rotatable bonds | 0 | Predicted density | 1.05 g/cm3 | | SMILES | Cc1cccc(C)c1Cl | | STD InChIKey | VDXLAYAQGYCQEO-UHFFFAOYAL | | Melting Points | | mp °C | source | |
|---|
| -36.00 | Alfa Aesar | | -35.00 | PHYSPROP |
|
|
| | | 2-chloro-1,3-dinitro-5-(trifluoromethyl)benzene C7H2ClF3N2O43, 61, 64 |
 | | Compound Data | | Melting point | 56.67 °C | 329.82 K | | CSID | 9426 | H bond acceptors | 6 | Rule of 5 violations | 0 | | Molecular weight | 270.55 | H bond donors | 0 | ACD/LogP | 2.64 | | Phase 25 °C | solid | Rotatable bonds | 2 | Predicted density | 1.71 g/cm3 | | SMILES | O=[N+]([O-])c1cc(cc([N+]([O-])=O)c1Cl)C(F)(F)F | | STD InChIKey | HFHAVERNVFNSHL-UHFFFAOYAU | | Melting Points | | mp °C | source | |
|---|
| 56.00 | Alfa Aesar | | 57.00 | Oxford University MSDS | | 57.00 | PHYSPROP |
|
|
| | | 2-chloro-1,3-dinitrobenzene C6H3ClN2O43, 64 |
 | | Compound Data | | Melting point | 87.00 °C | 360.15 K | | CSID | 21242790 | H bond acceptors | 6 | Rule of 5 violations | 0 | | Molecular weight | 202.552 | H bond donors | 0 | ACD/LogP | 1.79 | | Phase 25 °C | solid | Rotatable bonds | 2 | Predicted density | 1.62 g/cm3 | | SMILES | O=[N+]([O-])c1cccc([N+]([O-])=O)c1Cl | | STD InChIKey | BPPMIQPXQVIZNJ-UHFFFAOYAA | | Melting Points | | mp °C | source | |
|---|
| 86.00 | Alfa Aesar | | 88.00 | PHYSPROP |
|
|
| | | 2-chloro-2-methylbutane C5H11Cl3, 31, 61, 64 |
 | |
|
| | | 2-chloro-3-nitrobenzoic acid C7H4ClNO42, 3, 64 |
 | |
|
| | | 2-chloro-4-nitrobenzamide C7H5ClN2O33, 64 |
 | | Compound Data | | Melting point | 171.00 °C | 444.15 K | | CSID | 1991 | H bond acceptors | 5 | Rule of 5 violations | 0 | | Molecular weight | 200.5792 | H bond donors | 2 | ACD/LogP | 1.10 | | Phase 25 °C | solid | Rotatable bonds | 2 | Predicted density | 1.52 g/cm3 | | SMILES | O=C(c1ccc(cc1Cl)[N+]([O-])=O)N | | STD InChIKey | GFGSZUNNBQXGMK-UHFFFAOYAX | | Melting Points | | mp °C | source | |
|---|
| 170.00 | Alfa Aesar | | 172.00 | PHYSPROP |
|
|
| | | 2-chloro-4-nitrobenzoic acid C7H4ClNO42, 3, 64 |
 | |
|
| | | 2-chloro-4-nitrophenol C6H4ClNO32, 3 |
 | | Compound Data | | Melting point | 108.00 °C | 381.15 K | | CSID | 11577 | H bond acceptors | 4 | Rule of 5 violations | 0 | | Molecular weight | 173.5539 | H bond donors | 1 | ACD/LogP | 2.22 | | Phase 25 °C | solid | Rotatable bonds | 2 | Predicted density | 1.55 g/cm3 | | SMILES | Clc1cc([N+]([O-])=O)ccc1O | | STD InChIKey | BOFRXDMCQRTGII-UHFFFAOYAM | | Melting Points | | mp °C | source | |
|---|
| 106.00 | Aldrich Chemical Company; Aldrich Catalog-Handbook of Fine C... | | 110.00 | Alfa Aesar |
|
|
| | | 2-chloro-5-(trifluoromethyl)pyridine C6H3ClF3N3, 64 |
 | | Compound Data | | Melting point | 32.00 °C | 305.15 K | | CSID | 83365 | H bond acceptors | 1 | Rule of 5 violations | 0 | | Molecular weight | 181.5429 | H bond donors | 0 | ACD/LogP | 2.31 | | Phase 25 °C | solid | Rotatable bonds | 0 | Predicted density | 1.42 g/cm3 | | SMILES | c1cc(ncc1C(F)(F)F)Cl | | STD InChIKey | JFZJMSDDOOAOIV-UHFFFAOYAY | | Melting Points | | mp °C | source | |
|---|
| 31.00 | Alfa Aesar | | 33.00 | PHYSPROP |
|
|
| | | 2-chloro-5-methylaniline C7H8ClN2, 3, 64 |
 | |
|
| | | 2-chloro-5-nitroaniline C6H5ClN2O22, 3, 64 |
 | |
|
| | | 2-chloro-5-nitrobenzoic acid C7H4ClNO42, 3, 35, 64 |
 | |
|
| | | 2-chloro-5-nitrotoluene C7H6ClNO23, 64 |
 | | Compound Data | | Melting point | 42.75 °C | 315.90 K | | CSID | 75176 | H bond acceptors | 3 | Rule of 5 violations | 0 | | Molecular weight | 171.581 | H bond donors | 0 | ACD/LogP | 3.06 | | Phase 25 °C | solid | Rotatable bonds | 1 | Predicted density | 1.32 g/cm3 | | SMILES | Clc1ccc([N+]([O-])=O)cc1C | | STD InChIKey | BGDCQZFFNFXYQC-UHFFFAOYAN | | Melting Points | | mp °C | source | |
|---|
| 43.00 | Alfa Aesar | | 42.50 | PHYSPROP |
|
|
| | | 2-chloro-6-fluorobenzoic acid C7H4ClFO23, 64 |
 | | Compound Data | | Melting point | 159.00 °C | 432.15 K | | CSID | 61264 | H bond acceptors | 2 | Rule of 5 violations | 0 | | Molecular weight | 174.5569 | H bond donors | 1 | ACD/LogP | 1.56 | | Phase 25 °C | solid | Rotatable bonds | 1 | Predicted density | 1.48 g/cm3 | | SMILES | O=C(O)c1c(F)cccc1Cl | | STD InChIKey | XNTIGDVFBDJLTQ-UHFFFAOYAU | | Melting Points | | mp °C | source | |
|---|
| 158.00 | Alfa Aesar | | 160.00 | PHYSPROP |
|
|
| | | 2-chloro-6-nitrotoluene C7H6ClNO22, 3, 64 |
 | |
|
| | | 2-chloroacetamide C2H4ClNO3, 64 |
 | | Compound Data | | Melting point | 119.50 °C | 392.65 K | | CSID | 6332 | H bond acceptors | 2 | Rule of 5 violations | 0 | | Molecular weight | 93.5123 | H bond donors | 2 | ACD/LogP | -0.85 | | Phase 25 °C | solid | Rotatable bonds | 1 | Predicted density | 1.27 g/cm3 | | SMILES | ClCC(=O)N | | STD InChIKey | VXIVSQZSERGHQP-UHFFFAOYAM | | Melting Points | | mp °C | source | |
|---|
| 118.00 | Alfa Aesar | | 121.00 | PHYSPROP |
|
|
| | | 2-chloroacetanilide C8H8ClNO3, 64 |
 | | Compound Data | | Melting point | 88.00 °C | 361.15 K | | CSID | 10322 | H bond acceptors | 2 | Rule of 5 violations | 0 | | Molecular weight | 169.6082 | H bond donors | 1 | ACD/LogP | 1.28 | | Phase 25 °C | solid | Rotatable bonds | 1 | Predicted density | 1.26 g/cm3 | | SMILES | Clc1ccccc1NC(=O)C | | STD InChIKey | KNVQTRVKSOEHPU-UHFFFAOYAW | | Melting Points | | mp °C | source | |
|---|
| 87.00 | Alfa Aesar | | 89.00 | PHYSPROP |
|
|
| | | 2-chloroacrylic acid C3H3ClO23, 64 |
 | | Compound Data | | Melting point | 65.50 °C | 338.65 K | | CSID | 11242 | H bond acceptors | 2 | Rule of 5 violations | 0 | | Molecular weight | 106.5077 | H bond donors | 1 | ACD/LogP | 0.43 | | Phase 25 °C | solid | Rotatable bonds | 1 | Predicted density | 1.35 g/cm3 | | SMILES | Cl/C(=C)C(=O)O | | STD InChIKey | SZTBMYHIYNGYIA-UHFFFAOYAK | | Melting Points | | mp °C | source | |
|---|
| 65.00 | Alfa Aesar | | 66.00 | PHYSPROP |
|
|
| | | 2-chloroanthraquinone C14H7ClO23, 64 |
 | | Compound Data | | Melting point | 210.00 °C | 483.15 K | | CSID | 8235 | H bond acceptors | 2 | Rule of 5 violations | 0 | | Molecular weight | 242.6572 | H bond donors | 0 | ACD/LogP | 4.11 | | Phase 25 °C | solid | Rotatable bonds | 0 | Predicted density | 1.42 g/cm3 | | SMILES | Clc3ccc2C(=O)c1c(cccc1)C(=O)c2c3 | | STD InChIKey | FPKCTSIVDAWGFA-UHFFFAOYAD | | Melting Points | | mp °C | source | |
|---|
| 209.00 | Alfa Aesar | | 211.00 | PHYSPROP |
|
|
| | | 2-chlorobenzaldehyde C7H5ClO2, 3, 61, 64 |
 | |
|
| | | 2-chlorobenzamide C7H6ClNO2, 3, 64 |
 | |
|
| | | 2-chlorobenzhydrazide C7H7ClN2O3, 64 |
 | | Compound Data | | Melting point | 118.50 °C | 391.65 K | | CSID | 72174 | H bond acceptors | 3 | Rule of 5 violations | 0 | | Molecular weight | 170.5963 | H bond donors | 3 | ACD/LogP | 0.14 | | Phase 25 °C | solid | Rotatable bonds | 2 | Predicted density | 1.32 g/cm3 | | SMILES | O=C(c1ccccc1Cl)NN | | STD InChIKey | KPPNLSKVTKSSTG-UHFFFAOYAQ | | Melting Points | | mp °C | source | |
|---|
| 118.00 | Alfa Aesar | | 119.00 | PHYSPROP |
|
|
| | | 2-chlorobenzoic acid C7H5ClO22, 3, 61, 64 |
 | |
|
| | | 2-chlorobenzonitrile C7H4ClN2, 3, 64 |
 | |
|
| | | 2-chlorobenzotrichloride C7H4Cl43, 31, 64 |
 | |
|
| | | 2-chlorobenzyl alcohol C7H7ClO2, 3, 64 |
 | |
|
| | | 2-chlorobenzyl chloride C7H6Cl23, 64 |
 | | Compound Data | | Melting point | -15.00 °C | 258.15 K | | CSID | 11412 | H bond acceptors | 0 | Rule of 5 violations | 0 | | Molecular weight | 161.0285 | H bond donors | 0 | ACD/LogP | 3.08 | | Phase 25 °C | liquid/gas | Rotatable bonds | 1 | Predicted density | 1.25 g/cm3 | | SMILES | ClCc1ccccc1Cl | | STD InChIKey | BASMANVIUSSIIM-UHFFFAOYAQ | | Melting Points | | mp °C | source | |
|---|
| -13.00 | Alfa Aesar | | -17.00 | PHYSPROP |
|
|
| | | 2-chlorobenzyl cyanide C8H6ClN2, 3, 64 |
 | |
|
| | | 2-chloroethanol C2H5ClO3, 19, 37, 59, 61, 64 |
 | | Compound Data | | Melting point | -66.25 °C | 206.90 K | | CSID | 21106015 | H bond acceptors | 1 | Rule of 5 violations | 0 | | Molecular weight | 80.5135 | H bond donors | 1 | ACD/LogP | 0.00 | | Phase 25 °C | liquid/gas | Rotatable bonds | 2 | Predicted density | 1.14 g/cm3 | | SMILES | ClCCO | | STD InChIKey | SZIFAVKTNFCBPC-UHFFFAOYAF | | Melting Points | | mp °C | source | |
|---|
| -63.00 | Alfa Aesar | | -67.00 | Fisher | | -67.50 | NIST Web Book | | -67.50 | PHYSPROP | | Values not used in calculating the average melting point | | 159.50 | Chemical Book1 | | -89.00 | Oxford University MSDS2 | | 1. clearly out of range JCB | | 2. clearly out of range (4 NIST values) JCB |
|
|
| | | 2-chloroethylphosphonic acid C2H6ClO3P3, 64, 64 |
 | | Compound Data | | Melting point | 72.83 °C | 345.98 K | | CSID | 26031 | H bond acceptors | 3 | Rule of 5 violations | 0 | | Molecular weight | 144.494 | H bond donors | 2 | ACD/LogP | -1.42 | | Phase 25 °C | solid | Rotatable bonds | 2 | Predicted density | 1.57 g/cm3 | | SMILES | ClCCP(=O)(O)O | | STD InChIKey | UDPGUMQDCGORJQ-UHFFFAOYAQ | | Melting Points | | mp °C | source | |
|---|
| 70.00 | Alfa Aesar | | 74.50 | PHYSPROP | | 74.00 | PHYSPROP |
|
|
| | | 2-chlorolepidine C10H8ClN3, 47, 64 |
 | | Compound Data | | Melting point | 56.95 °C | 330.10 K | | CSID | 62656 | H bond acceptors | 1 | Rule of 5 violations | 0 | | Molecular weight | 177.6302 | H bond donors | 0 | ACD/LogP | 3.17 | | Phase 25 °C | solid | Rotatable bonds | 0 | Predicted density | 1.23 g/cm3 | | SMILES | Clc1nc2ccccc2c(c1)C | | STD InChIKey | PFEIMKNQOIFKSW-UHFFFAOYAZ | | Melting Points | | mp °C | source | |
|---|
| 55.00 | Alfa Aesar | | 56.85 | IUCr | | 59.00 | PHYSPROP |
|
|
| | | 2-chlorophenol C6H5ClO2, 3, 61, 64 |
 | |
|
| | | 2-chlorophenoxyacetic acid C8H7ClO33, 64 |
 | | Compound Data | | Melting point | 149.25 °C | 422.40 K | | CSID | 11475 | H bond acceptors | 3 | Rule of 5 violations | 0 | | Molecular weight | 186.5924 | H bond donors | 1 | ACD/LogP | 1.89 | | Phase 25 °C | solid | Rotatable bonds | 3 | Predicted density | 1.37 g/cm3 | | SMILES | Clc1ccccc1OCC(=O)O | | STD InChIKey | OPQYFNRLWBWCST-UHFFFAOYAU | | Melting Points | | mp °C | source | |
|---|
| 150.00 | Alfa Aesar | | 148.50 | PHYSPROP |
|
|
| | | 2-chlorophenylacetic acid C8H7ClO22, 3 |
 | | Compound Data | | Melting point | 95.50 °C | 368.65 K | | CSID | 16208 | H bond acceptors | 2 | Rule of 5 violations | 0 | | Molecular weight | 170.593 | H bond donors | 1 | ACD/LogP | 2.10 | | Phase 25 °C | solid | Rotatable bonds | 2 | Predicted density | 1.32 g/cm3 | | SMILES | Clc1ccccc1CC(=O)O | | STD InChIKey | IUJAAIZKRJJZGQ-UHFFFAOYAB | | Melting Points | | mp °C | source | |
|---|
| 95.00 | Aldrich Chemical Company; Aldrich Catalog-Handbook of Fine C... | | 96.00 | Alfa Aesar |
|
|
| | | 2-chloropropane C3H7Cl3, 31, 61, 64 |
 | |
|
| | | 2-chloropropene C3H5Cl3, 64 |
 | | Compound Data | | Melting point | -137.70 °C | 135.45 K | | CSID | 10730 | H bond acceptors | 0 | Rule of 5 violations | 0 | | Molecular weight | 76.5248 | H bond donors | 0 | ACD/LogP | 1.99 | | Phase 25 °C | liquid/gas | Rotatable bonds | 0 | Predicted density | 0.91 g/cm3 | | SMILES | Cl/C(=C)C | | STD InChIKey | PNLQPWWBHXMFCA-UHFFFAOYAD | | Melting Points | | mp °C | source | |
|---|
| -138.00 | Alfa Aesar | | -137.40 | PHYSPROP |
|
|
| | | 2-chloropyridine C5H4ClN3, 64 |
 | | Compound Data | | Melting point | -46.25 °C | 226.90 K | | CSID | 7689 | H bond acceptors | 1 | Rule of 5 violations | 0 | | Molecular weight | 113.545 | H bond donors | 0 | ACD/LogP | 1.40 | | Phase 25 °C | liquid/gas | Rotatable bonds | 0 | Predicted density | 1.20 g/cm3 | | SMILES | Clc1ncccc1 | | STD InChIKey | OKDGRDCXVWSXDC-UHFFFAOYAI | | Melting Points | | mp °C | source | |
|---|
| -46.00 | Alfa Aesar | | -46.50 | PHYSPROP |
|
|
| | | 2-chloropyrimidine C4H3ClN23, 64 |
 | | Compound Data | | Melting point | 66.50 °C | 339.65 K | | CSID | 66996 | H bond acceptors | 2 | Rule of 5 violations | 0 | | Molecular weight | 114.533 | H bond donors | 0 | ACD/LogP | 0.36 | | Phase 25 °C | solid | Rotatable bonds | 0 | Predicted density | 1.30 g/cm3 | | SMILES | c1cnc(nc1)Cl | | STD InChIKey | UNCQVRBWJWWJBF-UHFFFAOYAB | | Melting Points | | mp °C | source | |
|---|
| 66.00 | Alfa Aesar | | 67.00 | PHYSPROP |
|
|
| | | 2-chloroquinoline C9H6ClN3, 64 |
 | | Compound Data | | Melting point | 37.00 °C | 310.15 K | | CSID | 11434 | H bond acceptors | 1 | Rule of 5 violations | 0 | | Molecular weight | 163.6036 | H bond donors | 0 | ACD/LogP | 2.71 | | Phase 25 °C | solid | Rotatable bonds | 0 | Predicted density | 1.27 g/cm3 | | SMILES | Clc1nc2ccccc2cc1 | | STD InChIKey | OFUFXTHGZWIDDB-UHFFFAOYAC | | Melting Points | | mp °C | source | |
|---|
| 36.00 | Alfa Aesar | | 38.00 | PHYSPROP |
|
|
| | | 2-chlorostyrene C8H7Cl3, 64 |
 | | Compound Data | | Melting point | -63.05 °C | 210.10 K | | CSID | 14205 | H bond acceptors | 0 | Rule of 5 violations | 0 | | Molecular weight | 138.5942 | H bond donors | 0 | ACD/LogP | 3.55 | | Phase 25 °C | liquid/gas | Rotatable bonds | 1 | Predicted density | 1.09 g/cm3 | | SMILES | C=Cc1ccccc1Cl | | STD InChIKey | ISRGONDNXBCDBM-UHFFFAOYAD | | Melting Points | | mp °C | source | |
|---|
| -63.00 | Alfa Aesar | | -63.10 | PHYSPROP |
|
|
| | | 2-chlorothiophene C4H3ClS3, 64 |
 | | Compound Data | | Melting point | -71.95 °C | 201.20 K | | CSID | 7027 | H bond acceptors | 0 | Rule of 5 violations | 0 | | Molecular weight | 118.5846 | H bond donors | 0 | ACD/LogP | 2.54 | | Phase 25 °C | liquid/gas | Rotatable bonds | 0 | Predicted density | 1.30 g/cm3 | | SMILES | Clc1sccc1 | | STD InChIKey | GSFNQBFZFXUTBN-UHFFFAOYAH | | Melting Points | | mp °C | source | |
|---|
| -72.00 | Alfa Aesar | | -71.90 | PHYSPROP |
|
|
| | | 2-chlorotoluene C7H7Cl3, 31, 64 |
 | |
|
| | | 2-cyanobenzaldehyde C8H5NO3, 7 |
 | | Compound Data | | Melting point | 106.00 °C | 379.15 K | | CSID | 91446 | H bond acceptors | 2 | Rule of 5 violations | 0 | | Molecular weight | 131.1314 | H bond donors | 0 | ACD/LogP | 1.45 | | Phase 25 °C | solid | Rotatable bonds | 1 | Predicted density | 1.15 g/cm3 | | SMILES | N#Cc1ccccc1C=O | | STD InChIKey | QVTPWONEVZJCCS-UHFFFAOYAO | | Melting Points | | mp °C | source | |
|---|
| 104.00 | Alfa Aesar | | 108.00 | Beilstein F. K.; Beilsteins Handbuch der Organischen Chemie.... |
|
|
| | | 2-cyanobenzamide C8H6N2O3, 7 |
 | | Compound Data | | Melting point | 172.50 °C | 445.65 K | | CSID | 65715 | H bond acceptors | 3 | Rule of 5 violations | 0 | | Molecular weight | 146.146 | H bond donors | 2 | ACD/LogP | -0.00 | | Phase 25 °C | solid | Rotatable bonds | 1 | Predicted density | 1.24 g/cm3 | | SMILES | N#Cc1ccccc1C(=O)N | | STD InChIKey | STQPCKPKAIRSEL-UHFFFAOYAY | | Melting Points | | mp °C | source | |
|---|
| 173.00 | Alfa Aesar | | 172.00 | Beilstein F. K.; Beilsteins Handbuch der Organischen Chemie.... |
|
|
| | | 2-cyanobiphenyl C13H9N7, 64 |
 | | Compound Data | | Melting point | 39.50 °C | 312.65 K | | CSID | 124512 | H bond acceptors | 1 | Rule of 5 violations | 0 | | Molecular weight | 179.2173 | H bond donors | 0 | ACD/LogP | 3.18 | | Phase 25 °C | solid | Rotatable bonds | 1 | Predicted density | 1.11 g/cm3 | | SMILES | N#Cc2ccccc2c1ccccc1 | | STD InChIKey | WLPATYNQCGVFFH-UHFFFAOYAZ | | Melting Points | | mp °C | source | |
|---|
| 38.00 | Beilstein F. K.; Beilsteins Handbuch der Organischen Chemie.... | | 41.00 | PHYSPROP |
|
|
| | | 2-cyanophenol C7H5NO2, 3, 61, 64 |
 | |
|
| | | 2-cyanopyridine C6H4N23, 64 |
 | | Compound Data | | Melting point | 28.00 °C | 301.15 K | | CSID | 7241 | H bond acceptors | 2 | Rule of 5 violations | 0 | | Molecular weight | 104.1094 | H bond donors | 0 | ACD/LogP | 0.51 | | Phase 25 °C | solid | Rotatable bonds | 0 | Predicted density | 1.12 g/cm3 | | SMILES | N#Cc1ncccc1 | | STD InChIKey | FFNVQNRYTPFDDP-UHFFFAOYAF | | Melting Points | | mp °C | source | |
|---|
| 27.00 | Alfa Aesar | | 29.00 | PHYSPROP |
|
|
| | | 2-dodecanone C12H24O3, 4, 64 |
 | |
|
| | | 2-ethoxy-1-naphthaldehyde C13H12O23, 64 |
 | | Compound Data | | Melting point | 113.50 °C | 386.65 K | | CSID | 79481 | H bond acceptors | 2 | Rule of 5 violations | 0 | | Molecular weight | 200.2332 | H bond donors | 0 | ACD/LogP | 3.48 | | Phase 25 °C | solid | Rotatable bonds | 3 | Predicted density | 1.14 g/cm3 | | SMILES | O=Cc1c2c(ccc1OCC)cccc2 | | STD InChIKey | IMNKQTWVJHODOS-UHFFFAOYAP | | Melting Points | | mp °C | source | |
|---|
| 112.00 | Alfa Aesar | | 115.00 | PHYSPROP |
|
|
| | | 2-ethoxybenzoic acid C9H10O33, 64 |
 | | Compound Data | | Melting point | 20.35 °C | 293.50 K | | CSID | 60586 | H bond acceptors | 3 | Rule of 5 violations | 0 | | Molecular weight | 166.1739 | H bond donors | 1 | ACD/LogP | 2.03 | | Phase 25 °C | liquid/gas | Rotatable bonds | 3 | Predicted density | 1.17 g/cm3 | | SMILES | O=C(O)c1ccccc1OCC | | STD InChIKey | XDZMPRGFOOFSBL-UHFFFAOYAO | | Melting Points | | mp °C | source | |
|---|
| 20.00 | Alfa Aesar | | 20.70 | PHYSPROP |
|
|
| | | 2-ethoxyethyl acetate C6H12O32, 3, 61, 64 |
 | |
|
| | | 2-ethoxynaphthalene C12H12O3, 64 |
 | | Compound Data | | Melting point | 36.75 °C | 309.90 K | | CSID | 6862 | H bond acceptors | 1 | Rule of 5 violations | 0 | | Molecular weight | 172.2231 | H bond donors | 0 | ACD/LogP | 3.90 | | Phase 25 °C | solid | Rotatable bonds | 2 | Predicted density | 1.05 g/cm3 | | SMILES | O(c2ccc1c(cccc1)c2)CC | | STD InChIKey | GUMOJENFFHZAFP-UHFFFAOYAD | | Melting Points | | mp °C | source | |
|---|
| 36.00 | Alfa Aesar | | 37.50 | PHYSPROP |
|
|
| | | 2-ethoxyphenol C8H10O23, 64 |
 | | Compound Data | | Melting point | 27.50 °C | 300.65 K | | CSID | 60121 | H bond acceptors | 2 | Rule of 5 violations | 0 | | Molecular weight | 138.1638 | H bond donors | 1 | ACD/LogP | 1.72 | | Phase 25 °C | solid | Rotatable bonds | 3 | Predicted density | 1.08 g/cm3 | | SMILES | O(c1ccccc1O)CC | | STD InChIKey | MOEFFSWKSMRFRQ-UHFFFAOYAO | | Melting Points | | mp °C | source | |
|---|
| 26.00 | Alfa Aesar | | 29.00 | PHYSPROP |
|
|
| | | 2-ethyl anthraquinone C16H12O23, 61, 64 |
 | | Compound Data | | Melting point | 109.17 °C | 382.32 K | | CSID | 6514 | H bond acceptors | 2 | Rule of 5 violations | 0 | | Molecular weight | 236.2653 | H bond donors | 0 | ACD/LogP | 4.38 | | Phase 25 °C | solid | Rotatable bonds | 1 | Predicted density | 1.23 g/cm3 | | SMILES | O=C2c1c(cccc1)C(=O)c3c2ccc(c3)CC | | STD InChIKey | SJEBAWHUJDUKQK-UHFFFAOYAW | | Melting Points | | mp °C | source | |
|---|
| 109.00 | Alfa Aesar | | 109.00 | Oxford University MSDS | | 109.50 | PHYSPROP |
|
|
| | | 2-ethyl-1-butene C6H123, 4, 64 |
 | |
|
| | | 2-ethyl-1,4-dimethylbenzene C10H144, 64 |
 | | Compound Data | | Melting point | -53.85 °C | 219.30 K | | CSID | 14888 | H bond acceptors | 0 | Rule of 5 violations | 0 | | Molecular weight | 134.2182 | H bond donors | 0 | ACD/LogP | 4.13 | | Phase 25 °C | liquid/gas | Rotatable bonds | 1 | Predicted density | 0.87 g/cm3 | | SMILES | c1c(ccc(c1CC)C)C | | STD InChIKey | AXIUBBVSOWPLDA-UHFFFAOYAU | | Melting Points | | mp °C | source | |
|---|
| -54.00 | American Petroleum Institute. Research Project 44; Selected ... | | -53.70 | PHYSPROP |
|
|
| | | 2-ethyl-2-methyl-1,3-propanediol C6H14O22, 64 |
 | | Compound Data | | Melting point | 42.15 °C | 315.30 K | | CSID | 59556 | H bond acceptors | 2 | Rule of 5 violations | 0 | | Molecular weight | 118.1742 | H bond donors | 2 | ACD/LogP | 0.19 | | Phase 25 °C | solid | Rotatable bonds | 5 | Predicted density | 0.96 g/cm3 | | SMILES | OCC(C)(CC)CO | | STD InChIKey | VNAWKNVDKFZFSU-UHFFFAOYAD | | Melting Points | | mp °C | source | |
|---|
| 44.00 | Aldrich Chemical Company; Aldrich Catalog-Handbook of Fine C... | | 40.30 | PHYSPROP |
|
|
| | | 2-ethyl-4-methylimidazole C6H10N23, 64 |
 | | Compound Data | | Melting point | 48.75 °C | 321.90 K | | CSID | 63447 | H bond acceptors | 2 | Rule of 5 violations | 0 | | Molecular weight | 110.157 | H bond donors | 1 | ACD/LogP | 0.62 | | Phase 25 °C | solid | Rotatable bonds | 1 | Predicted density | 1.00 g/cm3 | | SMILES | n1cc(nc1CC)C | | STD InChIKey | ULKLGIFJWFIQFF-UHFFFAOYAC | | Melting Points | | mp °C | source | |
|---|
| 47.00 | Alfa Aesar | | 50.50 | PHYSPROP |
|
|
| | | 2-ethylaniline C8H11N2, 3, 64 |
 | |
|
| | | 2-ethylnaphthalene C12H1259, 59, 61, 64 |
 | | Compound Data | | Melting point | -7.40 °C | 265.75 K | | CSID | 13063 | H bond acceptors | 0 | Rule of 5 violations | 0 | | Molecular weight | 156.2237 | H bond donors | 0 | ACD/LogP | 4.41 | | Phase 25 °C | liquid/gas | Rotatable bonds | 1 | Predicted density | 1.00 g/cm3 | | SMILES | CCc1ccc2ccccc2c1 | | STD InChIKey | RJTJVVYSTUQWNI-UHFFFAOYAX | | Melting Points | | mp °C | source | |
|---|
| -7.45 | NIST Web Book | | -7.35 | NIST Web Book | | -7.40 | PHYSPROP | | Values not used in calculating the average melting point | | 34.85 | NIST Web Book1 | | -70.00 | Oxford University MSDS2 | | 1. clearly out of range JCB | | 2. clearly out of range JCB |
|
|
| | | 2-ethylpyridine C7H9N3, 64 |
 | | Compound Data | | Melting point | -63.05 °C | 210.10 K | | CSID | 7242 | H bond acceptors | 1 | Rule of 5 violations | 0 | | Molecular weight | 107.1531 | H bond donors | 0 | ACD/LogP | 1.72 | | Phase 25 °C | liquid/gas | Rotatable bonds | 1 | Predicted density | 0.93 g/cm3 | | SMILES | n1ccccc1CC | | STD InChIKey | NRGGMCIBEHEAIL-UHFFFAOYAU | | Melting Points | | mp °C | source | |
|---|
| -63.00 | Alfa Aesar | | -63.10 | PHYSPROP |
|
|
| | | 2-fluoro-4-nitrophenol C6H4FNO33, 64 |
 | | Compound Data | | Melting point | 120.00 °C | 393.15 K | | CSID | 9442 | H bond acceptors | 4 | Rule of 5 violations | 0 | | Molecular weight | 157.0993 | H bond donors | 1 | ACD/LogP | 1.70 | | Phase 25 °C | solid | Rotatable bonds | 2 | Predicted density | 1.51 g/cm3 | | SMILES | Fc1cc([N+]([O-])=O)ccc1O | | STD InChIKey | ORPHLVJBJOCHBR-UHFFFAOYAU | | Melting Points | | mp °C | source | |
|---|
| 119.00 | Alfa Aesar | | 121.00 | PHYSPROP |
|
|
| | | 2-fluorobenzaldehyde C7H5FO3, 64 |
 | | Compound Data | | Melting point | -44.75 °C | 228.40 K | | CSID | 21106521 | H bond acceptors | 1 | Rule of 5 violations | 0 | | Molecular weight | 124.1124 | H bond donors | 0 | ACD/LogP | 1.79 | | Phase 25 °C | liquid/gas | Rotatable bonds | 1 | Predicted density | 1.18 g/cm3 | | SMILES | O=Cc1ccccc1F | | STD InChIKey | ZWDVQMVZZYIAHO-UHFFFAOYAA | | Melting Points | | mp °C | source | |
|---|
| -45.00 | Alfa Aesar | | -44.50 | PHYSPROP |
|
|
| | | 2-fluorobenzamide C7H6FNO3, 64 |
 | | Compound Data | | Melting point | 117.00 °C | 390.15 K | | CSID | 61279 | H bond acceptors | 2 | Rule of 5 violations | 0 | | Molecular weight | 139.127 | H bond donors | 2 | ACD/LogP | 0.64 | | Phase 25 °C | solid | Rotatable bonds | 1 | Predicted density | 1.24 g/cm3 | | SMILES | O=C(c1ccccc1F)N | | STD InChIKey | KGGHWIKBOIQEAJ-UHFFFAOYAW | | Melting Points | | mp °C | source | |
|---|
| 116.00 | Alfa Aesar | | 118.00 | PHYSPROP |
|
|
| | | 2-fluorobenzoic acid C7H5FO23, 64 |
 | | Compound Data | | Melting point | 125.25 °C | 398.40 K | | CSID | 9547 | H bond acceptors | 2 | Rule of 5 violations | 0 | | Molecular weight | 140.1118 | H bond donors | 1 | ACD/LogP | 1.86 | | Phase 25 °C | solid | Rotatable bonds | 1 | Predicted density | 1.32 g/cm3 | | SMILES | O=C(O)c1ccccc1F | | STD InChIKey | NSTREUWFTAOOKS-UHFFFAOYAK | | Melting Points | | mp °C | source | |
|---|
| 124.00 | Alfa Aesar | | 126.50 | PHYSPROP |
|
|
| | | 2-fluorobenzoyl chloride C7H4ClFO3, 64 |
 | | Compound Data | | Melting point | 4.50 °C | 277.65 K | | CSID | 9425 | H bond acceptors | 1 | Rule of 5 violations | 0 | | Molecular weight | 158.5575 | H bond donors | 0 | ACD/LogP | 1.84 | | Phase 25 °C | liquid/gas | Rotatable bonds | 1 | Predicted density | 1.32 g/cm3 | | SMILES | O=C(Cl)c1ccccc1F | | STD InChIKey | RAAGZOYMEQDCTD-UHFFFAOYAQ | | Melting Points | | mp °C | source | |
|---|
| 5.00 | Alfa Aesar | | 4.00 | PHYSPROP |
|
|
| | | 2-fluorobiphenyl C12H9F3, 61, 64 |
 | | Compound Data | | Melting point | 73.67 °C | 346.82 K | | CSID | 60900 | H bond acceptors | 0 | Rule of 5 violations | 0 | | Molecular weight | 172.1983 | H bond donors | 0 | ACD/LogP | 4.48 | | Phase 25 °C | solid | Rotatable bonds | 1 | Predicted density | 1.08 g/cm3 | | SMILES | Fc2ccccc2c1ccccc1 | | STD InChIKey | KLECYOQFQXJYBC-UHFFFAOYAW | | Melting Points | | mp °C | source | |
|---|
| 74.00 | Alfa Aesar | | 73.50 | Oxford University MSDS | | 73.50 | PHYSPROP |
|
|
| | | 2-fluoroethanol C2H5FO3, 64 |
 | | Compound Data | | Melting point | -26.70 °C | 246.45 K | | CSID | 9354 | H bond acceptors | 1 | Rule of 5 violations | 0 | | Molecular weight | 64.0589 | H bond donors | 1 | ACD/LogP | -0.47 | | Phase 25 °C | liquid/gas | Rotatable bonds | 2 | Predicted density | 0.99 g/cm3 | | SMILES | FCCO | | STD InChIKey | GGDYAKVUZMZKRV-UHFFFAOYAT | | Melting Points | | mp °C | source | |
|---|
| -27.00 | Alfa Aesar | | -26.40 | PHYSPROP |
|
|
| | | 2-fluorophenol C6H5FO3, 61, 64 |
 | | Compound Data | | Melting point | 15.37 °C | 288.52 K | | CSID | 9326 | H bond acceptors | 1 | Rule of 5 violations | 0 | | Molecular weight | 112.1017 | H bond donors | 1 | ACD/LogP | 1.71 | | Phase 25 °C | liquid/gas | Rotatable bonds | 1 | Predicted density | 1.22 g/cm3 | | SMILES | Fc1ccccc1O | | STD InChIKey | HFHFGHLXUCOHLN-UHFFFAOYAV | | Melting Points | | mp °C | source | |
|---|
| 15.00 | Alfa Aesar | | 15.00 | Oxford University MSDS | | 16.10 | PHYSPROP |
|
|
| | | 2-formylbenzoic acid C8H6O32, 3, 64 |
 | |
|
| | | 2-furaldehyde C5H4O23, 35, 61, 64 |
 | | Compound Data | | Melting point | -37.15 °C | 236.00 K | | CSID | 13863629 | H bond acceptors | 2 | Rule of 5 violations | 0 | | Molecular weight | 96.0841 | H bond donors | 0 | ACD/LogP | 0.71 | | Phase 25 °C | liquid/gas | Rotatable bonds | 1 | Predicted density | 1.15 g/cm3 | | SMILES | c1cc(oc1)C=O | | STD InChIKey | HYBBIBNJHNGZAN-UHFFFAOYAD | | Melting Points | | mp °C | source | |
|---|
| -38.00 | Alfa Aesar | | -36.50 | EPISuite-ChemSpider | | -36.00 | Oxford University MSDS | | -38.10 | PHYSPROP |
|
|
| | | 2-furoic acid C5H4O33, 35, 64 |
 | | Compound Data | | Melting point | 132.33 °C | 405.48 K | | CSID | 10251740 | H bond acceptors | 3 | Rule of 5 violations | 0 | | Molecular weight | 112.0835 | H bond donors | 1 | ACD/LogP | 0.64 | | Phase 25 °C | solid | Rotatable bonds | 1 | Predicted density | 1.32 g/cm3 | | SMILES | OC(=O)c1ccco1 | | STD InChIKey | SMNDYUVBFMFKNZ-UHFFFAOYAH | | Melting Points | | mp °C | source | |
|---|
| 130.00 | Alfa Aesar | | 133.50 | EPISuite-ChemSpider | | 133.50 | PHYSPROP |
|
|
| | | 2-furoic acid hydrazide C5H6N2O23, 48 |
 | | Compound Data | | Melting point | 79.50 °C | 352.65 K | | CSID | 17687 | H bond acceptors | 4 | Rule of 5 violations | 0 | | Molecular weight | 126.1133 | H bond donors | 3 | ACD/LogP | -0.59 | | Phase 25 °C | solid | Rotatable bonds | 2 | Predicted density | 1.26 g/cm3 | | SMILES | O=C(NN)c1occc1 | | STD InChIKey | SKTSVWWOAIAIKI-UHFFFAOYAV | | Melting Points | | mp °C | source | |
|---|
| 79.00 | Alfa Aesar | | 80.00 | Karthikeyan M.; Glen R.C.; Bender A. General melting point p... |
|
|
| | | 2-furoyl chloride C5H3ClO23, 64, 64 |
 | | Compound Data | | Melting point | -1.67 °C | 271.48 K | | CSID | 13861158 | H bond acceptors | 2 | Rule of 5 violations | 0 | | Molecular weight | 130.5291 | H bond donors | 0 | ACD/LogP | 1.37 | | Phase 25 °C | liquid/gas | Rotatable bonds | 1 | Predicted density | 1.32 g/cm3 | | SMILES | ClC(=O)c1ccco1 | | STD InChIKey | OFTKFKYVSBNYEC-UHFFFAOYAN | | Melting Points | | mp °C | source | |
|---|
| -1.00 | Alfa Aesar | | -2.00 | PHYSPROP | | -2.00 | PHYSPROP |
|
|
| | | 2-hexyne C6H103, 4, 64 |
 | |
|
| | | 2-hexynoic acid C6H8O23, 64 |
 | | Compound Data | | Melting point | 26.00 °C | 299.15 K | | CSID | 287294 | H bond acceptors | 2 | Rule of 5 violations | 0 | | Molecular weight | 112.1265 | H bond donors | 1 | ACD/LogP | 1.92 | | Phase 25 °C | solid | Rotatable bonds | 2 | Predicted density | 1.06 g/cm3 | | SMILES | O=C(C#CCCC)O | | STD InChIKey | AKYAUBWOTZJUBI-UHFFFAOYAU | | Melting Points | | mp °C | source | |
|---|
| 25.00 | Alfa Aesar | | 27.00 | PHYSPROP |
|
|
| | | 2-hydroxy-1-naphthaldehyde C11H8O23, 64 |
 | | Compound Data | | Melting point | 81.00 °C | 354.15 K | | CSID | 12291 | H bond acceptors | 2 | Rule of 5 violations | 0 | | Molecular weight | 172.18 | H bond donors | 1 | ACD/LogP | 2.84 | | Phase 25 °C | solid | Rotatable bonds | 2 | Predicted density | 1.29 g/cm3 | | SMILES | O=Cc1c2c(ccc1O)cccc2 | | STD InChIKey | NTCCNERMXRIPTR-UHFFFAOYAU | | Melting Points | | mp °C | source | |
|---|
| 79.00 | Alfa Aesar | | 83.00 | PHYSPROP |
|
|
| | | 2-hydroxy-3-methoxybenzaldehyde C8H8O33, 35, 61, 64 |
 | | Compound Data | | Melting point | 42.75 °C | 315.90 K | | CSID | 21105848 | H bond acceptors | 3 | Rule of 5 violations | 0 | | Molecular weight | 152.1473 | H bond donors | 1 | ACD/LogP | 1.40 | | Phase 25 °C | solid | Rotatable bonds | 3 | Predicted density | 1.23 g/cm3 | | SMILES | Oc1c(cccc1OC)C=O | | STD InChIKey | JJVNINGBHGBWJH-UHFFFAOYAB | | Melting Points | | mp °C | source | |
|---|
| 41.00 | Alfa Aesar | | 44.50 | EPISuite-ChemSpider | | 41.00 | Oxford University MSDS | | 44.50 | PHYSPROP |
|
|
| | | 2-hydroxy-3-methoxybenzoic acid C8H8O43, 64 |
 | | Compound Data | | Melting point | 151.50 °C | 424.65 K | | CSID | 63328 | H bond acceptors | 4 | Rule of 5 violations | 0 | | Molecular weight | 168.1467 | H bond donors | 2 | ACD/LogP | 1.98 | | Phase 25 °C | solid | Rotatable bonds | 3 | Predicted density | 1.35 g/cm3 | | SMILES | O=C(O)c1cccc(OC)c1O | | STD InChIKey | AUZQQIPZESHNMG-UHFFFAOYAG | | Melting Points | | mp °C | source | |
|---|
| 152.00 | Alfa Aesar | | 151.00 | PHYSPROP |
|
|
| | | 2-hydroxy-4-methoxybenzophenone C14H12O33, 64 |
 | | Compound Data | | Melting point | 64.75 °C | 337.90 K | | CSID | 4471 | H bond acceptors | 3 | Rule of 5 violations | 0 | | Molecular weight | 228.2433 | H bond donors | 1 | ACD/LogP | 3.64 | | Phase 25 °C | solid | Rotatable bonds | 4 | Predicted density | 1.20 g/cm3 | | SMILES | O=C(c1ccc(OC)cc1O)c2ccccc2 | | STD InChIKey | DXGLGDHPHMLXJC-UHFFFAOYAX | | Melting Points | | mp °C | source | |
|---|
| 64.00 | Alfa Aesar | | 65.50 | PHYSPROP |
|
|
| | | 2-hydroxy-4-octyloxybenzophenone C21H26O33, 64 |
 | | Compound Data | | Melting point | 48.25 °C | 321.40 K | | CSID | 15020 | H bond acceptors | 3 | Rule of 5 violations | 1 | | Molecular weight | 326.4293 | H bond donors | 1 | ACD/LogP | 7.36 | | Phase 25 °C | solid | Rotatable bonds | 11 | Predicted density | 1.07 g/cm3 | | SMILES | O=C(c1ccc(OCCCCCCCC)cc1O)c2ccccc2 | | STD InChIKey | QUAMTGJKVDWJEQ-UHFFFAOYAM | | Melting Points | | mp °C | source | |
|---|
| 48.00 | Alfa Aesar | | 48.50 | PHYSPROP |
|
|
| | | 2-hydroxy-5-methylacetophenone C9H10O23, 64 |
 | | Compound Data | | Melting point | 48.50 °C | 321.65 K | | CSID | 14340 | H bond acceptors | 2 | Rule of 5 violations | 0 | | Molecular weight | 150.1745 | H bond donors | 1 | ACD/LogP | 2.42 | | Phase 25 °C | solid | Rotatable bonds | 2 | Predicted density | 1.11 g/cm3 | | SMILES | O=C(c1cc(ccc1O)C)C | | STD InChIKey | YNPDFBFVMJNGKZ-UHFFFAOYAB | | Melting Points | | mp °C | source | |
|---|
| 47.00 | Alfa Aesar | | 50.00 | PHYSPROP |
|
|
| | | 2-hydroxy-5-nitrobenzaldehyde C7H5NO43, 64 |
 | | Compound Data | | Melting point | 127.00 °C | 400.15 K | | CSID | 60173 | H bond acceptors | 5 | Rule of 5 violations | 0 | | Molecular weight | 167.1189 | H bond donors | 1 | ACD/LogP | 2.08 | | Phase 25 °C | solid | Rotatable bonds | 3 | Predicted density | 1.50 g/cm3 | | SMILES | O=Cc1cc(ccc1O)[N+]([O-])=O | | STD InChIKey | IHFRMUGEILMHNU-UHFFFAOYAV | | Melting Points | | mp °C | source | |
|---|
| 125.00 | Alfa Aesar | | 129.00 | PHYSPROP |
|
|
| | | 2-hydroxy-N-phenylbenzamide C13H11NO23, 64 |
 | | Compound Data | | Melting point | 136.75 °C | 409.90 K | | CSID | 6610 | H bond acceptors | 3 | Rule of 5 violations | 0 | | Molecular weight | 213.2319 | H bond donors | 2 | ACD/LogP | 3.27 | | Phase 25 °C | solid | Rotatable bonds | 3 | Predicted density | 1.28 g/cm3 | | SMILES | O=C(c1ccccc1O)Nc2ccccc2 | | STD InChIKey | WKEDVNSFRWHDNR-UHFFFAOYAI | | Melting Points | | mp °C | source | |
|---|
| 137.00 | Alfa Aesar | | 136.50 | PHYSPROP |
|
|
| | | 2-hydroxyacetophenone C10H8N23, 64 |
 | | Compound Data | | Melting point | 61.25 °C | 334.40 K | | CSID | 61763 | H bond acceptors | 2 | Rule of 5 violations | 0 | | Molecular weight | 156.1839 | H bond donors | 0 | ACD/LogP | 1.24 | | Phase 25 °C | solid | Rotatable bonds | 1 | Predicted density | 1.11 g/cm3 | | SMILES | n2ccc(c1ncccc1)cc2 | | STD InChIKey | RMHQDKYZXJVCME-UHFFFAOYAG | | Melting Points | | mp °C | source | |
|---|
| 61.00 | Alfa Aesar | | 61.50 | PHYSPROP |
|
|
| | | 2-hydroxybenzhydrazide C7H8N2O23, 64 |
 | | Compound Data | | Melting point | 148.25 °C | 421.40 K | | CSID | 13048 | H bond acceptors | 4 | Rule of 5 violations | 0 | | Molecular weight | 152.1506 | H bond donors | 4 | ACD/LogP | 0.60 | | Phase 25 °C | solid | Rotatable bonds | 3 | Predicted density | 1.32 g/cm3 | | SMILES | O=C(c1ccccc1O)NN | | STD InChIKey | XSXYESVZDBAKKT-UHFFFAOYAC | | Melting Points | | mp °C | source | |
|---|
| 148.00 | Alfa Aesar | | 148.50 | PHYSPROP |
|
|
| | | 2-hydroxybenzophenone C13H10O23, 64 |
 | | Compound Data | | Melting point | 39.50 °C | 312.65 K | | CSID | 8045 | H bond acceptors | 2 | Rule of 5 violations | 0 | | Molecular weight | 198.2173 | H bond donors | 1 | ACD/LogP | 3.47 | | Phase 25 °C | solid | Rotatable bonds | 3 | Predicted density | 1.19 g/cm3 | | SMILES | O=C(c1ccccc1O)c2ccccc2 | | STD InChIKey | HJIAMFHSAAEUKR-UHFFFAOYAQ | | Melting Points | | mp °C | source | |
|---|
| 39.00 | Alfa Aesar | | 40.00 | PHYSPROP |
|
|
| | | 2-hydroxybenzothiazole C7H5NOS3, 64 |
 | | Compound Data | | Melting point | 138.50 °C | 411.65 K | | CSID | 13036 | H bond acceptors | 2 | Rule of 5 violations | 0 | | Molecular weight | 151.1857 | H bond donors | 1 | ACD/LogP | 1.76 | | Phase 25 °C | solid | Rotatable bonds | 0 | Predicted density | 1.37 g/cm3 | | SMILES | O=C2Sc1ccccc1N2 | | STD InChIKey | YEDUAINPPJYDJZ-UHFFFAOYAF | | Melting Points | | mp °C | source | |
|---|
| 138.00 | Alfa Aesar | | 139.00 | PHYSPROP |
|
|
| | | 2-hydroxycarbazole C12H9NO3, 64 |
 | | Compound Data | | Melting point | 271.75 °C | 544.90 K | | CSID | 84451 | H bond acceptors | 2 | Rule of 5 violations | 0 | | Molecular weight | 183.206 | H bond donors | 2 | ACD/LogP | 2.98 | | Phase 25 °C | solid | Rotatable bonds | 1 | Predicted density | 1.36 g/cm3 | | SMILES | Oc3ccc2c1ccccc1nc2c3 | | STD InChIKey | GWPGDZPXOZATKL-UHFFFAOYAN | | Melting Points | | mp °C | source | |
|---|
| 272.00 | Alfa Aesar | | 271.50 | PHYSPROP |
|
|
| | | 2-hydroxyphenylacetic acid C8H8O33, 48, 64 |
 | |
|
| | | 2-hydroxypyridine C5H5NO3, 64, 64 |
 | | Compound Data | | Melting point | 107.53 °C | 380.68 K | | CSID | 8537 | H bond acceptors | 2 | Rule of 5 violations | 0 | | Molecular weight | 95.0993 | H bond donors | 1 | ACD/LogP | -0.58 | | Phase 25 °C | solid | Rotatable bonds | 0 | Predicted density | 1.11 g/cm3 | | SMILES | c1cc[nH]c(=O)c1 | | STD InChIKey | UBQKCCHYAOITMY-UHFFFAOYAK | | Melting Points | | mp °C | source | |
|---|
| 107.00 | Alfa Aesar | | 107.80 | PHYSPROP | | 107.80 | PHYSPROP |
|
|
| | | 2-hydroxytoluene C7H8O3, 31, 61, 64 |
 | |
|
| | | 2-indanone C9H8O3, 64 |
 | | Compound Data | | Melting point | 56.50 °C | 329.65 K | | CSID | 11488 | H bond acceptors | 1 | Rule of 5 violations | 0 | | Molecular weight | 132.1592 | H bond donors | 0 | ACD/LogP | 1.23 | | Phase 25 °C | solid | Rotatable bonds | 0 | Predicted density | 1.15 g/cm3 | | SMILES | O=C2Cc1ccccc1C2 | | STD InChIKey | UMJJFEIKYGFCAT-UHFFFAOYAK | | Melting Points | | mp °C | source | |
|---|
| 54.00 | Alfa Aesar | | 59.00 | PHYSPROP |
|
|
| | | 2-iodaniline C6H6IN2, 3, 64 |
 | |
|
| | | 2-iodo-1,3-dimethylbenzene C8H9I7, 64 |
 | | Compound Data | | Melting point | 11.10 °C | 284.25 K | | CSID | 62314 | H bond acceptors | 0 | Rule of 5 violations | 0 | | Molecular weight | 232.0615 | H bond donors | 0 | ACD/LogP | 4.17 | | Phase 25 °C | liquid/gas | Rotatable bonds | 0 | Predicted density | 1.61 g/cm3 | | SMILES | Ic1c(cccc1C)C | | STD InChIKey | QTUGGVBKWIYQSS-UHFFFAOYAW | | Melting Points | | mp °C | source | |
|---|
| 11.00 | Beilstein F. K.; Beilsteins Handbuch der Organischen Chemie.... | | 11.20 | PHYSPROP |
|
|
| | | 2-iodo-2-methylpropane C4H9I2, 3, 61, 64 |
 | |
|
| | | 2-iodoacetamide C2H4INO3, 61, 64 |
 | | Compound Data | | Melting point | 94.00 °C | 367.15 K | | CSID | 3596 | H bond acceptors | 2 | Rule of 5 violations | 0 | | Molecular weight | 184.9637 | H bond donors | 2 | ACD/LogP | 0.00 | | Phase 25 °C | solid | Rotatable bonds | 1 | Predicted density | 2.28 g/cm3 | | SMILES | C(C(=O)N)I | | STD InChIKey | PGLTVOMIXTUURA-UHFFFAOYAE | | Melting Points | | mp °C | source | |
|---|
| 93.50 | Alfa Aesar | | 94.00 | Oxford University MSDS | | 94.50 | PHYSPROP | | Values not used in calculating the average melting point | | -94.00 | Alfa Aesar1 | | 1. sign inversion JCB |
|
|
| | | 2-iodobenzoic acid C7H5IO22, 3, 61, 64 |
 | |
|
| | | 2-iodobenzyl alcohol C7H7IO2, 3, 64 |
 | |
|
| | | 2-iodophenol C6H5IO3, 7, 56, 61, 64, 72 |
 | |
|
| | | 2-isopropyl-1-methyl-5-nitroimidazole C7H11N3O264, 70 |
 | | Compound Data | | Melting point | 60.50 °C | 333.65 K | | CSID | 25097 | H bond acceptors | 5 | Rule of 5 violations | 0 | | Molecular weight | 169.1811 | H bond donors | 0 | ACD/LogP | 1.19 | | Phase 25 °C | solid | Rotatable bonds | 2 | Predicted density | 1.25 g/cm3 | | SMILES | [O-][N+](=O)c1cnc(n1C)C(C)C | | STD InChIKey | NTAFJUSDNOSFFY-UHFFFAOYAB | | Melting Points | | mp °C | source | |
|---|
| 60.00 | PHYSPROP | | 61.00 | Sepassi K; Yalkowsky SH. AAPS PharmSciTech 7(1) E1-E8 (2006) |
|
|
| | | 2-isopropylnaphthalene C13H143, 64 |
 | | Compound Data | | Melting point | 14.25 °C | 287.40 K | | CSID | 15410 | H bond acceptors | 0 | Rule of 5 violations | 0 | | Molecular weight | 170.2503 | H bond donors | 0 | ACD/LogP | 4.79 | | Phase 25 °C | liquid/gas | Rotatable bonds | 1 | Predicted density | 0.98 g/cm3 | | SMILES | c12ccccc1ccc(c2)C(C)C | | STD InChIKey | TVYVQNHYIHAJTD-UHFFFAOYAA | | Melting Points | | mp °C | source | |
|---|
| 14.00 | Alfa Aesar | | 14.50 | PHYSPROP |
|
|
| | | 2-isopropylphenol C9H12O2, 2, 3, 64 |
 | |
|
| | | 2-ketoglutaric acid C5H6O53, 35, 64 |
 | | Compound Data | | Melting point | 115.33 °C | 388.48 K | | CSID | 50 | H bond acceptors | 5 | Rule of 5 violations | 0 | | Molecular weight | 146.0981 | H bond donors | 2 | ACD/LogP | -1.43 | | Phase 25 °C | solid | Rotatable bonds | 4 | Predicted density | 1.50 g/cm3 | | SMILES | O=C(O)C(=O)CCC(=O)O | | STD InChIKey | KPGXRSRHYNQIFN-UHFFFAOYAN | | Melting Points | | mp °C | source | |
|---|
| 115.00 | Alfa Aesar | | 115.50 | EPISuite-ChemSpider | | 115.50 | PHYSPROP |
|
|
| | | 2-mercapto-4-methylthiazole C4H5NS23, 64 |
 | | Compound Data | | Melting point | 88.65 °C | 361.80 K | | CSID | 1013221 | H bond acceptors | 1 | Rule of 5 violations | 0 | | Molecular weight | 131.2192 | H bond donors | 1 | ACD/LogP | 1.48 | | Phase 25 °C | solid | Rotatable bonds | 0 | Predicted density | 1.36 g/cm3 | | SMILES | S=C1S\C=C(/N1)C | | STD InChIKey | NLHAIPFBNQZTMY-UHFFFAOYAK | | Melting Points | | mp °C | source | |
|---|
| 88.00 | Alfa Aesar | | 89.30 | PHYSPROP |
|
|
| | | 2-mercapto-5-methyl-1,3,4-thiadiazole C3H4N2S23, 48 |
 | | Compound Data | | Melting point | 185.50 °C | 458.65 K | | CSID | 1414905 | H bond acceptors | 2 | Rule of 5 violations | 0 | | Molecular weight | 132.2073 | H bond donors | 1 | ACD/LogP | -0.26 | | Phase 25 °C | solid | Rotatable bonds | 0 | Predicted density | 1.58 g/cm3 | | SMILES | S=C1S\C(=N/N1)C | | STD InChIKey | FPVUWZFFEGYCGB-UHFFFAOYAO | | Melting Points | | mp °C | source | |
|---|
| 184.00 | Alfa Aesar | | 187.00 | Karthikeyan M.; Glen R.C.; Bender A. General melting point p... |
|
|
| | | 2-mercaptoimidazole C3H4N2S3, 64 |
 | | Compound Data | | Melting point | 227.25 °C | 500.40 K | | CSID | 1013196 | H bond acceptors | 2 | Rule of 5 violations | 0 | | Molecular weight | 100.1423 | H bond donors | 2 | ACD/LogP | 0.21 | | Phase 25 °C | solid | Rotatable bonds | 0 | Predicted density | 1.36 g/cm3 | | SMILES | S=C1N\C=C/N1 | | STD InChIKey | OXFSTTJBVAAALW-UHFFFAOYAJ | | Melting Points | | mp °C | source | |
|---|
| 225.00 | Alfa Aesar | | 229.50 | PHYSPROP |
|
|
| | | 2-mercaptothiazoline C3H5NS23, 64 |
 | | Compound Data | | Melting point | 105.50 °C | 378.65 K | | CSID | 2005898 | H bond acceptors | 1 | Rule of 5 violations | 0 | | Molecular weight | 119.2085 | H bond donors | 1 | ACD/LogP | 0.82 | | Phase 25 °C | solid | Rotatable bonds | 0 | Predicted density | 1.38 g/cm3 | | SMILES | S=C1SCCN1 | | STD InChIKey | WGJCBBASTRWVJL-UHFFFAOYAV | | Melting Points | | mp °C | source | |
|---|
| 105.00 | Alfa Aesar | | 106.00 | PHYSPROP |
|
|
| | | 2-methoxy-1-naphthaldehyde C12H10O23, 3 |
 | | Compound Data | | Melting point | 83.50 °C | 356.65 K | | CSID | 71672 | H bond acceptors | 2 | Rule of 5 violations | 0 | | Molecular weight | 186.2066 | H bond donors | 0 | ACD/LogP | 2.95 | | Phase 25 °C | solid | Rotatable bonds | 2 | Predicted density | 1.17 g/cm3 | | SMILES | O=Cc1c2c(ccc1OC)cccc2 | | STD InChIKey | YIQGLTKAOHRZOL-UHFFFAOYAN | | Melting Points | | mp °C | source | |
|---|
| 84.00 | Alfa Aesar | | 83.00 | Alfa Aesar |
|
|
| | | 2-methoxy-4-methylphenol C8H10O23, 64 |
 | | Compound Data | | Melting point | 5.75 °C | 278.90 K | | CSID | 21105936 | H bond acceptors | 2 | Rule of 5 violations | 0 | | Molecular weight | 138.1638 | H bond donors | 1 | ACD/LogP | 1.65 | | Phase 25 °C | liquid/gas | Rotatable bonds | 2 | Predicted density | 1.08 g/cm3 | | SMILES | Oc1ccc(C)cc1OC | | STD InChIKey | PETRWTHZSKVLRE-UHFFFAOYAK | | Melting Points | | mp °C | source | |
|---|
| 6.00 | Alfa Aesar | | 5.50 | PHYSPROP |
|
|
| | | 2-methoxy-4-nitroaniline C7H8N2O33, 64 |
 | | Compound Data | | Melting point | 140.50 °C | 413.65 K | | CSID | 7060 | H bond acceptors | 5 | Rule of 5 violations | 0 | | Molecular weight | 168.15 | H bond donors | 2 | ACD/LogP | 1.85 | | Phase 25 °C | solid | Rotatable bonds | 3 | Predicted density | 1.32 g/cm3 | | SMILES | [O-][N+](=O)c1cc(OC)c(N)cc1 | | STD InChIKey | GVBHRNIWBGTNQA-UHFFFAOYAF | | Melting Points | | mp °C | source | |
|---|
| 140.00 | Alfa Aesar | | 141.00 | PHYSPROP |
|
|
| | | 2-methoxy-5-chloroaniline C7H8ClNO2, 3 |
 | | Compound Data | | Melting point | 82.50 °C | 355.65 K | | CSID | 60129 | H bond acceptors | 2 | Rule of 5 violations | 0 | | Molecular weight | 157.5975 | H bond donors | 2 | ACD/LogP | 2.06 | | Phase 25 °C | solid | Rotatable bonds | 2 | Predicted density | 1.23 g/cm3 | | SMILES | Clc1cc(c(OC)cc1)N | | STD InChIKey | WBSMIPLNPSCJFS-UHFFFAOYAK | | Melting Points | | mp °C | source | |
|---|
| 83.00 | Aldrich Chemical Company; Aldrich Catalog-Handbook of Fine C... | | 82.00 | Alfa Aesar |
|
|
| | | 2-methoxy-5-nitroaniline C7H8N2O33, 61, 64 |
 | | Compound Data | | Melting point | 117.67 °C | 390.82 K | | CSID | 7167 | H bond acceptors | 5 | Rule of 5 violations | 0 | | Molecular weight | 168.15 | H bond donors | 2 | ACD/LogP | 1.69 | | Phase 25 °C | solid | Rotatable bonds | 3 | Predicted density | 1.32 g/cm3 | | SMILES | [O-][N+](=O)c1ccc(OC)c(N)c1 | | STD InChIKey | NIPDVSLAMPAWTP-UHFFFAOYAL | | Melting Points | | mp °C | source | |
|---|
| 117.00 | Alfa Aesar | | 118.00 | Oxford University MSDS | | 118.00 | PHYSPROP |
|
|
| | | 2-methoxyaniline C7H9NO2, 3, 61, 64 |
 | |
|
| | | 2-methoxybenzaldehyde C8H8O22, 3, 64 |
 | |
|
| | | 2-methoxybenzoic acid C8H8O32, 3, 35, 64 |
 | |
|
| | | 2-methoxybenzophenone C14H12O23, 64 |
 | | Compound Data | | Melting point | 39.00 °C | 312.15 K | | CSID | 68220 | H bond acceptors | 2 | Rule of 5 violations | 0 | | Molecular weight | 212.2439 | H bond donors | 0 | ACD/LogP | 3.15 | | Phase 25 °C | solid | Rotatable bonds | 3 | Predicted density | 1.11 g/cm3 | | SMILES | O=C(c1ccccc1OC)c2ccccc2 | | STD InChIKey | CSUUDNFYSFENAE-UHFFFAOYAU | | Melting Points | | mp °C | source | |
|---|
| 37.00 | Alfa Aesar | | 41.00 | PHYSPROP |
|
|
| | | 2-methoxybiphenyl C13H12O3, 7, 64 |
 | |
|
| | | 2-methoxyethanol C3H8O22, 3, 32, 61, 64 |
 | |
|
| | | 2-methoxyethyl acetate C5H10O32, 64 |
 | | Compound Data | | Melting point | -65.05 °C | 208.10 K | | CSID | 13864773 | H bond acceptors | 3 | Rule of 5 violations | 0 | | Molecular weight | 118.1311 | H bond donors | 0 | ACD/LogP | 0.00 | | Phase 25 °C | liquid/gas | Rotatable bonds | 4 | Predicted density | 0.98 g/cm3 | | SMILES | CC(=O)OCCOC | | STD InChIKey | XLLIQLLCWZCATF-UHFFFAOYAF | | Melting Points | | mp °C | source | |
|---|
| -65.00 | Aldrich Chemical Company; Aldrich Catalog-Handbook of Fine C... | | -65.10 | PHYSPROP |
|
|
| | | 2-methoxyhydroquinone C7H8O33, 64 |
 | | Compound Data | | Melting point | 89.50 °C | 362.65 K | | CSID | 63180 | H bond acceptors | 3 | Rule of 5 violations | 0 | | Molecular weight | 140.1366 | H bond donors | 2 | ACD/LogP | 0.71 | | Phase 25 °C | solid | Rotatable bonds | 3 | Predicted density | 1.27 g/cm3 | | SMILES | COc1cc(ccc1O)O | | STD InChIKey | LAQYHRQFABOIFD-UHFFFAOYAC | | Melting Points | | mp °C | source | |
|---|
| 89.00 | Alfa Aesar | | 90.00 | PHYSPROP |
|
|
| | | 2-methoxynaphthalene C11H10O3, 61, 64 |
 | | Compound Data | | Melting point | 73.17 °C | 346.32 K | | CSID | 6852 | H bond acceptors | 1 | Rule of 5 violations | 0 | | Molecular weight | 158.1965 | H bond donors | 0 | ACD/LogP | 3.36 | | Phase 25 °C | solid | Rotatable bonds | 1 | Predicted density | 1.07 g/cm3 | | SMILES | O(c2ccc1c(cccc1)c2)C | | STD InChIKey | LUZDYPLAQQGJEA-UHFFFAOYAR | | Melting Points | | mp °C | source | |
|---|
| 72.00 | Alfa Aesar | | 74.00 | Oxford University MSDS | | 73.50 | PHYSPROP |
|
|
| | | 2-methoxyphenyl benzoate C14H12O33, 64 |
 | | Compound Data | | Melting point | 58.25 °C | 331.40 K | | CSID | 61569 | H bond acceptors | 3 | Rule of 5 violations | 0 | | Molecular weight | 228.2433 | H bond donors | 0 | ACD/LogP | 3.52 | | Phase 25 °C | solid | Rotatable bonds | 4 | Predicted density | 1.16 g/cm3 | | SMILES | O=C(Oc1ccccc1OC)c2ccccc2 | | STD InChIKey | IZYQCDNLUPLXOO-UHFFFAOYAC | | Melting Points | | mp °C | source | |
|---|
| 59.00 | Alfa Aesar | | 57.50 | PHYSPROP |
|
|
| | | 2-methoxyphenylacetonitrile C9H9NO2, 3, 64 |
 | |
|
| | | 2-methyl benzyl chloride C8H9Cl3, 61 |
 | | Compound Data | | Melting point | 0.00 °C | 273.15 K | | CSID | 21106134 | H bond acceptors | 0 | Rule of 5 violations | 0 | | Molecular weight | 140.6101 | H bond donors | 0 | ACD/LogP | 2.95 | | Phase 25 °C | liquid/gas | Rotatable bonds | 1 | Predicted density | 1.05 g/cm3 | | SMILES | Cc1ccccc1CCl | | STD InChIKey | VQRBXYBBGHOGFT-UHFFFAOYAS | | Melting Points | | mp °C | source | |
|---|
| 2.00 | Alfa Aesar | | -2.00 | Oxford University MSDS |
|
|
| | | 2-methyl-1-butene C5H103, 4, 61, 64 |
 | |
|
| | | 2-methyl-1-hexene C7H144, 64 |
 | | Compound Data | | Melting point | -102.90 °C | 170.25 K | | CSID | 21073 | H bond acceptors | 0 | Rule of 5 violations | 0 | | Molecular weight | 98.1861 | H bond donors | 0 | ACD/LogP | 3.99 | | Phase 25 °C | liquid/gas | Rotatable bonds | 3 | Predicted density | 0.71 g/cm3 | | SMILES | C=C(/C)CCCC | | STD InChIKey | IRUDSQHLKGNCGF-UHFFFAOYAD | | Melting Points | | mp °C | source | |
|---|
| -103.00 | American Petroleum Institute. Research Project 44; Selected ... | | -102.80 | PHYSPROP |
|
|
| | | 2-methyl-1-nitroanthraquinone C15H9NO448, 64 |
 | | Compound Data | | Melting point | 269.25 °C | 542.40 K | | CSID | 29156 | H bond acceptors | 5 | Rule of 5 violations | 0 | | Molecular weight | 267.2363 | H bond donors | 0 | ACD/LogP | 3.67 | | Phase 25 °C | solid | Rotatable bonds | 1 | Predicted density | 1.43 g/cm3 | | SMILES | [O-][N+](=O)c3c(ccc2C(=O)c1ccccc1C(=O)c23)C | | STD InChIKey | FYXKXZFTZBYYNP-UHFFFAOYAD | | Melting Points | | mp °C | source | |
|---|
| 268.00 | Karthikeyan M.; Glen R.C.; Bender A. General melting point p... | | 270.50 | PHYSPROP |
|
|
| | | 2-methyl-1-octene C9H184, 64 |
 | | Compound Data | | Melting point | -77.90 °C | 195.25 K | | CSID | 70705 | H bond acceptors | 0 | Rule of 5 violations | 1 | | Molecular weight | 126.2392 | H bond donors | 0 | ACD/LogP | 5.05 | | Phase 25 °C | liquid/gas | Rotatable bonds | 5 | Predicted density | 0.73 g/cm3 | | SMILES | C=C(/C)CCCCCC | | STD InChIKey | FBEDQPGLIKZGIN-UHFFFAOYAQ | | Melting Points | | mp °C | source | |
|---|
| -78.00 | American Petroleum Institute. Research Project 44; Selected ... | | -77.80 | PHYSPROP |
|
|
| | | 2-methyl-1-pentene C6H123, 4, 64 |
 | |
|
| | | 2-methyl-1,3-dinitrobenzene C7H6N2O42, 3, 61, 64 |
 | |
|
| | | 2-methyl-2-butanol C5H12O3, 4, 64 |
 | |
|
| | | 2-methyl-2-butene C5H103, 4, 61, 64 |
 | |
|
| | | 2-methyl-2-heptanol C8H18O64, 82 |
 | | Compound Data | | Melting point | -50.20 °C | 222.95 K | | CSID | 11741 | H bond acceptors | 1 | Rule of 5 violations | 0 | | Molecular weight | 130.2279 | H bond donors | 1 | ACD/LogP | 2.63 | | Phase 25 °C | liquid/gas | Rotatable bonds | 5 | Predicted density | 0.82 g/cm3 | | SMILES | OC(C)(C)CCCCC | | STD InChIKey | ACBMYYVZWKYLIP-UHFFFAOYAE | | Melting Points | | mp °C | source | |
|---|
| -50.40 | PHYSPROP | | -50.00 | Wilhoit R. C. Physical and Thermodynamic Properties of Aliph... |
|
|
| | | 2-methyl-2-hexene C7H144, 4, 64 |
 | |
|
| | | 2-methyl-2-nitro-1,3-propanediol C4H9NO43, 64 |
 | | Compound Data | | Melting point | 150.05 °C | 423.20 K | | CSID | 6235 | H bond acceptors | 5 | Rule of 5 violations | 0 | | Molecular weight | 135.1186 | H bond donors | 2 | ACD/LogP | 0.14 | | Phase 25 °C | solid | Rotatable bonds | 5 | Predicted density | 1.32 g/cm3 | | SMILES | [O-][N+](=O)C(C)(CO)CO | | STD InChIKey | LOTYADDQWWVBDJ-UHFFFAOYAT | | Melting Points | | mp °C | source | |
|---|
| 150.00 | Alfa Aesar | | 150.10 | PHYSPROP |
|
|
| | | 2-methyl-2-pentanol C6H14O3, 4, 64 |
 | |
|
| | | 2-methyl-2-phenylpropanoic acid C10H12O23, 48 |
 | | Compound Data | | Melting point | 80.00 °C | 353.15 K | | CSID | 12667 | H bond acceptors | 2 | Rule of 5 violations | 0 | | Molecular weight | 164.2011 | H bond donors | 1 | ACD/LogP | 2.20 | | Phase 25 °C | solid | Rotatable bonds | 2 | Predicted density | 1.09 g/cm3 | | SMILES | O=C(O)C(c1ccccc1)(C)C | | STD InChIKey | YYEROYLAYAVZNW-UHFFFAOYAE | | Melting Points | | mp °C | source | |
|---|
| 81.00 | Alfa Aesar | | 79.00 | Karthikeyan M.; Glen R.C.; Bender A. General melting point p... |
|
|
| | | 2-methyl-3-butyn-2-ol C5H8O3, 61, 64 |
 | | Compound Data | | Melting point | 2.87 °C | 276.02 K | | CSID | 21106133 | H bond acceptors | 1 | Rule of 5 violations | 0 | | Molecular weight | 84.1164 | H bond donors | 1 | ACD/LogP | 0.38 | | Phase 25 °C | liquid/gas | Rotatable bonds | 1 | Predicted density | 0.91 g/cm3 | | SMILES | CC(C)(C#C)O | | STD InChIKey | CEBKHWWANWSNTI-UHFFFAOYAU | | Melting Points | | mp °C | source | |
|---|
| 3.00 | Alfa Aesar | | 2.60 | Oxford University MSDS | | 3.00 | PHYSPROP |
|
|
| | | 2-methyl-3-hexyne C7H124, 64 |
 | | Compound Data | | Melting point | -116.85 °C | 156.30 K | | CSID | 454272 | H bond acceptors | 0 | Rule of 5 violations | 0 | | Molecular weight | 96.1702 | H bond donors | 0 | ACD/LogP | 2.87 | | Phase 25 °C | liquid/gas | Rotatable bonds | 1 | Predicted density | 0.75 g/cm3 | | SMILES | C(#CC(C)C)CC | | STD InChIKey | POBOUPFSQKXZFZ-UHFFFAOYAX | | Melting Points | | mp °C | source | |
|---|
| -117.00 | American Petroleum Institute. Research Project 44; Selected ... | | -116.70 | PHYSPROP |
|
|
| | | 2-methyl-3-nitroaniline C7H8N2O23, 64 |
 | | Compound Data | | Melting point | 91.00 °C | 364.15 K | | CSID | 11290 | H bond acceptors | 4 | Rule of 5 violations | 0 | | Molecular weight | 152.1506 | H bond donors | 2 | ACD/LogP | 1.83 | | Phase 25 °C | solid | Rotatable bonds | 2 | Predicted density | 1.27 g/cm3 | | SMILES | [O-][N+](=O)c1cccc(N)c1C | | STD InChIKey | HFCFJYRLBAANKN-UHFFFAOYAO | | Melting Points | | mp °C | source | |
|---|
| 90.00 | Alfa Aesar | | 92.00 | PHYSPROP |
|
|
| | | 2-methyl-3-nitroanisole C8H9NO33, 64 |
 | | Compound Data | | Melting point | 54.00 °C | 327.15 K | | CSID | 70915 | H bond acceptors | 4 | Rule of 5 violations | 0 | | Molecular weight | 167.162 | H bond donors | 0 | ACD/LogP | 2.63 | | Phase 25 °C | solid | Rotatable bonds | 2 | Predicted density | 1.18 g/cm3 | | SMILES | [O-][N+](=O)c1cccc(OC)c1C | | STD InChIKey | HQCZLEAGIOIIMC-UHFFFAOYAW | | Melting Points | | mp °C | source | |
|---|
| 53.00 | Alfa Aesar | | 55.00 | PHYSPROP |
|
|
| | | 2-methyl-4-nitroaniline C7H8N2O23, 64 |
 | | Compound Data | | Melting point | 132.75 °C | 405.90 K | | CSID | 7163 | H bond acceptors | 4 | Rule of 5 violations | 0 | | Molecular weight | 152.1506 | H bond donors | 2 | ACD/LogP | 1.85 | | Phase 25 °C | solid | Rotatable bonds | 2 | Predicted density | 1.27 g/cm3 | | SMILES | [O-][N+](=O)c1ccc(N)c(c1)C | | STD InChIKey | XTTIQGSLJBWVIV-UHFFFAOYAX | | Melting Points | | mp °C | source | |
|---|
| 132.00 | Alfa Aesar | | 133.50 | PHYSPROP |
|
|
| | | 2-methyl-4-quinolinol C10H9NO3, 64 |
 | | Compound Data | | Melting point | 234.50 °C | 507.65 K | | CSID | 62307 | H bond acceptors | 2 | Rule of 5 violations | 0 | | Molecular weight | 159.1846 | H bond donors | 1 | ACD/LogP | 3.09 | | Phase 25 °C | solid | Rotatable bonds | 0 | Predicted density | 1.14 g/cm3 | | SMILES | O=C\2c1c(cccc1)N/C(=C/2)C | | STD InChIKey | NWINIEGDLHHNLH-UHFFFAOYAE | | Melting Points | | mp °C | source | |
|---|
| 235.00 | Alfa Aesar | | 234.00 | PHYSPROP |
|
|
| | | 2-methyl-5-nitroaniline C7H8N2O23, 61, 64 |
 | | Compound Data | | Melting point | 106.67 °C | 379.82 K | | CSID | 7166 | H bond acceptors | 4 | Rule of 5 violations | 0 | | Molecular weight | 152.1506 | H bond donors | 2 | ACD/LogP | 1.83 | | Phase 25 °C | solid | Rotatable bonds | 2 | Predicted density | 1.27 g/cm3 | | SMILES | [O-][N+](=O)c1cc(N)c(cc1)C | | STD InChIKey | DSBIJCMXAIKKKI-UHFFFAOYAH | | Melting Points | | mp °C | source | |
|---|
| 107.00 | Alfa Aesar | | 107.50 | Oxford University MSDS | | 105.50 | PHYSPROP |
|
|
| | | 2-methyl-5-nitroimidazole C4H5N3O261, 64, 70 |
 | |
|
| | | 2-methyl-6-nitroaniline C7H8N2O23, 64 |
 | | Compound Data | | Melting point | 95.50 °C | 368.65 K | | CSID | 10824 | H bond acceptors | 4 | Rule of 5 violations | 0 | | Molecular weight | 152.1506 | H bond donors | 2 | ACD/LogP | 2.29 | | Phase 25 °C | solid | Rotatable bonds | 2 | Predicted density | 1.27 g/cm3 | | SMILES | [O-][N+](=O)c1cccc(c1N)C | | STD InChIKey | FCMRHMPITHLLLA-UHFFFAOYAO | | Melting Points | | mp °C | source | |
|---|
| 95.00 | Alfa Aesar | | 96.00 | PHYSPROP |
|
|
| | | 2-methyl-8-nitroquinoline C10H8N2O23, 64 |
 | | Compound Data | | Melting point | 139.00 °C | 412.15 K | | CSID | 12858 | H bond acceptors | 4 | Rule of 5 violations | 0 | | Molecular weight | 188.1827 | H bond donors | 0 | ACD/LogP | 1.93 | | Phase 25 °C | solid | Rotatable bonds | 1 | Predicted density | 1.30 g/cm3 | | SMILES | [O-][N+](=O)c1cccc2ccc(nc12)C | | STD InChIKey | UHPGVDHXHDPYQP-UHFFFAOYAN | | Melting Points | | mp °C | source | |
|---|
| 138.00 | Alfa Aesar | | 140.00 | PHYSPROP |
|
|
| | | 2-methylacetanilide C9H11NO3, 64 |
 | | Compound Data | | Melting point | 110.50 °C | 383.65 K | | CSID | 10298354 | H bond acceptors | 2 | Rule of 5 violations | 0 | | Molecular weight | 149.1897 | H bond donors | 1 | ACD/LogP | 1.54 | | Phase 25 °C | solid | Rotatable bonds | 1 | Predicted density | 1.07 g/cm3 | | SMILES | Cc1ccccc1NC(C)=O | | STD InChIKey | BPEXTIMJLDWDTL-UHFFFAOYAX | | Melting Points | | mp °C | source | |
|---|
| 111.00 | Alfa Aesar | | 110.00 | PHYSPROP |
|
|
| | | 2-methylamino-5-chlorobenzophenone C14H12ClNO3, 61 |
 | | Compound Data | | Melting point | 95.00 °C | 368.15 K | | CSID | 13323 | H bond acceptors | 2 | Rule of 5 violations | 0 | | Molecular weight | 245.7042 | H bond donors | 1 | ACD/LogP | 4.66 | | Phase 25 °C | solid | Rotatable bonds | 3 | Predicted density | 1.23 g/cm3 | | SMILES | Clc1cc(c(NC)cc1)C(=O)c2ccccc2 | | STD InChIKey | WPNMLCMTDCANOZ-UHFFFAOYAQ | | Melting Points | | mp °C | source | |
|---|
| 96.00 | Alfa Aesar | | 94.00 | Oxford University MSDS |
|
|
| | | 2-methylanthraquinone C15H10O23, 64 |
 | | Compound Data | | Melting point | 174.50 °C | 447.65 K | | CSID | 6515 | H bond acceptors | 2 | Rule of 5 violations | 0 | | Molecular weight | 222.2387 | H bond donors | 0 | ACD/LogP | 3.84 | | Phase 25 °C | solid | Rotatable bonds | 0 | Predicted density | 1.27 g/cm3 | | SMILES | O=C2c1c(cccc1)C(=O)c3c2ccc(c3)C | | STD InChIKey | NJWGQARXZDRHCD-UHFFFAOYAG | | Melting Points | | mp °C | source | |
|---|
| 172.00 | Alfa Aesar | | 177.00 | PHYSPROP |
|
|
| | | 2-methylbenzeneboronic acid C7H9BO23, 64 |
 | | Compound Data | | Melting point | 164.75 °C | 437.90 K | | CSID | 2015070 | H bond acceptors | 2 | Rule of 5 violations | 0 | | Molecular weight | 135.9562 | H bond donors | 2 | ACD/LogP | 2.05 | | Phase 25 °C | solid | Rotatable bonds | 3 | Predicted density | 1.10 g/cm3 | | SMILES | OB(O)c1ccccc1C | | STD InChIKey | NSJVYHOPHZMZPN-UHFFFAOYAT | | Melting Points | | mp °C | source | |
|---|
| 163.00 | Alfa Aesar | | 166.50 | PHYSPROP |
|
|
| | | 2-methylbenzimidazole C8H8N23, 35, 64 |
 | | Compound Data | | Melting point | 176.33 °C | 449.48 K | | CSID | 11489 | H bond acceptors | 2 | Rule of 5 violations | 0 | | Molecular weight | 132.1625 | H bond donors | 1 | ACD/LogP | 1.57 | | Phase 25 °C | solid | Rotatable bonds | 0 | Predicted density | 1.19 g/cm3 | | SMILES | n2c1ccccc1nc2C | | STD InChIKey | LDZYRENCLPUXAX-UHFFFAOYAQ | | Melting Points | | mp °C | source | |
|---|
| 176.00 | Alfa Aesar | | 176.50 | EPISuite-ChemSpider | | 176.50 | PHYSPROP |
|
|
| | | 2-methylbenzoic acid C8H8O22, 3, 35, 61, 64 |
 | |
|
| | | 2-methylbenzothiazole C8H7NS3, 64 |
 | | Compound Data | | Melting point | 13.00 °C | 286.15 K | | CSID | 8138 | H bond acceptors | 1 | Rule of 5 violations | 0 | | Molecular weight | 149.2129 | H bond donors | 0 | ACD/LogP | 2.41 | | Phase 25 °C | liquid/gas | Rotatable bonds | 0 | Predicted density | 1.22 g/cm3 | | SMILES | n1c2ccccc2sc1C | | STD InChIKey | DXYYSGDWQCSKKO-UHFFFAOYAE | | Melting Points | | mp °C | source | |
|---|
| 12.00 | Alfa Aesar | | 14.00 | PHYSPROP |
|
|
| | | 2-methylbenzyl alcohol C8H10O2, 3, 64 |
 | |
|
| | | 2-methylbenzyl bromide C8H9Br3, 64 |
 | | Compound Data | | Melting point | 20.00 °C | 293.15 K | | CSID | 6726 | H bond acceptors | 0 | Rule of 5 violations | 0 | | Molecular weight | 185.0611 | H bond donors | 0 | ACD/LogP | 3.38 | | Phase 25 °C | liquid/gas | Rotatable bonds | 1 | Predicted density | 1.37 g/cm3 | | SMILES | BrCc1ccccc1C | | STD InChIKey | WGVYCXYGPNNUQA-UHFFFAOYAQ | | Melting Points | | mp °C | source | |
|---|
| 19.00 | Alfa Aesar | | 21.00 | PHYSPROP |
|
|
| | | 2-methylbiphenyl C13H123, 4, 64 |
 | |
|
| | | 2-methylbutane C5H124, 61, 64 |
 | |
|
| | | 2-methyldecane C11H244, 64 |
 | | Compound Data | | Melting point | -48.95 °C | 224.20 K | | CSID | 21896 | H bond acceptors | 0 | Rule of 5 violations | 1 | | Molecular weight | 156.3083 | H bond donors | 0 | ACD/LogP | 6.42 | | Phase 25 °C | liquid/gas | Rotatable bonds | 7 | Predicted density | 0.74 g/cm3 | | SMILES | CCCCCCCCC(C)C | | STD InChIKey | CNPVJWYWYZMPDS-UHFFFAOYAI | | Melting Points | | mp °C | source | |
|---|
| -49.00 | American Petroleum Institute. Research Project 44; Selected ... | | -48.90 | PHYSPROP |
|
|
| | | 2-methylfuran C5H6O3, 61, 64 |
 | | Compound Data | | Melting point | -88.50 °C | 184.65 K | | CSID | 10340 | H bond acceptors | 1 | Rule of 5 violations | 0 | | Molecular weight | 82.1005 | H bond donors | 0 | ACD/LogP | 1.79 | | Phase 25 °C | liquid/gas | Rotatable bonds | 0 | Predicted density | 0.93 g/cm3 | | SMILES | Cc1ccco1 | | STD InChIKey | VQKFNUFAXTZWDK-UHFFFAOYAB | | Melting Points | | mp °C | source | |
|---|
| -89.00 | Alfa Aesar | | -89.00 | Oxford University MSDS | | -87.50 | PHYSPROP |
|
|
| | | 2-methylheptadecane C18H384, 64 |
 | | Compound Data | | Melting point | 5.85 °C | 279.00 K | | CSID | 14530 | H bond acceptors | 0 | Rule of 5 violations | 1 | | Molecular weight | 254.4943 | H bond donors | 0 | ACD/LogP | 10.14 | | Phase 25 °C | liquid/gas | Rotatable bonds | 14 | Predicted density | 0.78 g/cm3 | | SMILES | C(CCCCCCCC(C)C)CCCCCCC | | STD InChIKey | RJWUMFHQJJBBOD-UHFFFAOYAG | | Melting Points | | mp °C | source | |
|---|
| 6.00 | American Petroleum Institute. Research Project 44; Selected ... | | 5.70 | PHYSPROP |
|
|
| | | 2-methylheptane C8H184, 64, 64 |
 | |
|
| | | 2-methylhexane C7H164, 64 |
 | | Compound Data | | Melting point | -118.10 °C | 155.05 K | | CSID | 11094 | H bond acceptors | 0 | Rule of 5 violations | 0 | | Molecular weight | 100.2019 | H bond donors | 0 | ACD/LogP | 4.29 | | Phase 25 °C | liquid/gas | Rotatable bonds | 3 | Predicted density | 0.69 g/cm3 | | SMILES | CC(C)CCCC | | STD InChIKey | GXDHCNNESPLIKD-UHFFFAOYAR | | Melting Points | | mp °C | source | |
|---|
| -118.00 | American Petroleum Institute. Research Project 44; Selected ... | | -118.20 | PHYSPROP |
|
|
| | | 2-methylimidazole C4H6N23, 64 |
 | | Compound Data | | Melting point | 143.50 °C | 416.65 K | | CSID | 12225 | H bond acceptors | 2 | Rule of 5 violations | 0 | | Molecular weight | 82.1038 | H bond donors | 1 | ACD/LogP | -0.37 | | Phase 25 °C | solid | Rotatable bonds | 0 | Predicted density | 1.06 g/cm3 | | SMILES | n1ccnc1C | | STD InChIKey | LXBGSDVWAMZHDD-UHFFFAOYAM | | Melting Points | | mp °C | source | |
|---|
| 143.00 | Alfa Aesar | | 144.00 | PHYSPROP |
|
|
| | | 2-methylindole C9H9N3, 64 |
 | | Compound Data | | Melting point | 59.50 °C | 332.65 K | | CSID | 6954 | H bond acceptors | 1 | Rule of 5 violations | 0 | | Molecular weight | 131.1745 | H bond donors | 1 | ACD/LogP | 2.60 | | Phase 25 °C | solid | Rotatable bonds | 0 | Predicted density | 1.11 g/cm3 | | SMILES | c1cccc2c1cc(n2)C | | STD InChIKey | BHNHHSOHWZKFOX-UHFFFAOYAQ | | Melting Points | | mp °C | source | |
|---|
| 58.00 | Alfa Aesar | | 61.00 | PHYSPROP |
|
|
| | | 2-methyllactic acid C4H8O33, 64 |
 | | Compound Data | | Melting point | 80.75 °C | 353.90 K | | CSID | 11181 | H bond acceptors | 3 | Rule of 5 violations | 0 | | Molecular weight | 104.1045 | H bond donors | 2 | ACD/LogP | -0.35 | | Phase 25 °C | solid | Rotatable bonds | 2 | Predicted density | 1.20 g/cm3 | | SMILES | O=C(O)C(O)(C)C | | STD InChIKey | BWLBGMIXKSTLSX-UHFFFAOYAY | | Melting Points | | mp °C | source | |
|---|
| 79.00 | Alfa Aesar | | 82.50 | PHYSPROP |
|
|
| | | 2-methylnaphthalene C11H103, 64 |
 | | Compound Data | | Melting point | 33.70 °C | 306.85 K | | CSID | 6788 | H bond acceptors | 0 | Rule of 5 violations | 0 | | Molecular weight | 142.1971 | H bond donors | 0 | ACD/LogP | 3.91 | | Phase 25 °C | solid | Rotatable bonds | 0 | Predicted density | 1.02 g/cm3 | | SMILES | c12ccccc1ccc(c2)C | | STD InChIKey | QIMMUPPBPVKWKM-UHFFFAOYAY | | Melting Points | | mp °C | source | |
|---|
| 33.00 | Alfa Aesar | | 34.40 | PHYSPROP |
|
|
| | | 2-methylnonane C10H224, 64 |
 | | Compound Data | | Melting point | -74.80 °C | 198.35 K | | CSID | 12807 | H bond acceptors | 0 | Rule of 5 violations | 1 | | Molecular weight | 142.2817 | H bond donors | 0 | ACD/LogP | 5.88 | | Phase 25 °C | liquid/gas | Rotatable bonds | 6 | Predicted density | 0.73 g/cm3 | | SMILES | CC(CCCCCCC)C | | STD InChIKey | SGVYKUFIHHTIFL-UHFFFAOYAG | | Melting Points | | mp °C | source | |
|---|
| -75.00 | American Petroleum Institute. Research Project 44; Selected ... | | -74.60 | PHYSPROP |
|
|
| | | 2-methyloctane C9H204, 61, 64 |
 | |
|
| | | 2-methylpentane C6H143, 4, 61, 64 |
 | |
|
| | | 2-methylpyrazine C5H6N23, 64 |
 | | Compound Data | | Melting point | -29.50 °C | 243.65 K | | CSID | 7688 | H bond acceptors | 2 | Rule of 5 violations | 0 | | Molecular weight | 94.1145 | H bond donors | 0 | ACD/LogP | 0.18 | | Phase 25 °C | liquid/gas | Rotatable bonds | 0 | Predicted density | 1.02 g/cm3 | | SMILES | n1ccnc(c1)C | | STD InChIKey | CAWHJQAVHZEVTJ-UHFFFAOYAF | | Melting Points | | mp °C | source | |
|---|
| -30.00 | Alfa Aesar | | -29.00 | PHYSPROP |
|
|
| | | 2-methylpyridine C6H7N3, 61, 64 |
 | | Compound Data | | Melting point | -68.90 °C | 204.25 K | | CSID | 13839199 | H bond acceptors | 1 | Rule of 5 violations | 0 | | Molecular weight | 93.1265 | H bond donors | 0 | ACD/LogP | 1.22 | | Phase 25 °C | liquid/gas | Rotatable bonds | 0 | Predicted density | 0.94 g/cm3 | | SMILES | Cc1ccccn1 | | STD InChIKey | BSKHPKMHTQYZBB-UHFFFAOYAR | | Melting Points | | mp °C | source | |
|---|
| -70.00 | Alfa Aesar | | -70.00 | Oxford University MSDS | | -66.70 | PHYSPROP |
|
|
| | | 2-methylresorcinol C7H8O22, 3, 64 |
 | |
|
| | | 2-methylstyrene C9H103, 4, 64 |
 | |
|
| | | 2-methylthiophene C5H6S3, 64 |
 | | Compound Data | | Melting point | -63.20 °C | 209.95 K | | CSID | 21168808 | H bond acceptors | 0 | Rule of 5 violations | 0 | | Molecular weight | 98.1661 | H bond donors | 0 | ACD/LogP | 2.36 | | Phase 25 °C | liquid/gas | Rotatable bonds | 0 | Predicted density | 1.03 g/cm3 | | SMILES | Cc1cccs1 | | STD InChIKey | XQQBUAPQHNYYRS-UHFFFAOYAJ | | Melting Points | | mp °C | source | |
|---|
| -63.00 | Alfa Aesar | | -63.40 | PHYSPROP |
|
|
| | | 2-naphthaldehyde C11H8O3, 64 |
 | | Compound Data | | Melting point | 61.50 °C | 334.65 K | | CSID | 5966 | H bond acceptors | 1 | Rule of 5 violations | 0 | | Molecular weight | 156.1806 | H bond donors | 0 | ACD/LogP | 2.87 | | Phase 25 °C | solid | Rotatable bonds | 1 | Predicted density | 1.16 g/cm3 | | SMILES | O=Cc2ccc1c(cccc1)c2 | | STD InChIKey | PJKVFARRVXDXAD-UHFFFAOYAM | | Melting Points | | mp °C | source | |
|---|
| 61.00 | Alfa Aesar | | 62.00 | PHYSPROP |
|
|
| | | 2-naphthalenamine C10H9N61, 64 |
 | | Compound Data | | Melting point | 112.25 °C | 385.40 K | | CSID | 6790 | H bond acceptors | 1 | Rule of 5 violations | 0 | | Molecular weight | 143.1852 | H bond donors | 2 | ACD/LogP | 2.17 | | Phase 25 °C | solid | Rotatable bonds | 1 | Predicted density | 1.14 g/cm3 | | SMILES | c12ccccc1ccc(N)c2 | | STD InChIKey | JBIJLHTVPXGSAM-UHFFFAOYAA | | Melting Points | | mp °C | source | |
|---|
| 111.50 | Oxford University MSDS | | 113.00 | PHYSPROP |
|
|
| | | 2-naphthalenamine C6H7N3O261, 64 |
 | | Compound Data | | Melting point | 139.25 °C | 412.40 K | | CSID | 3542441 | H bond acceptors | 5 | Rule of 5 violations | 0 | | Molecular weight | 153.1387 | H bond donors | 4 | ACD/LogP | 0.91 | | Phase 25 °C | solid | Rotatable bonds | 3 | Predicted density | 1.45 g/cm3 | | SMILES | O=[N+]([O-])c1cc(ccc1N)N | | STD InChIKey | HVHNMNGARPCGGD-UHFFFAOYAX | | Melting Points | | mp °C | source | |
|---|
| 138.50 | Oxford University MSDS | | 140.00 | PHYSPROP |
|
|
| | | 2-naphthoic acid C11H8O23, 64 |
 | | Compound Data | | Melting point | 184.75 °C | 457.90 K | | CSID | 6856 | H bond acceptors | 2 | Rule of 5 violations | 0 | | Molecular weight | 172.18 | H bond donors | 1 | ACD/LogP | 3.12 | | Phase 25 °C | solid | Rotatable bonds | 1 | Predicted density | 1.26 g/cm3 | | SMILES | O=C(O)c2ccc1c(cccc1)c2 | | STD InChIKey | UOBYKYZJUGYBDK-UHFFFAOYAM | | Melting Points | | mp °C | source | |
|---|
| 184.00 | Alfa Aesar | | 185.50 | PHYSPROP |
|
|
| | | 2-naphthol C10H8O2, 3, 44, 61, 64 |
 | |
|
| | | 2-naphthonitrile C11H7N3, 64 |
 | | Compound Data | | Melting point | 65.50 °C | 338.65 K | | CSID | 11450 | H bond acceptors | 1 | Rule of 5 violations | 0 | | Molecular weight | 153.18 | H bond donors | 0 | ACD/LogP | 2.89 | | Phase 25 °C | solid | Rotatable bonds | 0 | Predicted density | 1.13 g/cm3 | | SMILES | N#Cc2ccc1c(cccc1)c2 | | STD InChIKey | AZKDTTQQTKDXLH-UHFFFAOYAM | | Melting Points | | mp °C | source | |
|---|
| 65.00 | Alfa Aesar | | 66.00 | PHYSPROP |
|
|
| | | 2-naphthoyl chloride C11H7ClO3, 64 |
 | | Compound Data | | Melting point | 50.50 °C | 323.65 K | | CSID | 67790 | H bond acceptors | 1 | Rule of 5 violations | 0 | | Molecular weight | 190.6257 | H bond donors | 0 | ACD/LogP | 3.44 | | Phase 25 °C | solid | Rotatable bonds | 1 | Predicted density | 1.27 g/cm3 | | SMILES | ClC(=O)c2ccc1c(cccc1)c2 | | STD InChIKey | XNLBCXGRQWUJLU-UHFFFAOYAX | | Melting Points | | mp °C | source | |
|---|
| 50.00 | Alfa Aesar | | 51.00 | PHYSPROP |
|
|
| | | 2-naphthyl benzoate C17H12O23, 48, 64 |
 | |
|
| | | 2-naphthylsulfonyl chloride C10H7ClO2S3, 64 |
 | | Compound Data | | Melting point | 78.50 °C | 351.65 K | | CSID | 6858 | H bond acceptors | 2 | Rule of 5 violations | 0 | | Molecular weight | 226.6794 | H bond donors | 0 | ACD/LogP | 3.22 | | Phase 25 °C | solid | Rotatable bonds | 1 | Predicted density | 1.41 g/cm3 | | SMILES | ClS(=O)(=O)c2ccc1c(cccc1)c2 | | STD InChIKey | OPECTNGATDYLSS-UHFFFAOYAP | | Melting Points | | mp °C | source | |
|---|
| 76.00 | Alfa Aesar | | 81.00 | PHYSPROP |
|
|
| | | 2-nitro-N-phenylacetamide C8H8N2O361, 64 |
 | | Compound Data | | Melting point | 93.50 °C | 366.65 K | | CSID | 11279086 | H bond acceptors | 5 | Rule of 5 violations | 0 | | Molecular weight | 180.1607 | H bond donors | 1 | ACD/LogP | 1.25 | | Phase 25 °C | solid | Rotatable bonds | 3 | Predicted density | 1.33 g/cm3 | | SMILES | O=C(Nc1ccccc1)CN(=O)=O | | STD InChIKey | JFPJVTNYCURRAB-UHFFFAOYAL | | Melting Points | | mp °C | source | |
|---|
| 93.00 | Oxford University MSDS | | 94.00 | PHYSPROP |
|
|
| | | 2-nitroaniline C6H6N2O22, 3, 61, 64 |
 | |
|
| | | 2-nitrobenzaldehyde C7H5NO32, 3, 64 |
 | |
|
| | | 2-nitrobenzamide C7H6N2O33, 7, 64 |
 | |
|
| | | 2-nitrobenzhydrazide C7H7N3O33, 64 |
 | | Compound Data | | Melting point | 122.50 °C | 395.65 K | | CSID | 3009396 | H bond acceptors | 6 | Rule of 5 violations | 0 | | Molecular weight | 181.1488 | H bond donors | 3 | ACD/LogP | -0.54 | | Phase 25 °C | solid | Rotatable bonds | 3 | Predicted density | 1.41 g/cm3 | | SMILES | O=[N+]([O-])c1ccccc1C(=O)NN | | STD InChIKey | LYGGDXLOJMNFBV-UHFFFAOYAW | | Melting Points | | mp °C | source | |
|---|
| 121.00 | Alfa Aesar | | 124.00 | PHYSPROP |
|
|
| | | 2-nitrobenzoic acid C7H5NO42, 3, 61, 64 |
 | |
|
| | | 2-nitrobenzonitrile C7H4N2O22, 3, 64 |
 | |
|
| | | 2-nitrobenzyl alcohol C7H7NO32, 3, 64 |
 | |
|
| | | 2-nitrobiphenyl C12H9NO27, 64 |
 | | Compound Data | | Melting point | 37.10 °C | 310.25 K | | CSID | 21106576 | H bond acceptors | 3 | Rule of 5 violations | 0 | | Molecular weight | 199.2054 | H bond donors | 0 | ACD/LogP | 3.52 | | Phase 25 °C | solid | Rotatable bonds | 2 | Predicted density | 1.20 g/cm3 | | SMILES | [O-][N+](=O)c2ccccc2c1ccccc1 | | STD InChIKey | YOJKKXRJMXIKSR-UHFFFAOYAD | | Melting Points | | mp °C | source | |
|---|
| 37.00 | Beilstein F. K.; Beilsteins Handbuch der Organischen Chemie.... | | 37.20 | PHYSPROP |
|
|
| | | 2-nitrofluorene C13H9NO261, 64 |
 | | Compound Data | | Melting point | 156.50 °C | 429.65 K | | CSID | 11338 | H bond acceptors | 3 | Rule of 5 violations | 0 | | Molecular weight | 211.2161 | H bond donors | 0 | ACD/LogP | 3.89 | | Phase 25 °C | solid | Rotatable bonds | 1 | Predicted density | 1.32 g/cm3 | | SMILES | [O-][N+](=O)c3ccc2c1ccccc1Cc2c3 | | STD InChIKey | XFOHWECQTFIEIX-UHFFFAOYAJ | | Melting Points | | mp °C | source | |
|---|
| 156.00 | Oxford University MSDS | | 157.00 | PHYSPROP |
|
|
| | | 2-nitrofuran C4H3NO361, 64 |
 | | Compound Data | | Melting point | 30.50 °C | 303.65 K | | CSID | 11372 | H bond acceptors | 4 | Rule of 5 violations | 0 | | Molecular weight | 113.0715 | H bond donors | 0 | ACD/LogP | 0.78 | | Phase 25 °C | solid | Rotatable bonds | 1 | Predicted density | 1.34 g/cm3 | | SMILES | [O-][N+](=O)c1occc1 | | STD InChIKey | FUBFWTUFPGFHOJ-UHFFFAOYAQ | | Melting Points | | mp °C | source | |
|---|
| 31.00 | Oxford University MSDS | | 30.00 | PHYSPROP |
|
|
| | | 2-nitroiodobenzene C6H4INO22, 3, 61, 64 |
 | |
|
| | | 2-nitrophenol C6H5NO33, 7, 28, 48, 56, 61, 64, 72 |
 | |
|
| | | 2-nitrophenyl acetate C8H7NO42, 64 |
 | | Compound Data | | Melting point | 40.25 °C | 313.40 K | | CSID | 11397 | H bond acceptors | 5 | Rule of 5 violations | 0 | | Molecular weight | 181.1455 | H bond donors | 0 | ACD/LogP | 1.55 | | Phase 25 °C | solid | Rotatable bonds | 3 | Predicted density | 1.30 g/cm3 | | SMILES | O=C(Oc1ccccc1[N+]([O-])=O)C | | STD InChIKey | MRCKRGSNLOHYRA-UHFFFAOYAR | | Melting Points | | mp °C | source | |
|---|
| 40.00 | Aldrich Chemical Company; Aldrich Catalog-Handbook of Fine C... | | 40.50 | PHYSPROP |
|
|
| | | 2-nitrophenylacetonitrile C8H6N2O22, 3, 48, 61, 64 |
 | |
|
| | | 2-nitropropane C3H7NO22, 61, 64 |
 | |
|
| | | 2-nitroresorcinol C6H5NO43, 64 |
 | | Compound Data | | Melting point | 82.50 °C | 355.65 K | | CSID | 11267 | H bond acceptors | 5 | Rule of 5 violations | 0 | | Molecular weight | 155.1082 | H bond donors | 2 | ACD/LogP | 1.49 | | Phase 25 °C | solid | Rotatable bonds | 3 | Predicted density | 1.58 g/cm3 | | SMILES | O=[N+]([O-])c1c(O)cccc1O | | STD InChIKey | ZLCPKMIJYMHZMJ-UHFFFAOYAG | | Melting Points | | mp °C | source | |
|---|
| 83.00 | Alfa Aesar | | 82.00 | PHYSPROP |
|
|
| | | 2-nitrothiophene C4H3NO2S3, 64 |
 | | Compound Data | | Melting point | 45.25 °C | 318.40 K | | CSID | 11373 | H bond acceptors | 3 | Rule of 5 violations | 0 | | Molecular weight | 129.1371 | H bond donors | 0 | ACD/LogP | 1.65 | | Phase 25 °C | solid | Rotatable bonds | 1 | Predicted density | 1.42 g/cm3 | | SMILES | [O-][N+](=O)c1sccc1 | | STD InChIKey | JIZRGGUCOQKGQD-UHFFFAOYAL | | Melting Points | | mp °C | source | |
|---|
| 44.00 | Alfa Aesar | | 46.50 | PHYSPROP |
|
|
| | | 2-octanone C8H16O3, 4, 64 |
 | |
|
| | | 2-oxetanone C3H4O23, 64 |
 | | Compound Data | | Melting point | -33.70 °C | 239.45 K | | CSID | 2275 | H bond acceptors | 2 | Rule of 5 violations | 0 | | Molecular weight | 72.0627 | H bond donors | 0 | ACD/LogP | -1.33 | | Phase 25 °C | liquid/gas | Rotatable bonds | 0 | Predicted density | 1.23 g/cm3 | | SMILES | O=C1OCC1 | | STD InChIKey | VEZXCJBBBCKRPI-UHFFFAOYAQ | | Melting Points | | mp °C | source | |
|---|
| -34.00 | Alfa Aesar | | -33.40 | PHYSPROP |
|
|
| | | 2-pentadecanone C15H30O3, 64 |
 | | Compound Data | | Melting point | 39.25 °C | 312.40 K | | CSID | 55242 | H bond acceptors | 1 | Rule of 5 violations | 1 | | Molecular weight | 226.3981 | H bond donors | 0 | ACD/LogP | 6.22 | | Phase 25 °C | solid | Rotatable bonds | 12 | Predicted density | 0.83 g/cm3 | | SMILES | CC(=O)CCCCCCCCCCCCC | | STD InChIKey | CJPNOLIZCWDHJK-UHFFFAOYAR | | Melting Points | | mp °C | source | |
|---|
| 39.00 | Alfa Aesar | | 39.50 | PHYSPROP |
|
|
| | | 2-pentanone C5H10O3, 4, 61, 64 |
 | |
|
| | | 2-pentyne C5H83, 4, 64 |
 | |
|
| | | 2-phenoxyaniline C12H11NO3, 64 |
 | | Compound Data | | Melting point | 46.40 °C | 319.55 K | | CSID | 68404 | H bond acceptors | 2 | Rule of 5 violations | 0 | | Molecular weight | 185.2218 | H bond donors | 2 | ACD/LogP | 2.46 | | Phase 25 °C | solid | Rotatable bonds | 3 | Predicted density | 1.14 g/cm3 | | SMILES | O(c1ccccc1)c2ccccc2N | | STD InChIKey | NMFFUUFPJJOWHK-UHFFFAOYAR | | Melting Points | | mp °C | source | |
|---|
| 47.00 | Alfa Aesar | | 45.80 | PHYSPROP |
|
|
| | | 2-phenoxyethanol C8H10O22, 3, 61, 64 |
 | |
|
| | | 2-phenoxyethyl chloride C8H9ClO3, 7, 64 |
 | |
|
| | | 2-phenyl-2-propanol C9H12O2, 3, 64 |
 | |
|
| | | 2-phenylbenzothiazole C13H9NS3, 64 |
 | | Compound Data | | Melting point | 114.50 °C | 387.65 K | | CSID | 12864 | H bond acceptors | 1 | Rule of 5 violations | 0 | | Molecular weight | 211.2823 | H bond donors | 0 | ACD/LogP | 4.26 | | Phase 25 °C | solid | Rotatable bonds | 1 | Predicted density | 1.23 g/cm3 | | SMILES | n1c3ccccc3sc1c2ccccc2 | | STD InChIKey | XBHOUXSGHYZCNH-UHFFFAOYAN | | Melting Points | | mp °C | source | |
|---|
| 114.00 | Alfa Aesar | | 115.00 | PHYSPROP |
|
|
| | | 2-phenylethyl acetate C10H12O23, 64 |
 | | Compound Data | | Melting point | -31.05 °C | 242.10 K | | CSID | 21105987 | H bond acceptors | 2 | Rule of 5 violations | 0 | | Molecular weight | 164.2011 | H bond donors | 0 | ACD/LogP | 2.30 | | Phase 25 °C | liquid/gas | Rotatable bonds | 4 | Predicted density | 1.03 g/cm3 | | SMILES | CC(=O)OCCc1ccccc1 | | STD InChIKey | MDHYEMXUFSJLGV-UHFFFAOYAK | | Melting Points | | mp °C | source | |
|---|
| -31.00 | Alfa Aesar | | -31.10 | PHYSPROP |
|
|
| | | 2-phenylimidazole C9H8N23, 64 |
 | | Compound Data | | Melting point | 148.65 °C | 421.80 K | | CSID | 62795 | H bond acceptors | 2 | Rule of 5 violations | 0 | | Molecular weight | 144.1732 | H bond donors | 1 | ACD/LogP | 1.88 | | Phase 25 °C | solid | Rotatable bonds | 1 | Predicted density | 1.14 g/cm3 | | SMILES | n1ccnc1c2ccccc2 | | STD InChIKey | ZCUJYXPAKHMBAZ-UHFFFAOYAE | | Melting Points | | mp °C | source | |
|---|
| 148.00 | Alfa Aesar | | 149.30 | PHYSPROP |
|
|
| | | 2-phenylindole C14H11N3, 64 |
 | | Compound Data | | Melting point | 190.25 °C | 463.40 K | | CSID | 13105 | H bond acceptors | 1 | Rule of 5 violations | 0 | | Molecular weight | 193.2438 | H bond donors | 1 | ACD/LogP | 4.68 | | Phase 25 °C | solid | Rotatable bonds | 1 | Predicted density | 1.16 g/cm3 | | SMILES | c1cccc3c1cc(c2ccccc2)n3 | | STD InChIKey | KLLLJCACIRKBDT-UHFFFAOYAH | | Melting Points | | mp °C | source | |
|---|
| 190.00 | Alfa Aesar | | 190.50 | PHYSPROP |
|
|
| | | 2-phenylquinoline C15H11N3, 64 |
 | | Compound Data | | Melting point | 84.50 °C | 357.65 K | | CSID | 64618 | H bond acceptors | 1 | Rule of 5 violations | 0 | | Molecular weight | 205.2545 | H bond donors | 0 | ACD/LogP | 4.19 | | Phase 25 °C | solid | Rotatable bonds | 1 | Predicted density | 1.13 g/cm3 | | SMILES | c1ccc(cc1)c2ccc3ccccc3n2 | | STD InChIKey | FSEXLNMNADBYJU-UHFFFAOYAP | | Melting Points | | mp °C | source | |
|---|
| 83.00 | Alfa Aesar | | 86.00 | PHYSPROP |
|
|
| | | 2-picoline N-oxide C6H7NO3, 64 |
 | | Compound Data | | Melting point | 48.50 °C | 321.65 K | | CSID | 13013 | H bond acceptors | 2 | Rule of 5 violations | 0 | | Molecular weight | 109.1259 | H bond donors | 0 | ACD/LogP | -0.74 | | Phase 25 °C | solid | Rotatable bonds | 0 | Predicted density | 1.01 g/cm3 | | SMILES | [O-][n+]1ccccc1C | | STD InChIKey | CFZKDDTWZYUZKS-UHFFFAOYAG | | Melting Points | | mp °C | source | |
|---|
| 48.00 | Alfa Aesar | | 49.00 | PHYSPROP |
|
|
| | | 2-picolinic acid C6H5NO23, 64 |
 | | Compound Data | | Melting point | 136.75 °C | 409.90 K | | CSID | 993 | H bond acceptors | 3 | Rule of 5 violations | 0 | | Molecular weight | 123.1094 | H bond donors | 1 | ACD/LogP | 0.24 | | Phase 25 °C | solid | Rotatable bonds | 1 | Predicted density | 1.29 g/cm3 | | SMILES | c1ccnc(c1)C(=O)O | | STD InChIKey | SIOXPEMLGUPBBT-UHFFFAOYAC | | Melting Points | | mp °C | source | |
|---|
| 137.00 | Alfa Aesar | | 136.50 | PHYSPROP |
|
|
| | | 2-propanethiol C3H8S3, 4, 64 |
 | |
|
| | | 2-propanol C3H8O3, 4, 32, 64 |
 | |
|
| | | 2-pyridinethiol C5H5NS3, 61, 64 |
 | | Compound Data | | Melting point | 128.33 °C | 401.48 K | | CSID | 2005897 | H bond acceptors | 1 | Rule of 5 violations | 0 | | Molecular weight | 111.1649 | H bond donors | 1 | ACD/LogP | 0.32 | | Phase 25 °C | solid | Rotatable bonds | 0 | Predicted density | 1.20 g/cm3 | | SMILES | S=C1/C=C\C=C/N1 | | STD InChIKey | WHMDPDGBKYUEMW-UHFFFAOYAE | | Melting Points | | mp °C | source | |
|---|
| 127.00 | Alfa Aesar | | 129.00 | Oxford University MSDS | | 129.00 | PHYSPROP |
|
|
| | | 2-pyrrolidinone C4H7NO3, 64 |
 | | Compound Data | | Melting point | 23.50 °C | 296.65 K | | CSID | 11530 | H bond acceptors | 2 | Rule of 5 violations | 0 | | Molecular weight | 85.1045 | H bond donors | 1 | ACD/LogP | -1.45 | | Phase 25 °C | liquid/gas | Rotatable bonds | 0 | Predicted density | 1.05 g/cm3 | | SMILES | O=C1NCCC1 | | STD InChIKey | HNJBEVLQSNELDL-UHFFFAOYAP | | Melting Points | | mp °C | source | |
|---|
| 24.00 | Alfa Aesar | | 23.00 | PHYSPROP |
|
|
| | | 2-t-butyl-4-methylphenol C11H16O3, 64 |
 | | Compound Data | | Melting point | 51.75 °C | 324.90 K | | CSID | 16109 | H bond acceptors | 1 | Rule of 5 violations | 0 | | Molecular weight | 164.2441 | H bond donors | 1 | ACD/LogP | 3.63 | | Phase 25 °C | solid | Rotatable bonds | 2 | Predicted density | 0.96 g/cm3 | | SMILES | Oc1ccc(cc1C(C)(C)C)C | | STD InChIKey | IKEHOXWJQXIQAG-UHFFFAOYAH | | Melting Points | | mp °C | source | |
|---|
| 52.00 | Alfa Aesar | | 51.50 | PHYSPROP |
|
|
| | | 2-t-butylphenol C10H14O3, 64 |
 | | Compound Data | | Melting point | -6.90 °C | 266.25 K | | CSID | 6657 | H bond acceptors | 1 | Rule of 5 violations | 0 | | Molecular weight | 150.2176 | H bond donors | 1 | ACD/LogP | 3.17 | | Phase 25 °C | liquid/gas | Rotatable bonds | 2 | Predicted density | 0.97 g/cm3 | | SMILES | Oc1ccccc1C(C)(C)C | | STD InChIKey | WJQOZHYUIDYNHM-UHFFFAOYAN | | Melting Points | | mp °C | source | |
|---|
| -7.00 | Alfa Aesar | | -6.80 | PHYSPROP |
|
|
| | | 2-thiahexane C5H12S4, 64 |
 | | Compound Data | | Melting point | -97.90 °C | 175.25 K | | CSID | 11834 | H bond acceptors | 0 | Rule of 5 violations | 0 | | Molecular weight | 104.2138 | H bond donors | 0 | ACD/LogP | 2.48 | | Phase 25 °C | liquid/gas | Rotatable bonds | 3 | Predicted density | 0.83 g/cm3 | | SMILES | S(CCCC)C | | STD InChIKey | WCXXISMIJBRDQK-UHFFFAOYAX | | Melting Points | | mp °C | source | |
|---|
| -98.00 | American Petroleum Institute. Research Project 44; Selected ... | | -97.80 | PHYSPROP |
|
|
| | | 2-thienylsulfonyl chloride C4H3ClO2S23, 64 |
 | | Compound Data | | Melting point | 29.00 °C | 302.15 K | | CSID | 77127 | H bond acceptors | 2 | Rule of 5 violations | 0 | | Molecular weight | 182.6484 | H bond donors | 0 | ACD/LogP | 1.67 | | Phase 25 °C | solid | Rotatable bonds | 1 | Predicted density | 1.58 g/cm3 | | SMILES | ClS(=O)(=O)c1sccc1 | | STD InChIKey | VNNLHYZDXIBHKZ-UHFFFAOYAM | | Melting Points | | mp °C | source | |
|---|
| 30.00 | Alfa Aesar | | 28.00 | PHYSPROP |
|
|
| | | 2-toluenesulfonamide C7H9NO2S3, 64 |
 | | Compound Data | | Melting point | 156.15 °C | 429.30 K | | CSID | 6658 | H bond acceptors | 3 | Rule of 5 violations | 0 | | Molecular weight | 171.2169 | H bond donors | 2 | ACD/LogP | 0.79 | | Phase 25 °C | solid | Rotatable bonds | 1 | Predicted density | 1.27 g/cm3 | | SMILES | O=S(=O)(c1ccccc1C)N | | STD InChIKey | YCMLQMDWSXFTIF-UHFFFAOYAB | | Melting Points | | mp °C | source | |
|---|
| 156.00 | Alfa Aesar | | 156.30 | PHYSPROP |
|
|
| | | 2-undecanone C11H22O3, 4, 61, 64 |
 | |
|
| | | 2-vinylnaphthalene C12H103, 64 |
 | | Compound Data | | Melting point | 65.50 °C | 338.65 K | | CSID | 12675 | H bond acceptors | 0 | Rule of 5 violations | 0 | | Molecular weight | 154.2078 | H bond donors | 0 | ACD/LogP | 3.93 | | Phase 25 °C | solid | Rotatable bonds | 1 | Predicted density | 1.03 g/cm3 | | SMILES | c12ccccc1ccc(\C=C)c2 | | STD InChIKey | KXYAVSFOJVUIHT-UHFFFAOYAO | | Melting Points | | mp °C | source | |
|---|
| 65.00 | Alfa Aesar | | 66.00 | PHYSPROP |
|
|
| | | 2,2-bis(hydroxymethyl)propionic acid C5H10O43, 64 |
 | | Compound Data | | Melting point | 189.50 °C | 462.65 K | | CSID | 70865 | H bond acceptors | 4 | Rule of 5 violations | 0 | | Molecular weight | 134.1305 | H bond donors | 3 | ACD/LogP | -1.90 | | Phase 25 °C | solid | Rotatable bonds | 5 | Predicted density | 1.33 g/cm3 | | SMILES | O=C(O)C(C)(CO)CO | | STD InChIKey | PTBDIHRZYDMNKB-UHFFFAOYAV | | Melting Points | | mp °C | source | |
|---|
| 189.00 | Alfa Aesar | | 190.00 | PHYSPROP |
|
|
| | | 2,2-dibromo-2-cyanoacetamide C3H2Br2N2O61, 64 |
 | | Compound Data | | Melting point | 124.00 °C | 397.15 K | | CSID | 23422 | H bond acceptors | 3 | Rule of 5 violations | 0 | | Molecular weight | 241.8688 | H bond donors | 2 | ACD/LogP | 1.51 | | Phase 25 °C | solid | Rotatable bonds | 1 | Predicted density | 2.45 g/cm3 | | SMILES | BrC(Br)(C#N)C(=O)N | | STD InChIKey | UUIVKBHZENILKB-UHFFFAOYAS | | Melting Points | | mp °C | source | |
|---|
| 123.50 | Oxford University MSDS | | 124.50 | PHYSPROP |
|
|
| | | 2,2-dichloroacetamide C2H3Cl2NO3, 64 |
 | | Compound Data | | Melting point | 99.20 °C | 372.35 K | | CSID | 12173 | H bond acceptors | 2 | Rule of 5 violations | 0 | | Molecular weight | 127.9573 | H bond donors | 2 | ACD/LogP | -0.12 | | Phase 25 °C | solid | Rotatable bonds | 1 | Predicted density | 1.50 g/cm3 | | SMILES | ClC(Cl)C(=O)N | | STD InChIKey | WCGGWVOVFQNRRS-UHFFFAOYAX | | Melting Points | | mp °C | source | |
|---|
| 99.00 | Alfa Aesar | | 99.40 | PHYSPROP |
|
|
| | | 2,2-dichloroacetophenone C8H6Cl2O3, 64 |
 | | Compound Data | | Melting point | 20.75 °C | 293.90 K | | CSID | 21169500 | H bond acceptors | 1 | Rule of 5 violations | 0 | | Molecular weight | 189.0386 | H bond donors | 0 | ACD/LogP | 2.38 | | Phase 25 °C | liquid/gas | Rotatable bonds | 2 | Predicted density | 1.31 g/cm3 | | SMILES | O=C(C(Cl)Cl)c1ccccc1 | | STD InChIKey | CERJZAHSUZVMCH-UHFFFAOYAC | | Melting Points | | mp °C | source | |
|---|
| 21.00 | Alfa Aesar | | 20.50 | PHYSPROP |
|
|
| | | 2,2-dichloropropane C3H6Cl231, 64 |
 | | Compound Data | | Melting point | -33.90 °C | 239.25 K | | CSID | 11170 | H bond acceptors | 0 | Rule of 5 violations | 0 | | Molecular weight | 112.9857 | H bond donors | 0 | ACD/LogP | 1.88 | | Phase 25 °C | liquid/gas | Rotatable bonds | 0 | Predicted density | 1.12 g/cm3 | | SMILES | ClC(Cl)(C)C | | STD InChIKey | ZEOVXNVKXIPWMS-UHFFFAOYAS | | Melting Points | | mp °C | source | |
|---|
| -34.00 | Dreisbach R. R. Physical Properties of Chemical Compounds; V... | | -33.80 | PHYSPROP |
|
|
| | | 2,2-difluoroethanol C2H4F2O3, 64 |
 | | Compound Data | | Melting point | -28.10 °C | 245.05 K | | CSID | 119963 | H bond acceptors | 1 | Rule of 5 violations | 0 | | Molecular weight | 82.0494 | H bond donors | 1 | ACD/LogP | -0.37 | | Phase 25 °C | liquid/gas | Rotatable bonds | 2 | Predicted density | 1.17 g/cm3 | | SMILES | FC(F)CO | | STD InChIKey | VOGSDFLJZPNWHY-UHFFFAOYAM | | Melting Points | | mp °C | source | |
|---|
| -28.00 | Alfa Aesar | | -28.20 | PHYSPROP |
|
|
| | | 2,2-dimethyl-3-ethylpentane C9H204, 64 |
 | | Compound Data | | Melting point | -99.15 °C | 174.00 K | | CSID | 26068 | H bond acceptors | 0 | Rule of 5 violations | 0 | | Molecular weight | 128.2551 | H bond donors | 0 | ACD/LogP | 4.99 | | Phase 25 °C | liquid/gas | Rotatable bonds | 3 | Predicted density | 0.72 g/cm3 | | SMILES | CCC(CC)C(C)(C)C | | STD InChIKey | CLZCPQKGOAXOJT-UHFFFAOYAN | | Melting Points | | mp °C | source | |
|---|
| -99.00 | American Petroleum Institute. Research Project 44; Selected ... | | -99.30 | PHYSPROP |
|
|
| | | 2,2-dimethylbutane C6H143, 4, 61, 64 |
 | |
|
| | | 2,2-dimethylhexane C8H184, 64 |
 | | Compound Data | | Melting point | -121.05 °C | 152.10 K | | CSID | 11064 | H bond acceptors | 0 | Rule of 5 violations | 0 | | Molecular weight | 114.2285 | H bond donors | 0 | ACD/LogP | 4.64 | | Phase 25 °C | liquid/gas | Rotatable bonds | 3 | Predicted density | 0.71 g/cm3 | | SMILES | CC(C)(C)CCCC | | STD InChIKey | FLTJDUOFAQWHDF-UHFFFAOYAU | | Melting Points | | mp °C | source | |
|---|
| -121.00 | American Petroleum Institute. Research Project 44; Selected ... | | -121.10 | PHYSPROP |
|
|
| | | 2,2-dimethylpentane C7H164, 64 |
 | | Compound Data | | Melting point | -123.90 °C | 149.25 K | | CSID | 11055 | H bond acceptors | 0 | Rule of 5 violations | 0 | | Molecular weight | 100.2019 | H bond donors | 0 | ACD/LogP | 4.11 | | Phase 25 °C | liquid/gas | Rotatable bonds | 2 | Predicted density | 0.69 g/cm3 | | SMILES | CC(C)(C)CCC | | STD InChIKey | CXOWYJMDMMMMJO-UHFFFAOYAN | | Melting Points | | mp °C | source | |
|---|
| -124.00 | American Petroleum Institute. Research Project 44; Selected ... | | -123.80 | PHYSPROP |
|
|
| | | 2,2-dimethylpropane C5H124, 64 |
 | | Compound Data | | Melting point | -16.70 °C | 256.45 K | | CSID | 9646 | H bond acceptors | 0 | Rule of 5 violations | 0 | | Molecular weight | 72.1488 | H bond donors | 0 | ACD/LogP | 3.05 | | Phase 25 °C | liquid/gas | Rotatable bonds | 0 | Predicted density | 0.65 g/cm3 | | SMILES | CC(C)(C)C | | STD InChIKey | CRSOQBOWXPBRES-UHFFFAOYAR | | Melting Points | | mp °C | source | |
|---|
| -17.00 | American Petroleum Institute. Research Project 44; Selected ... | | -16.40 | PHYSPROP |
|
|
| | | 2,2-diphenylpropionic acid C15H14O248, 64 |
 | | Compound Data | | Melting point | 174.50 °C | 447.65 K | | CSID | 71976 | H bond acceptors | 2 | Rule of 5 violations | 0 | | Molecular weight | 226.2705 | H bond donors | 1 | ACD/LogP | 3.60 | | Phase 25 °C | solid | Rotatable bonds | 3 | Predicted density | 1.15 g/cm3 | | SMILES | O=C(O)C(c1ccccc1)(c2ccccc2)C | | STD InChIKey | ODELFXJUOVNEFZ-UHFFFAOYAO | | Melting Points | | mp °C | source | |
|---|
| 173.00 | Karthikeyan M.; Glen R.C.; Bender A. General melting point p... | | 176.00 | PHYSPROP |
|
|
| | | 2,2,2-tribromoethanol C2H3Br3O3, 64 |
 | | Compound Data | | Melting point | 80.00 °C | 353.15 K | | CSID | 6160 | H bond acceptors | 1 | Rule of 5 violations | 0 | | Molecular weight | 282.7566 | H bond donors | 1 | ACD/LogP | 2.30 | | Phase 25 °C | solid | Rotatable bonds | 1 | Predicted density | 2.87 g/cm3 | | SMILES | BrC(Br)(Br)CO | | STD InChIKey | YFDSDPIBEUFTMI-UHFFFAOYAI | | Melting Points | | mp °C | source | |
|---|
| 79.00 | Alfa Aesar | | 81.00 | PHYSPROP |
|
|
| | | 2,2,2-trichloroethanol C2H3Cl3O3, 64 |
 | | Compound Data | | Melting point | 18.50 °C | 291.65 K | | CSID | 7961 | H bond acceptors | 1 | Rule of 5 violations | 0 | | Molecular weight | 149.4036 | H bond donors | 1 | ACD/LogP | 1.38 | | Phase 25 °C | liquid/gas | Rotatable bonds | 1 | Predicted density | 1.60 g/cm3 | | SMILES | ClC(Cl)(Cl)CO | | STD InChIKey | KPWDGTGXUYRARH-UHFFFAOYAW | | Melting Points | | mp °C | source | |
|---|
| 18.00 | Alfa Aesar | | 19.00 | PHYSPROP |
|
|
| | | 2,2,2-trifluoroacetamide C2H2F3NO3, 64 |
 | | Compound Data | | Melting point | 72.75 °C | 345.90 K | | CSID | 61036 | H bond acceptors | 2 | Rule of 5 violations | 0 | | Molecular weight | 113.0386 | H bond donors | 2 | ACD/LogP | 0.17 | | Phase 25 °C | solid | Rotatable bonds | 0 | Predicted density | 1.44 g/cm3 | | SMILES | FC(F)(F)C(=O)N | | STD InChIKey | NRKYWOKHZRQRJR-UHFFFAOYAD | | Melting Points | | mp °C | source | |
|---|
| 73.00 | Alfa Aesar | | 72.50 | PHYSPROP |
|
|
| | | 2,2,2-trifluoroethanol C2H3F3O3, 61, 64 |
 | | Compound Data | | Melting point | -43.67 °C | 229.48 K | | CSID | 21106169 | H bond acceptors | 1 | Rule of 5 violations | 0 | | Molecular weight | 100.0398 | H bond donors | 1 | ACD/LogP | 0.31 | | Phase 25 °C | liquid/gas | Rotatable bonds | 1 | Predicted density | 1.32 g/cm3 | | SMILES | FC(F)(F)CO | | STD InChIKey | RHQDFWAXVIIEBN-UHFFFAOYAH | | Melting Points | | mp °C | source | |
|---|
| -44.00 | Alfa Aesar | | -43.50 | Oxford University MSDS | | -43.50 | PHYSPROP |
|
|
| | | 2,2,3,3-tetramethylbutane C8H184, 64 |
 | | Compound Data | | Melting point | 100.85 °C | 374.00 K | | CSID | 11185 | H bond acceptors | 0 | Rule of 5 violations | 0 | | Molecular weight | 114.2285 | H bond donors | 0 | ACD/LogP | 4.28 | | Phase 25 °C | solid | Rotatable bonds | 1 | Predicted density | 0.71 g/cm3 | | SMILES | CC(C)(C)C(C)(C)C | | STD InChIKey | OMMLUKLXGSRPHK-UHFFFAOYAD | | Melting Points | | mp °C | source | |
|---|
| 101.00 | American Petroleum Institute. Research Project 44; Selected ... | | 100.70 | PHYSPROP |
|
|
| | | 2,2,3,3-tetramethylpentane C9H204, 64 |
 | | Compound Data | | Melting point | -9.90 °C | 263.25 K | | CSID | 83703 | H bond acceptors | 0 | Rule of 5 violations | 0 | | Molecular weight | 128.2551 | H bond donors | 0 | ACD/LogP | 4.81 | | Phase 25 °C | liquid/gas | Rotatable bonds | 2 | Predicted density | 0.72 g/cm3 | | SMILES | CC(C)(C)C(C)(C)CC | | STD InChIKey | QUKOJKFJIHSBKV-UHFFFAOYAN | | Melting Points | | mp °C | source | |
|---|
| -10.00 | American Petroleum Institute. Research Project 44; Selected ... | | -9.80 | PHYSPROP |
|
|
| | | 2,2,3,3,4-pentamethylpentane C10H224, 64 |
 | | Compound Data | | Melting point | -36.20 °C | 236.95 K | | CSID | 452968 | H bond acceptors | 0 | Rule of 5 violations | 1 | | Molecular weight | 142.2817 | H bond donors | 0 | ACD/LogP | 5.15 | | Phase 25 °C | liquid/gas | Rotatable bonds | 2 | Predicted density | 0.73 g/cm3 | | SMILES | CC(C)(C)C(C)(C)C(C)C | | STD InChIKey | WKQBIIUOSATALN-UHFFFAOYAR | | Melting Points | | mp °C | source | |
|---|
| -36.00 | American Petroleum Institute. Research Project 44; Selected ... | | -36.40 | PHYSPROP |
|
|
| | | 2,2,3,3,4,4-hexafluoro-1,5-pentanediol C5H6F6O23, 64 |
 | | Compound Data | | Melting point | 78.75 °C | 351.90 K | | CSID | 61148 | H bond acceptors | 2 | Rule of 5 violations | 0 | | Molecular weight | 212.0904 | H bond donors | 2 | ACD/LogP | 0.92 | | Phase 25 °C | solid | Rotatable bonds | 6 | Predicted density | 1.53 g/cm3 | | SMILES | FC(F)(C(F)(F)CO)C(F)(F)CO | | STD InChIKey | IELVMUPSWDZWSD-UHFFFAOYAZ | | Melting Points | | mp °C | source | |
|---|
| 78.00 | Alfa Aesar | | 79.50 | PHYSPROP |
|
|
| | | 2,2,3,4,4-pentamethylpentane C10H224, 64 |
 | | Compound Data | | Melting point | -38.85 °C | 234.30 K | | CSID | 452969 | H bond acceptors | 0 | Rule of 5 violations | 1 | | Molecular weight | 142.2817 | H bond donors | 0 | ACD/LogP | 5.15 | | Phase 25 °C | liquid/gas | Rotatable bonds | 2 | Predicted density | 0.73 g/cm3 | | SMILES | CC(C)(C(C)C(C)(C)C)C | | STD InChIKey | OWFKEHICSVOVAC-UHFFFAOYAN | | Melting Points | | mp °C | source | |
|---|
| -39.00 | American Petroleum Institute. Research Project 44; Selected ... | | -38.70 | PHYSPROP |
|
|
| | | 2,2,4-trimethylpentane C8H183, 4, 61, 64 |
 | |
|
| | | 2,2,4,4-tetramethylpentane C9H204, 64 |
 | | Compound Data | | Melting point | -66.75 °C | 206.40 K | | CSID | 13439 | H bond acceptors | 0 | Rule of 5 violations | 0 | | Molecular weight | 128.2551 | H bond donors | 0 | ACD/LogP | 4.81 | | Phase 25 °C | liquid/gas | Rotatable bonds | 2 | Predicted density | 0.72 g/cm3 | | SMILES | CC(C)(C)CC(C)(C)C | | STD InChIKey | GUMULFRCHLJNDY-UHFFFAOYAF | | Melting Points | | mp °C | source | |
|---|
| -67.00 | American Petroleum Institute. Research Project 44; Selected ... | | -66.50 | PHYSPROP |
|
|
| | | 2,2,5-trimethylhexane C9H204, 64 |
 | | Compound Data | | Melting point | -105.85 °C | 167.30 K | | CSID | 17976 | H bond acceptors | 0 | Rule of 5 violations | 0 | | Molecular weight | 128.2551 | H bond donors | 0 | ACD/LogP | 4.99 | | Phase 25 °C | liquid/gas | Rotatable bonds | 3 | Predicted density | 0.72 g/cm3 | | SMILES | CC(C)CCC(C)(C)C | | STD InChIKey | HHOSMYBYIHNXNO-UHFFFAOYAA | | Melting Points | | mp °C | source | |
|---|
| -106.00 | American Petroleum Institute. Research Project 44; Selected ... | | -105.70 | PHYSPROP |
|
|
| | | 2,2,5,5-tetramethylhexane C10H224, 64 |
 | | Compound Data | | Melting point | -12.80 °C | 260.35 K | | CSID | 13448 | H bond acceptors | 0 | Rule of 5 violations | 1 | | Molecular weight | 142.2817 | H bond donors | 0 | ACD/LogP | 5.34 | | Phase 25 °C | liquid/gas | Rotatable bonds | 3 | Predicted density | 0.73 g/cm3 | | SMILES | CC(C)(CCC(C)(C)C)C | | STD InChIKey | HXQDUXXBVMMIKL-UHFFFAOYAZ | | Melting Points | | mp °C | source | |
|---|
| -13.00 | American Petroleum Institute. Research Project 44; Selected ... | | -12.60 | PHYSPROP |
|
|
| | | 2,2'-binaphthalene C20H1448, 64 |
 | | Compound Data | | Melting point | 187.65 °C | 460.80 K | | CSID | 62381 | H bond acceptors | 0 | Rule of 5 violations | 1 | | Molecular weight | 254.3252 | H bond donors | 0 | ACD/LogP | 6.44 | | Phase 25 °C | solid | Rotatable bonds | 1 | Predicted density | 1.14 g/cm3 | | SMILES | c14ccccc1ccc(c3cc2ccccc2cc3)c4 | | STD InChIKey | MSBVBOUOMVTWKE-UHFFFAOYAM | | Melting Points | | mp °C | source | |
|---|
| 187.00 | Karthikeyan M.; Glen R.C.; Bender A. General melting point p... | | 188.30 | PHYSPROP |
|
|
| | | 2,2'-bipyridine C10H8N23, 64 |
 | | Compound Data | | Melting point | 71.00 °C | 344.15 K | | CSID | 13867714 | H bond acceptors | 2 | Rule of 5 violations | 0 | | Molecular weight | 156.1839 | H bond donors | 0 | ACD/LogP | 1.69 | | Phase 25 °C | solid | Rotatable bonds | 1 | Predicted density | 1.11 g/cm3 | | SMILES | c1ccnc(c1)c2ccccn2 | | STD InChIKey | ROFVEXUMMXZLPA-UHFFFAOYAP | | Melting Points | | mp °C | source | |
|---|
| 70.00 | Alfa Aesar | | 72.00 | PHYSPROP |
|
|
| | | 2,2'-biquinoline C18H12N23, 64 |
 | | Compound Data | | Melting point | 194.75 °C | 467.90 K | | CSID | 8105 | H bond acceptors | 2 | Rule of 5 violations | 0 | | Molecular weight | 256.3013 | H bond donors | 0 | ACD/LogP | 3.82 | | Phase 25 °C | solid | Rotatable bonds | 1 | Predicted density | 1.22 g/cm3 | | SMILES | n1c4c(ccc1c2nc3ccccc3cc2)cccc4 | | STD InChIKey | WPTCSQBWLUUYDV-UHFFFAOYAV | | Melting Points | | mp °C | source | |
|---|
| 195.00 | Alfa Aesar | | 194.50 | PHYSPROP |
|
|
| | | 2,2'-bithiophene C8H6S23, 64 |
 | | Compound Data | | Melting point | 32.50 °C | 305.65 K | | CSID | 61428 | H bond acceptors | 0 | Rule of 5 violations | 0 | | Molecular weight | 166.2632 | H bond donors | 0 | ACD/LogP | 3.71 | | Phase 25 °C | solid | Rotatable bonds | 1 | Predicted density | 1.24 g/cm3 | | SMILES | c1cc(sc1)c2cccs2 | | STD InChIKey | OHZAHWOAMVVGEL-UHFFFAOYAB | | Melting Points | | mp °C | source | |
|---|
| 32.00 | Alfa Aesar | | 33.00 | PHYSPROP |
|
|
| | | 2,2'-dibromobiphenyl C12H8Br23, 48 |
 | | Compound Data | | Melting point | 80.50 °C | 353.65 K | | CSID | 74932 | H bond acceptors | 0 | Rule of 5 violations | 1 | | Molecular weight | 311.9999 | H bond donors | 0 | ACD/LogP | 5.11 | | Phase 25 °C | solid | Rotatable bonds | 1 | Predicted density | 1.67 g/cm3 | | SMILES | Brc2ccccc2c1c(Br)cccc1 | | STD InChIKey | DRKHIWKXLZCAKP-UHFFFAOYAM | | Melting Points | | mp °C | source | |
|---|
| 80.00 | Alfa Aesar | | 81.00 | Karthikeyan M.; Glen R.C.; Bender A. General melting point p... |
|
|
| | | 2,2'-dihydroxy-4,4'-dimethoxybenzophenone C15H14O53, 64 |
 | | Compound Data | | Melting point | 137.25 °C | 410.40 K | | CSID | 8252 | H bond acceptors | 5 | Rule of 5 violations | 0 | | Molecular weight | 274.2687 | H bond donors | 2 | ACD/LogP | 4.10 | | Phase 25 °C | solid | Rotatable bonds | 6 | Predicted density | 1.29 g/cm3 | | SMILES | O=C(c1ccc(OC)cc1O)c2ccc(OC)cc2O | | STD InChIKey | SODJJEXAWOSSON-UHFFFAOYAQ | | Melting Points | | mp °C | source | |
|---|
| 135.00 | Alfa Aesar | | 139.50 | PHYSPROP |
|
|
| | | 2,2'-dimethoxybiphenyl C14H14O23, 48, 64 |
 | |
|
| | | 2,2'-dimethylbiphenyl C14H144, 64 |
 | | Compound Data | | Melting point | 18.75 °C | 291.90 K | | CSID | 11304 | H bond acceptors | 0 | Rule of 5 violations | 0 | | Molecular weight | 182.261 | H bond donors | 0 | ACD/LogP | 4.90 | | Phase 25 °C | liquid/gas | Rotatable bonds | 1 | Predicted density | 0.97 g/cm3 | | SMILES | c2(c(c1ccccc1C)cccc2)C | | STD InChIKey | ABMKWMASVFVTMD-UHFFFAOYAF | | Melting Points | | mp °C | source | |
|---|
| 18.00 | American Petroleum Institute. Research Project 44; Selected ... | | 19.50 | PHYSPROP |
|
|
| | | 2,2'-iminodiethanol C4H11NO23, 61, 64 |
 | | Compound Data | | Melting point | 28.33 °C | 301.48 K | | CSID | 13835604 | H bond acceptors | 3 | Rule of 5 violations | 0 | | Molecular weight | 105.1356 | H bond donors | 3 | ACD/LogP | 0.00 | | Phase 25 °C | solid | Rotatable bonds | 6 | Predicted density | 1.07 g/cm3 | | SMILES | C(CO)NCCO | | STD InChIKey | ZBCBWPMODOFKDW-UHFFFAOYAO | | Melting Points | | mp °C | source | |
|---|
| 29.00 | Alfa Aesar | | 28.00 | Oxford University MSDS | | 28.00 | PHYSPROP |
|
|
| | | 2,2',2''-nitrilotriethanol C6H15NO33, 61, 64 |
 | | Compound Data | | Melting point | 20.00 °C | 293.15 K | | CSID | 13835630 | H bond acceptors | 4 | Rule of 5 violations | 0 | | Molecular weight | 149.1882 | H bond donors | 3 | ACD/LogP | 0.00 | | Phase 25 °C | liquid/gas | Rotatable bonds | 9 | Predicted density | 1.17 g/cm3 | | SMILES | OCCN(CCO)CCO | | STD InChIKey | GSEJCLTVZPLZKY-UHFFFAOYAL | | Melting Points | | mp °C | source | |
|---|
| 20.00 | Alfa Aesar | | 19.50 | Oxford University MSDS | | 20.50 | PHYSPROP |
|
|
| | | 2,2',4,4'-tetrahydroxybenzophenone C13H10O53, 64 |
 | | Compound Data | | Melting point | 201.25 °C | 474.40 K | | CSID | 8253 | H bond acceptors | 5 | Rule of 5 violations | 0 | | Molecular weight | 246.2155 | H bond donors | 4 | ACD/LogP | 3.16 | | Phase 25 °C | solid | Rotatable bonds | 6 | Predicted density | 1.53 g/cm3 | | SMILES | O=C(c1ccc(O)cc1O)c2ccc(O)cc2O | | STD InChIKey | WXNRYSGJLQFHBR-UHFFFAOYAO | | Melting Points | | mp °C | source | |
|---|
| 201.00 | Alfa Aesar | | 201.50 | PHYSPROP |
|
|
| | | 2,3-dichloro-5,6-dicyanobenzoquinone C8Cl2N2O23, 64 |
 | | Compound Data | | Melting point | 214.75 °C | 487.90 K | | CSID | 6517 | H bond acceptors | 4 | Rule of 5 violations | 0 | | Molecular weight | 227.0038 | H bond donors | 0 | ACD/LogP | -0.54 | | Phase 25 °C | solid | Rotatable bonds | 0 | Predicted density | 1.70 g/cm3 | | SMILES | ClC=1C(=O)C(\C#N)=C(\C#N)C(=O)C=1Cl | | STD InChIKey | HZNVUJQVZSTENZ-UHFFFAOYAL | | Melting Points | | mp °C | source | |
|---|
| 215.00 | Alfa Aesar | | 214.50 | PHYSPROP |
|
|
| | | 2,3-dichloroaniline C6H5Cl2N2, 3, 64 |
 | |
|
| | | 2,3-dichloroanisole C7H6Cl2O2, 3, 64 |
 | |
|
| | | 2,3-dichlorobenzoic acid C7H4Cl2O23, 64 |
 | | Compound Data | | Melting point | 168.50 °C | 441.65 K | | CSID | 5562 | H bond acceptors | 2 | Rule of 5 violations | 0 | | Molecular weight | 191.0115 | H bond donors | 1 | ACD/LogP | 2.92 | | Phase 25 °C | solid | Rotatable bonds | 1 | Predicted density | 1.52 g/cm3 | | SMILES | Clc1c(C(=O)O)cccc1Cl | | STD InChIKey | QAOJBHRZQQDFHA-UHFFFAOYAD | | Melting Points | | mp °C | source | |
|---|
| 168.00 | Alfa Aesar | | 169.00 | PHYSPROP |
|
|
| | | 2,3-dichloronitrobenzene C6H3Cl2NO22, 3, 64 |
 | |
|
| | | 2,3-dichlorophenol C6H4Cl2O2, 3, 28, 61, 64, 72 |
 | |
|
| | | 2,3-dichloropyridine C5H3Cl2N3, 64 |
 | | Compound Data | | Melting point | 66.50 °C | 339.65 K | | CSID | 16094 | H bond acceptors | 1 | Rule of 5 violations | 0 | | Molecular weight | 147.99 | H bond donors | 0 | ACD/LogP | 2.12 | | Phase 25 °C | solid | Rotatable bonds | 0 | Predicted density | 1.39 g/cm3 | | SMILES | c1cc(c(nc1)Cl)Cl | | STD InChIKey | MAKFMOSBBNKPMS-UHFFFAOYAM | | Melting Points | | mp °C | source | |
|---|
| 67.00 | Alfa Aesar | | 66.00 | PHYSPROP |
|
|
| | | 2,3-dichloroquinoxaline C8H4Cl2N23, 61, 64 |
 | | Compound Data | | Melting point | 152.67 °C | 425.82 K | | CSID | 15796 | H bond acceptors | 2 | Rule of 5 violations | 0 | | Molecular weight | 199.0368 | H bond donors | 0 | ACD/LogP | 2.97 | | Phase 25 °C | solid | Rotatable bonds | 0 | Predicted density | 1.49 g/cm3 | | SMILES | c1ccc2c(c1)nc(c(n2)Cl)Cl | | STD InChIKey | SPSSDDOTEZKOOV-UHFFFAOYAN | | Melting Points | | mp °C | source | |
|---|
| 153.00 | Alfa Aesar | | 152.00 | Oxford University MSDS | | 153.00 | PHYSPROP |
|
|
| | | 2,3-dichlorotoluene C7H6Cl22, 3, 64 |
 | |
|
| | | 2,3-difluorobenzoic acid C7H4F2O23, 64 |
 | | Compound Data | | Melting point | 163.00 °C | 436.15 K | | CSID | 328957 | H bond acceptors | 2 | Rule of 5 violations | 0 | | Molecular weight | 158.1023 | H bond donors | 1 | ACD/LogP | 2.03 | | Phase 25 °C | solid | Rotatable bonds | 1 | Predicted density | 1.43 g/cm3 | | SMILES | Fc1c(C(=O)O)cccc1F | | STD InChIKey | JLZVIWSFUPLSOR-UHFFFAOYAR | | Melting Points | | mp °C | source | |
|---|
| 162.00 | Alfa Aesar | | 164.00 | PHYSPROP |
|
|
| | | 2,3-dihydroxybenzoic acid C7H6O43, 32, 64 |
 | | Compound Data | | Melting point | 204.67 °C | 477.82 K | | CSID | 18 | H bond acceptors | 4 | Rule of 5 violations | 0 | | Molecular weight | 154.1201 | H bond donors | 3 | ACD/LogP | 1.62 | | Phase 25 °C | solid | Rotatable bonds | 3 | Predicted density | 1.56 g/cm3 | | SMILES | c1cc(c(c(c1)O)O)C(=O)O | | STD InChIKey | GLDQAMYCGOIJDV-UHFFFAOYAE | | Melting Points | | mp °C | source | |
|---|
| 206.00 | Alfa Aesar | | 204.00 | DrugBank | | 204.00 | PHYSPROP |
|
|
| | | 2,3-dihydroxynaphthalene C10H8O23, 64 |
 | | Compound Data | | Melting point | 163.00 °C | 436.15 K | | CSID | 6824 | H bond acceptors | 2 | Rule of 5 violations | 0 | | Molecular weight | 160.1693 | H bond donors | 2 | ACD/LogP | 2.11 | | Phase 25 °C | solid | Rotatable bonds | 2 | Predicted density | 1.33 g/cm3 | | SMILES | Oc2cc1c(cccc1)cc2O | | STD InChIKey | JRNGUTKWMSBIBF-UHFFFAOYAQ | | Melting Points | | mp °C | source | |
|---|
| 164.00 | Alfa Aesar | | 162.00 | PHYSPROP |
|
|
| | | 2,3-dimethoxybenzonitrile C9H9NO23, 61 |
 | | Compound Data | | Melting point | 45.25 °C | 318.40 K | | CSID | 20548 | H bond acceptors | 3 | Rule of 5 violations | 0 | | Molecular weight | 163.1733 | H bond donors | 0 | ACD/LogP | 1.57 | | Phase 25 °C | solid | Rotatable bonds | 2 | Predicted density | 1.12 g/cm3 | | SMILES | N#Cc1cccc(OC)c1OC | | STD InChIKey | LBXGBNHUNHWYRM-UHFFFAOYAW | | Melting Points | | mp °C | source | |
|---|
| 46.00 | Alfa Aesar | | 44.50 | Oxford University MSDS |
|
|
| | | 2,3-dimethyl-1-butene C6H123, 4, 64 |
 | |
|
| | | 2,3-dimethyl-2-hexene C8H164, 64 |
 | | Compound Data | | Melting point | -115.05 °C | 158.10 K | | CSID | 21998 | H bond acceptors | 0 | Rule of 5 violations | 0 | | Molecular weight | 112.2126 | H bond donors | 0 | ACD/LogP | 4.53 | | Phase 25 °C | liquid/gas | Rotatable bonds | 2 | Predicted density | 0.73 g/cm3 | | SMILES | C(=C(/C)CCC)(\C)C | | STD InChIKey | RGYAVZGBAJFMIZ-UHFFFAOYAY | | Melting Points | | mp °C | source | |
|---|
| -115.00 | American Petroleum Institute. Research Project 44; Selected ... | | -115.10 | PHYSPROP |
|
|
| | | 2,3-dimethyl-2-pentene C7H144, 64 |
 | | Compound Data | | Melting point | -118.15 °C | 155.00 K | | CSID | 23718 | H bond acceptors | 0 | Rule of 5 violations | 0 | | Molecular weight | 98.1861 | H bond donors | 0 | ACD/LogP | 4.00 | | Phase 25 °C | liquid/gas | Rotatable bonds | 1 | Predicted density | 0.71 g/cm3 | | SMILES | C(=C(/C)CC)(\C)C | | STD InChIKey | WFHALSLYRWWUGH-UHFFFAOYAT | | Melting Points | | mp °C | source | |
|---|
| -118.00 | American Petroleum Institute. Research Project 44; Selected ... | | -118.30 | PHYSPROP |
|
|
| | | 2,3-dimethylaniline C8H11N2, 3 |
 | | Compound Data | | Melting point | 2.50 °C | 275.65 K | | CSID | 13840647 | H bond acceptors | 1 | Rule of 5 violations | 0 | | Molecular weight | 121.1796 | H bond donors | 2 | ACD/LogP | 1.86 | | Phase 25 °C | liquid/gas | Rotatable bonds | 1 | Predicted density | 0.97 g/cm3 | | SMILES | Cc1cccc(N)c1C | | STD InChIKey | VVAKEQGKZNKUSU-UHFFFAOYAN | | Melting Points | | mp °C | source | |
|---|
| 2.00 | Aldrich Chemical Company; Aldrich Catalog-Handbook of Fine C... | | 3.00 | Alfa Aesar |
|
|
| | | 2,3-dimethylbenzoic acid C9H10O23, 64 |
 | | Compound Data | | Melting point | 145.50 °C | 418.65 K | | CSID | 11289 | H bond acceptors | 2 | Rule of 5 violations | 0 | | Molecular weight | 150.1745 | H bond donors | 1 | ACD/LogP | 2.81 | | Phase 25 °C | solid | Rotatable bonds | 1 | Predicted density | 1.12 g/cm3 | | SMILES | O=C(O)c1cccc(c1C)C | | STD InChIKey | RIZUCYSQUWMQLX-UHFFFAOYAN | | Melting Points | | mp °C | source | |
|---|
| 145.00 | Alfa Aesar | | 146.00 | PHYSPROP |
|
|
| | | 2,3-dimethylbutane C6H143, 4, 61, 64 |
 | |
|
| | | 2,3-dimethylphenol C8H10O3, 28, 31, 64, 72 |
 | |
|
| | | 2,3-diphenyl-2-cyclopropen-1-one C15H10O3, 64 |
 | | Compound Data | | Melting point | 119.50 °C | 392.65 K | | CSID | 58568 | H bond acceptors | 1 | Rule of 5 violations | 0 | | Molecular weight | 206.2393 | H bond donors | 0 | ACD/LogP | 3.78 | | Phase 25 °C | solid | Rotatable bonds | 2 | Predicted density | 1.23 g/cm3 | | SMILES | O=C2C(=C2\c1ccccc1)\c3ccccc3 | | STD InChIKey | HCIBTBXNLVOFER-UHFFFAOYAZ | | Melting Points | | mp °C | source | |
|---|
| 120.00 | Alfa Aesar | | 119.00 | PHYSPROP |
|
|
| | | 2,3-diphenylquinoxaline C20H14N23, 61 |
 | | Compound Data | | Melting point | 126.25 °C | 399.40 K | | CSID | 66909 | H bond acceptors | 2 | Rule of 5 violations | 0 | | Molecular weight | 282.3386 | H bond donors | 0 | ACD/LogP | 4.24 | | Phase 25 °C | solid | Rotatable bonds | 2 | Predicted density | 1.17 g/cm3 | | SMILES | n1c4ccccc4nc(c1c2ccccc2)c3ccccc3 | | STD InChIKey | RSNQVABHABAKEZ-UHFFFAOYAA | | Melting Points | | mp °C | source | |
|---|
| 126.00 | Alfa Aesar | | 126.50 | Oxford University MSDS |
|
|
| | | 2,3,3-trimethyl-1-butene C7H144, 64 |
 | | Compound Data | | Melting point | -109.95 °C | 163.20 K | | CSID | 11179 | H bond acceptors | 0 | Rule of 5 violations | 0 | | Molecular weight | 98.1861 | H bond donors | 0 | ACD/LogP | 3.62 | | Phase 25 °C | liquid/gas | Rotatable bonds | 1 | Predicted density | 0.71 g/cm3 | | SMILES | C=C(/C)C(C)(C)C | | STD InChIKey | AUYRUAVCWOAHQN-UHFFFAOYAR | | Melting Points | | mp °C | source | |
|---|
| -110.00 | American Petroleum Institute. Research Project 44; Selected ... | | -109.90 | PHYSPROP |
|
|
| | | 2,3,3-trimethylhexane C9H204, 64 |
 | | Compound Data | | Melting point | -116.90 °C | 156.25 K | | CSID | 26065 | H bond acceptors | 0 | Rule of 5 violations | 0 | | Molecular weight | 128.2551 | H bond donors | 0 | ACD/LogP | 4.99 | | Phase 25 °C | liquid/gas | Rotatable bonds | 3 | Predicted density | 0.72 g/cm3 | | SMILES | CC(C)C(C)(C)CCC | | STD InChIKey | DJYSEQMMCZAKGT-UHFFFAOYAV | | Melting Points | | mp °C | source | |
|---|
| -117.00 | American Petroleum Institute. Research Project 44; Selected ... | | -116.80 | PHYSPROP |
|
|
| | | 2,3,3-trimethylpentane C8H184, 64 |
 | | Compound Data | | Melting point | -100.95 °C | 172.20 K | | CSID | 10742 | H bond acceptors | 0 | Rule of 5 violations | 0 | | Molecular weight | 114.2285 | H bond donors | 0 | ACD/LogP | 4.46 | | Phase 25 °C | liquid/gas | Rotatable bonds | 2 | Predicted density | 0.71 g/cm3 | | SMILES | CC(C)C(C)(C)CC | | STD InChIKey | OKVWYBALHQFVFP-UHFFFAOYAT | | Melting Points | | mp °C | source | |
|---|
| -101.00 | American Petroleum Institute. Research Project 44; Selected ... | | -100.90 | PHYSPROP |
|
|
| | | 2,3,3,4-tetramethylpentane C9H204, 64 |
 | | Compound Data | | Melting point | -102.05 °C | 171.10 K | | CSID | 26070 | H bond acceptors | 0 | Rule of 5 violations | 0 | | Molecular weight | 128.2551 | H bond donors | 0 | ACD/LogP | 4.80 | | Phase 25 °C | liquid/gas | Rotatable bonds | 2 | Predicted density | 0.72 g/cm3 | | SMILES | CC(C)C(C)(C)C(C)C | | STD InChIKey | JLCYYQOQSAMWTA-UHFFFAOYAI | | Melting Points | | mp °C | source | |
|---|
| -102.00 | American Petroleum Institute. Research Project 44; Selected ... | | -102.10 | PHYSPROP |
|
|
| | | 2,3,4-trihydroxyacetophenone C8H8O43, 64 |
 | | Compound Data | | Melting point | 172.00 °C | 445.15 K | | CSID | 10256 | H bond acceptors | 4 | Rule of 5 violations | 0 | | Molecular weight | 168.1467 | H bond donors | 3 | ACD/LogP | 1.73 | | Phase 25 °C | solid | Rotatable bonds | 4 | Predicted density | 1.45 g/cm3 | | SMILES | O=C(c1c(O)c(O)c(O)cc1)C | | STD InChIKey | XIROXSOOOAZHLL-UHFFFAOYAA | | Melting Points | | mp °C | source | |
|---|
| 171.00 | Alfa Aesar | | 173.00 | PHYSPROP |
|
|
| | | 2,3,4-trimethoxybenzoic acid C10H12O53, 64 |
 | | Compound Data | | Melting point | 100.75 °C | 373.90 K | | CSID | 10833 | H bond acceptors | 5 | Rule of 5 violations | 0 | | Molecular weight | 212.1993 | H bond donors | 1 | ACD/LogP | 1.38 | | Phase 25 °C | solid | Rotatable bonds | 4 | Predicted density | 1.22 g/cm3 | | SMILES | O=C(O)c1c(OC)c(OC)c(OC)cc1 | | STD InChIKey | HZNQSWJZTWOTKM-UHFFFAOYAS | | Melting Points | | mp °C | source | |
|---|
| 101.00 | Alfa Aesar | | 100.50 | PHYSPROP |
|
|
| | | 2,3,4-trimethyl-2-pentene C8H164, 64 |
 | | Compound Data | | Melting point | -113.20 °C | 159.95 K | | CSID | 10796 | H bond acceptors | 0 | Rule of 5 violations | 0 | | Molecular weight | 112.2126 | H bond donors | 0 | ACD/LogP | 4.35 | | Phase 25 °C | liquid/gas | Rotatable bonds | 1 | Predicted density | 0.73 g/cm3 | | SMILES | C(=C(/C)C(C)C)(\C)C | | STD InChIKey | SZFRZEBLZFTODC-UHFFFAOYAT | | Melting Points | | mp °C | source | |
|---|
| -113.00 | American Petroleum Institute. Research Project 44; Selected ... | | -113.40 | PHYSPROP |
|
|
| | | 2,3,4-trimethylpentane C8H183, 4, 64 |
 | |
|
| | | 2,3,4,5,6-pentafluorobenzamide C7H18N23, 64 |
 | | Compound Data | | Melting point | 28.45 °C | 301.60 K | | CSID | 62737 | H bond acceptors | 2 | Rule of 5 violations | 0 | | Molecular weight | 130.2312 | H bond donors | 4 | ACD/LogP | 0.57 | | Phase 25 °C | solid | Rotatable bonds | 8 | Predicted density | 0.86 g/cm3 | | SMILES | NCCCCCCCN | | STD InChIKey | PWSKHLMYTZNYKO-UHFFFAOYAF | | Melting Points | | mp °C | source | |
|---|
| 28.00 | Alfa Aesar | | 28.90 | PHYSPROP |
|
|
| | | 2,3,4,5,6-pentafluorobenzyl alcohol C7H3F5O3, 32, 64 |
 | | Compound Data | | Melting point | 36.33 °C | 309.48 K | | CSID | 9535 | H bond acceptors | 1 | Rule of 5 violations | 0 | | Molecular weight | 198.0901 | H bond donors | 1 | ACD/LogP | 1.22 | | Phase 25 °C | solid | Rotatable bonds | 2 | Predicted density | 1.59 g/cm3 | | SMILES | Fc1c(c(F)c(F)c(F)c1F)CO | | STD InChIKey | PGJYYCIOYBZTPU-UHFFFAOYAP | | Melting Points | | mp °C | source | |
|---|
| 34.00 | Alfa Aesar | | 37.50 | DrugBank | | 37.50 | PHYSPROP |
|
|
| | | 2,3,4,5,6-pentafluorotoluene C7H3F53, 64 |
 | | Compound Data | | Melting point | -29.90 °C | 243.25 K | | CSID | 21168888 | H bond acceptors | 0 | Rule of 5 violations | 0 | | Molecular weight | 182.0907 | H bond donors | 0 | ACD/LogP | 2.86 | | Phase 25 °C | liquid/gas | Rotatable bonds | 0 | Predicted density | 1.44 g/cm3 | | SMILES | Fc1c(C)c(F)c(F)c(F)c1F | | STD InChIKey | SXPRVMIZFRCAGC-UHFFFAOYAI | | Melting Points | | mp °C | source | |
|---|
| -30.00 | Alfa Aesar | | -29.80 | PHYSPROP |
|
|
| | | 2,3,5-tribromothiophene C4HBr3S3, 64 |
 | | Compound Data | | Melting point | 28.00 °C | 301.15 K | | CSID | 69057 | H bond acceptors | 0 | Rule of 5 violations | 0 | | Molecular weight | 320.8277 | H bond donors | 0 | ACD/LogP | 4.10 | | Phase 25 °C | solid | Rotatable bonds | 0 | Predicted density | 2.52 g/cm3 | | SMILES | Brc1sc(Br)c(Br)c1 | | STD InChIKey | SKDNDSLDRLEELJ-UHFFFAOYAQ | | Melting Points | | mp °C | source | |
|---|
| 27.00 | Alfa Aesar | | 29.00 | PHYSPROP |
|
|
| | | 2,3,5-trimethylphenol C9H12O3, 64 |
 | | Compound Data | | Melting point | 93.75 °C | 366.90 K | | CSID | 12244 | H bond acceptors | 1 | Rule of 5 violations | 0 | | Molecular weight | 136.191 | H bond donors | 1 | ACD/LogP | 2.86 | | Phase 25 °C | solid | Rotatable bonds | 1 | Predicted density | 1.00 g/cm3 | | SMILES | Oc1cc(cc(c1C)C)C | | STD InChIKey | OGRAOKJKVGDSFR-UHFFFAOYAF | | Melting Points | | mp °C | source | |
|---|
| 94.00 | Alfa Aesar | | 93.50 | PHYSPROP |
|
|
| | | 2,3,5,6-tetrachloropyridine C5HCl4N3, 64 |
 | | Compound Data | | Melting point | 90.75 °C | 363.90 K | | CSID | 16096 | H bond acceptors | 1 | Rule of 5 violations | 0 | | Molecular weight | 216.8801 | H bond donors | 0 | ACD/LogP | 3.38 | | Phase 25 °C | solid | Rotatable bonds | 0 | Predicted density | 1.66 g/cm3 | | SMILES | Clc1c(Cl)nc(Cl)c(Cl)c1 | | STD InChIKey | FATBKZJZAHWCSL-UHFFFAOYAH | | Melting Points | | mp °C | source | |
|---|
| 91.00 | Alfa Aesar | | 90.50 | PHYSPROP |
|
|
| | | 2,3,5,6-tetrafluoroaniline C6H3F4N3, 64 |
 | | Compound Data | | Melting point | 31.25 °C | 304.40 K | | CSID | 21112533 | H bond acceptors | 1 | Rule of 5 violations | 0 | | Molecular weight | 165.0883 | H bond donors | 2 | ACD/LogP | 2.54 | | Phase 25 °C | solid | Rotatable bonds | 1 | Predicted density | 1.52 g/cm3 | | SMILES | Fc1cc(F)c(F)c(N)c1F | | STD InChIKey | SPSWJTZNOXMMMV-UHFFFAOYAI | | Melting Points | | mp °C | source | |
|---|
| 31.00 | Alfa Aesar | | 31.50 | PHYSPROP |
|
|
| | | 2,3,5,6-tetrafluorophenylhydrazine C6H4F4N23, 64 |
 | | Compound Data | | Melting point | 90.50 °C | 363.65 K | | CSID | 62756 | H bond acceptors | 2 | Rule of 5 violations | 0 | | Molecular weight | 180.103 | H bond donors | 3 | ACD/LogP | 2.18 | | Phase 25 °C | solid | Rotatable bonds | 2 | Predicted density | 1.59 g/cm3 | | SMILES | Fc1c(F)cc(F)c(F)c1NN | | STD InChIKey | TYMFVEOXNZYYTF-UHFFFAOYAD | | Melting Points | | mp °C | source | |
|---|
| 89.00 | Alfa Aesar | | 92.00 | PHYSPROP |
|
|
| | | 2,3,5,6-tetramethylbenzyl chloride C11H15Cl3, 3, 48, 75 |
 | | Compound Data | | Melting point | 70.00 °C | 343.15 K | | CSID | 73945 | H bond acceptors | 0 | Rule of 5 violations | 0 | | Molecular weight | 182.6898 | H bond donors | 0 | ACD/LogP | 4.33 | | Phase 25 °C | solid | Rotatable bonds | 1 | Predicted density | 1.00 g/cm3 | | SMILES | ClCc1c(c(cc(c1C)C)C)C | | STD InChIKey | UGAPPXGBBWAIGT-UHFFFAOYAT | | Melting Points | | mp °C | source | |
|---|
| 70.00 | Alfa Aesar | | 69.50 | Alfa Aesar | | 70.50 | TauChem | | Values not used in calculating the average melting point | | 168.00 | Karthikeyan M.; Glen R.C.; Bender A. General melting point p...1 | | 1. clearly out of range JCB |
|
|
| | | 2,3,6-trichlorophenol C6H3Cl3O61, 64 |
 | | Compound Data | | Melting point | 57.00 °C | 330.15 K | | CSID | 13029 | H bond acceptors | 1 | Rule of 5 violations | 0 | | Molecular weight | 197.4464 | H bond donors | 1 | ACD/LogP | 3.33 | | Phase 25 °C | solid | Rotatable bonds | 1 | Predicted density | 1.60 g/cm3 | | SMILES | Clc1c(O)c(Cl)ccc1Cl | | STD InChIKey | XGCHAIDDPMFRLJ-UHFFFAOYAK | | Melting Points | | mp °C | source | |
|---|
| 56.00 | Oxford University MSDS | | 58.00 | PHYSPROP |
|
|
| | | 2,3,6-trifluorobenzoic acid C7H3F3O23, 64 |
 | | Compound Data | | Melting point | 130.75 °C | 403.90 K | | CSID | 453633 | H bond acceptors | 2 | Rule of 5 violations | 0 | | Molecular weight | 176.0927 | H bond donors | 1 | ACD/LogP | 2.10 | | Phase 25 °C | solid | Rotatable bonds | 1 | Predicted density | 1.54 g/cm3 | | SMILES | Fc1c(C(=O)O)c(F)ccc1F | | STD InChIKey | MGUPHQGQNHDGNK-UHFFFAOYAZ | | Melting Points | | mp °C | source | |
|---|
| 131.00 | Alfa Aesar | | 130.50 | PHYSPROP |
|
|
| | | 2,4-di-t-butylphenol C14H22O3, 61, 64 |
 | | Compound Data | | Melting point | 55.33 °C | 328.48 K | | CSID | 7037 | H bond acceptors | 1 | Rule of 5 violations | 0 | | Molecular weight | 206.3239 | H bond donors | 1 | ACD/LogP | 4.86 | | Phase 25 °C | solid | Rotatable bonds | 3 | Predicted density | 0.93 g/cm3 | | SMILES | Oc1ccc(cc1C(C)(C)C)C(C)(C)C | | STD InChIKey | ICKWICRCANNIBI-UHFFFAOYAJ | | Melting Points | | mp °C | source | |
|---|
| 55.00 | Alfa Aesar | | 54.50 | Oxford University MSDS | | 56.50 | PHYSPROP |
|
|
| | | 2,4-diaminotoluene C7H10N22, 3, 64 |
 | |
|
| | | 2,4-dibromoaniline C6H5Br2N2, 3, 64 |
 | |
|
| | | 2,4-dibromophenol C6H4Br2O2, 3, 64 |
 | |
|
| | | 2,4-dichloro-1-nitrobenzene C6H3Cl2NO22, 3, 61, 64 |
 | |
|
| | | 2,4-dichloro-6-methylpyrimidine C5H4Cl2N23, 64 |
 | | Compound Data | | Melting point | 46.25 °C | 319.40 K | | CSID | 71784 | H bond acceptors | 2 | Rule of 5 violations | 0 | | Molecular weight | 163.0047 | H bond donors | 0 | ACD/LogP | 1.61 | | Phase 25 °C | solid | Rotatable bonds | 0 | Predicted density | 1.40 g/cm3 | | SMILES | Cc1cc(nc(n1)Cl)Cl | | STD InChIKey | BTLKROSJMNFSQZ-UHFFFAOYAF | | Melting Points | | mp °C | source | |
|---|
| 46.00 | Alfa Aesar | | 46.50 | PHYSPROP |
|
|
| | | 2,4-dichloroacetophenone C8H6Cl2O2, 3, 64 |
 | |
|
| | | 2,4-dichloroaniline C6H5Cl2N2, 3, 64 |
 | |
|
| | | 2,4-dichloroanisole C7H6Cl2O3, 64 |
 | | Compound Data | | Melting point | 27.25 °C | 300.40 K | | CSID | 10648 | H bond acceptors | 1 | Rule of 5 violations | 0 | | Molecular weight | 177.0279 | H bond donors | 0 | ACD/LogP | 3.38 | | Phase 25 °C | solid | Rotatable bonds | 1 | Predicted density | 1.29 g/cm3 | | SMILES | Clc1cc(Cl)ccc1OC | | STD InChIKey | CICQUFBZCADHHX-UHFFFAOYAA | | Melting Points | | mp °C | source | |
|---|
| 26.00 | Alfa Aesar | | 28.50 | PHYSPROP |
|
|
| | | 2,4-dichlorobenzaldehyde C7H4Cl2O2, 3, 64 |
 | |
|
| | | 2,4-dichlorobenzoyl chloride C7H3Cl3O3, 64 |
 | | Compound Data | | Melting point | 17.25 °C | 290.40 K | | CSID | 60012 | H bond acceptors | 1 | Rule of 5 violations | 0 | | Molecular weight | 209.4571 | H bond donors | 0 | ACD/LogP | 3.16 | | Phase 25 °C | liquid/gas | Rotatable bonds | 1 | Predicted density | 1.50 g/cm3 | | SMILES | O=C(Cl)c1ccc(Cl)cc1Cl | | STD InChIKey | CEOCVKWBUWKBKA-UHFFFAOYAU | | Melting Points | | mp °C | source | |
|---|
| 18.00 | Alfa Aesar | | 16.50 | PHYSPROP |
|
|
| | | 2,4-dichlorobenzyl alcohol C7H6Cl2O3, 64 |
 | | Compound Data | | Melting point | 59.25 °C | 332.40 K | | CSID | 14918 | H bond acceptors | 1 | Rule of 5 violations | 0 | | Molecular weight | 177.0279 | H bond donors | 1 | ACD/LogP | 2.24 | | Phase 25 °C | solid | Rotatable bonds | 2 | Predicted density | 1.39 g/cm3 | | SMILES | Clc1cc(Cl)ccc1CO | | STD InChIKey | DBHODFSFBXJZNY-UHFFFAOYAI | | Melting Points | | mp °C | source | |
|---|
| 59.00 | Alfa Aesar | | 59.50 | PHYSPROP |
|
|
| | | 2,4-dichlorobenzyl chloride C7H5Cl33, 31, 64 |
 | |
|
| | | 2,4-dichlorophenol C6H4Cl2O2, 3, 64, 70 |
 | |
|
| | | 2,4-dichlorotoluene C7H6Cl23, 64 |
 | | Compound Data | | Melting point | -13.25 °C | 259.90 K | | CSID | 21111905 | H bond acceptors | 0 | Rule of 5 violations | 0 | | Molecular weight | 161.0285 | H bond donors | 0 | ACD/LogP | 3.88 | | Phase 25 °C | liquid/gas | Rotatable bonds | 0 | Predicted density | 1.24 g/cm3 | | SMILES | Clc1cc(Cl)c(C)cc1 | | STD InChIKey | FUNUTBJJKQIVSY-UHFFFAOYAA | | Melting Points | | mp °C | source | |
|---|
| -13.00 | Alfa Aesar | | -13.50 | PHYSPROP |
|
|
| | | 2,4-difluoro-1-nitrobenzene C6H3F2NO23, 61, 64 |
 | | Compound Data | | Melting point | 9.60 °C | 282.75 K | | CSID | 21106036 | H bond acceptors | 3 | Rule of 5 violations | 0 | | Molecular weight | 159.0903 | H bond donors | 0 | ACD/LogP | 1.58 | | Phase 25 °C | liquid/gas | Rotatable bonds | 1 | Predicted density | 1.45 g/cm3 | | SMILES | O=[N+]([O-])c1ccc(F)cc1F | | STD InChIKey | RJXOVESYJFXCGI-UHFFFAOYAO | | Melting Points | | mp °C | source | |
|---|
| 10.00 | Alfa Aesar | | 9.00 | Oxford University MSDS | | 9.80 | PHYSPROP |
|
|
| | | 2,4-difluoroaniline C6H5F2N3, 61, 64 |
 | | Compound Data | | Melting point | -7.67 °C | 265.48 K | | CSID | 9328 | H bond acceptors | 1 | Rule of 5 violations | 0 | | Molecular weight | 129.1074 | H bond donors | 2 | ACD/LogP | 1.52 | | Phase 25 °C | liquid/gas | Rotatable bonds | 1 | Predicted density | 1.29 g/cm3 | | SMILES | Fc1ccc(N)c(F)c1 | | STD InChIKey | CEPCPXLLFXPZGW-UHFFFAOYAI | | Melting Points | | mp °C | source | |
|---|
| -8.00 | Alfa Aesar | | -7.50 | Oxford University MSDS | | -7.50 | PHYSPROP |
|
|
| | | 2,4-difluorobenzoic acid C7H4F2O23, 64 |
 | | Compound Data | | Melting point | 188.50 °C | 461.65 K | | CSID | 66716 | H bond acceptors | 2 | Rule of 5 violations | 0 | | Molecular weight | 158.1023 | H bond donors | 1 | ACD/LogP | 2.07 | | Phase 25 °C | solid | Rotatable bonds | 1 | Predicted density | 1.43 g/cm3 | | SMILES | O=C(O)c1ccc(F)cc1F | | STD InChIKey | NJYBIFYEWYWYAN-UHFFFAOYAW | | Melting Points | | mp °C | source | |
|---|
| 188.00 | Alfa Aesar | | 189.00 | PHYSPROP |
|
|
| | | 2,4-dihydroxyacetophenone C8H8O33, 64 |
 | | Compound Data | | Melting point | 145.00 °C | 418.15 K | | CSID | 6724 | H bond acceptors | 3 | Rule of 5 violations | 0 | | Molecular weight | 152.1473 | H bond donors | 2 | ACD/LogP | 1.74 | | Phase 25 °C | solid | Rotatable bonds | 3 | Predicted density | 1.29 g/cm3 | | SMILES | O=C(c1ccc(O)cc1O)C | | STD InChIKey | SULYEHHGGXARJS-UHFFFAOYAF | | Melting Points | | mp °C | source | |
|---|
| 144.00 | Alfa Aesar | | 146.00 | PHYSPROP |
|
|
| | | 2,4-dihydroxybenzaldehyde C7H6O32, 3, 48, 61, 64 |
 | |
|
| | | 2,4-dihydroxybenzoic acid C7H6O42, 32 |
 | | Compound Data | | Melting point | 225.50 °C | 498.65 K | | CSID | 1446 | H bond acceptors | 4 | Rule of 5 violations | 0 | | Molecular weight | 154.1201 | H bond donors | 3 | ACD/LogP | 1.76 | | Phase 25 °C | solid | Rotatable bonds | 3 | Predicted density | 1.56 g/cm3 | | SMILES | c1cc(c(cc1O)O)C(=O)O | | STD InChIKey | UIAFKZKHHVMJGS-UHFFFAOYAR | | Melting Points | | mp °C | source | |
|---|
| 225.00 | Aldrich Chemical Company; Aldrich Catalog-Handbook of Fine C... | | 226.00 | DrugBank |
|
|
| | | 2,4-dihydroxybenzophenone C13H10O33, 64 |
 | | Compound Data | | Melting point | 145.00 °C | 418.15 K | | CSID | 8254 | H bond acceptors | 3 | Rule of 5 violations | 0 | | Molecular weight | 214.2167 | H bond donors | 2 | ACD/LogP | 3.17 | | Phase 25 °C | solid | Rotatable bonds | 4 | Predicted density | 1.30 g/cm3 | | SMILES | O=C(c1ccc(O)cc1O)c2ccccc2 | | STD InChIKey | ZXDDPOHVAMWLBH-UHFFFAOYAB | | Melting Points | | mp °C | source | |
|---|
| 146.00 | Alfa Aesar | | 144.00 | PHYSPROP |
|
|
| | | 2,4-dihydroxypropiophenone C9H10O33, 64 |
 | | Compound Data | | Melting point | 99.50 °C | 372.65 K | | CSID | 72148 | H bond acceptors | 3 | Rule of 5 violations | 0 | | Molecular weight | 166.1739 | H bond donors | 2 | ACD/LogP | 2.27 | | Phase 25 °C | solid | Rotatable bonds | 4 | Predicted density | 1.24 g/cm3 | | SMILES | O=C(c1ccc(O)cc1O)CC | | STD InChIKey | LLBBBYLDTDJMNU-UHFFFAOYAE | | Melting Points | | mp °C | source | |
|---|
| 100.00 | Alfa Aesar | | 99.00 | PHYSPROP |
|
|
| | | 2,4-diisocyanato-1-methylbenzene C9H6N2O23, 61, 64, 64, 64 |
 | | Compound Data | | Melting point | 20.40 °C | 293.55 K | | CSID | 13835351 | H bond acceptors | 4 | Rule of 5 violations | 0 | | Molecular weight | 174.1561 | H bond donors | 0 | ACD/LogP | 3.47 | | Phase 25 °C | liquid/gas | Rotatable bonds | 2 | Predicted density | 1.14 g/cm3 | | SMILES | Cc1ccc(cc1\N=C=O)\N=C=O | | STD InChIKey | DVKJHBMWWAPEIU-UHFFFAOYAL | | Melting Points | | mp °C | source | |
|---|
| 21.00 | Alfa Aesar | | 20.50 | Oxford University MSDS | | 20.50 | PHYSPROP | | 20.00 | PHYSPROP | | 20.00 | PHYSPROP |
|
|
| | | 2,4-dimethoxy-1-nitrobenzene C8H9NO43, 64 |
 | | Compound Data | | Melting point | 75.25 °C | 348.40 K | | CSID | 70990 | H bond acceptors | 5 | Rule of 5 violations | 0 | | Molecular weight | 183.1614 | H bond donors | 0 | ACD/LogP | 1.69 | | Phase 25 °C | solid | Rotatable bonds | 3 | Predicted density | 1.23 g/cm3 | | SMILES | [O-][N+](=O)c1ccc(OC)cc1OC | | STD InChIKey | XXWIYOBCHKCWNT-UHFFFAOYAL | | Melting Points | | mp °C | source | |
|---|
| 74.00 | Alfa Aesar | | 76.50 | PHYSPROP |
|
|
| | | 2,4-dimethoxyacetophenone C10H12O32, 3 |
 | | Compound Data | | Melting point | 40.50 °C | 313.65 K | | CSID | 63208 | H bond acceptors | 3 | Rule of 5 violations | 0 | | Molecular weight | 180.2005 | H bond donors | 0 | ACD/LogP | 1.84 | | Phase 25 °C | solid | Rotatable bonds | 3 | Predicted density | 1.07 g/cm3 | | SMILES | O=C(c1ccc(OC)cc1OC)C | | STD InChIKey | VQTDPCRSXHFMOL-UHFFFAOYAO | | Melting Points | | mp °C | source | |
|---|
| 41.00 | Aldrich Chemical Company; Aldrich Catalog-Handbook of Fine C... | | 40.00 | Alfa Aesar |
|
|
| | | 2,4-dimethoxyaniline C8H11NO23, 61, 64 |
 | | Compound Data | | Melting point | 34.00 °C | 307.15 K | | CSID | 16685 | H bond acceptors | 3 | Rule of 5 violations | 0 | | Molecular weight | 153.1784 | H bond donors | 2 | ACD/LogP | 0.78 | | Phase 25 °C | solid | Rotatable bonds | 3 | Predicted density | 1.10 g/cm3 | | SMILES | O(c1cc(OC)ccc1N)C | | STD InChIKey | GEQNZVKIDIPGCO-UHFFFAOYAU | | Melting Points | | mp °C | source | |
|---|
| 35.00 | Alfa Aesar | | 33.50 | Oxford University MSDS | | 33.50 | PHYSPROP |
|
|
| | | 2,4-dimethoxybenzaldehyde C9H10O32, 3, 64 |
 | |
|
| | | 2,4-dimethyl-1-nitrobenzene C8H9NO23, 61, 64 |
 | | Compound Data | | Melting point | 7.33 °C | 280.48 K | | CSID | 6725 | H bond acceptors | 3 | Rule of 5 violations | 0 | | Molecular weight | 151.1626 | H bond donors | 0 | ACD/LogP | 2.87 | | Phase 25 °C | liquid/gas | Rotatable bonds | 1 | Predicted density | 1.13 g/cm3 | | SMILES | O=[N+]([O-])c1ccc(cc1C)C | | STD InChIKey | BBUPBICWUURTNP-UHFFFAOYAF | | Melting Points | | mp °C | source | |
|---|
| 6.00 | Alfa Aesar | | 7.00 | Oxford University MSDS | | 9.00 | PHYSPROP |
|
|
| | | 2,4-dimethyl-1-pentene C7H144, 64 |
 | | Compound Data | | Melting point | -124.05 °C | 149.10 K | | CSID | 15794 | H bond acceptors | 0 | Rule of 5 violations | 0 | | Molecular weight | 98.1861 | H bond donors | 0 | ACD/LogP | 3.80 | | Phase 25 °C | liquid/gas | Rotatable bonds | 2 | Predicted density | 0.70 g/cm3 | | SMILES | C=C(/C)CC(C)C | | STD InChIKey | LXQPBCHJNIOMQU-UHFFFAOYAS | | Melting Points | | mp °C | source | |
|---|
| -124.00 | American Petroleum Institute. Research Project 44; Selected ... | | -124.10 | PHYSPROP |
|
|
| | | 2,4-dimethyl-2-pentene C7H144, 64 |
 | | Compound Data | | Melting point | -127.85 °C | 145.30 K | | CSID | 11757 | H bond acceptors | 0 | Rule of 5 violations | 0 | | Molecular weight | 98.1861 | H bond donors | 0 | ACD/LogP | 3.79 | | Phase 25 °C | liquid/gas | Rotatable bonds | 1 | Predicted density | 0.71 g/cm3 | | SMILES | C(=C\C(C)C)(\C)C | | STD InChIKey | VVCFYASOGFVJFN-UHFFFAOYAT | | Melting Points | | mp °C | source | |
|---|
| -128.00 | American Petroleum Institute. Research Project 44; Selected ... | | -127.70 | PHYSPROP |
|
|
| | | 2,4-dimethylpentane C7H163, 4, 64 |
 | |
|
| | | 2,4-dimethylphenol C8H10O3, 31, 64 |
 | |
|
| | | 2,4-dinitro-1-naphthol C10H6N2O53, 61, 64 |
 | | Compound Data | | Melting point | 131.50 °C | 404.65 K | | CSID | 11309 | H bond acceptors | 7 | Rule of 5 violations | 0 | | Molecular weight | 234.165 | H bond donors | 1 | ACD/LogP | 2.97 | | Phase 25 °C | solid | Rotatable bonds | 3 | Predicted density | 1.61 g/cm3 | | SMILES | [O-][N+](=O)c2c1ccccc1c(O)c(c2)[N+]([O-])=O | | STD InChIKey | FFRBMBIXVSCUFS-UHFFFAOYAH | | Melting Points | | mp °C | source | |
|---|
| 132.00 | Alfa Aesar | | 131.50 | Oxford University MSDS | | 131.00 | PHYSPROP |
|
|
| | | 2,4-dinitro-N-phenylaniline C12H9N3O461, 64 |
 | | Compound Data | | Melting point | 159.50 °C | 432.65 K | | CSID | 13153 | H bond acceptors | 7 | Rule of 5 violations | 0 | | Molecular weight | 259.2176 | H bond donors | 1 | ACD/LogP | 4.11 | | Phase 25 °C | solid | Rotatable bonds | 4 | Predicted density | 1.45 g/cm3 | | SMILES | [O-][N+](=O)c2ccc(Nc1ccccc1)c(c2)[N+]([O-])=O | | STD InChIKey | RHTVQEPJVKUMPI-UHFFFAOYAH | | Melting Points | | mp °C | source | |
|---|
| 160.00 | Oxford University MSDS | | 159.00 | PHYSPROP |
|
|
| | | 2,4-dinitroaniline C6H5N3O42, 3, 61, 64 |
 | |
|
| | | 2,4-dinitrobenzoic acid C7H4N2O63, 64 |
 | | Compound Data | | Melting point | 181.50 °C | 454.65 K | | CSID | 11387 | H bond acceptors | 8 | Rule of 5 violations | 0 | | Molecular weight | 212.1165 | H bond donors | 1 | ACD/LogP | 1.49 | | Phase 25 °C | solid | Rotatable bonds | 3 | Predicted density | 1.69 g/cm3 | | SMILES | O=[N+]([O-])c1cc(ccc1C(=O)O)[N+]([O-])=O | | STD InChIKey | ZIIGSRYPZWDGBT-UHFFFAOYAK | | Melting Points | | mp °C | source | |
|---|
| 181.00 | Alfa Aesar | | 182.00 | PHYSPROP |
|
|
| | | 2,4-hexadiyne C6H63, 64 |
 | | Compound Data | | Melting point | 67.40 °C | 340.55 K | | CSID | 121383 | H bond acceptors | 0 | Rule of 5 violations | 0 | | Molecular weight | 78.1118 | H bond donors | 0 | ACD/LogP | 2.24 | | Phase 25 °C | solid | Rotatable bonds | 0 | Predicted density | 0.83 g/cm3 | | SMILES | C(#CC#CC)C | | STD InChIKey | PCTCNWZFDASPLA-UHFFFAOYAB | | Melting Points | | mp °C | source | |
|---|
| 67.00 | Alfa Aesar | | 67.80 | PHYSPROP |
|
|
| | | 2,4-lutidine C7H9N3, 64 |
 | | Compound Data | | Melting point | -62.00 °C | 211.15 K | | CSID | 21132380 | H bond acceptors | 1 | Rule of 5 violations | 0 | | Molecular weight | 107.1531 | H bond donors | 0 | ACD/LogP | 1.65 | | Phase 25 °C | liquid/gas | Rotatable bonds | 0 | Predicted density | 0.93 g/cm3 | | SMILES | Cc1ccnc(C)c1 | | STD InChIKey | JYYNAJVZFGKDEQ-UHFFFAOYAI | | Melting Points | | mp °C | source | |
|---|
| -60.00 | Alfa Aesar | | -64.00 | PHYSPROP |
|
|
| | | 2,4-thiazolidinedione C3H3NO2S3, 64 |
 | | Compound Data | | Melting point | 126.50 °C | 399.65 K | | CSID | 5242 | H bond acceptors | 3 | Rule of 5 violations | 0 | | Molecular weight | 117.1264 | H bond donors | 1 | ACD/LogP | -0.54 | | Phase 25 °C | solid | Rotatable bonds | 0 | Predicted density | 1.52 g/cm3 | | SMILES | O=C1NC(=O)SC1 | | STD InChIKey | ZOBPZXTWZATXDG-UHFFFAOYAD | | Melting Points | | mp °C | source | |
|---|
| 125.00 | Alfa Aesar | | 128.00 | PHYSPROP |
|
|
| | | 2,4,4-trimethyl-1-pentene C8H163, 4, 61, 64 |
 | |
|
| | | 2,4,4-trimethyl-2-pentene C8H163, 4, 64 |
 | |
|
| | | 2,4,4-trimethylhexane C9H204, 64 |
 | | Compound Data | | Melting point | -113.20 °C | 159.95 K | | CSID | 26066 | H bond acceptors | 0 | Rule of 5 violations | 0 | | Molecular weight | 128.2551 | H bond donors | 0 | ACD/LogP | 4.99 | | Phase 25 °C | liquid/gas | Rotatable bonds | 3 | Predicted density | 0.72 g/cm3 | | SMILES | CC(C)CC(C)(C)CC | | STD InChIKey | SVEMKBCPZYWEPH-UHFFFAOYAX | | Melting Points | | mp °C | source | |
|---|
| -113.00 | American Petroleum Institute. Research Project 44; Selected ... | | -113.40 | PHYSPROP |
|
|
| | | 2,4,5-trichloroaniline C6H4Cl3N3, 64 |
 | | Compound Data | | Melting point | 95.25 °C | 368.40 K | | CSID | 21111772 | H bond acceptors | 1 | Rule of 5 violations | 0 | | Molecular weight | 196.4617 | H bond donors | 2 | ACD/LogP | 3.42 | | Phase 25 °C | solid | Rotatable bonds | 1 | Predicted density | 1.54 g/cm3 | | SMILES | Nc1cc(Cl)c(Cl)cc1Cl | | STD InChIKey | GUMCAKKKNKYFEB-UHFFFAOYAK | | Melting Points | | mp °C | source | |
|---|
| 94.00 | Alfa Aesar | | 96.50 | PHYSPROP |
|
|
| | | 2,4,5-trichlorobiphenyl C12H7Cl364, 70 |
 | | Compound Data | | Melting point | 76.15 °C | 349.30 K | | CSID | 25605 | H bond acceptors | 0 | Rule of 5 violations | 1 | | Molecular weight | 257.543 | H bond donors | 0 | ACD/LogP | 5.41 | | Phase 25 °C | solid | Rotatable bonds | 1 | Predicted density | 1.35 g/cm3 | | SMILES | Clc2cc(c1ccccc1)c(Cl)cc2Cl | | STD InChIKey | VGVIKVCCUATMNG-UHFFFAOYAG | | Melting Points | | mp °C | source | |
|---|
| 76.30 | PHYSPROP | | 76.00 | Sepassi K; Yalkowsky SH. AAPS PharmSciTech 7(1) E1-E8 (2006) |
|
|
| | | 2,4,5-trichlorophenol C6H3Cl3O28, 56, 64, 72, 72 |
 | |
|
| | | 2,4,5-trifluorobenzoic acid C7H3F3O23, 64 |
 | | Compound Data | | Melting point | 99.00 °C | 372.15 K | | CSID | 454604 | H bond acceptors | 2 | Rule of 5 violations | 0 | | Molecular weight | 176.0927 | H bond donors | 1 | ACD/LogP | 2.31 | | Phase 25 °C | solid | Rotatable bonds | 1 | Predicted density | 1.54 g/cm3 | | SMILES | Fc1cc(C(=O)O)c(F)cc1F | | STD InChIKey | AKAMNXFLKYKFOJ-UHFFFAOYAF | | Melting Points | | mp °C | source | |
|---|
| 98.00 | Alfa Aesar | | 100.00 | PHYSPROP |
|
|
| | | 2,4,5-trimethoxybenzaldehyde C10H12O42, 3, 64 |
 | |
|
| | | 2,4,5-trimethoxybenzoic acid C10H12O53, 64 |
 | | Compound Data | | Melting point | 144.50 °C | 417.65 K | | CSID | 9856 | H bond acceptors | 5 | Rule of 5 violations | 0 | | Molecular weight | 212.1993 | H bond donors | 1 | ACD/LogP | 1.52 | | Phase 25 °C | solid | Rotatable bonds | 4 | Predicted density | 1.22 g/cm3 | | SMILES | O=C(O)c1c(OC)cc(OC)c(OC)c1 | | STD InChIKey | KVZUCOGWKYOPID-UHFFFAOYAF | | Melting Points | | mp °C | source | |
|---|
| 144.00 | Alfa Aesar | | 145.00 | PHYSPROP |
|
|
| | | 2,4,5-trimethylacetophenone C11H14O3, 64 |
 | | Compound Data | | Melting point | 10.25 °C | 283.40 K | | CSID | 21159574 | H bond acceptors | 1 | Rule of 5 violations | 0 | | Molecular weight | 162.2283 | H bond donors | 0 | ACD/LogP | 3.04 | | Phase 25 °C | liquid/gas | Rotatable bonds | 1 | Predicted density | 0.95 g/cm3 | | SMILES | Cc1cc(C(C)=O)c(C)cc1C | | STD InChIKey | GENBEGZNCBFHSU-UHFFFAOYAI | | Melting Points | | mp °C | source | |
|---|
| 10.00 | Alfa Aesar | | 10.50 | PHYSPROP |
|
|
| | | 2,4,5-triphenylimidazole C21H16N23, 64 |
 | | Compound Data | | Melting point | 275.50 °C | 548.65 K | | CSID | 9815 | H bond acceptors | 2 | Rule of 5 violations | 0 | | Molecular weight | 296.3651 | H bond donors | 1 | ACD/LogP | 4.94 | | Phase 25 °C | solid | Rotatable bonds | 3 | Predicted density | 1.15 g/cm3 | | SMILES | n1c(c(nc1c2ccccc2)c3ccccc3)c4ccccc4 | | STD InChIKey | RNIPJYFZGXJSDD-UHFFFAOYAN | | Melting Points | | mp °C | source | |
|---|
| 276.00 | Alfa Aesar | | 275.00 | PHYSPROP |
|
|
| | | 2,4,5,6-tetrafluoroisophthalonitrile C8F4N23, 61 |
 | | Compound Data | | Melting point | 78.00 °C | 351.15 K | | CSID | 528656 | H bond acceptors | 2 | Rule of 5 violations | 0 | | Molecular weight | 200.0926 | H bond donors | 0 | ACD/LogP | -0.27 | | Phase 25 °C | solid | Rotatable bonds | 0 | Predicted density | 1.54 g/cm3 | | SMILES | Fc1c(C#N)c(F)c(C#N)c(F)c1F | | STD InChIKey | WVHMPQKZPHOCRD-UHFFFAOYAL | | Melting Points | | mp °C | source | |
|---|
| 77.00 | Alfa Aesar | | 79.00 | Oxford University MSDS |
|
|
| | | 2,4,6-tribromo-3-methylphenol C7H5Br3O3, 64 |
 | | Compound Data | | Melting point | 83.00 °C | 356.15 K | | CSID | 19526 | H bond acceptors | 1 | Rule of 5 violations | 0 | | Molecular weight | 344.826 | H bond donors | 1 | ACD/LogP | 4.79 | | Phase 25 °C | solid | Rotatable bonds | 1 | Predicted density | 2.26 g/cm3 | | SMILES | Brc1c(c(Br)cc(Br)c1O)C | | STD InChIKey | QKHROXOPRBWBDD-UHFFFAOYAW | | Melting Points | | mp °C | source | |
|---|
| 82.00 | Alfa Aesar | | 84.00 | PHYSPROP |
|
|
| | | 2,4,6-tribromoaniline C6H4Br3N3, 61, 64 |
 | | Compound Data | | Melting point | 121.00 °C | 394.15 K | | CSID | 21106171 | H bond acceptors | 1 | Rule of 5 violations | 0 | | Molecular weight | 329.8147 | H bond donors | 2 | ACD/LogP | 4.42 | | Phase 25 °C | solid | Rotatable bonds | 1 | Predicted density | 2.35 g/cm3 | | SMILES | Brc1cc(Br)cc(Br)c1N | | STD InChIKey | GVPODVKBTHCGFU-UHFFFAOYAV | | Melting Points | | mp °C | source | |
|---|
| 120.00 | Alfa Aesar | | 121.00 | Oxford University MSDS | | 122.00 | PHYSPROP |
|
|
| | | 2,4,6-tribromotoluene C7H5Br33, 64 |
 | | Compound Data | | Melting point | 69.50 °C | 342.65 K | | CSID | 31264 | H bond acceptors | 0 | Rule of 5 violations | 0 | | Molecular weight | 328.8266 | H bond donors | 0 | ACD/LogP | 4.85 | | Phase 25 °C | solid | Rotatable bonds | 0 | Predicted density | 2.13 g/cm3 | | SMILES | Brc1cc(Br)cc(Br)c1C | | STD InChIKey | BFRIZWKDNUHPHL-UHFFFAOYAD | | Melting Points | | mp °C | source | |
|---|
| 69.00 | Alfa Aesar | | 70.00 | PHYSPROP |
|
|
| | | 2,4,6-trichloroaniline C6H4Cl3N3, 61, 64 |
 | | Compound Data | | Melting point | 76.50 °C | 349.65 K | | CSID | 11961 | H bond acceptors | 1 | Rule of 5 violations | 0 | | Molecular weight | 196.4617 | H bond donors | 2 | ACD/LogP | 3.74 | | Phase 25 °C | solid | Rotatable bonds | 1 | Predicted density | 1.54 g/cm3 | | SMILES | Clc1cc(Cl)cc(Cl)c1N | | STD InChIKey | NATVSFWWYVJTAZ-UHFFFAOYAL | | Melting Points | | mp °C | source | |
|---|
| 77.00 | Alfa Aesar | | 74.00 | Oxford University MSDS | | 78.50 | PHYSPROP |
|
|
| | | 2,4,6-trichloroanisole C7H5Cl3O61, 64 |
 | | Compound Data | | Melting point | 61.25 °C | 334.40 K | | CSID | 6620 | H bond acceptors | 1 | Rule of 5 violations | 0 | | Molecular weight | 211.473 | H bond donors | 0 | ACD/LogP | 3.95 | | Phase 25 °C | solid | Rotatable bonds | 1 | Predicted density | 1.42 g/cm3 | | SMILES | Clc1cc(Cl)cc(Cl)c1OC | | STD InChIKey | WCVOGSZTONGSQY-UHFFFAOYAT | | Melting Points | | mp °C | source | |
|---|
| 61.00 | Oxford University MSDS | | 61.50 | PHYSPROP |
|
|
| | | 2,4,6-trichlorobenzoic acid C7H3Cl3O23, 64 |
 | | Compound Data | | Melting point | 162.50 °C | 435.65 K | | CSID | 5561 | H bond acceptors | 2 | Rule of 5 violations | 0 | | Molecular weight | 225.4565 | H bond donors | 1 | ACD/LogP | 2.98 | | Phase 25 °C | solid | Rotatable bonds | 1 | Predicted density | 1.64 g/cm3 | | SMILES | O=C(O)c1c(Cl)cc(Cl)cc1Cl | | STD InChIKey | RAFFVQBMVYYTQS-UHFFFAOYAY | | Melting Points | | mp °C | source | |
|---|
| 163.00 | Alfa Aesar | | 162.00 | PHYSPROP |
|
|
| | | 2,4,6-trichlorophenol C6H3Cl3O3, 28, 56, 61, 64, 70, 72 |
 | |
|
| | | 2,4,6-trichloropyrimidine C4HCl3N23, 64 |
 | | Compound Data | | Melting point | 22.75 °C | 295.90 K | | CSID | 69792 | H bond acceptors | 2 | Rule of 5 violations | 0 | | Molecular weight | 183.4231 | H bond donors | 0 | ACD/LogP | 1.96 | | Phase 25 °C | liquid/gas | Rotatable bonds | 0 | Predicted density | 1.64 g/cm3 | | SMILES | c1c(nc(nc1Cl)Cl)Cl | | STD InChIKey | DPVIABCMTHHTGB-UHFFFAOYAK | | Melting Points | | mp °C | source | |
|---|
| 23.00 | Alfa Aesar | | 22.50 | PHYSPROP |
|
|
| | | 2,4,6-trifluorobenzoic acid C7H3F3O23, 64 |
 | | Compound Data | | Melting point | 142.00 °C | 415.15 K | | CSID | 453910 | H bond acceptors | 2 | Rule of 5 violations | 0 | | Molecular weight | 176.0927 | H bond donors | 1 | ACD/LogP | 2.11 | | Phase 25 °C | solid | Rotatable bonds | 1 | Predicted density | 1.54 g/cm3 | | SMILES | O=C(O)c1c(F)cc(F)cc1F | | STD InChIKey | SJZATRRXUILGHH-UHFFFAOYAK | | Melting Points | | mp °C | source | |
|---|
| 141.00 | Alfa Aesar | | 143.00 | PHYSPROP |
|
|
| | | 2,4,6-triiodophenol C6H3I3O2, 3, 64 |
 | |
|
| | | 2,4,6-trimethoxybenzaldehyde C10H12O42, 3, 3 |
 | |
|
| | | 2,4,6-trimethylbenzoic acid C10H12O23, 48, 64 |
 | |
|
| | | 2,4,6-trimethylphenol C9H12O3, 64 |
 | | Compound Data | | Melting point | 72.50 °C | 345.65 K | | CSID | 10248 | H bond acceptors | 1 | Rule of 5 violations | 0 | | Molecular weight | 136.191 | H bond donors | 1 | ACD/LogP | 2.86 | | Phase 25 °C | solid | Rotatable bonds | 1 | Predicted density | 1.00 g/cm3 | | SMILES | Oc1c(cc(cc1C)C)C | | STD InChIKey | BPRYUXCVCCNUFE-UHFFFAOYAC | | Melting Points | | mp °C | source | |
|---|
| 72.00 | Alfa Aesar | | 73.00 | PHYSPROP |
|
|
| | | 2,4,6-trimethylpyridine C8H11N3, 61, 64 |
 | | Compound Data | | Melting point | -45.00 °C | 228.15 K | | CSID | 21106174 | H bond acceptors | 1 | Rule of 5 violations | 0 | | Molecular weight | 121.1796 | H bond donors | 0 | ACD/LogP | 2.11 | | Phase 25 °C | liquid/gas | Rotatable bonds | 0 | Predicted density | 0.92 g/cm3 | | SMILES | Cc1cc(C)cc(C)n1 | | STD InChIKey | BWZVCCNYKMEVEX-UHFFFAOYAX | | Melting Points | | mp °C | source | |
|---|
| -43.00 | Alfa Aesar | | -46.00 | Oxford University MSDS | | -46.00 | PHYSPROP |
|
|
| | | 2,4,6-trinitrotoluene C7H5N3O661, 64 |
 | | Compound Data | | Melting point | 80.05 °C | 353.20 K | | CSID | 8073 | H bond acceptors | 9 | Rule of 5 violations | 0 | | Molecular weight | 227.1311 | H bond donors | 0 | ACD/LogP | 1.59 | | Phase 25 °C | solid | Rotatable bonds | 3 | Predicted density | 1.61 g/cm3 | | SMILES | Cc1c(cc(cc1[N+](=O)[O-])[N+](=O)[O-])[N+](=O)[O-] | | STD InChIKey | SPSSULHKWOKEEL-UHFFFAOYAZ | | Melting Points | | mp °C | source | |
|---|
| 80.00 | Oxford University MSDS | | 80.10 | PHYSPROP |
|
|
| | | 2,4,6-tris(allyloxy)-1,3,5-triazine C12H15N3O33, 61, 64 |
 | | Compound Data | | Melting point | 26.67 °C | 299.82 K | | CSID | 7274 | H bond acceptors | 6 | Rule of 5 violations | 0 | | Molecular weight | 249.2658 | H bond donors | 0 | ACD/LogP | 2.81 | | Phase 25 °C | solid | Rotatable bonds | 9 | Predicted density | 1.10 g/cm3 | | SMILES | O(c1nc(nc(OC\C=C)n1)OC\C=C)C/C=C | | STD InChIKey | BJELTSYBAHKXRW-UHFFFAOYAX | | Melting Points | | mp °C | source | |
|---|
| 27.00 | Alfa Aesar | | 26.00 | Oxford University MSDS | | 27.00 | PHYSPROP |
|
|
| | | 2,4,6,8-tetramethyl-2,4,6,8-tetravinylcyclotetrasiloxane C12H24O4Si43, 64 |
 | | Compound Data | | Melting point | -43.25 °C | 229.90 K | | CSID | 68224 | H bond acceptors | 4 | Rule of 5 violations | NA | | Molecular weight | 344.6586 | H bond donors | 0 | ACD/LogP | 0.00 | | Phase 25 °C | liquid/gas | Rotatable bonds | 4 | Predicted density | 0.96 g/cm3 | | SMILES | O1[Si](O[Si](O[Si](O[Si]1(\C=C)C)(\C=C)C)(\C=C)C)(\C=C)C | | STD InChIKey | VMAWODUEPLAHOE-UHFFFAOYAO | | Melting Points | | mp °C | source | |
|---|
| -43.00 | Alfa Aesar | | -43.50 | PHYSPROP |
|
|
| | | 2,4'-dichloroacetophenone C8H6Cl2O3, 64 |
 | | Compound Data | | Melting point | 101.25 °C | 374.40 K | | CSID | 21170959 | H bond acceptors | 1 | Rule of 5 violations | 0 | | Molecular weight | 189.0386 | H bond donors | 0 | ACD/LogP | 2.53 | | Phase 25 °C | solid | Rotatable bonds | 2 | Predicted density | 1.31 g/cm3 | | SMILES | O=C(CCl)c1ccc(Cl)cc1 | | STD InChIKey | FWDFNLVLIXAOMX-UHFFFAOYAS | | Melting Points | | mp °C | source | |
|---|
| 101.00 | Alfa Aesar | | 101.50 | PHYSPROP |
|
|
| | | 2,4'-dichlorobenzophenone C13H8Cl2O3, 64 |
 | | Compound Data | | Melting point | 66.00 °C | 339.15 K | | CSID | 59928 | H bond acceptors | 1 | Rule of 5 violations | 0 | | Molecular weight | 251.108 | H bond donors | 0 | ACD/LogP | 4.08 | | Phase 25 °C | solid | Rotatable bonds | 2 | Predicted density | 1.31 g/cm3 | | SMILES | O=C(c1ccccc1Cl)c2ccc(Cl)cc2 | | STD InChIKey | YXMYPHLWXBXNFF-UHFFFAOYAB | | Melting Points | | mp °C | source | |
|---|
| 65.00 | Alfa Aesar | | 67.00 | PHYSPROP |
|
|
| | | 2,5-biphenyldiol C12H10O23, 64 |
 | | Compound Data | | Melting point | 101.75 °C | 374.90 K | | CSID | 13493 | H bond acceptors | 2 | Rule of 5 violations | 0 | | Molecular weight | 186.2066 | H bond donors | 2 | ACD/LogP | 2.09 | | Phase 25 °C | solid | Rotatable bonds | 3 | Predicted density | 1.23 g/cm3 | | SMILES | Oc2ccc(O)cc2c1ccccc1 | | STD InChIKey | XCZKKZXWDBOGPA-UHFFFAOYAQ | | Melting Points | | mp °C | source | |
|---|
| 101.00 | Alfa Aesar | | 102.50 | PHYSPROP |
|
|
| | | 2,5-bis(5-t-butyl-2-benzoxazolyl)thiophene C26H26N2O2S3, 61 |
 | | Compound Data | | Melting point | 200.00 °C | 473.15 K | | CSID | 258050 | H bond acceptors | 4 | Rule of 5 violations | 1 | | Molecular weight | 430.5618 | H bond donors | 0 | ACD/LogP | 9.13 | | Phase 25 °C | solid | Rotatable bonds | 4 | Predicted density | 1.19 g/cm3 | | SMILES | o1c5c(nc1c2sc(cc2)c3nc4cc(ccc4o3)C(C)(C)C)cc(cc5)C(C)(C)C | | STD InChIKey | AIXZBGVLNVRQSS-UHFFFAOYAN | | Melting Points | | mp °C | source | |
|---|
| 201.00 | Alfa Aesar | | 199.00 | Oxford University MSDS |
|
|
| | | 2,5-di-t-butylbenzene-1,4-diol C14H22O23, 61, 64 |
 | | Compound Data | | Melting point | 217.33 °C | 490.48 K | | CSID | 2283 | H bond acceptors | 2 | Rule of 5 violations | 0 | | Molecular weight | 222.3233 | H bond donors | 2 | ACD/LogP | 4.02 | | Phase 25 °C | solid | Rotatable bonds | 4 | Predicted density | 1.01 g/cm3 | | SMILES | Oc1cc(c(O)cc1C(C)(C)C)C(C)(C)C | | STD InChIKey | JZODKRWQWUWGCD-UHFFFAOYAA | | Melting Points | | mp °C | source | |
|---|
| 216.00 | Alfa Aesar | | 218.00 | Oxford University MSDS | | 218.00 | PHYSPROP |
|
|
| | | 2,5-dibromo-p-xylene C8H8Br23, 48 |
 | | Compound Data | | Melting point | 73.50 °C | 346.65 K | | CSID | 59562 | H bond acceptors | 0 | Rule of 5 violations | 0 | | Molecular weight | 263.9571 | H bond donors | 0 | ACD/LogP | 4.71 | | Phase 25 °C | solid | Rotatable bonds | 0 | Predicted density | 1.71 g/cm3 | | SMILES | Brc1c(cc(Br)c(c1)C)C | | STD InChIKey | QENIALCDPFDFHX-UHFFFAOYAM | | Melting Points | | mp °C | source | |
|---|
| 73.00 | Alfa Aesar | | 74.00 | Karthikeyan M.; Glen R.C.; Bender A. General melting point p... |
|
|
| | | 2,5-dibromoaniline C6H5Br2N2, 3 |
 | | Compound Data | | Melting point | 52.50 °C | 325.65 K | | CSID | 69628 | H bond acceptors | 1 | Rule of 5 violations | 0 | | Molecular weight | 250.9186 | H bond donors | 2 | ACD/LogP | 3.38 | | Phase 25 °C | solid | Rotatable bonds | 1 | Predicted density | 2.02 g/cm3 | | SMILES | Brc1ccc(Br)c(N)c1 | | STD InChIKey | WRTAZRGRFBCKBU-UHFFFAOYAR | | Melting Points | | mp °C | source | |
|---|
| 51.00 | Aldrich Chemical Company; Aldrich Catalog-Handbook of Fine C... | | 54.00 | Alfa Aesar |
|
|
| | | 2,5-dibromobenzoic acid C7H4Br2O23, 64 |
 | | Compound Data | | Melting point | 156.00 °C | 429.15 K | | CSID | 11398 | H bond acceptors | 2 | Rule of 5 violations | 0 | | Molecular weight | 279.9135 | H bond donors | 1 | ACD/LogP | 3.63 | | Phase 25 °C | solid | Rotatable bonds | 1 | Predicted density | 2.08 g/cm3 | | SMILES | c1cc(c(cc1Br)C(=O)O)Br | | STD InChIKey | SQQKOTVDGCJJKI-UHFFFAOYAU | | Melting Points | | mp °C | source | |
|---|
| 155.00 | Alfa Aesar | | 157.00 | PHYSPROP |
|
|
| | | 2,5-dibromonitrobenzene C6H3Br2NO22, 3, 64 |
 | |
|
| | | 2,5-dibromotoluene C7H6Br22, 3, 64 |
 | |
|
| | | 2,5-dichloro-1,4-dimethylbenzene C8H8Cl23, 31, 48, 64 |
 | |
|
| | | 2,5-dichloroaniline C6H5Cl2N2, 3, 61, 64 |
 | |
|
| | | 2,5-dichlorobenzaldehyde C7H4Cl2O3, 64 |
 | | Compound Data | | Melting point | 57.00 °C | 330.15 K | | CSID | 21111840 | H bond acceptors | 1 | Rule of 5 violations | 0 | | Molecular weight | 175.0121 | H bond donors | 0 | ACD/LogP | 2.87 | | Phase 25 °C | solid | Rotatable bonds | 1 | Predicted density | 1.40 g/cm3 | | SMILES | O=Cc1cc(Cl)ccc1Cl | | STD InChIKey | BUXHYMZMVMNDMG-UHFFFAOYAM | | Melting Points | | mp °C | source | |
|---|
| 56.00 | Alfa Aesar | | 58.00 | PHYSPROP |
|
|
| | | 2,5-dichlorobenzoic acid C7H4Cl2O22, 3, 61, 64 |
 | |
|
| | | 2,5-dichloronitrobenzene C6H3Cl2NO22, 3, 64 |
 | |
|
| | | 2,5-dichlorophenol C6H4Cl2O2, 3, 64 |
 | |
|
| | | 2,5-dichlorophenylhydrazine C6H6Cl2N23, 64 |
 | | Compound Data | | Melting point | 103.25 °C | 376.40 K | | CSID | 8998 | H bond acceptors | 2 | Rule of 5 violations | 0 | | Molecular weight | 177.0312 | H bond donors | 3 | ACD/LogP | 2.72 | | Phase 25 °C | solid | Rotatable bonds | 2 | Predicted density | 1.48 g/cm3 | | SMILES | Clc1ccc(Cl)cc1NN | | STD InChIKey | LZKWWERBNXLGLI-UHFFFAOYAL | | Melting Points | | mp °C | source | |
|---|
| 104.00 | Alfa Aesar | | 102.50 | PHYSPROP |
|
|
| | | 2,5-dichloropyridine C5H3Cl2N3, 64 |
 | | Compound Data | | Melting point | 60.75 °C | 333.90 K | | CSID | 25757 | H bond acceptors | 1 | Rule of 5 violations | 0 | | Molecular weight | 147.99 | H bond donors | 0 | ACD/LogP | 2.17 | | Phase 25 °C | solid | Rotatable bonds | 0 | Predicted density | 1.39 g/cm3 | | SMILES | c1cc(ncc1Cl)Cl | | STD InChIKey | GCTFDMFLLBCLPF-UHFFFAOYAP | | Melting Points | | mp °C | source | |
|---|
| 61.00 | Alfa Aesar | | 60.50 | PHYSPROP |
|
|
| | | 2,5-dichlorothiophene C4H2Cl2S3, 64 |
 | | Compound Data | | Melting point | -40.75 °C | 232.40 K | | CSID | 17474 | H bond acceptors | 0 | Rule of 5 violations | 0 | | Molecular weight | 153.0297 | H bond donors | 0 | ACD/LogP | 3.20 | | Phase 25 °C | liquid/gas | Rotatable bonds | 0 | Predicted density | 1.49 g/cm3 | | SMILES | Clc1sc(Cl)cc1 | | STD InChIKey | FGYBDASKYMSNCX-UHFFFAOYAS | | Melting Points | | mp °C | source | |
|---|
| -41.00 | Alfa Aesar | | -40.50 | PHYSPROP |
|
|
| | | 2,5-difluorobenzoic acid C7H4F2O23, 64 |
 | | Compound Data | | Melting point | 131.50 °C | 404.65 K | | CSID | 68816 | H bond acceptors | 2 | Rule of 5 violations | 0 | | Molecular weight | 158.1023 | H bond donors | 1 | ACD/LogP | 2.19 | | Phase 25 °C | solid | Rotatable bonds | 1 | Predicted density | 1.43 g/cm3 | | SMILES | O=C(O)c1cc(F)ccc1F | | STD InChIKey | LBQMIAVIGLLBGW-UHFFFAOYAH | | Melting Points | | mp °C | source | |
|---|
| 130.00 | Alfa Aesar | | 133.00 | PHYSPROP |
|
|
| | | 2,5-dihydrothiophene 1,1-dioxide C4H6O2S3, 61, 64 |
 | | Compound Data | | Melting point | 64.67 °C | 337.82 K | | CSID | 6253 | H bond acceptors | 2 | Rule of 5 violations | 0 | | Molecular weight | 118.1542 | H bond donors | 0 | ACD/LogP | -0.87 | | Phase 25 °C | solid | Rotatable bonds | 0 | Predicted density | 1.33 g/cm3 | | SMILES | O=S1(=O)C/C=C\C1 | | STD InChIKey | MBDNRNMVTZADMQ-UHFFFAOYAO | | Melting Points | | mp °C | source | |
|---|
| 65.00 | Alfa Aesar | | 64.50 | Oxford University MSDS | | 64.50 | PHYSPROP |
|
|
| | | 2,5-dihydroxybenzaldehyde C7H6O32, 3 |
 | | Compound Data | | Melting point | 98.50 °C | 371.65 K | | CSID | 64111 | H bond acceptors | 3 | Rule of 5 violations | 0 | | Molecular weight | 138.1207 | H bond donors | 2 | ACD/LogP | 1.12 | | Phase 25 °C | solid | Rotatable bonds | 3 | Predicted density | 1.41 g/cm3 | | SMILES | O=Cc1cc(O)ccc1O | | STD InChIKey | CLFRCXCBWIQVRN-UHFFFAOYAT | | Melting Points | | mp °C | source | |
|---|
| 98.00 | Aldrich Chemical Company; Aldrich Catalog-Handbook of Fine C... | | 99.00 | Alfa Aesar |
|
|
| | | 2,5-dihydroxypropiophenone C9H10O33, 64 |
 | | Compound Data | | Melting point | 97.25 °C | 370.40 K | | CSID | 63495 | H bond acceptors | 3 | Rule of 5 violations | 0 | | Molecular weight | 166.1739 | H bond donors | 2 | ACD/LogP | 2.12 | | Phase 25 °C | solid | Rotatable bonds | 4 | Predicted density | 1.24 g/cm3 | | SMILES | O=C(c1cc(O)ccc1O)CC | | STD InChIKey | CFQYIIXIHXUPQT-UHFFFAOYAB | | Melting Points | | mp °C | source | |
|---|
| 98.00 | Alfa Aesar | | 96.50 | PHYSPROP |
|
|
| | | 2,5-diiodothiophene C4H2I2S3, 64 |
 | | Compound Data | | Melting point | 41.25 °C | 314.40 K | | CSID | 62577 | H bond acceptors | 0 | Rule of 5 violations | 0 | | Molecular weight | 335.9326 | H bond donors | 0 | ACD/LogP | 3.50 | | Phase 25 °C | solid | Rotatable bonds | 0 | Predicted density | 2.73 g/cm3 | | SMILES | Ic1sc(I)cc1 | | STD InChIKey | PNYWRAHWEIOAGK-UHFFFAOYAR | | Melting Points | | mp °C | source | |
|---|
| 41.00 | Alfa Aesar | | 41.50 | PHYSPROP |
|
|
| | | 2,5-dimethoxyacetophenone C10H12O32, 3 |
 | | Compound Data | | Melting point | 19.50 °C | 292.65 K | | CSID | 64152 | H bond acceptors | 3 | Rule of 5 violations | 0 | | Molecular weight | 180.2005 | H bond donors | 0 | ACD/LogP | 2.11 | | Phase 25 °C | liquid/gas | Rotatable bonds | 3 | Predicted density | 1.07 g/cm3 | | SMILES | O=C(c1cc(OC)ccc1OC)C | | STD InChIKey | FAXUIYJKGGUCBO-UHFFFAOYAT | | Melting Points | | mp °C | source | |
|---|
| 20.00 | Aldrich Chemical Company; Aldrich Catalog-Handbook of Fine C... | | 19.00 | Alfa Aesar |
|
|
| | | 2,5-dimethoxyaniline C8H11NO23, 64 |
 | | Compound Data | | Melting point | 81.25 °C | 354.40 K | | CSID | 13869661 | H bond acceptors | 3 | Rule of 5 violations | 0 | | Molecular weight | 153.1784 | H bond donors | 2 | ACD/LogP | 1.29 | | Phase 25 °C | solid | Rotatable bonds | 3 | Predicted density | 1.10 g/cm3 | | SMILES | COc1ccc(c(c1)N)OC | | STD InChIKey | NAZDVUBIEPVUKE-UHFFFAOYAY | | Melting Points | | mp °C | source | |
|---|
| 80.00 | Alfa Aesar | | 82.50 | PHYSPROP |
|
|
| | | 2,5-dimethoxybenzaldehyde C9H10O32, 3, 64 |
 | |
|
| | | 2,5-dimethoxytoluene C9H12O23, 7 |
 | | Compound Data | | Melting point | 17.50 °C | 290.65 K | | CSID | 81759 | H bond acceptors | 2 | Rule of 5 violations | 0 | | Molecular weight | 152.1904 | H bond donors | 0 | ACD/LogP | 2.56 | | Phase 25 °C | liquid/gas | Rotatable bonds | 2 | Predicted density | 0.99 g/cm3 | | SMILES | O(c1ccc(OC)cc1C)C | | STD InChIKey | IQISOVKPFBLQIQ-UHFFFAOYAE | | Melting Points | | mp °C | source | |
|---|
| 20.00 | Alfa Aesar | | 15.00 | Beilstein F. K.; Beilsteins Handbuch der Organischen Chemie.... |
|
|
| | | 2,5-dimethyl-1,3,4-thiadiazole C4H6N2S3, 64 |
 | | Compound Data | | Melting point | 64.00 °C | 337.15 K | | CSID | 87514 | H bond acceptors | 2 | Rule of 5 violations | 0 | | Molecular weight | 114.1688 | H bond donors | 0 | ACD/LogP | 0.03 | | Phase 25 °C | solid | Rotatable bonds | 0 | Predicted density | 1.17 g/cm3 | | SMILES | n1nc(sc1C)C | | STD InChIKey | JXQGICFGPUAVLJ-UHFFFAOYAM | | Melting Points | | mp °C | source | |
|---|
| 63.00 | Alfa Aesar | | 65.00 | PHYSPROP |
|
|
| | | 2,5-dimethyl-1,5-hexadiene C8H143, 64 |
 | | Compound Data | | Melting point | -75.30 °C | 197.85 K | | CSID | 11818 | H bond acceptors | 0 | Rule of 5 violations | 0 | | Molecular weight | 110.1968 | H bond donors | 0 | ACD/LogP | 3.90 | | Phase 25 °C | liquid/gas | Rotatable bonds | 3 | Predicted density | 0.73 g/cm3 | | SMILES | C=C(/C)CCC(=C)\C | | STD InChIKey | DSAYAFZWRDYBQY-UHFFFAOYAP | | Melting Points | | mp °C | source | |
|---|
| -75.00 | Alfa Aesar | | -75.60 | PHYSPROP |
|
|
| | | 2,5-dimethyl-2,4-hexadiene C8H142, 3 |
 | | Compound Data | | Melting point | 12.50 °C | 285.65 K | | CSID | 12451 | H bond acceptors | 0 | Rule of 5 violations | 0 | | Molecular weight | 110.1968 | H bond donors | 0 | ACD/LogP | 4.01 | | Phase 25 °C | liquid/gas | Rotatable bonds | 1 | Predicted density | 0.75 g/cm3 | | SMILES | C(=C\C=C(/C)C)(\C)C | | STD InChIKey | DZPCYXCBXGQBRN-UHFFFAOYAU | | Melting Points | | mp °C | source | |
|---|
| 13.00 | Aldrich Chemical Company; Aldrich Catalog-Handbook of Fine C... | | 12.00 | Alfa Aesar |
|
|
| | | 2,5-dimethyl-2,5-hexanediol C8H18O23, 64 |
 | | Compound Data | | Melting point | 90.50 °C | 363.65 K | | CSID | 7740 | H bond acceptors | 2 | Rule of 5 violations | 0 | | Molecular weight | 146.2273 | H bond donors | 2 | ACD/LogP | 0.37 | | Phase 25 °C | solid | Rotatable bonds | 5 | Predicted density | 0.94 g/cm3 | | SMILES | OC(C)(CCC(O)(C)C)C | | STD InChIKey | ZWNMRZQYWRLGMM-UHFFFAOYAJ | | Melting Points | | mp °C | source | |
|---|
| 89.00 | Alfa Aesar | | 92.00 | PHYSPROP |
|
|
| | | 2,5-dimethylaniline C8H11N2, 3, 32, 64 |
 | |
|
| | | 2,5-dimethylbenzoic acid C9H10O23, 48, 64 |
 | |
|
| | | 2,5-dimethylbenzothiazole C9H9NS3, 64 |
 | | Compound Data | | Melting point | 39.00 °C | 312.15 K | | CSID | 6957 | H bond acceptors | 1 | Rule of 5 violations | 0 | | Molecular weight | 163.2395 | H bond donors | 0 | ACD/LogP | 2.87 | | Phase 25 °C | solid | Rotatable bonds | 0 | Predicted density | 1.18 g/cm3 | | SMILES | n1c2cc(ccc2sc1C)C | | STD InChIKey | XHANCLXYCNTZMM-UHFFFAOYAT | | Melting Points | | mp °C | source | |
|---|
| 40.00 | Alfa Aesar | | 38.00 | PHYSPROP |
|
|
| | | 2,5-dimethylfuran C6H8O3, 64 |
 | | Compound Data | | Melting point | -62.40 °C | 210.75 K | | CSID | 11763 | H bond acceptors | 1 | Rule of 5 violations | 0 | | Molecular weight | 96.1271 | H bond donors | 0 | ACD/LogP | 1.83 | | Phase 25 °C | liquid/gas | Rotatable bonds | 0 | Predicted density | 0.92 g/cm3 | | SMILES | Cc1ccc(o1)C | | STD InChIKey | GSNUFIFRDBKVIE-UHFFFAOYAS | | Melting Points | | mp °C | source | |
|---|
| -62.00 | Alfa Aesar | | -62.80 | PHYSPROP |
|
|
| | | 2,5-dimethylphenol C8H10O3, 28, 31, 64, 72 |
 | |
|
| | | 2,5-dimethylthiophene C6H8S3, 64 |
 | | Compound Data | | Melting point | -62.80 °C | 210.35 K | | CSID | 11998 | H bond acceptors | 0 | Rule of 5 violations | 0 | | Molecular weight | 112.1927 | H bond donors | 0 | ACD/LogP | 2.82 | | Phase 25 °C | liquid/gas | Rotatable bonds | 0 | Predicted density | 1.01 g/cm3 | | SMILES | s1c(ccc1C)C | | STD InChIKey | GWQOOADXMVQEFT-UHFFFAOYAY | | Melting Points | | mp °C | source | |
|---|
| -63.00 | Alfa Aesar | | -62.60 | PHYSPROP |
|
|
| | | 2,5-diphenyl-1,3,4-oxadiazole C14H10N2O3, 64 |
 | | Compound Data | | Melting point | 139.50 °C | 412.65 K | | CSID | 12355 | H bond acceptors | 3 | Rule of 5 violations | 0 | | Molecular weight | 222.242 | H bond donors | 0 | ACD/LogP | 4.15 | | Phase 25 °C | solid | Rotatable bonds | 2 | Predicted density | 1.17 g/cm3 | | SMILES | n1nc(oc1c2ccccc2)c3ccccc3 | | STD InChIKey | DCJKUXYSYJBBRD-UHFFFAOYAH | | Melting Points | | mp °C | source | |
|---|
| 140.00 | Alfa Aesar | | 139.00 | PHYSPROP |
|
|
| | | 2,5-diphenylfuran C16H12O3, 64 |
 | | Compound Data | | Melting point | 89.50 °C | 362.65 K | | CSID | 63567 | H bond acceptors | 1 | Rule of 5 violations | 1 | | Molecular weight | 220.2659 | H bond donors | 0 | ACD/LogP | 5.24 | | Phase 25 °C | solid | Rotatable bonds | 2 | Predicted density | 1.09 g/cm3 | | SMILES | o1c(ccc1c2ccccc2)c3ccccc3 | | STD InChIKey | VUPDHIIPAKIKAB-UHFFFAOYAN | | Melting Points | | mp °C | source | |
|---|
| 88.00 | Alfa Aesar | | 91.00 | PHYSPROP |
|
|
| | | 2,5-diphenyloxazole C15H11NO3, 64 |
 | | Compound Data | | Melting point | 73.00 °C | 346.15 K | | CSID | 6838 | H bond acceptors | 2 | Rule of 5 violations | 0 | | Molecular weight | 221.2539 | H bond donors | 0 | ACD/LogP | 4.12 | | Phase 25 °C | solid | Rotatable bonds | 2 | Predicted density | 1.13 g/cm3 | | SMILES | n1cc(oc1c2ccccc2)c3ccccc3 | | STD InChIKey | CNRNYORZJGVOSY-UHFFFAOYAG | | Melting Points | | mp °C | source | |
|---|
| 72.00 | Alfa Aesar | | 74.00 | PHYSPROP |
|
|
| | | 2,5-norbornadiene C7H83, 64 |
 | | Compound Data | | Melting point | -19.55 °C | 253.60 K | | CSID | 8160 | H bond acceptors | 0 | Rule of 5 violations | 0 | | Molecular weight | 92.1384 | H bond donors | 0 | ACD/LogP | 2.15 | | Phase 25 °C | liquid/gas | Rotatable bonds | 0 | Predicted density | 1.00 g/cm3 | | SMILES | C\1=C\C2/C=C\C/1C2 | | STD InChIKey | SJYNFBVQFBRSIB-UHFFFAOYAK | | Melting Points | | mp °C | source | |
|---|
| -20.00 | Alfa Aesar | | -19.10 | PHYSPROP |
|
|
| | | 2,5-thiophenedicarboxylic acid C6H4O4S3, 64 |
 | | Compound Data | | Melting point | 358.50 °C | 631.65 K | | CSID | 19099 | H bond acceptors | 4 | Rule of 5 violations | 0 | | Molecular weight | 172.1586 | H bond donors | 2 | ACD/LogP | 1.34 | | Phase 25 °C | solid | Rotatable bonds | 2 | Predicted density | 1.66 g/cm3 | | SMILES | O=C(O)c1sc(C(=O)O)cc1 | | STD InChIKey | YCGAZNXXGKTASZ-UHFFFAOYAF | | Melting Points | | mp °C | source | |
|---|
| 358.00 | Alfa Aesar | | 359.00 | PHYSPROP |
|
|
| | | 2,6-di-t-butyl-4-(dimethylaminomethyl)phenol C17H29NO3, 64 |
 | | Compound Data | | Melting point | 92.25 °C | 365.40 K | | CSID | 59976 | H bond acceptors | 2 | Rule of 5 violations | 0 | | Molecular weight | 263.4183 | H bond donors | 1 | ACD/LogP | 4.62 | | Phase 25 °C | solid | Rotatable bonds | 5 | Predicted density | 0.95 g/cm3 | | SMILES | Oc1c(cc(cc1C(C)(C)C)CN(C)C)C(C)(C)C | | STD InChIKey | VMZVBRIIHDRYGK-UHFFFAOYAR | | Melting Points | | mp °C | source | |
|---|
| 91.00 | Alfa Aesar | | 93.50 | PHYSPROP |
|
|
| | | 2,6-di-t-butylbenzoquinone C14H20O23, 64 |
 | | Compound Data | | Melting point | 66.50 °C | 339.65 K | | CSID | 12336 | H bond acceptors | 2 | Rule of 5 violations | 0 | | Molecular weight | 220.3074 | H bond donors | 0 | ACD/LogP | 3.90 | | Phase 25 °C | solid | Rotatable bonds | 2 | Predicted density | 1.03 g/cm3 | | SMILES | O=C/1/C(=C\C(=O)\C=C\1C(C)(C)C)C(C)(C)C | | STD InChIKey | RDQSIADLBQFVMY-UHFFFAOYAS | | Melting Points | | mp °C | source | |
|---|
| 67.00 | Alfa Aesar | | 66.00 | PHYSPROP |
|
|
| | | 2,6-di-t-butylphenol C14H22O3, 61, 64 |
 | | Compound Data | | Melting point | 37.50 °C | 310.65 K | | CSID | 29135 | H bond acceptors | 1 | Rule of 5 violations | 0 | | Molecular weight | 206.3239 | H bond donors | 1 | ACD/LogP | 4.86 | | Phase 25 °C | solid | Rotatable bonds | 3 | Predicted density | 0.93 g/cm3 | | SMILES | Oc1c(cccc1C(C)(C)C)C(C)(C)C | | STD InChIKey | DKCPKDPYUFEZCP-UHFFFAOYAK | | Melting Points | | mp °C | source | |
|---|
| 37.00 | Alfa Aesar | | 36.50 | Oxford University MSDS | | 39.00 | PHYSPROP |
|
|
| | | 2,6-di-t-butylpyridine C13H21N61, 64 |
 | | Compound Data | | Melting point | 2.10 °C | 275.25 K | | CSID | 61785 | H bond acceptors | 1 | Rule of 5 violations | 0 | | Molecular weight | 191.3125 | H bond donors | 0 | ACD/LogP | 4.10 | | Phase 25 °C | liquid/gas | Rotatable bonds | 2 | Predicted density | 0.89 g/cm3 | | SMILES | n1c(cccc1C(C)(C)C)C(C)(C)C | | STD InChIKey | UWKQJZCTQGMHKD-UHFFFAOYAA | | Melting Points | | mp °C | source | |
|---|
| 2.00 | Oxford University MSDS | | 2.20 | PHYSPROP |
|
|
| | | 2,6-di-tert-butyl-4-ethylphenol C16H26O3, 64 |
 | | Compound Data | | Melting point | 43.50 °C | 316.65 K | | CSID | 18924 | H bond acceptors | 1 | Rule of 5 violations | 1 | | Molecular weight | 234.377 | H bond donors | 1 | ACD/LogP | 5.85 | | Phase 25 °C | solid | Rotatable bonds | 4 | Predicted density | 0.92 g/cm3 | | SMILES | Oc1c(cc(cc1C(C)(C)C)CC)C(C)(C)C | | STD InChIKey | BVUXDWXKPROUDO-UHFFFAOYAH | | Melting Points | | mp °C | source | |
|---|
| 43.00 | Alfa Aesar | | 44.00 | PHYSPROP |
|
|
| | | 2,6-diaminopyridine C5H7N33, 35, 64 |
 | | Compound Data | | Melting point | 121.00 °C | 394.15 K | | CSID | 8528 | H bond acceptors | 3 | Rule of 5 violations | 0 | | Molecular weight | 109.1292 | H bond donors | 4 | ACD/LogP | 0.55 | | Phase 25 °C | solid | Rotatable bonds | 0 | Predicted density | 1.25 g/cm3 | | SMILES | c1cc(nc(c1)N)N | | STD InChIKey | VHNQIURBCCNWDN-UHFFFAOYAB | | Melting Points | | mp °C | source | |
|---|
| 120.00 | Alfa Aesar | | 121.50 | EPISuite-ChemSpider | | 121.50 | PHYSPROP |
|
|
| | | 2,6-dibromo-N-chloroquinonimine C6H2Br2ClNO3, 64 |
 | | Compound Data | | Melting point | 81.50 °C | 354.65 K | | CSID | 10378 | H bond acceptors | 2 | Rule of 5 violations | 0 | | Molecular weight | 299.3472 | H bond donors | 0 | ACD/LogP | 1.97 | | Phase 25 °C | solid | Rotatable bonds | 0 | Predicted density | 2.18 g/cm3 | | SMILES | Br\C1=CC(=N\Cl)/C=C(/Br)C1=O | | STD InChIKey | JYWKEVKEKOTYEX-UHFFFAOYAP | | Melting Points | | mp °C | source | |
|---|
| 80.00 | Alfa Aesar | | 83.00 | PHYSPROP |
|
|
| | | 2,6-dibromophenol C6H4Br2O3, 64 |
 | | Compound Data | | Melting point | 55.75 °C | 328.90 K | | CSID | 11354 | H bond acceptors | 1 | Rule of 5 violations | 0 | | Molecular weight | 251.9034 | H bond donors | 1 | ACD/LogP | 3.27 | | Phase 25 °C | solid | Rotatable bonds | 1 | Predicted density | 2.10 g/cm3 | | SMILES | c1cc(c(c(c1)Br)O)Br | | STD InChIKey | SSIZLKDLDKIHEV-UHFFFAOYAG | | Melting Points | | mp °C | source | |
|---|
| 55.00 | Alfa Aesar | | 56.50 | PHYSPROP |
|
|
| | | 2,6-dichloro-3-cyano-4-methylpyridine C7H4Cl2N23, 48 |
 | | Compound Data | | Melting point | 111.50 °C | 384.65 K | | CSID | 63319 | H bond acceptors | 2 | Rule of 5 violations | 0 | | Molecular weight | 187.0261 | H bond donors | 0 | ACD/LogP | 2.23 | | Phase 25 °C | solid | Rotatable bonds | 0 | Predicted density | 1.42 g/cm3 | | SMILES | N#Cc1c(cc(Cl)nc1Cl)C | | STD InChIKey | LSPMHHJCDSFAAY-UHFFFAOYAA | | Melting Points | | mp °C | source | |
|---|
| 110.00 | Alfa Aesar | | 113.00 | Karthikeyan M.; Glen R.C.; Bender A. General melting point p... |
|
|
| | | 2,6-dichloro-4-nitroaniline C6H4Cl2N2O23, 64 |
 | | Compound Data | | Melting point | 190.00 °C | 463.15 K | | CSID | 7152 | H bond acceptors | 4 | Rule of 5 violations | 0 | | Molecular weight | 207.0142 | H bond donors | 2 | ACD/LogP | 3.54 | | Phase 25 °C | solid | Rotatable bonds | 2 | Predicted density | 1.62 g/cm3 | | SMILES | Clc1cc(cc(Cl)c1N)[N+]([O-])=O | | STD InChIKey | BIXZHMJUSMUDOQ-UHFFFAOYAH | | Melting Points | | mp °C | source | |
|---|
| 189.00 | Alfa Aesar | | 191.00 | PHYSPROP |
|
|
| | | 2,6-dichloroaniline C6H5Cl2N2, 3, 64 |
 | |
|
| | | 2,6-dichlorobenzaldehyde C7H4Cl2O2, 3, 35, 61, 64 |
 | |
|
| | | 2,6-dichlorobenzamide C7H5Cl2NO2, 3, 64 |
 | |
|
| | | 2,6-dichlorobenzoic acid C7H4Cl2O22, 3, 61, 64 |
 | |
|
| | | 2,6-dichlorobenzonitrile C7H3Cl2N2, 3, 61, 64 |
 | |
|
| | | 2,6-dichlorobenzyl alcohol C7H6Cl2O3, 64 |
 | | Compound Data | | Melting point | 97.50 °C | 370.65 K | | CSID | 25276 | H bond acceptors | 1 | Rule of 5 violations | 0 | | Molecular weight | 177.0279 | H bond donors | 1 | ACD/LogP | 2.24 | | Phase 25 °C | solid | Rotatable bonds | 2 | Predicted density | 1.39 g/cm3 | | SMILES | Clc1cccc(Cl)c1CO | | STD InChIKey | WKKHCCZLKYKUDN-UHFFFAOYAY | | Melting Points | | mp °C | source | |
|---|
| 97.00 | Alfa Aesar | | 98.00 | PHYSPROP |
|
|
| | | 2,6-dichlorophenol C6H4Cl2O2, 3, 28, 56, 61, 64, 72 |
 | |
|
| | | 2,6-dichlorophenylacetic acid C8H6Cl2O23, 3 |
 | | Compound Data | | Melting point | 159.50 °C | 432.65 K | | CSID | 73131 | H bond acceptors | 2 | Rule of 5 violations | 0 | | Molecular weight | 205.038 | H bond donors | 1 | ACD/LogP | 2.71 | | Phase 25 °C | solid | Rotatable bonds | 2 | Predicted density | 1.46 g/cm3 | | SMILES | Clc1cccc(Cl)c1CC(=O)O | | STD InChIKey | SFAILOOQFZNOAU-UHFFFAOYAK | | Melting Points | | mp °C | source | |
|---|
| 159.00 | Alfa Aesar | | 160.00 | Alfa Aesar |
|
|
| | | 2,6-dichloropyrazine C4H2Cl2N23, 64 |
 | | Compound Data | | Melting point | 55.25 °C | 328.40 K | | CSID | 70868 | H bond acceptors | 2 | Rule of 5 violations | 0 | | Molecular weight | 148.9781 | H bond donors | 0 | ACD/LogP | 1.48 | | Phase 25 °C | solid | Rotatable bonds | 0 | Predicted density | 1.49 g/cm3 | | SMILES | c1c(nc(cn1)Cl)Cl | | STD InChIKey | LSEAAPGIZCDEEH-UHFFFAOYAG | | Melting Points | | mp °C | source | |
|---|
| 54.00 | Alfa Aesar | | 56.50 | PHYSPROP |
|
|
| | | 2,6-dichloropyridine C5H3Cl2N3, 64 |
 | | Compound Data | | Melting point | 87.00 °C | 360.15 K | | CSID | 16095 | H bond acceptors | 1 | Rule of 5 violations | 0 | | Molecular weight | 147.99 | H bond donors | 0 | ACD/LogP | 2.08 | | Phase 25 °C | solid | Rotatable bonds | 0 | Predicted density | 1.39 g/cm3 | | SMILES | Clc1nc(Cl)ccc1 | | STD InChIKey | FILKGCRCWDMBKA-UHFFFAOYAA | | Melting Points | | mp °C | source | |
|---|
| 86.00 | Alfa Aesar | | 88.00 | PHYSPROP |
|
|
| | | 2,6-dichlorothiobenzamide C7H5Cl2NS3, 64 |
 | | Compound Data | | Melting point | 151.25 °C | 424.40 K | | CSID | 2016563 | H bond acceptors | 1 | Rule of 5 violations | 0 | | Molecular weight | 206.0923 | H bond donors | 2 | ACD/LogP | 1.85 | | Phase 25 °C | solid | Rotatable bonds | 1 | Predicted density | 1.47 g/cm3 | | SMILES | S=C(c1c(Cl)cccc1Cl)N | | STD InChIKey | KGKGSIUWJCAFPX-UHFFFAOYAZ | | Melting Points | | mp °C | source | |
|---|
| 151.00 | Alfa Aesar | | 151.50 | PHYSPROP |
|
|
| | | 2,6-difluorobenzamide C7H5F2NO3, 64 |
 | | Compound Data | | Melting point | 146.75 °C | 419.90 K | | CSID | 78873 | H bond acceptors | 2 | Rule of 5 violations | 0 | | Molecular weight | 157.1175 | H bond donors | 2 | ACD/LogP | 0.58 | | Phase 25 °C | solid | Rotatable bonds | 1 | Predicted density | 1.35 g/cm3 | | SMILES | O=C(c1c(F)cccc1F)N | | STD InChIKey | AVRQBXVUUXHRMY-UHFFFAOYAV | | Melting Points | | mp °C | source | |
|---|
| 147.00 | Alfa Aesar | | 146.50 | PHYSPROP |
|
|
| | | 2,6-difluorobenzoic acid C7H4F2O23, 64 |
 | | Compound Data | | Melting point | 158.50 °C | 431.65 K | | CSID | 9413 | H bond acceptors | 2 | Rule of 5 violations | 0 | | Molecular weight | 158.1023 | H bond donors | 1 | ACD/LogP | 1.85 | | Phase 25 °C | solid | Rotatable bonds | 1 | Predicted density | 1.43 g/cm3 | | SMILES | O=C(O)c1c(F)cccc1F | | STD InChIKey | ONOTYLMNTZNAQZ-UHFFFAOYAX | | Melting Points | | mp °C | source | |
|---|
| 158.00 | Alfa Aesar | | 159.00 | PHYSPROP |
|
|
| | | 2,6-difluorobenzonitrile C7H3F2N3, 64 |
 | | Compound Data | | Melting point | 30.50 °C | 303.65 K | | CSID | 67268 | H bond acceptors | 1 | Rule of 5 violations | 0 | | Molecular weight | 139.1022 | H bond donors | 0 | ACD/LogP | 1.40 | | Phase 25 °C | solid | Rotatable bonds | 0 | Predicted density | 1.26 g/cm3 | | SMILES | N#Cc1c(F)cccc1F | | STD InChIKey | BNBRIFIJRKJGEI-UHFFFAOYAP | | Melting Points | | mp °C | source | |
|---|
| 30.00 | Alfa Aesar | | 31.00 | PHYSPROP |
|
|
| | | 2,6-difluorophenol C6H4F2O3, 64 |
 | | Compound Data | | Melting point | 38.75 °C | 311.90 K | | CSID | 85185 | H bond acceptors | 1 | Rule of 5 violations | 0 | | Molecular weight | 130.0922 | H bond donors | 1 | ACD/LogP | 1.98 | | Phase 25 °C | solid | Rotatable bonds | 1 | Predicted density | 1.35 g/cm3 | | SMILES | Fc1cccc(F)c1O | | STD InChIKey | CKKOVFGIBXCEIJ-UHFFFAOYAW | | Melting Points | | mp °C | source | |
|---|
| 38.00 | Alfa Aesar | | 39.50 | PHYSPROP |
|
|
| | | 2,6-dihydroxynaphthalene C10H8O23, 64 |
 | | Compound Data | | Melting point | 222.00 °C | 495.15 K | | CSID | 84452 | H bond acceptors | 2 | Rule of 5 violations | 0 | | Molecular weight | 160.1693 | H bond donors | 2 | ACD/LogP | 1.90 | | Phase 25 °C | solid | Rotatable bonds | 2 | Predicted density | 1.33 g/cm3 | | SMILES | Oc1ccc2c(c1)ccc(O)c2 | | STD InChIKey | MNZMMCVIXORAQL-UHFFFAOYAZ | | Melting Points | | mp °C | source | |
|---|
| 224.00 | Alfa Aesar | | 220.00 | PHYSPROP |
|
|
| | | 2,6-diiodo-4-nitrophenol C6H3I2NO33, 61, 64 |
 | | Compound Data | | Melting point | 155.67 °C | 428.82 K | | CSID | 9002 | H bond acceptors | 4 | Rule of 5 violations | 0 | | Molecular weight | 390.9019 | H bond donors | 1 | ACD/LogP | 3.37 | | Phase 25 °C | solid | Rotatable bonds | 2 | Predicted density | 2.72 g/cm3 | | SMILES | Ic1cc([N+]([O-])=O)cc(I)c1O | | STD InChIKey | UVGTXNPVQOQFQW-UHFFFAOYAA | | Melting Points | | mp °C | source | |
|---|
| 153.00 | Alfa Aesar | | 157.00 | Oxford University MSDS | | 157.00 | PHYSPROP |
|
|
| | | 2,6-dimethoxyacetophenone C10H12O33, 64 |
 | | Compound Data | | Melting point | 69.50 °C | 342.65 K | | CSID | 15435 | H bond acceptors | 3 | Rule of 5 violations | 0 | | Molecular weight | 180.2005 | H bond donors | 0 | ACD/LogP | 1.98 | | Phase 25 °C | solid | Rotatable bonds | 3 | Predicted density | 1.07 g/cm3 | | SMILES | O=C(c1c(OC)cccc1OC)C | | STD InChIKey | XEUGKOFTNAYMMX-UHFFFAOYAM | | Melting Points | | mp °C | source | |
|---|
| 70.00 | Alfa Aesar | | 69.00 | PHYSPROP |
|
|
| | | 2,6-dimethoxybenzoquinone C8H8O43, 61, 64 |
 | | Compound Data | | Melting point | 254.67 °C | 527.82 K | | CSID | 61560 | H bond acceptors | 4 | Rule of 5 violations | 0 | | Molecular weight | 168.1467 | H bond donors | 0 | ACD/LogP | 0.28 | | Phase 25 °C | solid | Rotatable bonds | 2 | Predicted density | 1.24 g/cm3 | | SMILES | O=C1C(/OC)=C\C(=O)\C=C1\OC | | STD InChIKey | OLBNOBQOQZRLMP-UHFFFAOYAL | | Melting Points | | mp °C | source | |
|---|
| 255.00 | Alfa Aesar | | 253.00 | Oxford University MSDS | | 256.00 | PHYSPROP |
|
|
| | | 2,6-dimethoxynaphthalene C12H12O23, 48 |
 | | Compound Data | | Melting point | 151.50 °C | 424.65 K | | CSID | 71934 | H bond acceptors | 2 | Rule of 5 violations | 0 | | Molecular weight | 188.2225 | H bond donors | 0 | ACD/LogP | 3.28 | | Phase 25 °C | solid | Rotatable bonds | 2 | Predicted density | 1.10 g/cm3 | | SMILES | O(c1ccc2c(c1)ccc(OC)c2)C | | STD InChIKey | AHKDVDYNDXGFPP-UHFFFAOYAF | | Melting Points | | mp °C | source | |
|---|
| 153.00 | Alfa Aesar | | 150.00 | Karthikeyan M.; Glen R.C.; Bender A. General melting point p... |
|
|
| | | 2,6-dimethoxytoluene C9H12O22, 3, 64 |
 | |
|
| | | 2,6-dimethyl-4-heptanone C9H18O3, 64 |
 | | Compound Data | | Melting point | -41.75 °C | 231.40 K | | CSID | 7670 | H bond acceptors | 1 | Rule of 5 violations | 0 | | Molecular weight | 142.2386 | H bond donors | 0 | ACD/LogP | 2.66 | | Phase 25 °C | liquid/gas | Rotatable bonds | 4 | Predicted density | 0.81 g/cm3 | | SMILES | O=C(CC(C)C)CC(C)C | | STD InChIKey | PTTPXKJBFFKCEK-UHFFFAOYAW | | Melting Points | | mp °C | source | |
|---|
| -42.00 | Alfa Aesar | | -41.50 | PHYSPROP |
|
|
| | | 2,6-dimethyl-4-pyrone C7H8O23, 64 |
 | | Compound Data | | Melting point | 133.00 °C | 406.15 K | | CSID | 13262 | H bond acceptors | 2 | Rule of 5 violations | 0 | | Molecular weight | 124.1372 | H bond donors | 0 | ACD/LogP | 0.10 | | Phase 25 °C | solid | Rotatable bonds | 0 | Predicted density | 1.06 g/cm3 | | SMILES | O=C\1/C=C(\O/C(=C/1)C)C | | STD InChIKey | VSYFZULSKMFUJJ-UHFFFAOYAS | | Melting Points | | mp °C | source | |
|---|
| 134.00 | Alfa Aesar | | 132.00 | PHYSPROP |
|
|
| | | 2,6-dimethylaniline C8H11N2, 3, 61, 64 |
 | |
|
| | | 2,6-dimethylbenzoquinone C8H8O23, 61, 64 |
 | | Compound Data | | Melting point | 70.83 °C | 343.98 K | | CSID | 61542 | H bond acceptors | 2 | Rule of 5 violations | 0 | | Molecular weight | 136.1479 | H bond donors | 0 | ACD/LogP | 1.45 | | Phase 25 °C | solid | Rotatable bonds | 0 | Predicted density | 1.11 g/cm3 | | SMILES | O=C\1\C=C(/C(=O)/C(=C/1)C)C | | STD InChIKey | SENUUPBBLQWHMF-UHFFFAOYAI | | Melting Points | | mp °C | source | |
|---|
| 70.00 | Alfa Aesar | | 70.00 | Oxford University MSDS | | 72.50 | PHYSPROP |
|
|
| | | 2,6-dimethylheptane C9H204, 64 |
 | | Compound Data | | Melting point | -102.95 °C | 170.20 K | | CSID | 13450 | H bond acceptors | 0 | Rule of 5 violations | 1 | | Molecular weight | 128.2551 | H bond donors | 0 | ACD/LogP | 5.17 | | Phase 25 °C | liquid/gas | Rotatable bonds | 4 | Predicted density | 0.72 g/cm3 | | SMILES | CC(C)CCCC(C)C | | STD InChIKey | KBPCCVWUMVGXGF-UHFFFAOYAV | | Melting Points | | mp °C | source | |
|---|
| -103.00 | American Petroleum Institute. Research Project 44; Selected ... | | -102.90 | PHYSPROP |
|
|
| | | 2,6-dimethylphenol C8H10O3, 31, 61, 64 |
 | |
|
| | | 2,6-dimethylquinoline C11H11N3, 64 |
 | | Compound Data | | Melting point | 58.50 °C | 331.65 K | | CSID | 12840 | H bond acceptors | 1 | Rule of 5 violations | 0 | | Molecular weight | 157.2117 | H bond donors | 0 | ACD/LogP | 3.00 | | Phase 25 °C | solid | Rotatable bonds | 0 | Predicted density | 1.05 g/cm3 | | SMILES | n1c(ccc2cc(ccc12)C)C | | STD InChIKey | JJPSZKIOGBRMHK-UHFFFAOYAO | | Melting Points | | mp °C | source | |
|---|
| 57.00 | Alfa Aesar | | 60.00 | PHYSPROP |
|
|
| | | 2,6-lutidine C7H9N3, 61, 64 |
 | | Compound Data | | Melting point | -6.37 °C | 266.78 K | | CSID | 13842613 | H bond acceptors | 1 | Rule of 5 violations | 0 | | Molecular weight | 107.1531 | H bond donors | 0 | ACD/LogP | 1.65 | | Phase 25 °C | liquid/gas | Rotatable bonds | 0 | Predicted density | 0.93 g/cm3 | | SMILES | Cc1cccc(C)n1 | | STD InChIKey | OISVCGZHLKNMSJ-UHFFFAOYAH | | Melting Points | | mp °C | source | |
|---|
| -7.00 | Alfa Aesar | | -6.00 | Oxford University MSDS | | -6.10 | PHYSPROP |
|
|
| | | 2,7-dimethyloctane C10H223, 4, 64 |
 | |
|
| | | 2',6'-dimethylacetanilide C10H13NO3, 64 |
 | | Compound Data | | Melting point | 182.00 °C | 455.15 K | | CSID | 15753 | H bond acceptors | 2 | Rule of 5 violations | 0 | | Molecular weight | 163.2163 | H bond donors | 1 | ACD/LogP | 2.00 | | Phase 25 °C | solid | Rotatable bonds | 1 | Predicted density | 1.05 g/cm3 | | SMILES | O=C(Nc1c(cccc1C)C)C | | STD InChIKey | NRPTXWYBRKRZES-UHFFFAOYAQ | | Melting Points | | mp °C | source | |
|---|
| 181.00 | Alfa Aesar | | 183.00 | PHYSPROP |
|
|
| | | 3-(2-pyridyl)-5,6-diphenyl-1,2,4-triazine C20H14N461, 64 |
 | | Compound Data | | Melting point | 191.50 °C | 464.65 K | | CSID | 63757 | H bond acceptors | 4 | Rule of 5 violations | 0 | | Molecular weight | 310.352 | H bond donors | 0 | ACD/LogP | 3.27 | | Phase 25 °C | solid | Rotatable bonds | 3 | Predicted density | 1.20 g/cm3 | | SMILES | n2c(nnc(c1ccccc1)c2c3ccccc3)c4ncccc4 | | STD InChIKey | OTMYLOBWDNFTLO-UHFFFAOYAF | | Melting Points | | mp °C | source | |
|---|
| 191.00 | Oxford University MSDS | | 192.00 | PHYSPROP |
|
|
| | | 3-(dimethylamino)phenol C8H11NO3, 61, 64 |
 | | Compound Data | | Melting point | 83.67 °C | 356.82 K | | CSID | 7143 | H bond acceptors | 2 | Rule of 5 violations | 0 | | Molecular weight | 137.179 | H bond donors | 1 | ACD/LogP | 1.56 | | Phase 25 °C | solid | Rotatable bonds | 2 | Predicted density | 1.09 g/cm3 | | SMILES | Oc1cccc(N(C)C)c1 | | STD InChIKey | MESJRHHDBDCQTH-UHFFFAOYAC | | Melting Points | | mp °C | source | |
|---|
| 82.00 | Alfa Aesar | | 83.00 | Oxford University MSDS | | 86.00 | PHYSPROP |
|
|
| | | 3-(trifluoromethyl)acetanilide C9H8F3NO3, 64 |
 | | Compound Data | | Melting point | 104.75 °C | 377.90 K | | CSID | 9219 | H bond acceptors | 2 | Rule of 5 violations | 0 | | Molecular weight | 203.1611 | H bond donors | 1 | ACD/LogP | 2.20 | | Phase 25 °C | solid | Rotatable bonds | 1 | Predicted density | 1.30 g/cm3 | | SMILES | O=C(Nc1cc(ccc1)C(F)(F)F)C | | STD InChIKey | HNIPNANLYHXYDE-UHFFFAOYAI | | Melting Points | | mp °C | source | |
|---|
| 105.00 | Alfa Aesar | | 104.50 | PHYSPROP |
|
|
| | | 3-(trifluoromethyl)aniline C7H6F3N3, 64 |
 | | Compound Data | | Melting point | 5.75 °C | 278.90 K | | CSID | 7097 | H bond acceptors | 1 | Rule of 5 violations | 0 | | Molecular weight | 161.1244 | H bond donors | 2 | ACD/LogP | 2.39 | | Phase 25 °C | liquid/gas | Rotatable bonds | 1 | Predicted density | 1.29 g/cm3 | | SMILES | FC(F)(F)c1cc(N)ccc1 | | STD InChIKey | VIUDTWATMPPKEL-UHFFFAOYAM | | Melting Points | | mp °C | source | |
|---|
| 6.00 | Alfa Aesar | | 5.50 | PHYSPROP |
|
|
| | | 3-(trifluoromethyl)benzoic acid C8H5F3O23, 64 |
 | | Compound Data | | Melting point | 105.25 °C | 378.40 K | | CSID | 9569 | H bond acceptors | 2 | Rule of 5 violations | 0 | | Molecular weight | 190.1193 | H bond donors | 1 | ACD/LogP | 2.95 | | Phase 25 °C | solid | Rotatable bonds | 1 | Predicted density | 1.40 g/cm3 | | SMILES | FC(F)(F)c1cccc(C(=O)O)c1 | | STD InChIKey | FQXQBFUUVCDIRK-UHFFFAOYAO | | Melting Points | | mp °C | source | |
|---|
| 105.00 | Alfa Aesar | | 105.50 | PHYSPROP |
|
|
| | | 3-(trifluoromethyl)benzonitrile C8H4F3N3, 64 |
 | | Compound Data | | Melting point | 15.25 °C | 288.40 K | | CSID | 61101 | H bond acceptors | 1 | Rule of 5 violations | 0 | | Molecular weight | 171.1193 | H bond donors | 0 | ACD/LogP | 2.56 | | Phase 25 °C | liquid/gas | Rotatable bonds | 0 | Predicted density | 1.29 g/cm3 | | SMILES | FC(F)(F)c1cccc(C#N)c1 | | STD InChIKey | OGOBINRVCUWLGN-UHFFFAOYAZ | | Melting Points | | mp °C | source | |
|---|
| 16.00 | Alfa Aesar | | 14.50 | PHYSPROP |
|
|
| | | 3-(trifluoromethyl)benzophenone C14H9F3O3, 64 |
 | | Compound Data | | Melting point | 52.25 °C | 325.40 K | | CSID | 62965 | H bond acceptors | 1 | Rule of 5 violations | 0 | | Molecular weight | 250.2159 | H bond donors | 0 | ACD/LogP | 4.24 | | Phase 25 °C | solid | Rotatable bonds | 2 | Predicted density | 1.24 g/cm3 | | SMILES | FC(F)(F)c2cccc(C(=O)c1ccccc1)c2 | | STD InChIKey | IOXDAYKKVHAKSX-UHFFFAOYAE | | Melting Points | | mp °C | source | |
|---|
| 52.00 | Alfa Aesar | | 52.50 | PHYSPROP |
|
|
| | | 3-(trifluoromethyl)phenol C7H5F3O3, 64 |
 | | Compound Data | | Melting point | -1.90 °C | 271.25 K | | CSID | 7098 | H bond acceptors | 1 | Rule of 5 violations | 0 | | Molecular weight | 162.1092 | H bond donors | 1 | ACD/LogP | 2.95 | | Phase 25 °C | liquid/gas | Rotatable bonds | 1 | Predicted density | 1.33 g/cm3 | | SMILES | FC(F)(F)c1cc(O)ccc1 | | STD InChIKey | UGEJOEBBMPOJMT-UHFFFAOYAP | | Melting Points | | mp °C | source | |
|---|
| -2.00 | Alfa Aesar | | -1.80 | PHYSPROP |
|
|
| | | 3-(trifluoromethyl)phenylacetic acid C9H7F3O23, 64 |
 | | Compound Data | | Melting point | 77.50 °C | 350.65 K | | CSID | 61014 | H bond acceptors | 2 | Rule of 5 violations | 0 | | Molecular weight | 204.1459 | H bond donors | 1 | ACD/LogP | 2.08 | | Phase 25 °C | solid | Rotatable bonds | 2 | Predicted density | 1.36 g/cm3 | | SMILES | FC(F)(F)c1cccc(c1)CC(=O)O | | STD InChIKey | BLXXCCIBGGBDHI-UHFFFAOYAN | | Melting Points | | mp °C | source | |
|---|
| 78.00 | Alfa Aesar | | 77.00 | PHYSPROP |
|
|
| | | 3-acetamidophenol C8H9NO22, 3, 64 |
 | |
|
| | | 3-acetyl-6-methyl-2-pyranone C8H8O43, 64 |
 | | Compound Data | | Melting point | 110.00 °C | 383.15 K | | CSID | 13887609 | H bond acceptors | 4 | Rule of 5 violations | 0 | | Molecular weight | 168.1467 | H bond donors | 0 | ACD/LogP | 0.35 | | Phase 25 °C | solid | Rotatable bonds | 1 | Predicted density | 1.26 g/cm3 | | SMILES | O=C(C)C1C(=O)/C=C(/C)OC1=O | | STD InChIKey | PGRHXDWITVMQBC-UHFFFAOYAH | | Melting Points | | mp °C | source | |
|---|
| 111.00 | Alfa Aesar | | 109.00 | PHYSPROP |
|
|
| | | 3-acetylbenzonitrile C9H7NO3, 7, 64 |
 | |
|
| | | 3-acetylindole C10H9NO3, 48, 64 |
 | |
|
| | | 3-acetylpyridine C7H7NO3, 64 |
 | | Compound Data | | Melting point | 12.75 °C | 285.90 K | | CSID | 13856009 | H bond acceptors | 2 | Rule of 5 violations | 0 | | Molecular weight | 121.1366 | H bond donors | 0 | ACD/LogP | 0.47 | | Phase 25 °C | liquid/gas | Rotatable bonds | 1 | Predicted density | 1.06 g/cm3 | | SMILES | CC(=O)c1cccnc1 | | STD InChIKey | WEGYGNROSJDEIW-UHFFFAOYAV | | Melting Points | | mp °C | source | |
|---|
| 12.00 | Alfa Aesar | | 13.50 | PHYSPROP |
|
|
| | | 3-amino-4-chlorobenzoic acid C7H6ClNO23, 64 |
 | | Compound Data | | Melting point | 215.00 °C | 488.15 K | | CSID | 68579 | H bond acceptors | 3 | Rule of 5 violations | 0 | | Molecular weight | 171.581 | H bond donors | 3 | ACD/LogP | 1.92 | | Phase 25 °C | solid | Rotatable bonds | 2 | Predicted density | 1.48 g/cm3 | | SMILES | Clc1ccc(C(=O)O)cc1N | | STD InChIKey | DMGFVJVLVZOSOE-UHFFFAOYAF | | Melting Points | | mp °C | source | |
|---|
| 216.00 | Alfa Aesar | | 214.00 | PHYSPROP |
|
|
| | | 3-aminoacetophenone C8H9NO2, 3, 64 |
 | |
|
| | | 3-aminobenzamide C7H8N2O2, 3, 64 |
 | |
|
| | | 3-aminobenzoic acid C7H7NO22, 3, 64 |
 | |
|
| | | 3-aminobenzonitrile C7H6N22, 3, 64 |
 | |
|
| | | 3-aminobenzyl alcohol C7H9NO3, 7 |
 | |
|
| | | 3-aminophenol C6H7NO2, 3, 61, 64 |
 | |
|
| | | 3-aminopyridine C5H6N23, 64 |
 | | Compound Data | | Melting point | 62.75 °C | 335.90 K | | CSID | 21111768 | H bond acceptors | 2 | Rule of 5 violations | 0 | | Molecular weight | 94.1145 | H bond donors | 2 | ACD/LogP | 0.00 | | Phase 25 °C | solid | Rotatable bonds | 1 | Predicted density | 1.11 g/cm3 | | SMILES | Nc1cccnc1 | | STD InChIKey | CUYKNJBYIJFRCU-UHFFFAOYAD | | Melting Points | | mp °C | source | |
|---|
| 61.00 | Alfa Aesar | | 64.50 | PHYSPROP |
|
|
| | | 3-aminoquinoline C9H8N23, 64 |
 | | Compound Data | | Melting point | 92.75 °C | 365.90 K | | CSID | 10897 | H bond acceptors | 2 | Rule of 5 violations | 0 | | Molecular weight | 144.1732 | H bond donors | 2 | ACD/LogP | 1.49 | | Phase 25 °C | solid | Rotatable bonds | 1 | Predicted density | 1.21 g/cm3 | | SMILES | n1cc(cc2ccccc12)N | | STD InChIKey | SVNCRRZKBNSMIV-UHFFFAOYAF | | Melting Points | | mp °C | source | |
|---|
| 94.00 | Alfa Aesar | | 91.50 | PHYSPROP |
|
|
| | | 3-aminotoluene C7H9N3, 31, 64 |
 | |
|
| | | 3-anilinophenol C12H11NO3, 61, 64 |
 | | Compound Data | | Melting point | 81.00 °C | 354.15 K | | CSID | 21106124 | H bond acceptors | 2 | Rule of 5 violations | 0 | | Molecular weight | 185.2218 | H bond donors | 2 | ACD/LogP | 2.53 | | Phase 25 °C | solid | Rotatable bonds | 3 | Predicted density | 1.20 g/cm3 | | SMILES | Oc2cccc(Nc1ccccc1)c2 | | STD InChIKey | NDACNGSDAFKTGE-UHFFFAOYAF | | Melting Points | | mp °C | source | |
|---|
| 80.00 | Alfa Aesar | | 81.50 | Oxford University MSDS | | 81.50 | PHYSPROP |
|
|
| | | 3-anisidine C7H9NO2, 3, 64 |
 | |
|
| | | 3-benzoylpropionic acid C10H10O33, 64 |
 | | Compound Data | | Melting point | 117.50 °C | 390.65 K | | CSID | 65703 | H bond acceptors | 3 | Rule of 5 violations | 0 | | Molecular weight | 178.1846 | H bond donors | 1 | ACD/LogP | 1.29 | | Phase 25 °C | solid | Rotatable bonds | 4 | Predicted density | 1.20 g/cm3 | | SMILES | O=C(c1ccccc1)CCC(=O)O | | STD InChIKey | KMQLIDDEQAJAGJ-UHFFFAOYAS | | Melting Points | | mp °C | source | |
|---|
| 117.00 | Alfa Aesar | | 118.00 | PHYSPROP |
|
|
| | | 3-brombenzophenone C13H9BrO3, 64 |
 | | Compound Data | | Melting point | 78.50 °C | 351.65 K | | CSID | 63718 | H bond acceptors | 1 | Rule of 5 violations | 0 | | Molecular weight | 261.114 | H bond donors | 0 | ACD/LogP | 4.15 | | Phase 25 °C | solid | Rotatable bonds | 2 | Predicted density | 1.42 g/cm3 | | SMILES | O=C(c1cc(Br)ccc1)c2ccccc2 | | STD InChIKey | XNUMUNIJQMSNNN-UHFFFAOYAU | | Melting Points | | mp °C | source | |
|---|
| 76.00 | Alfa Aesar | | 81.00 | PHYSPROP |
|
|
| | | 3-bromo-4-methylaniline C7H8BrN3, 64 |
 | | Compound Data | | Melting point | 26.50 °C | 299.65 K | | CSID | 74169 | H bond acceptors | 1 | Rule of 5 violations | 0 | | Molecular weight | 186.0491 | H bond donors | 2 | ACD/LogP | 2.56 | | Phase 25 °C | solid | Rotatable bonds | 1 | Predicted density | 1.50 g/cm3 | | SMILES | Brc1cc(N)ccc1C | | STD InChIKey | GRXMMIBZRMKADT-UHFFFAOYAE | | Melting Points | | mp °C | source | |
|---|
| 27.00 | Alfa Aesar | | 26.00 | PHYSPROP |
|
|
| | | 3-bromoacetophenone C8H7BrO3, 64 |
 | | Compound Data | | Melting point | 7.75 °C | 280.90 K | | CSID | 15644 | H bond acceptors | 1 | Rule of 5 violations | 0 | | Molecular weight | 199.0446 | H bond donors | 0 | ACD/LogP | 2.58 | | Phase 25 °C | liquid/gas | Rotatable bonds | 1 | Predicted density | 1.45 g/cm3 | | SMILES | O=C(c1cc(Br)ccc1)C | | STD InChIKey | JYAQYXOVOHJRCS-UHFFFAOYAF | | Melting Points | | mp °C | source | |
|---|
| 8.00 | Alfa Aesar | | 7.50 | PHYSPROP |
|
|
| | | 3-bromoaniline C6H6BrN2, 3, 64 |
 | |
|
| | | 3-bromobenzamide C7H6BrNO7, 64 |
 | | Compound Data | | Melting point | 155.15 °C | 428.30 K | | CSID | 81061 | H bond acceptors | 2 | Rule of 5 violations | 0 | | Molecular weight | 200.0326 | H bond donors | 2 | ACD/LogP | 1.65 | | Phase 25 °C | solid | Rotatable bonds | 1 | Predicted density | 1.61 g/cm3 | | SMILES | O=C(c1cc(Br)ccc1)N | | STD InChIKey | ODJFDWIECLJWSR-UHFFFAOYAG | | Melting Points | | mp °C | source | |
|---|
| 155.00 | Beilstein F. K.; Beilsteins Handbuch der Organischen Chemie.... | | 155.30 | PHYSPROP |
|
|
| | | 3-bromobenzhydrazide C7H7BrN2O3, 64 |
 | | Compound Data | | Melting point | 157.00 °C | 430.15 K | | CSID | 454393 | H bond acceptors | 3 | Rule of 5 violations | 0 | | Molecular weight | 215.0473 | H bond donors | 3 | ACD/LogP | 1.26 | | Phase 25 °C | solid | Rotatable bonds | 2 | Predicted density | 1.61 g/cm3 | | SMILES | O=C(c1cc(Br)ccc1)NN | | STD InChIKey | BNAQRAZIPAHWAR-UHFFFAOYAG | | Melting Points | | mp °C | source | |
|---|
| 156.00 | Alfa Aesar | | 158.00 | PHYSPROP |
|
|
| | | 3-bromobenzoic acid C7H5BrO22, 3, 64, 70 |
 | |
|
| | | 3-bromobenzonitrile C7H4BrN2, 3, 64 |
 | |
|
| | | 3-bromobenzyl cyanide C8H6BrN2, 3 |
 | | Compound Data | | Melting point | 27.50 °C | 300.65 K | | CSID | 33137 | H bond acceptors | 1 | Rule of 5 violations | 0 | | Molecular weight | 196.0439 | H bond donors | 0 | ACD/LogP | 2.22 | | Phase 25 °C | solid | Rotatable bonds | 1 | Predicted density | 1.49 g/cm3 | | SMILES | Brc1cc(ccc1)CC#N | | STD InChIKey | UUZYFBXKWIQKTF-UHFFFAOYAN | | Melting Points | | mp °C | source | |
|---|
| 28.00 | Aldrich Chemical Company; Aldrich Catalog-Handbook of Fine C... | | 27.00 | Alfa Aesar |
|
|
| | | 3-bromonitrobenzene C6H4BrNO22, 64 |
 | | Compound Data | | Melting point | 55.00 °C | 328.15 K | | CSID | 21111786 | H bond acceptors | 3 | Rule of 5 violations | 0 | | Molecular weight | 202.0055 | H bond donors | 0 | ACD/LogP | 2.52 | | Phase 25 °C | solid | Rotatable bonds | 1 | Predicted density | 1.72 g/cm3 | | SMILES | O=[N+]([O-])c1cc(Br)ccc1 | | STD InChIKey | FWIROFMBWVMWLB-UHFFFAOYAI | | Melting Points | | mp °C | source | |
|---|
| 54.00 | Aldrich Chemical Company; Aldrich Catalog-Handbook of Fine C... | | 56.00 | PHYSPROP |
|
|
| | | 3-bromopentane C5H11Br31, 64 |
 | | Compound Data | | Melting point | -126.10 °C | 147.05 K | | CSID | 14966 | H bond acceptors | 0 | Rule of 5 violations | 0 | | Molecular weight | 151.0448 | H bond donors | 0 | ACD/LogP | 3.09 | | Phase 25 °C | liquid/gas | Rotatable bonds | 2 | Predicted density | 1.21 g/cm3 | | SMILES | BrC(CC)CC | | STD InChIKey | VTOQFOCYBTVOJZ-UHFFFAOYAL | | Melting Points | | mp °C | source | |
|---|
| -126.00 | Dreisbach R. R. Physical Properties of Chemical Compounds; V... | | -126.20 | PHYSPROP |
|
|
| | | 3-bromophenol C6H5BrO2, 3, 64 |
 | |
|
| | | 3-bromopropionic acid C3H5BrO23, 64 |
 | | Compound Data | | Melting point | 61.25 °C | 334.40 K | | CSID | 11066 | H bond acceptors | 2 | Rule of 5 violations | 0 | | Molecular weight | 152.9746 | H bond donors | 1 | ACD/LogP | 0.69 | | Phase 25 °C | solid | Rotatable bonds | 2 | Predicted density | 1.78 g/cm3 | | SMILES | BrCCC(=O)O | | STD InChIKey | DHXNZYCXMFBMHE-UHFFFAOYAK | | Melting Points | | mp °C | source | |
|---|
| 60.00 | Alfa Aesar | | 62.50 | PHYSPROP |
|
|
| | | 3-bromopyridine C5H4BrN3, 64 |
 | | Compound Data | | Melting point | -27.15 °C | 246.00 K | | CSID | 11783 | H bond acceptors | 1 | Rule of 5 violations | 0 | | Molecular weight | 157.996 | H bond donors | 0 | ACD/LogP | 1.75 | | Phase 25 °C | liquid/gas | Rotatable bonds | 0 | Predicted density | 1.60 g/cm3 | | SMILES | Brc1cccnc1 | | STD InChIKey | NYPYPOZNGOXYSU-UHFFFAOYAJ | | Melting Points | | mp °C | source | |
|---|
| -27.00 | Alfa Aesar | | -27.30 | PHYSPROP |
|
|
| | | 3-bromoquinoline C9H6BrN3, 64 |
 | | Compound Data | | Melting point | 13.65 °C | 286.80 K | | CSID | 20124 | H bond acceptors | 1 | Rule of 5 violations | 0 | | Molecular weight | 208.0546 | H bond donors | 0 | ACD/LogP | 3.03 | | Phase 25 °C | liquid/gas | Rotatable bonds | 0 | Predicted density | 1.56 g/cm3 | | SMILES | Brc1cc2ccccc2nc1 | | STD InChIKey | ZGIKWINFUGEQEO-UHFFFAOYAK | | Melting Points | | mp °C | source | |
|---|
| 14.00 | Alfa Aesar | | 13.30 | PHYSPROP |
|
|
| | | 3-bromotoluene C7H7Br2, 3, 64 |
 | |
|
| | | 3-butyn-1-ol C4H6O3, 61, 64 |
 | | Compound Data | | Melting point | -63.40 °C | 209.75 K | | CSID | 12977 | H bond acceptors | 1 | Rule of 5 violations | 0 | | Molecular weight | 70.0898 | H bond donors | 1 | ACD/LogP | 0.13 | | Phase 25 °C | liquid/gas | Rotatable bonds | 2 | Predicted density | 0.92 g/cm3 | | SMILES | C#CCCO | | STD InChIKey | OTJZCIYGRUNXTP-UHFFFAOYAH | | Melting Points | | mp °C | source | |
|---|
| -63.00 | Alfa Aesar | | -63.60 | Oxford University MSDS | | -63.60 | PHYSPROP |
|
|
| | | 3-carboxybenzaldehyde C8H6O33, 7, 64, 64 |
 | | Compound Data | | Melting point | 174.33 °C | 447.48 K | | CSID | 11580 | H bond acceptors | 3 | Rule of 5 violations | 0 | | Molecular weight | 150.1314 | H bond donors | 1 | ACD/LogP | 1.60 | | Phase 25 °C | solid | Rotatable bonds | 2 | Predicted density | 1.32 g/cm3 | | SMILES | O=C(O)c1cccc(C=O)c1 | | STD InChIKey | UHDNUPHSDMOGCR-UHFFFAOYAK | | Melting Points | | mp °C | source | |
|---|
| 174.00 | Alfa Aesar | | 175.00 | Beilstein F. K.; Beilsteins Handbuch der Organischen Chemie.... | | 174.00 | PHYSPROP | | Values not used in calculating the average melting point | | 247.00 | PHYSPROP1 | | 1. wrong isomer JCB |
|
|
| | | 3-chloro-2-methylaniline C7H8ClN3, 64 |
 | | Compound Data | | Melting point | 1.50 °C | 274.65 K | | CSID | 6628 | H bond acceptors | 1 | Rule of 5 violations | 0 | | Molecular weight | 141.5981 | H bond donors | 2 | ACD/LogP | 2.27 | | Phase 25 °C | liquid/gas | Rotatable bonds | 1 | Predicted density | 1.18 g/cm3 | | SMILES | Clc1cccc(N)c1C | | STD InChIKey | ZUVPLKVDZNDZCM-UHFFFAOYAZ | | Melting Points | | mp °C | source | |
|---|
| 2.00 | Alfa Aesar | | 1.00 | PHYSPROP |
|
|
| | | 3-chloro-2-nitrobenzoic acid C7H4ClNO42, 3, 64 |
 | |
|
| | | 3-chloro-4-fluoroaniline C6H5ClFN3, 61, 64 |
 | | Compound Data | | Melting point | 45.67 °C | 318.82 K | | CSID | 9327 | H bond acceptors | 1 | Rule of 5 violations | 0 | | Molecular weight | 145.562 | H bond donors | 2 | ACD/LogP | 2.14 | | Phase 25 °C | solid | Rotatable bonds | 1 | Predicted density | 1.35 g/cm3 | | SMILES | Fc1ccc(N)cc1Cl | | STD InChIKey | YSEMCVGMNUUNRK-UHFFFAOYAD | | Melting Points | | mp °C | source | |
|---|
| 46.00 | Alfa Aesar | | 45.50 | Oxford University MSDS | | 45.50 | PHYSPROP |
|
|
| | | 3-chloro-4-hydroxybenzoic acid C7H5ClO33, 64 |
 | | Compound Data | | Melting point | 170.00 °C | 443.15 K | | CSID | 18708 | H bond acceptors | 3 | Rule of 5 violations | 0 | | Molecular weight | 172.5658 | H bond donors | 2 | ACD/LogP | 2.39 | | Phase 25 °C | solid | Rotatable bonds | 2 | Predicted density | 1.54 g/cm3 | | SMILES | Clc1cc(C(=O)O)ccc1O | | STD InChIKey | QGNLHMKIGMZKJX-UHFFFAOYAR | | Melting Points | | mp °C | source | |
|---|
| 169.00 | Alfa Aesar | | 171.00 | PHYSPROP |
|
|
| | | 3-chloro-4-methoxyaniline C7H8ClNO2, 64 |
 | | Compound Data | | Melting point | 51.25 °C | 324.40 K | | CSID | 20151 | H bond acceptors | 2 | Rule of 5 violations | 0 | | Molecular weight | 157.5975 | H bond donors | 2 | ACD/LogP | 1.57 | | Phase 25 °C | solid | Rotatable bonds | 2 | Predicted density | 1.23 g/cm3 | | SMILES | Clc1cc(ccc1OC)N | | STD InChIKey | XQVCBOLNTSUFGD-UHFFFAOYAN | | Melting Points | | mp °C | source | |
|---|
| 50.00 | Aldrich Chemical Company; Aldrich Catalog-Handbook of Fine C... | | 52.50 | PHYSPROP |
|
|
| | | 3-chloro-4-methylaniline C7H8ClN3, 61, 64 |
 | | Compound Data | | Melting point | 25.00 °C | 298.15 K | | CSID | 6985 | H bond acceptors | 1 | Rule of 5 violations | 0 | | Molecular weight | 141.5981 | H bond donors | 2 | ACD/LogP | 2.27 | | Phase 25 °C | liquid/gas | Rotatable bonds | 1 | Predicted density | 1.18 g/cm3 | | SMILES | Clc1cc(N)ccc1C | | STD InChIKey | RQKFYFNZSHWXAW-UHFFFAOYAO | | Melting Points | | mp °C | source | |
|---|
| 23.00 | Alfa Aesar | | 26.00 | Oxford University MSDS | | 26.00 | PHYSPROP |
|
|
| | | 3-chloro-4-methylphenol C7H7ClO3, 64 |
 | | Compound Data | | Melting point | 53.75 °C | 326.90 K | | CSID | 14163 | H bond acceptors | 1 | Rule of 5 violations | 0 | | Molecular weight | 142.5829 | H bond donors | 1 | ACD/LogP | 2.86 | | Phase 25 °C | solid | Rotatable bonds | 1 | Predicted density | 1.23 g/cm3 | | SMILES | Clc1cc(O)ccc1C | | STD InChIKey | VQZRLBWPEHFGCD-UHFFFAOYAO | | Melting Points | | mp °C | source | |
|---|
| 52.00 | Alfa Aesar | | 55.50 | PHYSPROP |
|
|
| | | 3-chloroacetanilide C8H8ClNO3, 64 |
 | | Compound Data | | Melting point | 78.50 °C | 351.65 K | | CSID | 11009 | H bond acceptors | 2 | Rule of 5 violations | 0 | | Molecular weight | 169.6082 | H bond donors | 1 | ACD/LogP | 1.81 | | Phase 25 °C | solid | Rotatable bonds | 1 | Predicted density | 1.26 g/cm3 | | SMILES | Clc1cc(NC(=O)C)ccc1 | | STD InChIKey | MUUQHCOAOLLHIL-UHFFFAOYAA | | Melting Points | | mp °C | source | |
|---|
| 77.00 | Alfa Aesar | | 80.00 | PHYSPROP |
|
|
| | | 3-chloroaniline C6H6ClN3, 31, 64 |
 | |
|
| | | 3-chlorobenzaldehyde C7H5ClO2, 3, 64 |
 | |
|
| | | 3-chlorobenzamide C7H6ClNO3, 7 |
 | | Compound Data | | Melting point | 135.50 °C | 408.65 K | | CSID | 62467 | H bond acceptors | 2 | Rule of 5 violations | 0 | | Molecular weight | 155.5816 | H bond donors | 2 | ACD/LogP | 1.51 | | Phase 25 °C | solid | Rotatable bonds | 1 | Predicted density | 1.29 g/cm3 | | SMILES | O=C(c1cc(Cl)ccc1)N | | STD InChIKey | MJTGQALMWUUPQM-UHFFFAOYAL | | Melting Points | | mp °C | source | |
|---|
| 135.00 | Alfa Aesar | | 136.00 | Beilstein F. K.; Beilsteins Handbuch der Organischen Chemie.... |
|
|
| | | 3-chlorobenzamide C8H9NO2, 3, 64 |
 | |
|
| | | 3-chlorobenzoic acid C7H5ClO22, 3, 64 |
 | |
|
| | | 3-chlorobenzophenone C13H9ClO2, 3 |
 | | Compound Data | | Melting point | 82.50 °C | 355.65 K | | CSID | 59487 | H bond acceptors | 1 | Rule of 5 violations | 0 | | Molecular weight | 216.663 | H bond donors | 0 | ACD/LogP | 3.98 | | Phase 25 °C | solid | Rotatable bonds | 2 | Predicted density | 1.21 g/cm3 | | SMILES | O=C(c1cc(Cl)ccc1)c2ccccc2 | | STD InChIKey | CPLWKNRPZVNELG-UHFFFAOYAS | | Melting Points | | mp °C | source | |
|---|
| 82.00 | Aldrich Chemical Company; Aldrich Catalog-Handbook of Fine C... | | 83.00 | Alfa Aesar |
|
|
| | | 3-chlorobenzyl cyanide C8H6ClN3, 61 |
 | | Compound Data | | Melting point | 11.75 °C | 284.90 K | | CSID | 66365 | H bond acceptors | 1 | Rule of 5 violations | 0 | | Molecular weight | 151.5929 | H bond donors | 0 | ACD/LogP | 2.04 | | Phase 25 °C | liquid/gas | Rotatable bonds | 1 | Predicted density | 1.19 g/cm3 | | SMILES | Clc1cc(ccc1)CC#N | | STD InChIKey | GTIKLPYCSAMPNG-UHFFFAOYAY | | Melting Points | | mp °C | source | |
|---|
| 12.00 | Alfa Aesar | | 11.50 | Oxford University MSDS |
|
|
| | | 3-chlorobiphenyl C12H9Cl7, 64 |
 | | Compound Data | | Melting point | 17.00 °C | 290.15 K | | CSID | 15488 | H bond acceptors | 0 | Rule of 5 violations | 0 | | Molecular weight | 188.6529 | H bond donors | 0 | ACD/LogP | 4.54 | | Phase 25 °C | liquid/gas | Rotatable bonds | 1 | Predicted density | 1.13 g/cm3 | | SMILES | Clc2cc(c1ccccc1)ccc2 | | STD InChIKey | NMWSKOLWZZWHPL-UHFFFAOYAE | | Melting Points | | mp °C | source | |
|---|
| 18.00 | Beilstein F. K.; Beilsteins Handbuch der Organischen Chemie.... | | 16.00 | PHYSPROP |
|
|
| | | 3-chlorophenol C6H5ClO2, 3, 32, 61, 64, 72 |
 | |
|
| | | 3-chlorophenoxyacetic acid C8H7ClO33, 64 |
 | | Compound Data | | Melting point | 109.00 °C | 382.15 K | | CSID | 11013 | H bond acceptors | 3 | Rule of 5 violations | 0 | | Molecular weight | 186.5924 | H bond donors | 1 | ACD/LogP | 2.17 | | Phase 25 °C | solid | Rotatable bonds | 3 | Predicted density | 1.37 g/cm3 | | SMILES | Clc1cc(OCC(=O)O)ccc1 | | STD InChIKey | XSBUXVWJQVTYLC-UHFFFAOYAT | | Melting Points | | mp °C | source | |
|---|
| 108.00 | Alfa Aesar | | 110.00 | PHYSPROP |
|
|
| | | 3-chlorophenylacetic acid C8H7ClO22, 3, 64 |
 | |
|
| | | 3-chloropropionic acid C3H5ClO23, 64 |
 | | Compound Data | | Melting point | 40.00 °C | 313.15 K | | CSID | 7611 | H bond acceptors | 2 | Rule of 5 violations | 0 | | Molecular weight | 108.5236 | H bond donors | 1 | ACD/LogP | 0.41 | | Phase 25 °C | solid | Rotatable bonds | 2 | Predicted density | 1.29 g/cm3 | | SMILES | ClCCC(=O)O | | STD InChIKey | QEYMMOKECZBKAC-UHFFFAOYAJ | | Melting Points | | mp °C | source | |
|---|
| 39.00 | Alfa Aesar | | 41.00 | PHYSPROP |
|
|
| | | 3-chloropropionitrile C3H4ClN2, 3, 64 |
 | |
|
| | | 3-chlorotoluene C7H7Cl2, 3, 61, 64 |
 | |
|
| | | 3-cyanobenzaldehyde C8H5NO2, 3, 64 |
 | |
|
| | | 3-cyanobenzoic acid C8H5NO22, 3, 64 |
 | |
|
| | | 3-cyanophenol C7H5NO2, 3, 64, 72 |
 | |
|
| | | 3-cyanopyridine C6H4N23, 61, 64 |
 | | Compound Data | | Melting point | 50.33 °C | 323.48 K | | CSID | 78 | H bond acceptors | 2 | Rule of 5 violations | 0 | | Molecular weight | 104.1094 | H bond donors | 0 | ACD/LogP | 0.42 | | Phase 25 °C | solid | Rotatable bonds | 0 | Predicted density | 1.12 g/cm3 | | SMILES | c1cc(cnc1)C#N | | STD InChIKey | GZPHSAQLYPIAIN-UHFFFAOYAR | | Melting Points | | mp °C | source | |
|---|
| 50.00 | Alfa Aesar | | 50.00 | Oxford University MSDS | | 51.00 | PHYSPROP |
|
|
| | | 3-cyanotoluene C8H7N2, 3, 64 |
 | |
|
| | | 3-ethoxy-4-hydroxybenzaldehyde C9H10O33, 64 |
 | | Compound Data | | Melting point | 77.25 °C | 350.40 K | | CSID | 8154 | H bond acceptors | 3 | Rule of 5 violations | 0 | | Molecular weight | 166.1739 | H bond donors | 1 | ACD/LogP | 1.72 | | Phase 25 °C | solid | Rotatable bonds | 4 | Predicted density | 1.19 g/cm3 | | SMILES | O=Cc1cc(OCC)c(O)cc1 | | STD InChIKey | CBOQJANXLMLOSS-UHFFFAOYAD | | Melting Points | | mp °C | source | |
|---|
| 77.00 | Alfa Aesar | | 77.50 | PHYSPROP |
|
|
| | | 3-ethoxybenzoic acid C9H10O33, 64 |
 | | Compound Data | | Melting point | 136.50 °C | 409.65 K | | CSID | 11628 | H bond acceptors | 3 | Rule of 5 violations | 0 | | Molecular weight | 166.1739 | H bond donors | 1 | ACD/LogP | 2.55 | | Phase 25 °C | solid | Rotatable bonds | 3 | Predicted density | 1.17 g/cm3 | | SMILES | O=C(O)c1cc(OCC)ccc1 | | STD InChIKey | DTFQMPQJMDEWKJ-UHFFFAOYAC | | Melting Points | | mp °C | source | |
|---|
| 136.00 | Alfa Aesar | | 137.00 | PHYSPROP |
|
|
| | | 3-ethyl-1-pentene C7H144, 64 |
 | | Compound Data | | Melting point | -127.25 °C | 145.90 K | | CSID | 18792 | H bond acceptors | 0 | Rule of 5 violations | 0 | | Molecular weight | 98.1861 | H bond donors | 0 | ACD/LogP | 3.78 | | Phase 25 °C | liquid/gas | Rotatable bonds | 3 | Predicted density | 0.70 g/cm3 | | SMILES | C=C\C(CC)CC | | STD InChIKey | YPVPQMCSLFDIKA-UHFFFAOYAR | | Melting Points | | mp °C | source | |
|---|
| -127.00 | American Petroleum Institute. Research Project 44; Selected ... | | -127.50 | PHYSPROP |
|
|
| | | 3-ethyl-2-methylpentane C8H184, 64 |
 | | Compound Data | | Melting point | -114.95 °C | 158.20 K | | CSID | 11370 | H bond acceptors | 0 | Rule of 5 violations | 0 | | Molecular weight | 114.2285 | H bond donors | 0 | ACD/LogP | 4.64 | | Phase 25 °C | liquid/gas | Rotatable bonds | 3 | Predicted density | 0.71 g/cm3 | | SMILES | CC(C)C(CC)CC | | STD InChIKey | DUPUVYJQZSLSJB-UHFFFAOYAR | | Melting Points | | mp °C | source | |
|---|
| -115.00 | American Petroleum Institute. Research Project 44; Selected ... | | -114.90 | PHYSPROP |
|
|
| | | 3-ethyl-2,4-dimethylpentane C9H204, 64 |
 | | Compound Data | | Melting point | -122.20 °C | 150.95 K | | CSID | 13421 | H bond acceptors | 0 | Rule of 5 violations | 0 | | Molecular weight | 128.2551 | H bond donors | 0 | ACD/LogP | 4.99 | | Phase 25 °C | liquid/gas | Rotatable bonds | 3 | Predicted density | 0.72 g/cm3 | | SMILES | CC(C)C(CC)C(C)C | | STD InChIKey | VLHAGZNBWKUMRW-UHFFFAOYAK | | Melting Points | | mp °C | source | |
|---|
| -122.00 | American Petroleum Institute. Research Project 44; Selected ... | | -122.40 | PHYSPROP |
|
|
| | | 3-ethyl-3-pentanol C7H16O3, 64 |
 | | Compound Data | | Melting point | -12.75 °C | 260.40 K | | CSID | 11210 | H bond acceptors | 1 | Rule of 5 violations | 0 | | Molecular weight | 116.2013 | H bond donors | 1 | ACD/LogP | 2.10 | | Phase 25 °C | liquid/gas | Rotatable bonds | 4 | Predicted density | 0.82 g/cm3 | | SMILES | OC(CC)(CC)CC | | STD InChIKey | XKIRHOWVQWCYBT-UHFFFAOYAB | | Melting Points | | mp °C | source | |
|---|
| -13.00 | Alfa Aesar | | -12.50 | PHYSPROP |
|
|
| | | 3-ethylbiphenyl C14H144, 64 |
 | | Compound Data | | Melting point | -27.75 °C | 245.40 K | | CSID | 72051 | H bond acceptors | 0 | Rule of 5 violations | 0 | | Molecular weight | 182.261 | H bond donors | 0 | ACD/LogP | 4.97 | | Phase 25 °C | liquid/gas | Rotatable bonds | 2 | Predicted density | 0.97 g/cm3 | | SMILES | c2(c1cccc(c1)CC)ccccc2 | | STD InChIKey | HUXKTWJQSHBZIV-UHFFFAOYAH | | Melting Points | | mp °C | source | |
|---|
| -28.00 | American Petroleum Institute. Research Project 44; Selected ... | | -27.50 | PHYSPROP |
|
|
| | | 3-ethylpentane C7H164, 64 |
 | | Compound Data | | Melting point | -118.80 °C | 154.35 K | | CSID | 11551 | H bond acceptors | 0 | Rule of 5 violations | 0 | | Molecular weight | 100.2019 | H bond donors | 0 | ACD/LogP | 4.29 | | Phase 25 °C | liquid/gas | Rotatable bonds | 3 | Predicted density | 0.69 g/cm3 | | SMILES | CCC(CC)CC | | STD InChIKey | AORMDLNPRGXHHL-UHFFFAOYAP | | Melting Points | | mp °C | source | |
|---|
| -119.00 | American Petroleum Institute. Research Project 44; Selected ... | | -118.60 | PHYSPROP |
|
|
| | | 3-ethylpyridine C7H9N3, 64 |
 | | Compound Data | | Melting point | -76.95 °C | 196.20 K | | CSID | 21105905 | H bond acceptors | 1 | Rule of 5 violations | 0 | | Molecular weight | 107.1531 | H bond donors | 0 | ACD/LogP | 1.72 | | Phase 25 °C | liquid/gas | Rotatable bonds | 1 | Predicted density | 0.93 g/cm3 | | SMILES | CCc1cccnc1 | | STD InChIKey | MFEIKQPHQINPRI-UHFFFAOYAR | | Melting Points | | mp °C | source | |
|---|
| -77.00 | Alfa Aesar | | -76.90 | PHYSPROP |
|
|
| | | 3-ethyltoluene C9H123, 4, 64 |
 | |
|
| | | 3-fluoro-4-methylaniline C7H8FN3, 64 |
 | | Compound Data | | Melting point | 32.00 °C | 305.15 K | | CSID | 9563 | H bond acceptors | 1 | Rule of 5 violations | 0 | | Molecular weight | 125.1435 | H bond donors | 2 | ACD/LogP | 1.85 | | Phase 25 °C | solid | Rotatable bonds | 1 | Predicted density | 1.11 g/cm3 | | SMILES | Fc1c(ccc(N)c1)C | | STD InChIKey | MGRHBBRSAFPBIN-UHFFFAOYAI | | Melting Points | | mp °C | source | |
|---|
| 33.00 | Alfa Aesar | | 31.00 | PHYSPROP |
|
|
| | | 3-fluoro-4-nitrotoluene C7H6FNO23, 64 |
 | | Compound Data | | Melting point | 53.10 °C | 326.25 K | | CSID | 61281 | H bond acceptors | 3 | Rule of 5 violations | 0 | | Molecular weight | 155.1264 | H bond donors | 0 | ACD/LogP | 2.15 | | Phase 25 °C | solid | Rotatable bonds | 1 | Predicted density | 1.27 g/cm3 | | SMILES | O=[N+]([O-])c1ccc(cc1F)C | | STD InChIKey | WZMOWQCNPFDWPA-UHFFFAOYAV | | Melting Points | | mp °C | source | |
|---|
| 53.00 | Alfa Aesar | | 53.20 | PHYSPROP |
|
|
| | | 3-fluorobenzoic acid C7H5FO23, 64 |
 | | Compound Data | | Melting point | 123.50 °C | 396.65 K | | CSID | 9574 | H bond acceptors | 2 | Rule of 5 violations | 0 | | Molecular weight | 140.1118 | H bond donors | 1 | ACD/LogP | 2.16 | | Phase 25 °C | solid | Rotatable bonds | 1 | Predicted density | 1.32 g/cm3 | | SMILES | O=C(O)c1cc(F)ccc1 | | STD InChIKey | MXNBDFWNYRNIBH-UHFFFAOYAD | | Melting Points | | mp °C | source | |
|---|
| 123.00 | Alfa Aesar | | 124.00 | PHYSPROP |
|
|
| | | 3-fluorophenol C6H5FO3, 61, 64 |
 | | Compound Data | | Melting point | 11.90 °C | 285.05 K | | CSID | 9360 | H bond acceptors | 1 | Rule of 5 violations | 0 | | Molecular weight | 112.1017 | H bond donors | 1 | ACD/LogP | 1.93 | | Phase 25 °C | liquid/gas | Rotatable bonds | 1 | Predicted density | 1.22 g/cm3 | | SMILES | Fc1cccc(O)c1 | | STD InChIKey | SJTBRFHBXDZMPS-UHFFFAOYAM | | Melting Points | | mp °C | source | |
|---|
| 12.00 | Alfa Aesar | | 10.00 | Oxford University MSDS | | 13.70 | PHYSPROP |
|
|
| | | 3-fluorophenylacetic acid C8H7FO23, 64 |
 | | Compound Data | | Melting point | 44.50 °C | 317.65 K | | CSID | 60937 | H bond acceptors | 2 | Rule of 5 violations | 0 | | Molecular weight | 154.1384 | H bond donors | 1 | ACD/LogP | 1.56 | | Phase 25 °C | solid | Rotatable bonds | 2 | Predicted density | 1.27 g/cm3 | | SMILES | Fc1cc(ccc1)CC(=O)O | | STD InChIKey | YEAUYVGUXSZCFI-UHFFFAOYAP | | Melting Points | | mp °C | source | |
|---|
| 46.00 | Alfa Aesar | | 43.00 | PHYSPROP |
|
|
| | | 3-furoic acid C5H4O33, 64 |
 | | Compound Data | | Melting point | 122.25 °C | 395.40 K | | CSID | 9849 | H bond acceptors | 3 | Rule of 5 violations | 0 | | Molecular weight | 112.0835 | H bond donors | 1 | ACD/LogP | 1.03 | | Phase 25 °C | solid | Rotatable bonds | 1 | Predicted density | 1.32 g/cm3 | | SMILES | c1cocc1C(=O)O | | STD InChIKey | IHCCAYCGZOLTEU-UHFFFAOYAX | | Melting Points | | mp °C | source | |
|---|
| 122.00 | Alfa Aesar | | 122.50 | PHYSPROP |
|
|
| | | 3-heptanone C7H14O3, 4, 61, 64 |
 | |
|
| | | 3-heptyne C7H124, 64 |
 | | Compound Data | | Melting point | -130.75 °C | 142.40 K | | CSID | 68268 | H bond acceptors | 0 | Rule of 5 violations | 0 | | Molecular weight | 96.1702 | H bond donors | 0 | ACD/LogP | 3.05 | | Phase 25 °C | liquid/gas | Rotatable bonds | 2 | Predicted density | 0.75 g/cm3 | | SMILES | C(#CCCC)CC | | STD InChIKey | KLYHSJRCIZOUHE-UHFFFAOYAH | | Melting Points | | mp °C | source | |
|---|
| -131.00 | American Petroleum Institute. Research Project 44; Selected ... | | -130.50 | PHYSPROP |
|
|
| | | 3-hexanone C6H12O3, 64 |
 | | Compound Data | | Melting point | -55.25 °C | 217.90 K | | CSID | 11025 | H bond acceptors | 1 | Rule of 5 violations | 0 | | Molecular weight | 100.1589 | H bond donors | 0 | ACD/LogP | 1.44 | | Phase 25 °C | liquid/gas | Rotatable bonds | 3 | Predicted density | 0.80 g/cm3 | | SMILES | O=C(CC)CCC | | STD InChIKey | PFCHFHIRKBAQGU-UHFFFAOYAM | | Melting Points | | mp °C | source | |
|---|
| -55.00 | Alfa Aesar | | -55.50 | PHYSPROP |
|
|
| | | 3-hydroxy-2-naphthoic acid C11H8O33, 64 |
 | | Compound Data | | Melting point | 221.25 °C | 494.40 K | | CSID | 6837 | H bond acceptors | 3 | Rule of 5 violations | 0 | | Molecular weight | 188.1794 | H bond donors | 2 | ACD/LogP | 3.29 | | Phase 25 °C | solid | Rotatable bonds | 2 | Predicted density | 1.40 g/cm3 | | SMILES | O=C(O)c2cc1c(cccc1)cc2O | | STD InChIKey | ALKYHXVLJMQRLQ-UHFFFAOYAT | | Melting Points | | mp °C | source | |
|---|
| 220.00 | Alfa Aesar | | 222.50 | PHYSPROP |
|
|
| | | 3-hydroxy-4-methoxybenzoic acid C8H8O43, 64 |
 | | Compound Data | | Melting point | 252.25 °C | 525.40 K | | CSID | 12055 | H bond acceptors | 4 | Rule of 5 violations | 0 | | Molecular weight | 168.1467 | H bond donors | 2 | ACD/LogP | 1.35 | | Phase 25 °C | solid | Rotatable bonds | 3 | Predicted density | 1.35 g/cm3 | | SMILES | O=C(O)c1ccc(OC)c(O)c1 | | STD InChIKey | LBKFGYZQBSGRHY-UHFFFAOYAM | | Melting Points | | mp °C | source | |
|---|
| 253.00 | Alfa Aesar | | 251.50 | PHYSPROP |
|
|
| | | 3-hydroxy-4-nitrobenzoic acid C8H7NO42, 3, 61, 64 |
 | |
|
| | | 3-hydroxybenzaldehyde C7H6O22, 3, 64 |
 | |
|
| | | 3-hydroxybenzoic acid C7H6O32, 3, 64 |
 | |
|
| | | 3-hydroxybenzyl alcohol C7H8O22, 3, 64 |
 | |
|
| | | 3-hydroxyflavone C15H10O33, 64 |
 | | Compound Data | | Melting point | 170.75 °C | 443.90 K | | CSID | 10871 | H bond acceptors | 3 | Rule of 5 violations | 0 | | Molecular weight | 238.2381 | H bond donors | 1 | ACD/LogP | 3.76 | | Phase 25 °C | solid | Rotatable bonds | 2 | Predicted density | 1.37 g/cm3 | | SMILES | O=C1c3c(O/C(=C1/O)c2ccccc2)cccc3 | | STD InChIKey | HVQAJTFOCKOKIN-UHFFFAOYAX | | Melting Points | | mp °C | source | |
|---|
| 170.00 | Alfa Aesar | | 171.50 | PHYSPROP |
|
|
| | | 3-hydroxyphenylacetic acid C8H8O33, 64 |
 | | Compound Data | | Melting point | 131.00 °C | 404.15 K | | CSID | 11624 | H bond acceptors | 3 | Rule of 5 violations | 0 | | Molecular weight | 152.1473 | H bond donors | 2 | ACD/LogP | 0.77 | | Phase 25 °C | solid | Rotatable bonds | 3 | Predicted density | 1.32 g/cm3 | | SMILES | O=C(O)Cc1cc(O)ccc1 | | STD InChIKey | FVMDYYGIDFPZAX-UHFFFAOYAR | | Melting Points | | mp °C | source | |
|---|
| 130.00 | Alfa Aesar | | 132.00 | PHYSPROP |
|
|
| | | 3-hydroxypyridine C5H5NO3, 64 |
 | | Compound Data | | Melting point | 127.25 °C | 400.40 K | | CSID | 7683 | H bond acceptors | 2 | Rule of 5 violations | 0 | | Molecular weight | 95.0993 | H bond donors | 1 | ACD/LogP | 0.64 | | Phase 25 °C | solid | Rotatable bonds | 1 | Predicted density | 1.17 g/cm3 | | SMILES | Oc1cccnc1 | | STD InChIKey | GRFNBEZIAWKNCO-UHFFFAOYAT | | Melting Points | | mp °C | source | |
|---|
| 127.00 | Alfa Aesar | | 127.50 | PHYSPROP |
|
|
| | | 3-iodobenzaldehyde C7H5IO3, 7 |
 | | Compound Data | | Melting point | 57.00 °C | 330.15 K | | CSID | 221355 | H bond acceptors | 1 | Rule of 5 violations | 0 | | Molecular weight | 232.0185 | H bond donors | 0 | ACD/LogP | 2.87 | | Phase 25 °C | solid | Rotatable bonds | 1 | Predicted density | 1.88 g/cm3 | | SMILES | O=Cc1cc(I)ccc1 | | STD InChIKey | RZODAQZAFOBFLS-UHFFFAOYAZ | | Melting Points | | mp °C | source | |
|---|
| 56.00 | Alfa Aesar | | 58.00 | Beilstein F. K.; Beilsteins Handbuch der Organischen Chemie.... |
|
|
| | | 3-iodobenzoic acid C7H5IO22, 3, 64 |
 | |
|
| | | 3-iodopropionic acid C3H5IO23, 64 |
 | | Compound Data | | Melting point | 81.75 °C | 354.90 K | | CSID | 8524 | H bond acceptors | 2 | Rule of 5 violations | 0 | | Molecular weight | 199.9751 | H bond donors | 1 | ACD/LogP | 1.04 | | Phase 25 °C | solid | Rotatable bonds | 2 | Predicted density | 2.19 g/cm3 | | SMILES | ICCC(=O)O | | STD InChIKey | KMRNTNDWADEIIX-UHFFFAOYAY | | Melting Points | | mp °C | source | |
|---|
| 82.00 | Alfa Aesar | | 81.50 | PHYSPROP |
|
|
| | | 3-iodotoluene C7H7I3, 64 |
 | | Compound Data | | Melting point | -27.10 °C | 246.05 K | | CSID | 11765 | H bond acceptors | 0 | Rule of 5 violations | 0 | | Molecular weight | 218.0349 | H bond donors | 0 | ACD/LogP | 3.71 | | Phase 25 °C | liquid/gas | Rotatable bonds | 0 | Predicted density | 1.71 g/cm3 | | SMILES | Ic1cc(ccc1)C | | STD InChIKey | VLCPISYURGTGLP-UHFFFAOYAK | | Melting Points | | mp °C | source | |
|---|
| -27.00 | Alfa Aesar | | -27.20 | PHYSPROP |
|
|
| | | 3-isopropyl-2,4-dimethylpentane C10H224, 64 |
 | | Compound Data | | Melting point | -81.85 °C | 191.30 K | | CSID | 452568 | H bond acceptors | 0 | Rule of 5 violations | 1 | | Molecular weight | 142.2817 | H bond donors | 0 | ACD/LogP | 5.33 | | Phase 25 °C | liquid/gas | Rotatable bonds | 3 | Predicted density | 0.73 g/cm3 | | SMILES | CC(C)C(C(C)C)C(C)C | | STD InChIKey | YVYHOOYMDHZALB-UHFFFAOYAK | | Melting Points | | mp °C | source | |
|---|
| -82.00 | American Petroleum Institute. Research Project 44; Selected ... | | -81.70 | PHYSPROP |
|
|
| | | 3-methoxy-4-methylaniline C8H11NO3, 64 |
 | | Compound Data | | Melting point | 57.25 °C | 330.40 K | | CSID | 25942 | H bond acceptors | 2 | Rule of 5 violations | 0 | | Molecular weight | 137.179 | H bond donors | 2 | ACD/LogP | 1.29 | | Phase 25 °C | solid | Rotatable bonds | 2 | Predicted density | 1.04 g/cm3 | | SMILES | O(c1cc(ccc1C)N)C | | STD InChIKey | ONADZNBSLRAJFW-UHFFFAOYAC | | Melting Points | | mp °C | source | |
|---|
| 58.00 | Alfa Aesar | | 56.50 | PHYSPROP |
|
|
| | | 3-methoxyacetophenone C9H10O23, 19, 64 |
 | | Compound Data | | Melting point | -7.50 °C | 265.65 K | | CSID | 21111758 | H bond acceptors | 2 | Rule of 5 violations | 0 | | Molecular weight | 150.1745 | H bond donors | 0 | ACD/LogP | 1.84 | | Phase 25 °C | liquid/gas | Rotatable bonds | 2 | Predicted density | 1.03 g/cm3 | | SMILES | COc1cc(ccc1)C(C)=O | | STD InChIKey | BAYUSCHCCGXLAY-UHFFFAOYAB | | Melting Points | | mp °C | source | |
|---|
| -7.00 | Alfa Aesar | | -8.00 | Chemical Book | | Values not used in calculating the average melting point | | 95.50 | PHYSPROP1 | | 1. clearly out of range JCB |
|
|
| | | 3-methoxybenzamide C8H9NO22, 3, 64 |
 | |
|
| | | 3-methoxybenzhydrazide C8H10N2O23, 64 |
 | | Compound Data | | Melting point | 93.00 °C | 366.15 K | | CSID | 72141 | H bond acceptors | 4 | Rule of 5 violations | 0 | | Molecular weight | 166.1772 | H bond donors | 3 | ACD/LogP | 0.38 | | Phase 25 °C | solid | Rotatable bonds | 3 | Predicted density | 1.18 g/cm3 | | SMILES | O=C(c1cc(OC)ccc1)NN | | STD InChIKey | VMZSDAQEWPNOIB-UHFFFAOYAX | | Melting Points | | mp °C | source | |
|---|
| 92.00 | Alfa Aesar | | 94.00 | PHYSPROP |
|
|
| | | 3-methoxybenzoic acid C8H8O32, 3, 64 |
 | |
|
| | | 3-methoxycatechol C7H8O33, 64 |
 | | Compound Data | | Melting point | 42.40 °C | 315.55 K | | CSID | 13033 | H bond acceptors | 3 | Rule of 5 violations | 0 | | Molecular weight | 140.1366 | H bond donors | 2 | ACD/LogP | 0.70 | | Phase 25 °C | solid | Rotatable bonds | 3 | Predicted density | 1.27 g/cm3 | | SMILES | O(c1cccc(O)c1O)C | | STD InChIKey | LPYUENQFPVNPHY-UHFFFAOYAA | | Melting Points | | mp °C | source | |
|---|
| 42.00 | Alfa Aesar | | 42.80 | PHYSPROP |
|
|
| | | 3-methoxyphenylacetic acid C9H10O33, 64 |
 | | Compound Data | | Melting point | 71.00 °C | 344.15 K | | CSID | 14948 | H bond acceptors | 3 | Rule of 5 violations | 0 | | Molecular weight | 166.1739 | H bond donors | 1 | ACD/LogP | 1.42 | | Phase 25 °C | solid | Rotatable bonds | 3 | Predicted density | 1.18 g/cm3 | | SMILES | O=C(O)Cc1cc(OC)ccc1 | | STD InChIKey | LEGPZHPSIPPYIO-UHFFFAOYAY | | Melting Points | | mp °C | source | |
|---|
| 70.00 | Alfa Aesar | | 72.00 | PHYSPROP |
|
|
| | | 3-methyl-1-butanol C5H12O3, 61, 64 |
 | | Compound Data | | Melting point | -117.07 °C | 156.08 K | | CSID | 29000 | H bond acceptors | 1 | Rule of 5 violations | 0 | | Molecular weight | 88.1482 | H bond donors | 1 | ACD/LogP | 1.22 | | Phase 25 °C | liquid/gas | Rotatable bonds | 3 | Predicted density | 0.81 g/cm3 | | SMILES | OCCC(C)C | | STD InChIKey | PHTQWCKDNZKARW-UHFFFAOYAW | | Melting Points | | mp °C | source | |
|---|
| -117.00 | Alfa Aesar | | -117.00 | Oxford University MSDS | | -117.20 | PHYSPROP |
|
|
| | | 3-methyl-1-butene C5H104, 64 |
 | | Compound Data | | Melting point | -168.25 °C | 104.90 K | | CSID | 10765 | H bond acceptors | 0 | Rule of 5 violations | 0 | | Molecular weight | 70.1329 | H bond donors | 0 | ACD/LogP | 2.72 | | Phase 25 °C | liquid/gas | Rotatable bonds | 1 | Predicted density | 0.66 g/cm3 | | SMILES | C=C\C(C)C | | STD InChIKey | YHQXBTXEYZIYOV-UHFFFAOYAS | | Melting Points | | mp °C | source | |
|---|
| -168.00 | American Petroleum Institute. Research Project 44; Selected ... | | -168.50 | PHYSPROP |
|
|
| | | 3-methyl-2-butanone C5H10O3, 4, 64 |
 | |
|
| | | 3-methyl-2-nitrobenzoic acid C8H7NO43, 61 |
 | | Compound Data | | Melting point | 221.50 °C | 494.65 K | | CSID | 20277 | H bond acceptors | 5 | Rule of 5 violations | 0 | | Molecular weight | 181.1455 | H bond donors | 1 | ACD/LogP | 1.81 | | Phase 25 °C | solid | Rotatable bonds | 2 | Predicted density | 1.39 g/cm3 | | SMILES | Cc1cccc(c1[N+](=O)[O-])C(=O)O | | STD InChIKey | DGDAVTPQCQXLGU-UHFFFAOYAG | | Melting Points | | mp °C | source | |
|---|
| 222.00 | Alfa Aesar | | 221.00 | Oxford University MSDS |
|
|
| | | 3-methyl-2-phenylindole C15H13N48, 64 |
 | | Compound Data | | Melting point | 91.25 °C | 364.40 K | | CSID | 226885 | H bond acceptors | 1 | Rule of 5 violations | 1 | | Molecular weight | 207.2704 | H bond donors | 1 | ACD/LogP | 5.14 | | Phase 25 °C | solid | Rotatable bonds | 1 | Predicted density | 1.13 g/cm3 | | SMILES | c1cccc3c1c(c(c2ccccc2)n3)C | | STD InChIKey | KYAXCYQVBBQQHB-UHFFFAOYAF | | Melting Points | | mp °C | source | |
|---|
| 91.00 | Karthikeyan M.; Glen R.C.; Bender A. General melting point p... | | 91.50 | PHYSPROP |
|
|
| | | 3-methyl-2-pyrazolin-5-one C4H6N2O3, 64 |
 | | Compound Data | | Melting point | 221.50 °C | 494.65 K | | CSID | 7632 | H bond acceptors | 3 | Rule of 5 violations | 0 | | Molecular weight | 98.1032 | H bond donors | 1 | ACD/LogP | -1.08 | | Phase 25 °C | solid | Rotatable bonds | 0 | Predicted density | 1.33 g/cm3 | | SMILES | O=C1N/N=C(/C)C1 | | STD InChIKey | NHLAPJMCARJFOG-UHFFFAOYAZ | | Melting Points | | mp °C | source | |
|---|
| 222.00 | Alfa Aesar | | 221.00 | PHYSPROP |
|
|
| | | 3-methyl-2-pyridone C6H7NO3, 48, 64 |
 | |
|
| | | 3-methyl-2,5-furandione C5H4O33, 64 |
 | | Compound Data | | Melting point | 7.75 °C | 280.90 K | | CSID | 11517 | H bond acceptors | 3 | Rule of 5 violations | 0 | | Molecular weight | 112.0835 | H bond donors | 0 | ACD/LogP | 0.23 | | Phase 25 °C | liquid/gas | Rotatable bonds | 0 | Predicted density | 1.33 g/cm3 | | SMILES | O=C\1OC(=O)/C(=C/1)C | | STD InChIKey | AYKYXWQEBUNJCN-UHFFFAOYAM | | Melting Points | | mp °C | source | |
|---|
| 8.00 | Alfa Aesar | | 7.50 | PHYSPROP |
|
|
| | | 3-methyl-3-ethylpentane C8H184, 64 |
 | | Compound Data | | Melting point | -90.95 °C | 182.20 K | | CSID | 13400 | H bond acceptors | 0 | Rule of 5 violations | 0 | | Molecular weight | 114.2285 | H bond donors | 0 | ACD/LogP | 4.64 | | Phase 25 °C | liquid/gas | Rotatable bonds | 3 | Predicted density | 0.71 g/cm3 | | SMILES | CC(CC)(CC)CC | | STD InChIKey | GIEZWIDCIFCQPS-UHFFFAOYAZ | | Melting Points | | mp °C | source | |
|---|
| -91.00 | American Petroleum Institute. Research Project 44; Selected ... | | -90.90 | PHYSPROP |
|
|
| | | 3-methyl-3-pentanol C6H14O4, 64 |
 | | Compound Data | | Melting point | -23.80 °C | 249.35 K | | CSID | 6248 | H bond acceptors | 1 | Rule of 5 violations | 0 | | Molecular weight | 102.1748 | H bond donors | 1 | ACD/LogP | 1.57 | | Phase 25 °C | liquid/gas | Rotatable bonds | 3 | Predicted density | 0.82 g/cm3 | | SMILES | OC(C)(CC)CC | | STD InChIKey | FRDAATYAJDYRNW-UHFFFAOYAV | | Melting Points | | mp °C | source | |
|---|
| -24.00 | American Petroleum Institute. Research Project 44; Selected ... | | -23.60 | PHYSPROP |
|
|
| | | 3-methylbenzoic acid C8H8O22, 3, 61, 64 |
 | |
|
| | | 3-methylbiphenyl C13H123, 4, 64 |
 | |
|
| | | 3-methylcatechol C7H8O23, 64 |
 | | Compound Data | | Melting point | 66.50 °C | 339.65 K | | CSID | 333 | H bond acceptors | 2 | Rule of 5 violations | 0 | | Molecular weight | 124.1372 | H bond donors | 2 | ACD/LogP | 1.34 | | Phase 25 °C | solid | Rotatable bonds | 2 | Predicted density | 1.21 g/cm3 | | SMILES | Oc1c(cccc1O)C | | STD InChIKey | PGSWEKYNAOWQDF-UHFFFAOYAB | | Melting Points | | mp °C | source | |
|---|
| 65.00 | Alfa Aesar | | 68.00 | PHYSPROP |
|
|
| | | 3-methylcholanthrene C21H1644, 61, 64 |
 | |
|
| | | 3-methylglutaric acid C6H10O43, 64 |
 | | Compound Data | | Melting point | 86.50 °C | 359.65 K | | CSID | 11781 | H bond acceptors | 4 | Rule of 5 violations | 0 | | Molecular weight | 146.1412 | H bond donors | 2 | ACD/LogP | -0.69 | | Phase 25 °C | solid | Rotatable bonds | 4 | Predicted density | 1.25 g/cm3 | | SMILES | O=C(O)CC(C)CC(=O)O | | STD InChIKey | XJMMNTGIMDZPMU-UHFFFAOYAU | | Melting Points | | mp °C | source | |
|---|
| 86.00 | Alfa Aesar | | 87.00 | PHYSPROP |
|
|
| | | 3-methylindole C9H9N3, 61, 64 |
 | | Compound Data | | Melting point | 96.17 °C | 369.32 K | | CSID | 6480 | H bond acceptors | 1 | Rule of 5 violations | 0 | | Molecular weight | 131.1745 | H bond donors | 1 | ACD/LogP | 2.60 | | Phase 25 °C | solid | Rotatable bonds | 0 | Predicted density | 1.11 g/cm3 | | SMILES | c1cccc2c1c(cn2)C | | STD InChIKey | ZFRKQXVRDFCRJG-UHFFFAOYAZ | | Melting Points | | mp °C | source | |
|---|
| 96.00 | Alfa Aesar | | 95.00 | Oxford University MSDS | | 97.50 | PHYSPROP |
|
|
| | | 3-methylisoquinoline C10H9N48, 64 |
 | | Compound Data | | Melting point | 65.50 °C | 338.65 K | | CSID | 13668 | H bond acceptors | 1 | Rule of 5 violations | 0 | | Molecular weight | 143.1852 | H bond donors | 0 | ACD/LogP | 2.42 | | Phase 25 °C | solid | Rotatable bonds | 0 | Predicted density | 1.08 g/cm3 | | SMILES | n2c(cc1c(cccc1)c2)C | | STD InChIKey | FVVXWRGARUACNW-UHFFFAOYAG | | Melting Points | | mp °C | source | |
|---|
| 63.00 | Karthikeyan M.; Glen R.C.; Bender A. General melting point p... | | 68.00 | PHYSPROP |
|
|
| | | 3-methylphenol C7H8O3, 31, 32, 61, 64 |
 | |
|
| | | 3-methylquinoline C10H9N3, 64 |
 | | Compound Data | | Melting point | 15.75 °C | 288.90 K | | CSID | 11432 | H bond acceptors | 1 | Rule of 5 violations | 0 | | Molecular weight | 143.1852 | H bond donors | 0 | ACD/LogP | 2.54 | | Phase 25 °C | liquid/gas | Rotatable bonds | 0 | Predicted density | 1.08 g/cm3 | | SMILES | n1cc(cc2ccccc12)C | | STD InChIKey | DTBDAFLSBDGPEA-UHFFFAOYAE | | Melting Points | | mp °C | source | |
|---|
| 15.00 | Alfa Aesar | | 16.50 | PHYSPROP |
|
|
| | | 3-methylsalicylic acid C8H8O33, 64 |
 | | Compound Data | | Melting point | 165.25 °C | 438.40 K | | CSID | 6482 | H bond acceptors | 3 | Rule of 5 violations | 0 | | Molecular weight | 152.1473 | H bond donors | 2 | ACD/LogP | 2.52 | | Phase 25 °C | solid | Rotatable bonds | 2 | Predicted density | 1.30 g/cm3 | | SMILES | O=C(O)c1cccc(c1O)C | | STD InChIKey | WHSXTWFYRGOBGO-UHFFFAOYAV | | Melting Points | | mp °C | source | |
|---|
| 165.00 | Alfa Aesar | | 165.50 | PHYSPROP |
|
|
| | | 3-methylstyrene C9H103, 4, 64 |
 | |
|
| | | 3-nitro-anisole C7H7NO32, 64 |
 | | Compound Data | | Melting point | 38.25 °C | 311.40 K | | CSID | 21170967 | H bond acceptors | 4 | Rule of 5 violations | 0 | | Molecular weight | 153.1354 | H bond donors | 0 | ACD/LogP | 2.17 | | Phase 25 °C | solid | Rotatable bonds | 2 | Predicted density | 1.22 g/cm3 | | SMILES | COc1cccc(c1)[N+]([O-])=O | | STD InChIKey | WGYFINWERLNPHR-UHFFFAOYAD | | Melting Points | | mp °C | source | |
|---|
| 38.00 | Aldrich Chemical Company; Aldrich Catalog-Handbook of Fine C... | | 38.50 | PHYSPROP |
|
|
| | | 3-nitroacetanilide C8H8N2O33, 64 |
 | | Compound Data | | Melting point | 153.50 °C | 426.65 K | | CSID | 28947 | H bond acceptors | 5 | Rule of 5 violations | 0 | | Molecular weight | 180.1607 | H bond donors | 1 | ACD/LogP | 1.47 | | Phase 25 °C | solid | Rotatable bonds | 2 | Predicted density | 1.34 g/cm3 | | SMILES | O=C(Nc1cccc(c1)[N+]([O-])=O)C | | STD InChIKey | KFTYNYHJHKCRKU-UHFFFAOYAG | | Melting Points | | mp °C | source | |
|---|
| 152.00 | Alfa Aesar | | 155.00 | PHYSPROP |
|
|
| | | 3-nitroacetophenone C8H7NO32, 3, 61, 64 |
 | |
|
| | | 3-nitroaniline C6H6N2O22, 3, 64, 72 |
 | |
|
| | | 3-nitrobenzaldehyde C7H5NO32, 3, 64 |
 | |
|
| | | 3-nitrobenzamide C7H6N2O33, 7, 64 |
 | |
|
| | | 3-nitrobenzenesulfonyl chloride C6H4ClNO4S3, 47 |
 | | Compound Data | | Melting point | 60.92 °C | 334.07 K | | CSID | 8163 | H bond acceptors | 5 | Rule of 5 violations | 0 | | Molecular weight | 221.6183 | H bond donors | 0 | ACD/LogP | 2.21 | | Phase 25 °C | solid | Rotatable bonds | 2 | Predicted density | 1.61 g/cm3 | | SMILES | O=S(Cl)(=O)c1cc([N+]([O-])=O)ccc1 | | STD InChIKey | MWWNNNAOGWPTQY-UHFFFAOYAO | | Melting Points | | mp °C | source | |
|---|
| 61.00 | Alfa Aesar | | 60.85 | IUCr |
|
|
| | | 3-nitrobenzoic acid C7H5NO42, 3, 61, 64 |
 | |
|
| | | 3-nitrobenzonitrile C7H4N2O22, 3, 64 |
 | |
|
| | | 3-nitrobenzotrifluoride C7H4F3NO23, 64 |
 | | Compound Data | | Melting point | -3.70 °C | 269.45 K | | CSID | 7108 | H bond acceptors | 3 | Rule of 5 violations | 0 | | Molecular weight | 191.1074 | H bond donors | 0 | ACD/LogP | 2.62 | | Phase 25 °C | liquid/gas | Rotatable bonds | 1 | Predicted density | 1.42 g/cm3 | | SMILES | FC(F)(F)c1cccc([N+]([O-])=O)c1 | | STD InChIKey | WHNAMGUAXHGCHH-UHFFFAOYAT | | Melting Points | | mp °C | source | |
|---|
| -5.00 | Alfa Aesar | | -2.40 | PHYSPROP |
|
|
| | | 3-nitrobenzoyl chloride C7H4ClNO33, 64 |
 | | Compound Data | | Melting point | 34.50 °C | 307.65 K | | CSID | 8181 | H bond acceptors | 4 | Rule of 5 violations | 0 | | Molecular weight | 185.5646 | H bond donors | 0 | ACD/LogP | 2.12 | | Phase 25 °C | solid | Rotatable bonds | 2 | Predicted density | 1.45 g/cm3 | | SMILES | O=[N+]([O-])c1cc(C(Cl)=O)ccc1 | | STD InChIKey | NXTNASSYJUXJDV-UHFFFAOYAW | | Melting Points | | mp °C | source | |
|---|
| 33.00 | Alfa Aesar | | 36.00 | PHYSPROP |
|
|
| | | 3-nitrobenzyl alcohol C7H7NO32, 3, 64 |
 | |
|
| | | 3-nitrobenzyl alcohol C7H5NO53, 64 |
 | | Compound Data | | Melting point | 232.00 °C | 505.15 K | | CSID | 62477 | H bond acceptors | 6 | Rule of 5 violations | 0 | | Molecular weight | 183.1183 | H bond donors | 2 | ACD/LogP | 1.99 | | Phase 25 °C | solid | Rotatable bonds | 3 | Predicted density | 1.63 g/cm3 | | SMILES | O=[N+]([O-])c1ccc(cc1O)C(=O)O | | STD InChIKey | XLDLRRGZWIEEHT-UHFFFAOYAO | | Melting Points | | mp °C | source | |
|---|
| 234.00 | Alfa Aesar | | 230.00 | PHYSPROP |
|
|
| | | 3-nitrobenzyl bromide C7H6BrNO22, 3, 64 |
 | |
|
| | | 3-nitrobenzyl chloride C7H6ClNO22, 3, 64 |
 | |
|
| | | 3-nitrobiphenyl C12H9NO23, 7, 64 |
 | |
|
| | | 3-nitrophenol C6H5NO32, 3, 61, 64, 72, 72 |
 | |
|
| | | 3-nitrophenyl isocyanate C7H4N2O33, 64 |
 | | Compound Data | | Melting point | 51.50 °C | 324.65 K | | CSID | 69290 | H bond acceptors | 5 | Rule of 5 violations | 0 | | Molecular weight | 164.1183 | H bond donors | 0 | ACD/LogP | 2.49 | | Phase 25 °C | solid | Rotatable bonds | 2 | Predicted density | 1.32 g/cm3 | | SMILES | O=C=N\c1cccc(c1)[N+]([O-])=O | | STD InChIKey | GFFGYTMCNVMFAJ-UHFFFAOYAM | | Melting Points | | mp °C | source | |
|---|
| 52.00 | Alfa Aesar | | 51.00 | PHYSPROP |
|
|
| | | 3-nitrophenylacetic acid C8H7NO43, 7, 64 |
 | |
|
| | | 3-nitrophthalic acid C8H5NO648, 61 |
 | |
|
| | | 3-nitrophthalimide C8H4N2O43, 64 |
 | | Compound Data | | Melting point | 216.50 °C | 489.65 K | | CSID | 11286 | H bond acceptors | 6 | Rule of 5 violations | 0 | | Molecular weight | 192.1284 | H bond donors | 1 | ACD/LogP | 0.88 | | Phase 25 °C | solid | Rotatable bonds | 1 | Predicted density | 1.61 g/cm3 | | SMILES | [O-][N+](=O)c1cccc2c1C(=O)NC2=O | | STD InChIKey | BONIIQYTWOPUQI-UHFFFAOYAD | | Melting Points | | mp °C | source | |
|---|
| 219.00 | Alfa Aesar | | 214.00 | PHYSPROP |
|
|
| | | 3-nitropropanoic acid C3H5NO461, 64 |
 | | Compound Data | | Melting point | 63.00 °C | 336.15 K | | CSID | 1615 | H bond acceptors | 5 | Rule of 5 violations | 0 | | Molecular weight | 119.0761 | H bond donors | 1 | ACD/LogP | 0.00 | | Phase 25 °C | solid | Rotatable bonds | 3 | Predicted density | 1.39 g/cm3 | | SMILES | C(C[N+](=O)[O-])C(=O)O | | STD InChIKey | WBLZUCOIBUDNBV-UHFFFAOYAZ | | Melting Points | | mp °C | source | |
|---|
| 64.00 | Oxford University MSDS | | 62.00 | PHYSPROP |
|
|
| | | 3-octyne C8H143, 4, 64 |
 | |
|
| | | 3-pentanethiol C5H12S4, 64 |
 | | Compound Data | | Melting point | -110.90 °C | 162.25 K | | CSID | 62433 | H bond acceptors | 0 | Rule of 5 violations | 0 | | Molecular weight | 104.2138 | H bond donors | 0 | ACD/LogP | 2.66 | | Phase 25 °C | liquid/gas | Rotatable bonds | 3 | Predicted density | 0.83 g/cm3 | | SMILES | SC(CC)CC | | STD InChIKey | WICKAMSPKJXSGN-UHFFFAOYAR | | Melting Points | | mp °C | source | |
|---|
| -111.00 | American Petroleum Institute. Research Project 44; Selected ... | | -110.80 | PHYSPROP |
|
|
| | | 3-pentanone C5H10O3, 4, 61, 64 |
 | |
|
| | | 3-phenoxyaniline C12H11NO3, 64 |
 | | Compound Data | | Melting point | 36.50 °C | 309.65 K | | CSID | 21170956 | H bond acceptors | 2 | Rule of 5 violations | 0 | | Molecular weight | 185.2218 | H bond donors | 2 | ACD/LogP | 2.63 | | Phase 25 °C | solid | Rotatable bonds | 3 | Predicted density | 1.14 g/cm3 | | SMILES | Nc2cccc(Oc1ccccc1)c2 | | STD InChIKey | UCSYVYFGMFODMY-UHFFFAOYAB | | Melting Points | | mp °C | source | |
|---|
| 36.00 | Alfa Aesar | | 37.00 | PHYSPROP |
|
|
| | | 3-phenoxybenzoic acid C13H10O33, 64 |
 | | Compound Data | | Melting point | 148.75 °C | 421.90 K | | CSID | 18409 | H bond acceptors | 3 | Rule of 5 violations | 0 | | Molecular weight | 214.2167 | H bond donors | 1 | ACD/LogP | 3.91 | | Phase 25 °C | solid | Rotatable bonds | 3 | Predicted density | 1.24 g/cm3 | | SMILES | O=C(O)c2cc(Oc1ccccc1)ccc2 | | STD InChIKey | NXTDJHZGHOFSQG-UHFFFAOYAC | | Melting Points | | mp °C | source | |
|---|
| 148.00 | Alfa Aesar | | 149.50 | PHYSPROP |
|
|
| | | 3-phenoxybenzyl alcohol C13H12O23, 61 |
 | | Compound Data | | Melting point | 8.00 °C | 281.15 K | | CSID | 24499 | H bond acceptors | 2 | Rule of 5 violations | 0 | | Molecular weight | 200.2332 | H bond donors | 1 | ACD/LogP | 3.03 | | Phase 25 °C | liquid/gas | Rotatable bonds | 4 | Predicted density | 1.15 g/cm3 | | SMILES | O(c1ccccc1)c2cc(ccc2)CO | | STD InChIKey | KGANAERDZBAECK-UHFFFAOYAU | | Melting Points | | mp °C | source | |
|---|
| 6.00 | Alfa Aesar | | 10.00 | Oxford University MSDS |
|
|
| | | 3-phenoxypropionic acid C9H10O33, 64 |
 | | Compound Data | | Melting point | 97.75 °C | 370.90 K | | CSID | 73626 | H bond acceptors | 3 | Rule of 5 violations | 0 | | Molecular weight | 166.1739 | H bond donors | 1 | ACD/LogP | 1.63 | | Phase 25 °C | solid | Rotatable bonds | 4 | Predicted density | 1.18 g/cm3 | | SMILES | O=C(O)CCOc1ccccc1 | | STD InChIKey | BUSOTUQRURCMCM-UHFFFAOYAR | | Melting Points | | mp °C | source | |
|---|
| 98.00 | Alfa Aesar | | 97.50 | PHYSPROP |
|
|
| | | 3-phenylpropionyl chloride C9H9ClO3, 64 |
 | | Compound Data | | Melting point | -4.50 °C | 268.65 K | | CSID | 58333 | H bond acceptors | 1 | Rule of 5 violations | 0 | | Molecular weight | 168.6202 | H bond donors | 0 | ACD/LogP | 2.65 | | Phase 25 °C | liquid/gas | Rotatable bonds | 3 | Predicted density | 1.15 g/cm3 | | SMILES | ClC(=O)CCc1ccccc1 | | STD InChIKey | MFEILWXBDBCWKF-UHFFFAOYAM | | Melting Points | | mp °C | source | |
|---|
| -7.00 | Alfa Aesar | | -2.00 | PHYSPROP |
|
|
| | | 3-picoline C6H7N3, 32, 64 |
 | | Compound Data | | Melting point | -18.07 °C | 255.08 K | | CSID | 21106520 | H bond acceptors | 1 | Rule of 5 violations | 0 | | Molecular weight | 93.1265 | H bond donors | 0 | ACD/LogP | 1.34 | | Phase 25 °C | liquid/gas | Rotatable bonds | 0 | Predicted density | 0.94 g/cm3 | | SMILES | Cc1cccnc1 | | STD InChIKey | ITQTTZVARXURQS-UHFFFAOYAH | | Melting Points | | mp °C | source | |
|---|
| -18.00 | Alfa Aesar | | -18.10 | DrugBank | | -18.10 | PHYSPROP |
|
|
| | | 3-picoline n-oxide C6H7NO3, 64 |
 | | Compound Data | | Melting point | 38.50 °C | 311.65 K | | CSID | 13258 | H bond acceptors | 2 | Rule of 5 violations | 0 | | Molecular weight | 109.1259 | H bond donors | 0 | ACD/LogP | -0.74 | | Phase 25 °C | solid | Rotatable bonds | 0 | Predicted density | 1.01 g/cm3 | | SMILES | [O-][n+]1cccc(c1)C | | STD InChIKey | DMGGLIWGZFZLIY-UHFFFAOYAT | | Melting Points | | mp °C | source | |
|---|
| 38.00 | Alfa Aesar | | 39.00 | PHYSPROP |
|
|
| | | 3-piperidinemethanol C6H13NO3, 64 |
 | | Compound Data | | Melting point | 60.50 °C | 333.65 K | | CSID | 96573 | H bond acceptors | 2 | Rule of 5 violations | 0 | | Molecular weight | 115.1735 | H bond donors | 2 | ACD/LogP | -0.28 | | Phase 25 °C | solid | Rotatable bonds | 2 | Predicted density | 0.95 g/cm3 | | SMILES | OCC1CCCNC1 | | STD InChIKey | VUNPWIPIOOMCPT-UHFFFAOYAZ | | Melting Points | | mp °C | source | |
|---|
| 60.00 | Alfa Aesar | | 61.00 | PHYSPROP |
|
|
| | | 3-pyridylmethylamine C6H8N23, 64 |
 | | Compound Data | | Melting point | -21.05 °C | 252.10 K | | CSID | 28777 | H bond acceptors | 2 | Rule of 5 violations | 0 | | Molecular weight | 108.1411 | H bond donors | 2 | ACD/LogP | -0.40 | | Phase 25 °C | liquid/gas | Rotatable bonds | 2 | Predicted density | 1.05 g/cm3 | | SMILES | n1cccc(c1)CN | | STD InChIKey | HDOUGSFASVGDCS-UHFFFAOYAI | | Melting Points | | mp °C | source | |
|---|
| -21.00 | Alfa Aesar | | -21.10 | PHYSPROP |
|
|
| | | 3-t-butylphenol C10H14O3, 31, 64 |
 | |
|
| | | 3-t-butyltoluene C11H163, 4, 64 |
 | |
|
| | | 3-thiaheptane C6H14S4, 64 |
 | | Compound Data | | Melting point | -95.05 °C | 178.10 K | | CSID | 12011 | H bond acceptors | 0 | Rule of 5 violations | 0 | | Molecular weight | 118.2404 | H bond donors | 0 | ACD/LogP | 3.01 | | Phase 25 °C | liquid/gas | Rotatable bonds | 4 | Predicted density | 0.83 g/cm3 | | SMILES | S(CC)CCCC | | STD InChIKey | XJIRSLHMKBUGMR-UHFFFAOYAK | | Melting Points | | mp °C | source | |
|---|
| -95.00 | American Petroleum Institute. Research Project 44; Selected ... | | -95.10 | PHYSPROP |
|
|
| | | 3-undecanone C11H22O2, 3, 64 |
 | |
|
| | | 3-vinylbenzoic acid C9H8O23, 7 |
 | | Compound Data | | Melting point | 95.50 °C | 368.65 K | | CSID | 3637837 | H bond acceptors | 2 | Rule of 5 violations | 0 | | Molecular weight | 148.1586 | H bond donors | 1 | ACD/LogP | 2.38 | | Phase 25 °C | solid | Rotatable bonds | 2 | Predicted density | 1.16 g/cm3 | | SMILES | O=C(O)c1cccc(\C=C)c1 | | STD InChIKey | VWXZFDWVWMQRQR-UHFFFAOYAJ | | Melting Points | | mp °C | source | |
|---|
| 95.00 | Alfa Aesar | | 96.00 | Beilstein F. K.; Beilsteins Handbuch der Organischen Chemie.... |
|
|
| | | 3,3-diethylpentane C9H204, 64 |
 | | Compound Data | | Melting point | -33.05 °C | 240.10 K | | CSID | 13402 | H bond acceptors | 0 | Rule of 5 violations | 1 | | Molecular weight | 128.2551 | H bond donors | 0 | ACD/LogP | 5.17 | | Phase 25 °C | liquid/gas | Rotatable bonds | 4 | Predicted density | 0.72 g/cm3 | | SMILES | CCC(CC)(CC)CC | | STD InChIKey | BGXXXYLRPIRDHJ-UHFFFAOYAE | | Melting Points | | mp °C | source | |
|---|
| -33.00 | American Petroleum Institute. Research Project 44; Selected ... | | -33.10 | PHYSPROP |
|
|
| | | 3,3-dimethyl-1-butene C6H123, 4, 64 |
 | |
|
| | | 3,3-dimethyl-1-pentene C7H144, 64 |
 | | Compound Data | | Melting point | -134.15 °C | 139.00 K | | CSID | 17801 | H bond acceptors | 0 | Rule of 5 violations | 0 | | Molecular weight | 98.1861 | H bond donors | 0 | ACD/LogP | 3.60 | | Phase 25 °C | liquid/gas | Rotatable bonds | 2 | Predicted density | 0.70 g/cm3 | | SMILES | C=C\C(C)(C)CC | | STD InChIKey | TXBZITDWMURSEF-UHFFFAOYAV | | Melting Points | | mp °C | source | |
|---|
| -134.00 | American Petroleum Institute. Research Project 44; Selected ... | | -134.30 | PHYSPROP |
|
|
| | | 3,3-dimethylbutyric acid C6H12O23, 64 |
 | | Compound Data | | Melting point | 6.25 °C | 279.40 K | | CSID | 13438 | H bond acceptors | 2 | Rule of 5 violations | 0 | | Molecular weight | 116.1583 | H bond donors | 1 | ACD/LogP | 1.47 | | Phase 25 °C | liquid/gas | Rotatable bonds | 2 | Predicted density | 0.95 g/cm3 | | SMILES | O=C(O)CC(C)(C)C | | STD InChIKey | MLMQPDHYNJCQAO-UHFFFAOYAR | | Melting Points | | mp °C | source | |
|---|
| 6.00 | Alfa Aesar | | 6.50 | PHYSPROP |
|
|
| | | 3,3-dimethylglutaric acid C7H12O43, 64 |
 | | Compound Data | | Melting point | 102.25 °C | 375.40 K | | CSID | 19739 | H bond acceptors | 4 | Rule of 5 violations | 0 | | Molecular weight | 160.1678 | H bond donors | 2 | ACD/LogP | -0.34 | | Phase 25 °C | solid | Rotatable bonds | 4 | Predicted density | 1.20 g/cm3 | | SMILES | O=C(O)CC(C)(CC(=O)O)C | | STD InChIKey | DUHQIGLHYXLKAE-UHFFFAOYAV | | Melting Points | | mp °C | source | |
|---|
| 101.00 | Alfa Aesar | | 103.50 | PHYSPROP |
|
|
| | | 3,3-dimethylhexane C8H184, 64 |
 | | Compound Data | | Melting point | -126.05 °C | 147.10 K | | CSID | 10759 | H bond acceptors | 0 | Rule of 5 violations | 0 | | Molecular weight | 114.2285 | H bond donors | 0 | ACD/LogP | 4.64 | | Phase 25 °C | liquid/gas | Rotatable bonds | 3 | Predicted density | 0.71 g/cm3 | | SMILES | CC(C)(CC)CCC | | STD InChIKey | KUMXLFIBWFCMOJ-UHFFFAOYAZ | | Melting Points | | mp °C | source | |
|---|
| -126.00 | American Petroleum Institute. Research Project 44; Selected ... | | -126.10 | PHYSPROP |
|
|
| | | 3,3-dimethylpentane C7H163, 4, 64 |
 | |
|
| | | 3,3'-dimethoxybiphenyl-4,4'-diamine C14H16N2O23, 64 |
 | | Compound Data | | Melting point | 136.50 °C | 409.65 K | | CSID | 8104 | H bond acceptors | 4 | Rule of 5 violations | 0 | | Molecular weight | 244.289 | H bond donors | 4 | ACD/LogP | 1.57 | | Phase 25 °C | solid | Rotatable bonds | 5 | Predicted density | 1.18 g/cm3 | | SMILES | O(c1cc(ccc1N)c2ccc(N)c(OC)c2)C | | STD InChIKey | JRBJSXQPQWSCCF-UHFFFAOYAM | | Melting Points | | mp °C | source | |
|---|
| 136.00 | Alfa Aesar | | 137.00 | PHYSPROP |
|
|
| | | 3,3'-dimethyl-4,4'-biphenyldiamine C14H16N23, 64 |
 | | Compound Data | | Melting point | 130.75 °C | 403.90 K | | CSID | 8106 | H bond acceptors | 2 | Rule of 5 violations | 0 | | Molecular weight | 212.2902 | H bond donors | 4 | ACD/LogP | 2.48 | | Phase 25 °C | solid | Rotatable bonds | 3 | Predicted density | 1.11 g/cm3 | | SMILES | c2(c1ccc(N)c(c1)C)ccc(N)c(c2)C | | STD InChIKey | NUIURNJTPRWVAP-UHFFFAOYAK | | Melting Points | | mp °C | source | |
|---|
| 130.00 | Alfa Aesar | | 131.50 | PHYSPROP |
|
|
| | | 3,3'-dimethylbiphenyl C14H144, 64 |
 | | Compound Data | | Melting point | 8.00 °C | 281.15 K | | CSID | 11437 | H bond acceptors | 0 | Rule of 5 violations | 0 | | Molecular weight | 182.261 | H bond donors | 0 | ACD/LogP | 4.90 | | Phase 25 °C | liquid/gas | Rotatable bonds | 1 | Predicted density | 0.97 g/cm3 | | SMILES | c2c(c1cccc(c1)C)cccc2C | | STD InChIKey | GVEDOIATHPCYGS-UHFFFAOYAW | | Melting Points | | mp °C | source | |
|---|
| 7.00 | American Petroleum Institute. Research Project 44; Selected ... | | 9.00 | PHYSPROP |
|
|
| | | 3,4-diaminopyridine C5H7N33, 64, 64, 72 |
 | | Compound Data | | Melting point | 218.50 °C | 491.65 K | | CSID | 5705 | H bond acceptors | 3 | Rule of 5 violations | 0 | | Molecular weight | 109.1292 | H bond donors | 4 | ACD/LogP | -0.09 | | Phase 25 °C | solid | Rotatable bonds | 2 | Predicted density | 1.25 g/cm3 | | SMILES | c1cncc(c1N)N | | STD InChIKey | OYTKINVCDFNREN-UHFFFAOYAR | | Melting Points | | mp °C | source | |
|---|
| 219.00 | Alfa Aesar | | 220.00 | PHYSPROP | | 216.50 | Sigma-Aldrich | | Values not used in calculating the average melting point | | 120.80 | PHYSPROP1 | | 1. clearly out of range JCB |
|
|
| | | 3,4-dibromothiophene C4H2Br2S3, 64 |
 | | Compound Data | | Melting point | 4.75 °C | 277.90 K | | CSID | 17428 | H bond acceptors | 0 | Rule of 5 violations | 0 | | Molecular weight | 241.9317 | H bond donors | 0 | ACD/LogP | 3.21 | | Phase 25 °C | liquid/gas | Rotatable bonds | 0 | Predicted density | 2.17 g/cm3 | | SMILES | Brc1cscc1Br | | STD InChIKey | VGKLVWTVCUDISO-UHFFFAOYAN | | Melting Points | | mp °C | source | |
|---|
| 5.00 | Alfa Aesar | | 4.50 | PHYSPROP |
|
|
| | | 3,4-dichloroacetophenone C8H6Cl2O2, 3, 64 |
 | |
|
| | | 3,4-dichlorobenzaldehyde C7H4Cl2O2, 3, 64 |
 | |
|
| | | 3,4-dichlorobenzoic acid C7H4Cl2O22, 3 |
 | | Compound Data | | Melting point | 207.50 °C | 480.65 K | | CSID | 5612 | H bond acceptors | 2 | Rule of 5 violations | 0 | | Molecular weight | 191.0115 | H bond donors | 1 | ACD/LogP | 3.53 | | Phase 25 °C | solid | Rotatable bonds | 1 | Predicted density | 1.52 g/cm3 | | SMILES | Clc1ccc(C(=O)O)cc1Cl | | STD InChIKey | VPHHJAOJUJHJKD-UHFFFAOYAX | | Melting Points | | mp °C | source | |
|---|
| 208.00 | Aldrich Chemical Company; Aldrich Catalog-Handbook of Fine C... | | 207.00 | Alfa Aesar |
|
|
| | | 3,4-dichlorobenzotrifluoride C7H3Cl2F33, 64 |
 | | Compound Data | | Melting point | -12.25 °C | 260.90 K | | CSID | 9109 | H bond acceptors | 0 | Rule of 5 violations | 0 | | Molecular weight | 214.9999 | H bond donors | 0 | ACD/LogP | 4.12 | | Phase 25 °C | liquid/gas | Rotatable bonds | 0 | Predicted density | 1.46 g/cm3 | | SMILES | Clc1ccc(cc1Cl)C(F)(F)F | | STD InChIKey | XILPLWOGHPSJBK-UHFFFAOYAR | | Melting Points | | mp °C | source | |
|---|
| -12.00 | Alfa Aesar | | -12.50 | PHYSPROP |
|
|
| | | 3,4-dichlorobenzyl alcohol C7H6Cl2O3, 64 |
 | | Compound Data | | Melting point | 37.00 °C | 310.15 K | | CSID | 14956 | H bond acceptors | 1 | Rule of 5 violations | 0 | | Molecular weight | 177.0279 | H bond donors | 1 | ACD/LogP | 2.10 | | Phase 25 °C | solid | Rotatable bonds | 2 | Predicted density | 1.39 g/cm3 | | SMILES | Clc1ccc(cc1Cl)CO | | STD InChIKey | FVJIUQSKXOYFKG-UHFFFAOYAY | | Melting Points | | mp °C | source | |
|---|
| 38.00 | Alfa Aesar | | 36.00 | PHYSPROP |
|
|
| | | 3,4-dichlorophenol C6H4Cl2O2, 3, 28, 61, 64, 72 |
 | |
|
| | | 3,4-dichlorophenyl isocyanate C7H3Cl2NO3, 64 |
 | | Compound Data | | Melting point | 42.50 °C | 315.65 K | | CSID | 7325 | H bond acceptors | 2 | Rule of 5 violations | 0 | | Molecular weight | 188.0108 | H bond donors | 0 | ACD/LogP | 4.01 | | Phase 25 °C | solid | Rotatable bonds | 1 | Predicted density | 1.37 g/cm3 | | SMILES | Clc1ccc(/N=C=O)cc1Cl | | STD InChIKey | MFUVCHZWGSJKEQ-UHFFFAOYAC | | Melting Points | | mp °C | source | |
|---|
| 42.00 | Alfa Aesar | | 43.00 | PHYSPROP |
|
|
| | | 3,4-dichlorotoluene C7H6Cl23, 31, 64 |
 | |
|
| | | 3,4-dihydroxybenzaldehyde C7H6O32, 3, 61 |
 | |
|
| | | 3,4-dihydroxyphenylacetic acid C8H8O43, 32, 64 |
 | | Compound Data | | Melting point | 128.67 °C | 401.82 K | | CSID | 532 | H bond acceptors | 4 | Rule of 5 violations | 0 | | Molecular weight | 168.1467 | H bond donors | 3 | ACD/LogP | 0.17 | | Phase 25 °C | solid | Rotatable bonds | 4 | Predicted density | 1.48 g/cm3 | | SMILES | O=C(O)Cc1cc(O)c(O)cc1 | | STD InChIKey | CFFZDZCDUFSOFZ-UHFFFAOYAU | | Melting Points | | mp °C | source | |
|---|
| 129.00 | Alfa Aesar | | 128.50 | DrugBank | | 128.50 | PHYSPROP |
|
|
| | | 3,4-dimethoxyacetophenone C10H12O32, 3, 64 |
 | |
|
| | | 3,4-dimethoxybenzoic acid C9H10O43, 61, 64, 64 |
 | | Compound Data | | Melting point | 180.50 °C | 453.65 K | | CSID | 6854 | H bond acceptors | 4 | Rule of 5 violations | 0 | | Molecular weight | 182.1733 | H bond donors | 1 | ACD/LogP | 1.39 | | Phase 25 °C | solid | Rotatable bonds | 3 | Predicted density | 1.22 g/cm3 | | SMILES | COc1ccc(cc1OC)C(=O)O | | STD InChIKey | DAUAQNGYDSHRET-UHFFFAOYAJ | | Melting Points | | mp °C | source | |
|---|
| 181.00 | Alfa Aesar | | 180.00 | Oxford University MSDS | | 181.00 | PHYSPROP | | 180.00 | PHYSPROP |
|
|
| | | 3,4-dimethoxyphenol C8H10O32, 3 |
 | | Compound Data | | Melting point | 82.00 °C | 355.15 K | | CSID | 15420 | H bond acceptors | 3 | Rule of 5 violations | 0 | | Molecular weight | 154.1632 | H bond donors | 1 | ACD/LogP | 1.25 | | Phase 25 °C | solid | Rotatable bonds | 3 | Predicted density | 1.13 g/cm3 | | SMILES | O(c1ccc(O)cc1OC)C | | STD InChIKey | SMFFZOQLHYIRDA-UHFFFAOYAA | | Melting Points | | mp °C | source | |
|---|
| 83.00 | Aldrich Chemical Company; Aldrich Catalog-Handbook of Fine C... | | 81.00 | Alfa Aesar |
|
|
| | | 3,4-dimethoxyphenylacetic acid C10H12O43, 61 |
 | | Compound Data | | Melting point | 97.50 °C | 370.65 K | | CSID | 6872 | H bond acceptors | 4 | Rule of 5 violations | 0 | | Molecular weight | 196.1999 | H bond donors | 1 | ACD/LogP | 1.24 | | Phase 25 °C | solid | Rotatable bonds | 4 | Predicted density | 1.19 g/cm3 | | SMILES | O=C(O)Cc1cc(OC)c(OC)cc1 | | STD InChIKey | WUAXWQRULBZETB-UHFFFAOYAW | | Melting Points | | mp °C | source | |
|---|
| 97.00 | Alfa Aesar | | 98.00 | Oxford University MSDS |
|
|
| | | 3,4-dimethoxyphenylacetonitrile C10H11NO23, 64 |
 | | Compound Data | | Melting point | 63.38 °C | 336.52 K | | CSID | 60093 | H bond acceptors | 3 | Rule of 5 violations | 0 | | Molecular weight | 177.1998 | H bond donors | 0 | ACD/LogP | 1.19 | | Phase 25 °C | solid | Rotatable bonds | 3 | Predicted density | 1.08 g/cm3 | | SMILES | N#CCc1cc(OC)c(OC)cc1 | | STD InChIKey | ASLSUMISAQDOOB-UHFFFAOYAS | | Melting Points | | mp °C | source | |
|---|
| 64.00 | Alfa Aesar | | 62.75 | PHYSPROP |
|
|
| | | 3,4-dimethylaniline C8H11N2, 3, 64 |
 | |
|
| | | 3,4-dimethylbenzoic acid C9H10O23, 64 |
 | | Compound Data | | Melting point | 165.50 °C | 438.65 K | | CSID | 11576 | H bond acceptors | 2 | Rule of 5 violations | 0 | | Molecular weight | 150.1745 | H bond donors | 1 | ACD/LogP | 2.81 | | Phase 25 °C | solid | Rotatable bonds | 1 | Predicted density | 1.12 g/cm3 | | SMILES | O=C(O)c1cc(c(cc1)C)C | | STD InChIKey | OPVAJFQBSDUNQA-UHFFFAOYAK | | Melting Points | | mp °C | source | |
|---|
| 166.00 | Alfa Aesar | | 165.00 | PHYSPROP |
|
|
| | | 3,4-dimethylbenzophenone C15H14O3, 64 |
 | | Compound Data | | Melting point | 46.75 °C | 319.90 K | | CSID | 68247 | H bond acceptors | 1 | Rule of 5 violations | 0 | | Molecular weight | 210.2711 | H bond donors | 0 | ACD/LogP | 4.10 | | Phase 25 °C | solid | Rotatable bonds | 2 | Predicted density | 1.05 g/cm3 | | SMILES | O=C(c1cc(c(cc1)C)C)c2ccccc2 | | STD InChIKey | JENOLWCGNVWTJN-UHFFFAOYAX | | Melting Points | | mp °C | source | |
|---|
| 46.00 | Alfa Aesar | | 47.50 | PHYSPROP |
|
|
| | | 3,4-dinitrobenzoic acid C7H4N2O63, 64 |
 | | Compound Data | | Melting point | 165.50 °C | 438.65 K | | CSID | 10259 | H bond acceptors | 8 | Rule of 5 violations | 0 | | Molecular weight | 212.1165 | H bond donors | 1 | ACD/LogP | 1.98 | | Phase 25 °C | solid | Rotatable bonds | 3 | Predicted density | 1.69 g/cm3 | | SMILES | O=[N+]([O-])c1cc(ccc1[N+]([O-])=O)C(=O)O | | STD InChIKey | OMVRRHJJQILIJX-UHFFFAOYAQ | | Melting Points | | mp °C | source | |
|---|
| 165.00 | Alfa Aesar | | 166.00 | PHYSPROP |
|
|
| | | 3,4-dinitrotoluene C7H6N2O42, 3, 64 |
 | |
|
| | | 3,4,5-trimethoxybenzoic acid C10H12O53, 48, 64 |
 | |
|
| | | 3,4,5-trimethoxybenzonitrile C10H11NO33, 48, 64 |
 | |
|
| | | 3,5-di-t-butyl-1,2-benzoquinone C14H20O23, 61 |
 | | Compound Data | | Melting point | 114.25 °C | 387.40 K | | CSID | 69366 | H bond acceptors | 2 | Rule of 5 violations | 0 | | Molecular weight | 220.3074 | H bond donors | 0 | ACD/LogP | 3.04 | | Phase 25 °C | solid | Rotatable bonds | 2 | Predicted density | 1.03 g/cm3 | | SMILES | O=C1/C(=C\C(=C/C1=O)C(C)(C)C)C(C)(C)C | | STD InChIKey | NOUZOVBGCDDMSX-UHFFFAOYAY | | Melting Points | | mp °C | source | |
|---|
| 115.00 | Alfa Aesar | | 113.50 | Oxford University MSDS |
|
|
| | | 3,5-di-t-butyl-4-hydroxybenzaldehyde C15H22O23, 64 |
 | | Compound Data | | Melting point | 187.00 °C | 460.15 K | | CSID | 65974 | H bond acceptors | 2 | Rule of 5 violations | 0 | | Molecular weight | 234.334 | H bond donors | 1 | ACD/LogP | 4.77 | | Phase 25 °C | solid | Rotatable bonds | 4 | Predicted density | 1.01 g/cm3 | | SMILES | O=Cc1cc(c(O)c(c1)C(C)(C)C)C(C)(C)C | | STD InChIKey | DOZRDZLFLOODMB-UHFFFAOYAD | | Melting Points | | mp °C | source | |
|---|
| 188.00 | Alfa Aesar | | 186.00 | PHYSPROP |
|
|
| | | 3,5-di-t-butyl-4-hydroxybenzoic acid C15H22O33, 64 |
 | | Compound Data | | Melting point | 207.75 °C | 480.90 K | | CSID | 14285 | H bond acceptors | 3 | Rule of 5 violations | 0 | | Molecular weight | 250.3334 | H bond donors | 2 | ACD/LogP | 4.80 | | Phase 25 °C | solid | Rotatable bonds | 4 | Predicted density | 1.07 g/cm3 | | SMILES | O=C(O)c1cc(c(O)c(c1)C(C)(C)C)C(C)(C)C | | STD InChIKey | YEXOWHQZWLCHHD-UHFFFAOYAK | | Melting Points | | mp °C | source | |
|---|
| 208.00 | Alfa Aesar | | 207.50 | PHYSPROP |
|
|
| | | 3,5-dibromo-4-hydroxybenzaldehyde C7H4Br2O23, 48 |
 | | Compound Data | | Melting point | 181.50 °C | 454.65 K | | CSID | 17097 | H bond acceptors | 2 | Rule of 5 violations | 0 | | Molecular weight | 279.9135 | H bond donors | 1 | ACD/LogP | 3.53 | | Phase 25 °C | solid | Rotatable bonds | 2 | Predicted density | 2.12 g/cm3 | | SMILES | Brc1cc(cc(Br)c1O)C=O | | STD InChIKey | SXRHGLQCOLNZPT-UHFFFAOYAU | | Melting Points | | mp °C | source | |
|---|
| 181.00 | Alfa Aesar | | 182.00 | Karthikeyan M.; Glen R.C.; Bender A. General melting point p... |
|
|
| | | 3,5-dibromosalicylaldehyde C7H4Br2O23, 64 |
 | | Compound Data | | Melting point | 84.50 °C | 357.65 K | | CSID | 6757 | H bond acceptors | 2 | Rule of 5 violations | 0 | | Molecular weight | 279.9135 | H bond donors | 1 | ACD/LogP | 3.76 | | Phase 25 °C | solid | Rotatable bonds | 2 | Predicted density | 2.12 g/cm3 | | SMILES | Brc1cc(Br)cc(C=O)c1O | | STD InChIKey | JHZOXYGFQMROFJ-UHFFFAOYAH | | Melting Points | | mp °C | source | |
|---|
| 83.00 | Alfa Aesar | | 86.00 | PHYSPROP |
|
|
| | | 3,5-dibromosalicylic acid C7H4Br2O33, 64 |
 | | Compound Data | | Melting point | 227.00 °C | 500.15 K | | CSID | 17440 | H bond acceptors | 3 | Rule of 5 violations | 0 | | Molecular weight | 295.9129 | H bond donors | 2 | ACD/LogP | 4.10 | | Phase 25 °C | solid | Rotatable bonds | 2 | Predicted density | 2.23 g/cm3 | | SMILES | Brc1cc(Br)cc(C(=O)O)c1O | | STD InChIKey | BFBZHSOXKROMBG-UHFFFAOYAZ | | Melting Points | | mp °C | source | |
|---|
| 226.00 | Alfa Aesar | | 228.00 | PHYSPROP |
|
|
| | | 3,5-dichloro-4-hydroxybenzoic acid C7H4Cl2O33, 64 |
 | | Compound Data | | Melting point | 266.50 °C | 539.65 K | | CSID | 17704 | H bond acceptors | 3 | Rule of 5 violations | 0 | | Molecular weight | 207.0109 | H bond donors | 2 | ACD/LogP | 3.37 | | Phase 25 °C | solid | Rotatable bonds | 2 | Predicted density | 1.67 g/cm3 | | SMILES | Clc1cc(cc(Cl)c1O)C(=O)O | | STD InChIKey | AULKDLUOQCUNOK-UHFFFAOYAH | | Melting Points | | mp °C | source | |
|---|
| 268.00 | Alfa Aesar | | 265.00 | PHYSPROP |
|
|
| | | 3,5-dichloroaniline C6H5Cl2N2, 3, 64 |
 | |
|
| | | 3,5-dichloroanisole C7H6Cl2O2, 3, 64 |
 | |
|
| | | 3,5-dichlorobenzaldehyde C7H4Cl2O3, 48, 64 |
 | |
|
| | | 3,5-dichlorobenzoic acid C7H4Cl2O22, 3, 64 |
 | |
|
| | | 3,5-dichlorobenzonitrile C7H3Cl2N2, 3 |
 | | Compound Data | | Melting point | 65.00 °C | 338.15 K | | CSID | 73125 | H bond acceptors | 1 | Rule of 5 violations | 0 | | Molecular weight | 172.0114 | H bond donors | 0 | ACD/LogP | 2.69 | | Phase 25 °C | solid | Rotatable bonds | 0 | Predicted density | 1.40 g/cm3 | | SMILES | c1c(cc(cc1Cl)Cl)C#N | | STD InChIKey | PUJSUOGJGIECFQ-UHFFFAOYAP | | Melting Points | | mp °C | source | |
|---|
| 64.00 | Aldrich Chemical Company; Aldrich Catalog-Handbook of Fine C... | | 66.00 | Alfa Aesar |
|
|
| | | 3,5-dichlorobenzyl alcohol C7H6Cl2O3, 64 |
 | | Compound Data | | Melting point | 79.25 °C | 352.40 K | | CSID | 39404 | H bond acceptors | 1 | Rule of 5 violations | 0 | | Molecular weight | 177.0279 | H bond donors | 1 | ACD/LogP | 2.24 | | Phase 25 °C | solid | Rotatable bonds | 2 | Predicted density | 1.39 g/cm3 | | SMILES | Clc1cc(cc(Cl)c1)CO | | STD InChIKey | VSNNLLQKDRCKCB-UHFFFAOYAF | | Melting Points | | mp °C | source | |
|---|
| 78.00 | Alfa Aesar | | 80.50 | PHYSPROP |
|
|
| | | 3,5-dichlorophenol C6H4Cl2O2, 3, 64 |
 | |
|
| | | 3,5-dichloropyridine C5H3Cl2N3, 64 |
 | | Compound Data | | Melting point | 65.50 °C | 338.65 K | | CSID | 16237 | H bond acceptors | 1 | Rule of 5 violations | 0 | | Molecular weight | 147.99 | H bond donors | 0 | ACD/LogP | 2.42 | | Phase 25 °C | solid | Rotatable bonds | 0 | Predicted density | 1.39 g/cm3 | | SMILES | Clc1cncc(Cl)c1 | | STD InChIKey | WPGHPGAUFIJVJF-UHFFFAOYAF | | Melting Points | | mp °C | source | |
|---|
| 65.00 | Alfa Aesar | | 66.00 | PHYSPROP |
|
|
| | | 3,5-dichlorosalicylic acid C7H4Cl2O33, 64 |
 | | Compound Data | | Melting point | 222.25 °C | 495.40 K | | CSID | 9073 | H bond acceptors | 3 | Rule of 5 violations | 0 | | Molecular weight | 207.0109 | H bond donors | 2 | ACD/LogP | 4.40 | | Phase 25 °C | solid | Rotatable bonds | 2 | Predicted density | 1.67 g/cm3 | | SMILES | Clc1cc(Cl)cc(C(=O)O)c1O | | STD InChIKey | CNJGWCQEGROXEE-UHFFFAOYAB | | Melting Points | | mp °C | source | |
|---|
| 224.00 | Alfa Aesar | | 220.50 | PHYSPROP |
|
|
| | | 3,5-difluorobenzoic acid C7H4F2O23, 64 |
 | | Compound Data | | Melting point | 121.50 °C | 394.65 K | | CSID | 91500 | H bond acceptors | 2 | Rule of 5 violations | 0 | | Molecular weight | 158.1023 | H bond donors | 1 | ACD/LogP | 2.47 | | Phase 25 °C | solid | Rotatable bonds | 1 | Predicted density | 1.43 g/cm3 | | SMILES | Fc1cc(C(=O)O)cc(F)c1 | | STD InChIKey | GONAVIHGXFBTOZ-UHFFFAOYAZ | | Melting Points | | mp °C | source | |
|---|
| 121.00 | Alfa Aesar | | 122.00 | PHYSPROP |
|
|
| | | 3,5-dihydroxytoluene C7H8O23, 64 |
 | | Compound Data | | Melting point | 107.25 °C | 380.40 K | | CSID | 13839080 | H bond acceptors | 2 | Rule of 5 violations | 0 | | Molecular weight | 124.1372 | H bond donors | 2 | ACD/LogP | 1.22 | | Phase 25 °C | solid | Rotatable bonds | 2 | Predicted density | 1.21 g/cm3 | | SMILES | Cc1cc(O)cc(O)c1 | | STD InChIKey | OIPPWFOQEKKFEE-UHFFFAOYAN | | Melting Points | | mp °C | source | |
|---|
| 107.00 | Alfa Aesar | | 107.50 | PHYSPROP |
|
|
| | | 3,5-diiodosalicylic acid C7H4I2O33, 64 |
 | | Compound Data | | Melting point | 233.25 °C | 506.40 K | | CSID | 8310 | H bond acceptors | 3 | Rule of 5 violations | 0 | | Molecular weight | 389.9138 | H bond donors | 2 | ACD/LogP | 4.56 | | Phase 25 °C | solid | Rotatable bonds | 2 | Predicted density | 2.70 g/cm3 | | SMILES | Ic1cc(C(=O)O)c(O)c(I)c1 | | STD InChIKey | DHZVWQPHNWDCFS-UHFFFAOYAS | | Melting Points | | mp °C | source | |
|---|
| 231.00 | Alfa Aesar | | 235.50 | PHYSPROP |
|
|
| | | 3,5-dimethoxybenzaldehyde C9H10O32, 3, 35, 64 |
 | |
|
| | | 3,5-dimethoxybenzoic acid C9H10O43, 64 |
 | | Compound Data | | Melting point | 184.75 °C | 457.90 K | | CSID | 13693 | H bond acceptors | 4 | Rule of 5 violations | 0 | | Molecular weight | 182.1733 | H bond donors | 1 | ACD/LogP | 2.03 | | Phase 25 °C | solid | Rotatable bonds | 3 | Predicted density | 1.21 g/cm3 | | SMILES | O=C(O)c1cc(OC)cc(OC)c1 | | STD InChIKey | IWPZKOJSYQZABD-UHFFFAOYAJ | | Melting Points | | mp °C | source | |
|---|
| 184.00 | Alfa Aesar | | 185.50 | PHYSPROP |
|
|
| | | 3,5-dimethylaniline C8H11N3, 64 |
 | | Compound Data | | Melting point | 9.90 °C | 283.05 K | | CSID | 21106578 | H bond acceptors | 1 | Rule of 5 violations | 0 | | Molecular weight | 121.1796 | H bond donors | 2 | ACD/LogP | 1.86 | | Phase 25 °C | liquid/gas | Rotatable bonds | 1 | Predicted density | 0.97 g/cm3 | | SMILES | Cc1cc(N)cc(C)c1 | | STD InChIKey | MKARNSWMMBGSHX-UHFFFAOYAO | | Melting Points | | mp °C | source | |
|---|
| 10.00 | Alfa Aesar | | 9.80 | PHYSPROP |
|
|
| | | 3,5-dimethylbenzoic acid C9H10O23, 64 |
 | | Compound Data | | Melting point | 170.55 °C | 443.70 K | | CSID | 9929 | H bond acceptors | 2 | Rule of 5 violations | 0 | | Molecular weight | 150.1745 | H bond donors | 1 | ACD/LogP | 2.81 | | Phase 25 °C | solid | Rotatable bonds | 1 | Predicted density | 1.12 g/cm3 | | SMILES | O=C(O)c1cc(cc(c1)C)C | | STD InChIKey | UMVOQQDNEYOJOK-UHFFFAOYAD | | Melting Points | | mp °C | source | |
|---|
| 170.00 | Alfa Aesar | | 171.10 | PHYSPROP |
|
|
| | | 3,5-dimethylphenol C8H10O3, 28, 64, 72, 72 |
 | |
|
| | | 3,5-dimethylpyrazole C5H8N23, 64 |
 | | Compound Data | | Melting point | 107.25 °C | 380.40 K | | CSID | 5975 | H bond acceptors | 2 | Rule of 5 violations | 0 | | Molecular weight | 96.1304 | H bond donors | 1 | ACD/LogP | 1.24 | | Phase 25 °C | solid | Rotatable bonds | 0 | Predicted density | 1.03 g/cm3 | | SMILES | n1c(cc(n1)C)C | | STD InChIKey | SDXAWLJRERMRKF-UHFFFAOYAF | | Melting Points | | mp °C | source | |
|---|
| 107.00 | Alfa Aesar | | 107.50 | PHYSPROP |
|
|
| | | 3,5-dinitroaniline C6H5N3O42, 64 |
 | | Compound Data | | Melting point | 162.00 °C | 435.15 K | | CSID | 11571 | H bond acceptors | 7 | Rule of 5 violations | 0 | | Molecular weight | 183.1216 | H bond donors | 2 | ACD/LogP | 1.74 | | Phase 25 °C | solid | Rotatable bonds | 3 | Predicted density | 1.59 g/cm3 | | SMILES | O=[N+]([O-])c1cc(cc(N)c1)[N+]([O-])=O | | STD InChIKey | MPBZUKLDHPOCLS-UHFFFAOYAF | | Melting Points | | mp °C | source | |
|---|
| 161.00 | Aldrich Chemical Company; Aldrich Catalog-Handbook of Fine C... | | 163.00 | PHYSPROP |
|
|
| | | 3,5-dinitrobenzamide C7H5N3O53, 64 |
 | | Compound Data | | Melting point | 183.00 °C | 456.15 K | | CSID | 4355 | H bond acceptors | 8 | Rule of 5 violations | 0 | | Molecular weight | 211.1317 | H bond donors | 2 | ACD/LogP | 0.55 | | Phase 25 °C | solid | Rotatable bonds | 3 | Predicted density | 1.60 g/cm3 | | SMILES | O=[N+]([O-])c1cc(cc([N+]([O-])=O)c1)C(=O)N | | STD InChIKey | UUKWKUSGGZNXGA-UHFFFAOYAE | | Melting Points | | mp °C | source | |
|---|
| 182.00 | Alfa Aesar | | 184.00 | PHYSPROP |
|
|
| | | 3,5-dinitrobenzoic acid C7H4N2O63, 61, 64 |
 | | Compound Data | | Melting point | 205.67 °C | 478.82 K | | CSID | 7155 | H bond acceptors | 8 | Rule of 5 violations | 0 | | Molecular weight | 212.1165 | H bond donors | 1 | ACD/LogP | 1.69 | | Phase 25 °C | solid | Rotatable bonds | 3 | Predicted density | 1.69 g/cm3 | | SMILES | O=[N+]([O-])c1cc(cc([N+]([O-])=O)c1)C(=O)O | | STD InChIKey | VYWYYJYRVSBHJQ-UHFFFAOYAQ | | Melting Points | | mp °C | source | |
|---|
| 206.00 | Alfa Aesar | | 206.00 | Oxford University MSDS | | 205.00 | PHYSPROP |
|
|
| | | 3,5-dinitrosalicylic acid C7H4N2O73, 61, 64 |
 | | Compound Data | | Melting point | 170.50 °C | 443.65 K | | CSID | 11380 | H bond acceptors | 9 | Rule of 5 violations | 0 | | Molecular weight | 228.12 | H bond donors | 2 | ACD/LogP | 2.71 | | Phase 25 °C | solid | Rotatable bonds | 4 | Predicted density | 1.84 g/cm3 | | SMILES | c1c(cc(c(c1C(=O)O)O)[N+](=O)[O-])[N+](=O)[O-] | | STD InChIKey | LWFUFLREGJMOIZ-UHFFFAOYAQ | | Melting Points | | mp °C | source | |
|---|
| 171.00 | Alfa Aesar | | 170.50 | Oxford University MSDS | | 170.00 | PHYSPROP |
|
|
| | | 3,5-lutidine C7H9N3, 64 |
 | | Compound Data | | Melting point | -7.80 °C | 265.35 K | | CSID | 11077 | H bond acceptors | 1 | Rule of 5 violations | 0 | | Molecular weight | 107.1531 | H bond donors | 0 | ACD/LogP | 1.65 | | Phase 25 °C | liquid/gas | Rotatable bonds | 0 | Predicted density | 0.93 g/cm3 | | SMILES | n1cc(cc(c1)C)C | | STD InChIKey | HWWYDZCSSYKIAD-UHFFFAOYAB | | Melting Points | | mp °C | source | |
|---|
| -9.00 | Alfa Aesar | | -6.60 | PHYSPROP |
|
|
| | | 3,5,5-trimethyl-2,4-dioxooxazolidine C6H9NO33, 32, 64 |
 | | Compound Data | | Melting point | 46.33 °C | 319.48 K | | CSID | 5374 | H bond acceptors | 4 | Rule of 5 violations | 0 | | Molecular weight | 143.1406 | H bond donors | 0 | ACD/LogP | 0.31 | | Phase 25 °C | solid | Rotatable bonds | 0 | Predicted density | 1.17 g/cm3 | | SMILES | O=C1N(C(=O)OC1(C)C)C | | STD InChIKey | IRYJRGCIQBGHIV-UHFFFAOYAZ | | Melting Points | | mp °C | source | |
|---|
| 47.00 | Alfa Aesar | | 46.00 | DrugBank | | 46.00 | PHYSPROP |
|
|
| | | 3,5,7-trihydroxyflavone C15H10O53, 64 |
 | | Compound Data | | Melting point | 214.75 °C | 487.90 K | | CSID | 4444935 | H bond acceptors | 5 | Rule of 5 violations | 0 | | Molecular weight | 270.2369 | H bond donors | 3 | ACD/LogP | 2.83 | | Phase 25 °C | solid | Rotatable bonds | 4 | Predicted density | 1.58 g/cm3 | | SMILES | O=C1c3c(O/C(=C1/O)c2ccccc2)cc(O)cc3O | | STD InChIKey | VCCRNZQBSJXYJD-UHFFFAOYAC | | Melting Points | | mp °C | source | |
|---|
| 215.00 | Alfa Aesar | | 214.50 | PHYSPROP |
|
|
| | | 3,6-dichloropyridazine C4H2Cl2N23, 64 |
 | | Compound Data | | Melting point | 67.75 °C | 340.90 K | | CSID | 60662 | H bond acceptors | 2 | Rule of 5 violations | 0 | | Molecular weight | 148.9781 | H bond donors | 0 | ACD/LogP | 0.90 | | Phase 25 °C | solid | Rotatable bonds | 0 | Predicted density | 1.49 g/cm3 | | SMILES | Clc1nnc(Cl)cc1 | | STD InChIKey | GUSWJGOYDXFJSI-UHFFFAOYAK | | Melting Points | | mp °C | source | |
|---|
| 68.00 | Alfa Aesar | | 67.50 | PHYSPROP |
|
|
| | | 3,7-dinitroso-1,3,5,7-tetraazabicyclo[3.3.1]nonane C5H10N6O261, 64 |
 | | Compound Data | | Melting point | 205.75 °C | 478.90 K | | CSID | 7268 | H bond acceptors | 8 | Rule of 5 violations | 0 | | Molecular weight | 186.1719 | H bond donors | 0 | ACD/LogP | 0.05 | | Phase 25 °C | solid | Rotatable bonds | 2 | Predicted density | 1.80 g/cm3 | | SMILES | O=NN2CN1CN(CN(N=O)C1)C2 | | STD InChIKey | MWRWFPQBGSZWNV-UHFFFAOYAW | | Melting Points | | mp °C | source | |
|---|
| 207.00 | Oxford University MSDS | | 204.50 | PHYSPROP |
|
|
| | | 4-(2-aminoethyl)morpholine C6H14N2O3, 64 |
 | | Compound Data | | Melting point | 24.80 °C | 297.95 K | | CSID | 361265 | H bond acceptors | 3 | Rule of 5 violations | 0 | | Molecular weight | 130.1882 | H bond donors | 2 | ACD/LogP | -1.01 | | Phase 25 °C | liquid/gas | Rotatable bonds | 3 | Predicted density | 1.00 g/cm3 | | SMILES | O1CCN(CCN)CC1 | | STD InChIKey | RWIVICVCHVMHMU-UHFFFAOYAF | | Melting Points | | mp °C | source | |
|---|
| 24.00 | Alfa Aesar | | 25.60 | PHYSPROP |
|
|
| | | 4-(4-methoxyphenyl)butanoic acid C11H14O348, 64 |
 | | Compound Data | | Melting point | 58.25 °C | 331.40 K | | CSID | 70652 | H bond acceptors | 3 | Rule of 5 violations | 0 | | Molecular weight | 194.2271 | H bond donors | 1 | ACD/LogP | 2.33 | | Phase 25 °C | solid | Rotatable bonds | 5 | Predicted density | 1.12 g/cm3 | | SMILES | O=C(O)CCCc1ccc(OC)cc1 | | STD InChIKey | LZHMNCJMXQKSBY-UHFFFAOYAO | | Melting Points | | mp °C | source | |
|---|
| 59.00 | Karthikeyan M.; Glen R.C.; Bender A. General melting point p... | | 57.50 | PHYSPROP |
|
|
| | | 4-(aminomethyl)piperidine C6H14N23, 64 |
 | | Compound Data | | Melting point | 24.50 °C | 297.65 K | | CSID | 21997 | H bond acceptors | 2 | Rule of 5 violations | 0 | | Molecular weight | 114.1888 | H bond donors | 3 | ACD/LogP | -0.19 | | Phase 25 °C | liquid/gas | Rotatable bonds | 2 | Predicted density | 0.90 g/cm3 | | SMILES | NCC1CCNCC1 | | STD InChIKey | LTEKQAPRXFBRNN-UHFFFAOYAB | | Melting Points | | mp °C | source | |
|---|
| 24.00 | Alfa Aesar | | 25.00 | PHYSPROP |
|
|
| | | 4-(benzylamino)phenol C13H13NO3, 64 |
 | | Compound Data | | Melting point | 86.00 °C | 359.15 K | | CSID | 7355 | H bond acceptors | 2 | Rule of 5 violations | 0 | | Molecular weight | 199.2484 | H bond donors | 2 | ACD/LogP | 2.38 | | Phase 25 °C | solid | Rotatable bonds | 4 | Predicted density | 1.19 g/cm3 | | SMILES | Oc2ccc(NCc1ccccc1)cc2 | | STD InChIKey | SRYYOKKLTBRLHT-UHFFFAOYAD | | Melting Points | | mp °C | source | |
|---|
| 84.00 | Alfa Aesar | | 88.00 | PHYSPROP |
|
|
| | | 4-(bromomethyl)benzoic acid C8H7BrO23, 64 |
 | | Compound Data | | Melting point | 227.50 °C | 500.65 K | | CSID | 21185 | H bond acceptors | 2 | Rule of 5 violations | 0 | | Molecular weight | 215.044 | H bond donors | 1 | ACD/LogP | 2.60 | | Phase 25 °C | solid | Rotatable bonds | 2 | Predicted density | 1.64 g/cm3 | | SMILES | BrCc1ccc(C(=O)O)cc1 | | STD InChIKey | CQQSQBRPAJSTFB-UHFFFAOYAU | | Melting Points | | mp °C | source | |
|---|
| 225.00 | Alfa Aesar | | 230.00 | PHYSPROP |
|
|
| | | 4-(dimethylamino)benzaldehyde C9H11NO2, 3, 35, 48, 61, 64 |
 | |
|
| | | 4-(dimethylamino)benzoic acid C9H11NO261, 64 |
 | | Compound Data | | Melting point | 242.75 °C | 515.90 K | | CSID | 11595 | H bond acceptors | 3 | Rule of 5 violations | 0 | | Molecular weight | 165.1891 | H bond donors | 1 | ACD/LogP | 2.31 | | Phase 25 °C | solid | Rotatable bonds | 2 | Predicted density | 1.18 g/cm3 | | SMILES | O=C(O)c1ccc(N(C)C)cc1 | | STD InChIKey | YDIYEOMDOWUDTJ-UHFFFAOYAK | | Melting Points | | mp °C | source | |
|---|
| 243.00 | Oxford University MSDS | | 242.50 | PHYSPROP |
|
|
| | | 4-(hydroxymethyl)benzoic acid C8H8O33, 7 |
 | | Compound Data | | Melting point | 181.50 °C | 454.65 K | | CSID | 68837 | H bond acceptors | 3 | Rule of 5 violations | 0 | | Molecular weight | 152.1473 | H bond donors | 2 | ACD/LogP | 0.71 | | Phase 25 °C | solid | Rotatable bonds | 3 | Predicted density | 1.31 g/cm3 | | SMILES | O=C(O)c1ccc(cc1)CO | | STD InChIKey | WWYFPDXEIFBNKE-UHFFFAOYAK | | Melting Points | | mp °C | source | |
|---|
| 181.00 | Alfa Aesar | | 182.00 | Beilstein F. K.; Beilsteins Handbuch der Organischen Chemie.... |
|
|
| | | 4-(iodophenyl)acetonitrile C8H6IN3, 7 |
 | | Compound Data | | Melting point | 50.50 °C | 323.65 K | | CSID | 126037 | H bond acceptors | 1 | Rule of 5 violations | 0 | | Molecular weight | 243.0444 | H bond donors | 0 | ACD/LogP | 2.48 | | Phase 25 °C | solid | Rotatable bonds | 1 | Predicted density | 1.76 g/cm3 | | SMILES | Ic1ccc(cc1)CC#N | | STD InChIKey | PNXWQTYSBFGIFD-UHFFFAOYAN | | Melting Points | | mp °C | source | |
|---|
| 53.00 | Alfa Aesar | | 48.00 | Beilstein F. K.; Beilsteins Handbuch der Organischen Chemie.... |
|
|
| | | 4-(methylsulfonyl)benzoic acid C8H8O4S3, 64 |
 | | Compound Data | | Melting point | 271.25 °C | 544.40 K | | CSID | 70071 | H bond acceptors | 4 | Rule of 5 violations | 0 | | Molecular weight | 200.2117 | H bond donors | 1 | ACD/LogP | 0.67 | | Phase 25 °C | solid | Rotatable bonds | 2 | Predicted density | 1.39 g/cm3 | | SMILES | O=S(=O)(c1ccc(C(=O)O)cc1)C | | STD InChIKey | AJBWNNKDUMXZLM-UHFFFAOYAZ | | Melting Points | | mp °C | source | |
|---|
| 273.00 | Alfa Aesar | | 269.50 | PHYSPROP |
|
|
| | | 4-(methylthio)benzoic acid C8H8O2S3, 64 |
 | | Compound Data | | Melting point | 194.75 °C | 467.90 K | | CSID | 75095 | H bond acceptors | 2 | Rule of 5 violations | 0 | | Molecular weight | 168.2129 | H bond donors | 1 | ACD/LogP | 2.74 | | Phase 25 °C | solid | Rotatable bonds | 2 | Predicted density | 1.28 g/cm3 | | SMILES | O=C(O)c1ccc(SC)cc1 | | STD InChIKey | KWHCPERWLHBLOT-UHFFFAOYAJ | | Melting Points | | mp °C | source | |
|---|
| 195.00 | Alfa Aesar | | 194.50 | PHYSPROP |
|
|
| | | 4-(trifluoromethoxy)benzoic acid C8H5F3O33, 64 |
 | | Compound Data | | Melting point | 152.50 °C | 425.65 K | | CSID | 60933 | H bond acceptors | 3 | Rule of 5 violations | 0 | | Molecular weight | 206.1187 | H bond donors | 1 | ACD/LogP | 3.00 | | Phase 25 °C | solid | Rotatable bonds | 2 | Predicted density | 1.45 g/cm3 | | SMILES | FC(F)(F)Oc1ccc(cc1)C(=O)O | | STD InChIKey | RATSANVPHHXDCT-UHFFFAOYAL | | Melting Points | | mp °C | source | |
|---|
| 153.00 | Alfa Aesar | | 152.00 | PHYSPROP |
|
|
| | | 4-(trifluoromethyl)acetophenone C9H7F3O3, 64 |
 | | Compound Data | | Melting point | 31.50 °C | 304.65 K | | CSID | 62931 | H bond acceptors | 1 | Rule of 5 violations | 0 | | Molecular weight | 188.1465 | H bond donors | 0 | ACD/LogP | 2.60 | | Phase 25 °C | solid | Rotatable bonds | 1 | Predicted density | 1.22 g/cm3 | | SMILES | CC(=O)c1ccc(cc1)C(F)(F)F | | STD InChIKey | HHAISVSEJFEWBZ-UHFFFAOYAE | | Melting Points | | mp °C | source | |
|---|
| 32.00 | Alfa Aesar | | 31.00 | PHYSPROP |
|
|
| | | 4-(trifluoromethyl)benzaldehyde C8H5F3O3, 3 |
 | | Compound Data | | Melting point | 1.75 °C | 274.90 K | | CSID | 61311 | H bond acceptors | 1 | Rule of 5 violations | 0 | | Molecular weight | 174.1199 | H bond donors | 0 | ACD/LogP | 2.61 | | Phase 25 °C | liquid/gas | Rotatable bonds | 1 | Predicted density | 1.29 g/cm3 | | SMILES | FC(F)(F)c1ccc(C=O)cc1 | | STD InChIKey | BEOBZEOPTQQELP-UHFFFAOYAG | | Melting Points | | mp °C | source | |
|---|
| 1.50 | Alfa Aesar | | 2.00 | Alfa Aesar |
|
|
| | | 4-(trifluoromethyl)benzamide C8H6F3NO3, 64 |
 | | Compound Data | | Melting point | 184.50 °C | 457.65 K | | CSID | 67257 | H bond acceptors | 2 | Rule of 5 violations | 0 | | Molecular weight | 189.1345 | H bond donors | 2 | ACD/LogP | 1.71 | | Phase 25 °C | solid | Rotatable bonds | 1 | Predicted density | 1.33 g/cm3 | | SMILES | FC(F)(F)c1ccc(C(=O)N)cc1 | | STD InChIKey | WEJHBEDHLLBJFW-UHFFFAOYAB | | Melting Points | | mp °C | source | |
|---|
| 184.00 | Alfa Aesar | | 185.00 | PHYSPROP |
|
|
| | | 4-(trifluoromethyl)benzoic acid C8H5F3O23, 64 |
 | | Compound Data | | Melting point | 220.25 °C | 493.40 K | | CSID | 9572 | H bond acceptors | 2 | Rule of 5 violations | 0 | | Molecular weight | 190.1193 | H bond donors | 1 | ACD/LogP | 3.10 | | Phase 25 °C | solid | Rotatable bonds | 1 | Predicted density | 1.40 g/cm3 | | SMILES | FC(F)(F)c1ccc(C(=O)O)cc1 | | STD InChIKey | SWKPKONEIZGROQ-UHFFFAOYAJ | | Melting Points | | mp °C | source | |
|---|
| 221.00 | Alfa Aesar | | 219.50 | PHYSPROP |
|
|
| | | 4-(trifluoromethyl)benzophenone C14H9F3O3, 48, 64 |
 | |
|
| | | 4-(trifluoromethyl)phenylacetic acid C9H7F3O23, 64 |
 | | Compound Data | | Melting point | 82.00 °C | 355.15 K | | CSID | 105768 | H bond acceptors | 2 | Rule of 5 violations | 0 | | Molecular weight | 204.1459 | H bond donors | 1 | ACD/LogP | 2.08 | | Phase 25 °C | solid | Rotatable bonds | 2 | Predicted density | 1.36 g/cm3 | | SMILES | FC(F)(F)c1ccc(cc1)CC(=O)O | | STD InChIKey | HNORVZDAANCHAY-UHFFFAOYAZ | | Melting Points | | mp °C | source | |
|---|
| 80.00 | Alfa Aesar | | 84.00 | PHYSPROP |
|
|
| | | 4-(trifluoromethyl)phenylacetonitrile C9H6F3N3, 47, 64 |
 | | Compound Data | | Melting point | 47.17 °C | 320.32 K | | CSID | 67895 | H bond acceptors | 1 | Rule of 5 violations | 0 | | Molecular weight | 185.1458 | H bond donors | 0 | ACD/LogP | 2.02 | | Phase 25 °C | solid | Rotatable bonds | 1 | Predicted density | 1.24 g/cm3 | | SMILES | FC(F)(F)c1ccc(cc1)CC#N | | STD InChIKey | QNKOCFJZJWOXDE-UHFFFAOYAE | | Melting Points | | mp °C | source | |
|---|
| 45.00 | Alfa Aesar | | 48.50 | IUCr | | 48.00 | PHYSPROP |
|
|
| | | 4-acetamidobenzaldehyde C9H9NO23, 7, 64 |
 | |
|
| | | 4-acetoxyacetophenone C10H10O33, 7 |
 | | Compound Data | | Melting point | 53.50 °C | 326.65 K | | CSID | 74935 | H bond acceptors | 3 | Rule of 5 violations | 0 | | Molecular weight | 178.1846 | H bond donors | 0 | ACD/LogP | 1.29 | | Phase 25 °C | solid | Rotatable bonds | 3 | Predicted density | 1.12 g/cm3 | | SMILES | O=C(Oc1ccc(cc1)C(=O)C)C | | STD InChIKey | SMIOEQSLJNNKQF-UHFFFAOYAC | | Melting Points | | mp °C | source | |
|---|
| 53.00 | Alfa Aesar | | 54.00 | Beilstein F. K.; Beilsteins Handbuch der Organischen Chemie.... |
|
|
| | | 4-acetoxybenzoic acid C9H8O42, 3, 64 |
 | |
|
| | | 4-acetoxybiphenyl C14H12O23, 7, 64 |
 | |
|
| | | 4-acetylbenzoic acid C9H8O32, 3, 64 |
 | |
|
| | | 4-acetylbenzonitrile C9H7NO2, 3, 7, 64 |
 | |
|
| | | 4-acetylbiphenyl C14H12O3, 7, 64 |
 | |
|
| | | 4-acetylphenoxyacetic acid C10H10O43, 64 |
 | | Compound Data | | Melting point | 174.50 °C | 447.65 K | | CSID | 67230 | H bond acceptors | 4 | Rule of 5 violations | 0 | | Molecular weight | 194.184 | H bond donors | 1 | ACD/LogP | 0.95 | | Phase 25 °C | solid | Rotatable bonds | 4 | Predicted density | 1.24 g/cm3 | | SMILES | O=C(c1ccc(OCC(=O)O)cc1)C | | STD InChIKey | KMXZEXUYXUMHEQ-UHFFFAOYAE | | Melting Points | | mp °C | source | |
|---|
| 173.00 | Alfa Aesar | | 176.00 | PHYSPROP |
|
|
| | | 4-acetylpyridine C7H7NO3, 64 |
 | | Compound Data | | Melting point | 15.50 °C | 288.65 K | | CSID | 13644 | H bond acceptors | 2 | Rule of 5 violations | 0 | | Molecular weight | 121.1366 | H bond donors | 0 | ACD/LogP | 0.24 | | Phase 25 °C | liquid/gas | Rotatable bonds | 1 | Predicted density | 1.06 g/cm3 | | SMILES | O=C(c1ccncc1)C | | STD InChIKey | WMQUKDQWMMOHSA-UHFFFAOYAX | | Melting Points | | mp °C | source | |
|---|
| 15.00 | Alfa Aesar | | 16.00 | PHYSPROP |
|
|
| | | 4-amino-1,2,4-triazole C2H4N43, 64 |
 | | Compound Data | | Melting point | 84.25 °C | 357.40 K | | CSID | 10951 | H bond acceptors | 4 | Rule of 5 violations | 0 | | Molecular weight | 84.08 | H bond donors | 2 | ACD/LogP | 0.00 | | Phase 25 °C | solid | Rotatable bonds | 1 | Predicted density | 1.60 g/cm3 | | SMILES | c1nncn1N | | STD InChIKey | FMCUPJKTGNBGEC-UHFFFAOYAB | | Melting Points | | mp °C | source | |
|---|
| 86.00 | Alfa Aesar | | 82.50 | PHYSPROP |
|
|
| | | 4-amino-2-chlorophenol C6H6ClNO3, 61 |
 | | Compound Data | | Melting point | 151.75 °C | 424.90 K | | CSID | 69983 | H bond acceptors | 2 | Rule of 5 violations | 0 | | Molecular weight | 143.5709 | H bond donors | 3 | ACD/LogP | 0.55 | | Phase 25 °C | solid | Rotatable bonds | 2 | Predicted density | 1.41 g/cm3 | | SMILES | Clc1cc(N)ccc1O | | STD InChIKey | ZYZQSCWSPFLAFM-UHFFFAOYAH | | Melting Points | | mp °C | source | |
|---|
| 152.00 | Alfa Aesar | | 151.50 | Oxford University MSDS |
|
|
| | | 4-amino-2-methylquinoline C10H10N23, 64 |
 | | Compound Data | | Melting point | 166.50 °C | 439.65 K | | CSID | 73183 | H bond acceptors | 2 | Rule of 5 violations | 0 | | Molecular weight | 158.1998 | H bond donors | 2 | ACD/LogP | 2.09 | | Phase 25 °C | solid | Rotatable bonds | 1 | Predicted density | 1.17 g/cm3 | | SMILES | n1c(cc(c2ccccc12)N)C | | STD InChIKey | COCFIBRMFPWUDW-UHFFFAOYAZ | | Melting Points | | mp °C | source | |
|---|
| 164.00 | Alfa Aesar | | 169.00 | PHYSPROP |
|
|
| | | 4-amino-2-nitrophenol C6H6N2O33, 64 |
 | | Compound Data | | Melting point | 127.50 °C | 400.65 K | | CSID | 2661194 | H bond acceptors | 5 | Rule of 5 violations | 0 | | Molecular weight | 154.1234 | H bond donors | 3 | ACD/LogP | 0.64 | | Phase 25 °C | solid | Rotatable bonds | 3 | Predicted density | 1.51 g/cm3 | | SMILES | O=[N+]([O-])c1cc(ccc1O)N | | STD InChIKey | WHODQVWERNSQEO-UHFFFAOYAM | | Melting Points | | mp °C | source | |
|---|
| 129.00 | Alfa Aesar | | 126.00 | PHYSPROP |
|
|
| | | 4-amino-2,6-dichlorophenol C6H5Cl2NO3, 61, 64 |
 | | Compound Data | | Melting point | 167.83 °C | 440.98 K | | CSID | 72291 | H bond acceptors | 2 | Rule of 5 violations | 0 | | Molecular weight | 178.016 | H bond donors | 3 | ACD/LogP | 1.40 | | Phase 25 °C | solid | Rotatable bonds | 2 | Predicted density | 1.56 g/cm3 | | SMILES | Clc1cc(cc(Cl)c1O)N | | STD InChIKey | KGEXISHTCZHGFT-UHFFFAOYAM | | Melting Points | | mp °C | source | |
|---|
| 167.00 | Alfa Aesar | | 168.50 | Oxford University MSDS | | 168.00 | PHYSPROP |
|
|
| | | 4-amino-2,6-dimethylpyrimidine C6H9N33, 64 |
 | | Compound Data | | Melting point | 184.00 °C | 457.15 K | | CSID | 61354 | H bond acceptors | 3 | Rule of 5 violations | 0 | | Molecular weight | 123.1558 | H bond donors | 2 | ACD/LogP | 0.39 | | Phase 25 °C | solid | Rotatable bonds | 0 | Predicted density | 1.11 g/cm3 | | SMILES | n1c(cc(nc1C)N)C | | STD InChIKey | BJJDXAFKCKSLTE-UHFFFAOYAV | | Melting Points | | mp °C | source | |
|---|
| 185.00 | Alfa Aesar | | 183.00 | PHYSPROP |
|
|
| | | 4-amino-3-methylbenzoic acid C8H9NO23, 64 |
 | | Compound Data | | Melting point | 169.75 °C | 442.90 K | | CSID | 68122 | H bond acceptors | 3 | Rule of 5 violations | 0 | | Molecular weight | 151.1626 | H bond donors | 3 | ACD/LogP | 1.29 | | Phase 25 °C | solid | Rotatable bonds | 2 | Predicted density | 1.25 g/cm3 | | SMILES | O=C(O)c1ccc(N)c(c1)C | | STD InChIKey | NHFKECPTBZZFBC-UHFFFAOYAZ | | Melting Points | | mp °C | source | |
|---|
| 170.00 | Alfa Aesar | | 169.50 | PHYSPROP |
|
|
| | | 4-amino-N-carbamothioylbenzenesulfonamide C7H9N3O2S264, 64 |
 | | Compound Data | | Melting point | 180.50 °C | 453.65 K | | CSID | 2272143 | H bond acceptors | 5 | Rule of 5 violations | 1 | | Molecular weight | 231.2953 | H bond donors | 5 | ACD/LogP | -0.48 | | Phase 25 °C | solid | Rotatable bonds | 2 | Predicted density | 1.53 g/cm3 | | SMILES | O=S(=O)(c1ccc(N)cc1)NC(=S)N | | STD InChIKey | UEMLYRZWLVXWRU-UHFFFAOYAW | | Melting Points | | mp °C | source | |
|---|
| 182.00 | PHYSPROP | | 179.00 | PHYSPROP |
|
|
| | | 4-aminoacetanilide C8H10N2O3, 64 |
 | | Compound Data | | Melting point | 164.75 °C | 437.90 K | | CSID | 10297844 | H bond acceptors | 3 | Rule of 5 violations | 0 | | Molecular weight | 150.1778 | H bond donors | 3 | ACD/LogP | 0.08 | | Phase 25 °C | solid | Rotatable bonds | 2 | Predicted density | 1.20 g/cm3 | | SMILES | Nc1ccc(NC(C)=O)cc1 | | STD InChIKey | CHMBIJAOCISYEW-UHFFFAOYAK | | Melting Points | | mp °C | source | |
|---|
| 163.00 | Alfa Aesar | | 166.50 | PHYSPROP |
|
|
| | | 4-aminobenzamide C7H8N2O2, 3, 64 |
 | |
|
| | | 4-aminobenzenesulfonamide C6H8N2O2S3, 32, 44, 61, 64 |
 | |
|
| | | 4-aminobenzhydrazide C7H9N3O3, 64 |
 | | Compound Data | | Melting point | 227.00 °C | 500.15 K | | CSID | 20160 | H bond acceptors | 4 | Rule of 5 violations | 1 | | Molecular weight | 151.1659 | H bond donors | 5 | ACD/LogP | -0.75 | | Phase 25 °C | solid | Rotatable bonds | 3 | Predicted density | 1.27 g/cm3 | | SMILES | O=C(c1ccc(N)cc1)NN | | STD InChIKey | WPBZMCGPFHZRHJ-UHFFFAOYAL | | Melting Points | | mp °C | source | |
|---|
| 228.00 | Alfa Aesar | | 226.00 | PHYSPROP |
|
|
| | | 4-aminobenzoic acid C7H7NO22, 3, 32, 35, 44, 61, 64, 70, 70 |
 | |
|
| | | 4-aminobenzophenone C13H11NO3, 64 |
 | | Compound Data | | Melting point | 122.75 °C | 395.90 K | | CSID | 13707 | H bond acceptors | 2 | Rule of 5 violations | 0 | | Molecular weight | 197.2325 | H bond donors | 2 | ACD/LogP | 2.42 | | Phase 25 °C | solid | Rotatable bonds | 3 | Predicted density | 1.16 g/cm3 | | SMILES | O=C(c1ccc(N)cc1)c2ccccc2 | | STD InChIKey | RBKHNGHPZZZJCI-UHFFFAOYAH | | Melting Points | | mp °C | source | |
|---|
| 123.00 | Alfa Aesar | | 122.50 | PHYSPROP |
|
|
| | | 4-aminobenzyl cyanide C8H8N22, 2, 3, 64 |
 | |
|
| | | 4-aminobiphenyl C12H11N7, 61, 64 |
 | |
|
| | | 4-aminophenol C6H7NO2, 3, 61, 64 |
 | |
|
| | | 4-aminopyridine C5H6N23, 64 |
 | | Compound Data | | Melting point | 158.75 °C | 431.90 K | | CSID | 1664 | H bond acceptors | 2 | Rule of 5 violations | 0 | | Molecular weight | 94.1145 | H bond donors | 2 | ACD/LogP | 0.26 | | Phase 25 °C | solid | Rotatable bonds | 1 | Predicted density | 1.11 g/cm3 | | SMILES | n1ccc(N)cc1 | | STD InChIKey | NUKYPUAOHBNCPY-UHFFFAOYAH | | Melting Points | | mp °C | source | |
|---|
| 159.00 | Alfa Aesar | | 158.50 | PHYSPROP |
|
|
| | | 4-aminopyrimidine C16H10ClN39, 48, 64 |
 | |
|
| | | 4-aminostyrene C8H9N3, 7, 64 |
 | |
|
| | | 4-benzoylbenzoic acid C14H10O33, 61, 64 |
 | | Compound Data | | Melting point | 198.67 °C | 471.82 K | | CSID | 62362 | H bond acceptors | 3 | Rule of 5 violations | 0 | | Molecular weight | 226.2274 | H bond donors | 1 | ACD/LogP | 3.29 | | Phase 25 °C | solid | Rotatable bonds | 3 | Predicted density | 1.26 g/cm3 | | SMILES | O=C(O)c2ccc(C(=O)c1ccccc1)cc2 | | STD InChIKey | IFQUPKAISSPFTE-UHFFFAOYAO | | Melting Points | | mp °C | source | |
|---|
| 199.00 | Alfa Aesar | | 198.00 | Oxford University MSDS | | 199.00 | PHYSPROP |
|
|
| | | 4-benzoylbiphenyl C19H14O3, 64 |
 | | Compound Data | | Melting point | 100.50 °C | 373.65 K | | CSID | 67593 | H bond acceptors | 1 | Rule of 5 violations | 1 | | Molecular weight | 258.3139 | H bond donors | 0 | ACD/LogP | 5.37 | | Phase 25 °C | solid | Rotatable bonds | 3 | Predicted density | 1.11 g/cm3 | | SMILES | O=C(c2ccc(c1ccccc1)cc2)c3ccccc3 | | STD InChIKey | LYXOWKPVTCPORE-UHFFFAOYAO | | Melting Points | | mp °C | source | |
|---|
| 101.00 | Alfa Aesar | | 100.00 | PHYSPROP |
|
|
| | | 4-benzoylbutyric acid C11H12O33, 64 |
 | | Compound Data | | Melting point | 127.12 °C | 400.27 K | | CSID | 66547 | H bond acceptors | 3 | Rule of 5 violations | 0 | | Molecular weight | 192.2112 | H bond donors | 1 | ACD/LogP | 1.49 | | Phase 25 °C | solid | Rotatable bonds | 5 | Predicted density | 1.16 g/cm3 | | SMILES | O=C(c1ccccc1)CCCC(=O)O | | STD InChIKey | SHKWSBAVRQZYLE-UHFFFAOYAT | | Melting Points | | mp °C | source | |
|---|
| 127.00 | Alfa Aesar | | 127.25 | PHYSPROP |
|
|
| | | 4-benzoylpyridine C12H9NO3, 64 |
 | | Compound Data | | Melting point | 71.00 °C | 344.15 K | | CSID | 24905 | H bond acceptors | 2 | Rule of 5 violations | 0 | | Molecular weight | 183.206 | H bond donors | 0 | ACD/LogP | 1.89 | | Phase 25 °C | solid | Rotatable bonds | 2 | Predicted density | 1.14 g/cm3 | | SMILES | O=C(c1ccccc1)c2ccncc2 | | STD InChIKey | SKFLCXNDKRUHTA-UHFFFAOYAL | | Melting Points | | mp °C | source | |
|---|
| 70.00 | Alfa Aesar | | 72.00 | PHYSPROP |
|
|
| | | 4-benzylbiphenyl C19H163, 64 |
 | | Compound Data | | Melting point | 85.50 °C | 358.65 K | | CSID | 62389 | H bond acceptors | 0 | Rule of 5 violations | 1 | | Molecular weight | 244.3303 | H bond donors | 0 | ACD/LogP | 5.96 | | Phase 25 °C | solid | Rotatable bonds | 3 | Predicted density | 1.04 g/cm3 | | SMILES | c1c(cccc1)Cc2ccc(cc2)c3ccccc3 | | STD InChIKey | AGPLQTQFIZBOLI-UHFFFAOYAY | | Melting Points | | mp °C | source | |
|---|
| 86.00 | Alfa Aesar | | 85.00 | PHYSPROP |
|
|
| | | 4-benzylphenol C13H12O3, 64 |
 | | Compound Data | | Melting point | 83.50 °C | 356.65 K | | CSID | 21159439 | H bond acceptors | 1 | Rule of 5 violations | 0 | | Molecular weight | 184.2338 | H bond donors | 1 | ACD/LogP | 3.47 | | Phase 25 °C | solid | Rotatable bonds | 3 | Predicted density | 1.10 g/cm3 | | SMILES | Oc2ccc(Cc1ccccc1)cc2 | | STD InChIKey | HJSPWKGEPDZNLK-UHFFFAOYAX | | Melting Points | | mp °C | source | |
|---|
| 83.00 | Alfa Aesar | | 84.00 | PHYSPROP |
|
|
| | | 4-benzylpyridine C12H11N3, 64 |
 | | Compound Data | | Melting point | 11.20 °C | 284.35 K | | CSID | 15603 | H bond acceptors | 1 | Rule of 5 violations | 0 | | Molecular weight | 169.2224 | H bond donors | 0 | ACD/LogP | 2.71 | | Phase 25 °C | liquid/gas | Rotatable bonds | 2 | Predicted density | 1.04 g/cm3 | | SMILES | n1ccc(cc1)Cc2ccccc2 | | STD InChIKey | DBOLXXRVIFGDTI-UHFFFAOYAL | | Melting Points | | mp °C | source | |
|---|
| 10.00 | Alfa Aesar | | 12.40 | PHYSPROP |
|
|
| | | 4-benzyltoluene C14H144, 64 |
 | | Compound Data | | Melting point | 6.80 °C | 279.95 K | | CSID | 62938 | H bond acceptors | 0 | Rule of 5 violations | 0 | | Molecular weight | 182.261 | H bond donors | 0 | ACD/LogP | 4.67 | | Phase 25 °C | liquid/gas | Rotatable bonds | 2 | Predicted density | 0.98 g/cm3 | | SMILES | c1c(cccc1)Cc2ccccc2C | | STD InChIKey | PQTAUFTUHHRKSS-UHFFFAOYAY | | Melting Points | | mp °C | source | |
|---|
| 7.00 | American Petroleum Institute. Research Project 44; Selected ... | | 6.60 | PHYSPROP |
|
|
| | | 4-benzyltoluene C14H144, 53, 59, 59, 64, 64, 76 |
 | |
|
| | | 4-biphenylacetic acid C14H12O23, 64 |
 | | Compound Data | | Melting point | 160.75 °C | 433.90 K | | CSID | 3215 | H bond acceptors | 2 | Rule of 5 violations | 0 | | Molecular weight | 212.2439 | H bond donors | 1 | ACD/LogP | 3.26 | | Phase 25 °C | solid | Rotatable bonds | 3 | Predicted density | 1.17 g/cm3 | | SMILES | O=C(O)Cc1ccc(cc1)c2ccccc2 | | STD InChIKey | QRZAKQDHEVVFRX-UHFFFAOYAC | | Melting Points | | mp °C | source | |
|---|
| 161.00 | Alfa Aesar | | 160.50 | PHYSPROP |
|
|
| | | 4-bromo-1,2-dichlorobenzene C6H3BrCl23, 64 |
 | | Compound Data | | Melting point | 24.50 °C | 297.65 K | | CSID | 13881395 | H bond acceptors | 0 | Rule of 5 violations | 0 | | Molecular weight | 225.898 | H bond donors | 0 | ACD/LogP | 3.94 | | Phase 25 °C | liquid/gas | Rotatable bonds | 0 | Predicted density | 1.74 g/cm3 | | SMILES | Clc1cc(Br)ccc1Cl | | STD InChIKey | CFPZDVAZISWERM-UHFFFAOYAW | | Melting Points | | mp °C | source | |
|---|
| 24.00 | Alfa Aesar | | 25.00 | PHYSPROP |
|
|
| | | 4-bromo-2-chlorophenol C6H4BrClO3, 64 |
 | | Compound Data | | Melting point | 49.75 °C | 322.90 K | | CSID | 18707 | H bond acceptors | 1 | Rule of 5 violations | 0 | | Molecular weight | 207.4524 | H bond donors | 1 | ACD/LogP | 3.00 | | Phase 25 °C | solid | Rotatable bonds | 1 | Predicted density | 1.79 g/cm3 | | SMILES | Clc1cc(Br)ccc1O | | STD InChIKey | VIBJPUXLAKVICD-UHFFFAOYAV | | Melting Points | | mp °C | source | |
|---|
| 49.00 | Alfa Aesar | | 50.50 | PHYSPROP |
|
|
| | | 4-bromo-2-methylphenol C7H7BrO3, 64 |
 | | Compound Data | | Melting point | 64.35 °C | 337.50 K | | CSID | 16011 | H bond acceptors | 1 | Rule of 5 violations | 0 | | Molecular weight | 187.0339 | H bond donors | 1 | ACD/LogP | 2.95 | | Phase 25 °C | solid | Rotatable bonds | 1 | Predicted density | 1.55 g/cm3 | | SMILES | Brc1cc(c(O)cc1)C | | STD InChIKey | IWJGMJHAIUBWKT-UHFFFAOYAK | | Melting Points | | mp °C | source | |
|---|
| 64.00 | Alfa Aesar | | 64.70 | PHYSPROP |
|
|
| | | 4-bromo-2-nitroaniline C6H5BrN2O23, 64 |
 | | Compound Data | | Melting point | 111.75 °C | 384.90 K | | CSID | 63320 | H bond acceptors | 4 | Rule of 5 violations | 0 | | Molecular weight | 217.0201 | H bond donors | 2 | ACD/LogP | 2.75 | | Phase 25 °C | solid | Rotatable bonds | 2 | Predicted density | 1.81 g/cm3 | | SMILES | Brc1cc([N+]([O-])=O)c(N)cc1 | | STD InChIKey | ZCWBZRBJSPWUPG-UHFFFAOYAV | | Melting Points | | mp °C | source | |
|---|
| 112.00 | Alfa Aesar | | 111.50 | PHYSPROP |
|
|
| | | 4-bromo-3-methylaniline C7H8BrN2, 3, 64 |
 | |
|
| | | 4-bromo-3-methylphenol C7H7BrO3, 48, 64 |
 | |
|
| | | 4-bromo-3-methylpyrazole C4H5BrN23, 64 |
 | | Compound Data | | Melting point | 75.75 °C | 348.90 K | | CSID | 75563 | H bond acceptors | 2 | Rule of 5 violations | 0 | | Molecular weight | 160.9999 | H bond donors | 1 | ACD/LogP | 1.55 | | Phase 25 °C | solid | Rotatable bonds | 0 | Predicted density | 1.72 g/cm3 | | SMILES | Brc1cnnc1C | | STD InChIKey | IXQPRETWBGVNPJ-UHFFFAOYAW | | Melting Points | | mp °C | source | |
|---|
| 75.00 | Alfa Aesar | | 76.50 | PHYSPROP |
|
|
| | | 4-bromo-N,N-diethylaniline C10H14BrN3, 64 |
 | | Compound Data | | Melting point | 36.00 °C | 309.15 K | | CSID | 21159579 | H bond acceptors | 1 | Rule of 5 violations | 0 | | Molecular weight | 228.1289 | H bond donors | 0 | ACD/LogP | 4.40 | | Phase 25 °C | solid | Rotatable bonds | 3 | Predicted density | 1.29 g/cm3 | | SMILES | Brc1ccc(cc1)N(CC)CC | | STD InChIKey | NGYMZFJVHHKJQR-UHFFFAOYAE | | Melting Points | | mp °C | source | |
|---|
| 34.00 | Alfa Aesar | | 38.00 | PHYSPROP |
|
|
| | | 4-bromo-N,N-dimethylaniline C8H10BrN2, 3, 64 |
 | |
|
| | | 4-bromoacetophenone C8H7BrO2, 3, 64 |
 | |
|
| | | 4-bromoaniline C6H6BrN2, 3, 61, 64 |
 | |
|
| | | 4-bromoanisole C7H7BrO2, 3, 64 |
 | |
|
| | | 4-bromobenzamide C7H6BrNO2, 3, 64 |
 | |
|
| | | 4-bromobenzenesulfonyl chloride C6H4BrClO2S3, 64 |
 | | Compound Data | | Melting point | 75.50 °C | 348.65 K | | CSID | 7118 | H bond acceptors | 2 | Rule of 5 violations | 0 | | Molecular weight | 255.5168 | H bond donors | 0 | ACD/LogP | 3.02 | | Phase 25 °C | solid | Rotatable bonds | 1 | Predicted density | 1.79 g/cm3 | | SMILES | O=S(Cl)(=O)c1ccc(Br)cc1 | | STD InChIKey | KMMHZIBWCXYAAH-UHFFFAOYAQ | | Melting Points | | mp °C | source | |
|---|
| 75.00 | Alfa Aesar | | 76.00 | PHYSPROP |
|
|
| | | 4-bromobenzhydrazide C7H7BrN2O3, 64 |
 | | Compound Data | | Melting point | 167.00 °C | 440.15 K | | CSID | 20861 | H bond acceptors | 3 | Rule of 5 violations | 0 | | Molecular weight | 215.0473 | H bond donors | 3 | ACD/LogP | 1.28 | | Phase 25 °C | solid | Rotatable bonds | 2 | Predicted density | 1.61 g/cm3 | | SMILES | O=C(c1ccc(Br)cc1)NN | | STD InChIKey | UYIMBYKIIMYFPS-UHFFFAOYAQ | | Melting Points | | mp °C | source | |
|---|
| 168.00 | Alfa Aesar | | 166.00 | PHYSPROP |
|
|
| | | 4-bromobenzoic acid C7H5BrO22, 3, 64, 70 |
 | |
|
| | | 4-bromobenzonitrile C7H4BrN2, 3, 64 |
 | |
|
| | | 4-bromobenzophenone C13H9BrO2, 3, 64 |
 | |
|
| | | 4-bromobenzoyl chloride C7H4BrClO3, 64 |
 | | Compound Data | | Melting point | 41.00 °C | 314.15 K | | CSID | 61790 | H bond acceptors | 1 | Rule of 5 violations | 0 | | Molecular weight | 219.4631 | H bond donors | 0 | ACD/LogP | 3.15 | | Phase 25 °C | solid | Rotatable bonds | 1 | Predicted density | 1.66 g/cm3 | | SMILES | O=C(Cl)c1ccc(Br)cc1 | | STD InChIKey | DENKGPBHLYFNGK-UHFFFAOYAR | | Melting Points | | mp °C | source | |
|---|
| 40.00 | Alfa Aesar | | 42.00 | PHYSPROP |
|
|
| | | 4-bromobenzoyl chloride C8H7NO22, 3, 61, 64 |
 | |
|
| | | 4-bromobenzyl alcohol C7H7BrO2, 3 |
 | |
|
| | | 4-bromobenzyl bromide C9H11BrO3, 64 |
 | | Compound Data | | Melting point | 10.35 °C | 283.50 K | | CSID | 61797 | H bond acceptors | 1 | Rule of 5 violations | 0 | | Molecular weight | 215.087 | H bond donors | 0 | ACD/LogP | 3.29 | | Phase 25 °C | liquid/gas | Rotatable bonds | 4 | Predicted density | 1.35 g/cm3 | | SMILES | BrCCCOc1ccccc1 | | STD InChIKey | NIDWUZTTXGJFNN-UHFFFAOYAV | | Melting Points | | mp °C | source | |
|---|
| 10.00 | Alfa Aesar | | 10.70 | PHYSPROP |
|
|
| | | 4-bromobenzyl bromide C7H6Br23, 64 |
 | | Compound Data | | Melting point | 62.50 °C | 335.65 K | | CSID | 61802 | H bond acceptors | 0 | Rule of 5 violations | 0 | | Molecular weight | 249.9305 | H bond donors | 0 | ACD/LogP | 3.69 | | Phase 25 °C | solid | Rotatable bonds | 1 | Predicted density | 1.85 g/cm3 | | SMILES | BrCc1ccc(Br)cc1 | | STD InChIKey | YLRBJYMANQKEAW-UHFFFAOYAE | | Melting Points | | mp °C | source | |
|---|
| 62.00 | Alfa Aesar | | 63.00 | PHYSPROP |
|
|
| | | 4-bromobenzyl cyanide C8H6BrN2, 3, 64 |
 | |
|
| | | 4-bromobiphenyl C12H9Br3, 64 |
 | | Compound Data | | Melting point | 90.75 °C | 363.90 K | | CSID | 6834 | H bond acceptors | 0 | Rule of 5 violations | 0 | | Molecular weight | 233.1039 | H bond donors | 0 | ACD/LogP | 4.88 | | Phase 25 °C | solid | Rotatable bonds | 1 | Predicted density | 1.36 g/cm3 | | SMILES | Brc2ccc(c1ccccc1)cc2 | | STD InChIKey | PKJBWOWQJHHAHG-UHFFFAOYAK | | Melting Points | | mp °C | source | |
|---|
| 90.00 | Alfa Aesar | | 91.50 | PHYSPROP |
|
|
| | | 4-bromochlorobenzene C6H4BrCl2, 3, 64 |
 | |
|
| | | 4-bromodiphenyl ether C12H9BrO3, 64 |
 | | Compound Data | | Melting point | 18.36 °C | 291.51 K | | CSID | 7284 | H bond acceptors | 1 | Rule of 5 violations | 1 | | Molecular weight | 249.1033 | H bond donors | 0 | ACD/LogP | 5.11 | | Phase 25 °C | liquid/gas | Rotatable bonds | 2 | Predicted density | 1.41 g/cm3 | | SMILES | Brc2ccc(Oc1ccccc1)cc2 | | STD InChIKey | JDUYPUMQALQRCN-UHFFFAOYAP | | Melting Points | | mp °C | source | |
|---|
| 18.00 | Alfa Aesar | | 18.72 | PHYSPROP |
|
|
| | | 4-bromoisoquinoline C9H6BrN3, 64 |
 | | Compound Data | | Melting point | 41.25 °C | 314.40 K | | CSID | 66385 | H bond acceptors | 1 | Rule of 5 violations | 0 | | Molecular weight | 208.0546 | H bond donors | 0 | ACD/LogP | 2.98 | | Phase 25 °C | solid | Rotatable bonds | 0 | Predicted density | 1.56 g/cm3 | | SMILES | Brc2c1c(cccc1)cnc2 | | STD InChIKey | SCRBSGZBTHKAHU-UHFFFAOYAW | | Melting Points | | mp °C | source | |
|---|
| 41.00 | Alfa Aesar | | 41.50 | PHYSPROP |
|
|
| | | 4-bromonitrobenzene C6H4BrNO22, 3, 64 |
 | |
|
| | | 4-bromophenol C6H5BrO2, 3, 64, 72 |
 | |
|
| | | 4-bromophenyl isothiocyanate C7H4BrNS3, 64 |
 | | Compound Data | | Melting point | 59.25 °C | 332.40 K | | CSID | 15317 | H bond acceptors | 1 | Rule of 5 violations | 0 | | Molecular weight | 214.0824 | H bond donors | 0 | ACD/LogP | 4.03 | | Phase 25 °C | solid | Rotatable bonds | 1 | Predicted density | 1.50 g/cm3 | | SMILES | Brc1ccc(\N=C=S)cc1 | | STD InChIKey | XQACWEBGSZBLRG-UHFFFAOYAV | | Melting Points | | mp °C | source | |
|---|
| 58.00 | Alfa Aesar | | 60.50 | PHYSPROP |
|
|
| | | 4-bromophenylacetic acid C8H7BrO23, 35, 64 |
 | | Compound Data | | Melting point | 116.33 °C | 389.48 K | | CSID | 67229 | H bond acceptors | 2 | Rule of 5 violations | 0 | | Molecular weight | 215.044 | H bond donors | 1 | ACD/LogP | 2.28 | | Phase 25 °C | solid | Rotatable bonds | 2 | Predicted density | 1.62 g/cm3 | | SMILES | Brc1ccc(cc1)CC(=O)O | | STD InChIKey | QOWSWEBLNVACCL-UHFFFAOYAS | | Melting Points | | mp °C | source | |
|---|
| 117.00 | Alfa Aesar | | 116.00 | EPISuite-ChemSpider | | 116.00 | PHYSPROP |
|
|
| | | 4-bromopropiophenone C9H9BrO3, 64 |
 | | Compound Data | | Melting point | 47.00 °C | 320.15 K | | CSID | 59691 | H bond acceptors | 1 | Rule of 5 violations | 0 | | Molecular weight | 213.0712 | H bond donors | 0 | ACD/LogP | 2.96 | | Phase 25 °C | solid | Rotatable bonds | 2 | Predicted density | 1.39 g/cm3 | | SMILES | O=C(c1ccc(Br)cc1)CC | | STD InChIKey | UOMOSYFPKGQIKI-UHFFFAOYAL | | Melting Points | | mp °C | source | |
|---|
| 46.00 | Alfa Aesar | | 48.00 | PHYSPROP |
|
|
| | | 4-bromostyrene C8H7Br3, 64 |
 | | Compound Data | | Melting point | 6.35 °C | 279.50 K | | CSID | 15431 | H bond acceptors | 0 | Rule of 5 violations | 0 | | Molecular weight | 183.0452 | H bond donors | 0 | ACD/LogP | 3.59 | | Phase 25 °C | liquid/gas | Rotatable bonds | 1 | Predicted density | 1.39 g/cm3 | | SMILES | Brc1ccc(\C=C)cc1 | | STD InChIKey | WGGLDBIZIQMEGH-UHFFFAOYAY | | Melting Points | | mp °C | source | |
|---|
| 5.00 | Alfa Aesar | | 7.70 | PHYSPROP |
|
|
| | | 4-bromothiophenol C6H5BrS3, 64 |
 | | Compound Data | | Melting point | 74.00 °C | 347.15 K | | CSID | 59439 | H bond acceptors | 0 | Rule of 5 violations | 0 | | Molecular weight | 189.0729 | H bond donors | 0 | ACD/LogP | 3.53 | | Phase 25 °C | solid | Rotatable bonds | 1 | Predicted density | 1.60 g/cm3 | | SMILES | Brc1ccc(S)cc1 | | STD InChIKey | FTBCOQFMQSTCQQ-UHFFFAOYAM | | Melting Points | | mp °C | source | |
|---|
| 75.00 | Alfa Aesar | | 73.00 | PHYSPROP |
|
|
| | | 4-butoxybenzoic acid C11H14O32, 64 |
 | | Compound Data | | Melting point | 147.75 °C | 420.90 K | | CSID | 65785 | H bond acceptors | 3 | Rule of 5 violations | 0 | | Molecular weight | 194.2271 | H bond donors | 1 | ACD/LogP | 3.55 | | Phase 25 °C | solid | Rotatable bonds | 5 | Predicted density | 1.11 g/cm3 | | SMILES | O=C(O)c1ccc(OCCCC)cc1 | | STD InChIKey | LAUFPZPAKULAGB-UHFFFAOYAE | | Melting Points | | mp °C | source | |
|---|
| 147.00 | Aldrich Chemical Company; Aldrich Catalog-Handbook of Fine C... | | 148.50 | PHYSPROP |
|
|
| | | 4-butoxyphenol C10H14O22, 64 |
 | | Compound Data | | Melting point | 65.25 °C | 338.40 K | | CSID | 28973 | H bond acceptors | 2 | Rule of 5 violations | 0 | | Molecular weight | 166.217 | H bond donors | 1 | ACD/LogP | 2.90 | | Phase 25 °C | solid | Rotatable bonds | 5 | Predicted density | 1.03 g/cm3 | | SMILES | O(c1ccc(O)cc1)CCCC | | STD InChIKey | MBGGFXOXUIDRJD-UHFFFAOYAH | | Melting Points | | mp °C | source | |
|---|
| 65.00 | Aldrich Chemical Company; Aldrich Catalog-Handbook of Fine C... | | 65.50 | PHYSPROP |
|
|
| | | 4-chlor-2-methoxyanilin C7H8ClNO2, 64 |
 | | Compound Data | | Melting point | 51.50 °C | 324.65 K | | CSID | 21159424 | H bond acceptors | 2 | Rule of 5 violations | 0 | | Molecular weight | 157.5975 | H bond donors | 2 | ACD/LogP | 2.14 | | Phase 25 °C | solid | Rotatable bonds | 2 | Predicted density | 1.23 g/cm3 | | SMILES | Nc1ccc(Cl)cc1OC | | STD InChIKey | WOXLPNAOCCIZGP-UHFFFAOYAL | | Melting Points | | mp °C | source | |
|---|
| 51.00 | Aldrich Chemical Company; Aldrich Catalog-Handbook of Fine C... | | 52.00 | PHYSPROP |
|
|
| | | 4-chloro-2-fluoroacetanilide C8H7ClFNO3, 22, 23, 64 |
 | | Compound Data | | Melting point | 156.00 °C | 429.15 K | | CSID | 745600 | H bond acceptors | 2 | Rule of 5 violations | 0 | | Molecular weight | 187.5987 | H bond donors | 1 | ACD/LogP | 1.43 | | Phase 25 °C | solid | Rotatable bonds | 1 | Predicted density | 1.35 g/cm3 | | SMILES | Clc1cc(F)c(NC(=O)C)cc1 | | STD InChIKey | GVRKNSAEOVXHOS-UHFFFAOYAV | | Melting Points | | mp °C | source | |
|---|
| 156.00 | Alfa Aesar | | 155.00 | ChemKoo | | 157.00 | ChemNet | | Values not used in calculating the average melting point | | 48.50 | PHYSPROP1 | | 1. clearly out of range JCB |
|
|
| | | 4-chloro-2-methoxybenzoic acid C8H7ClO32, 3 |
 | | Compound Data | | Melting point | 146.50 °C | 419.65 K | | CSID | 84565 | H bond acceptors | 3 | Rule of 5 violations | 0 | | Molecular weight | 186.5924 | H bond donors | 1 | ACD/LogP | 2.48 | | Phase 25 °C | solid | Rotatable bonds | 2 | Predicted density | 1.35 g/cm3 | | SMILES | O=C(O)c1c(OC)cc(Cl)cc1 | | STD InChIKey | UFEYMXHWIHFRBX-UHFFFAOYAL | | Melting Points | | mp °C | source | |
|---|
| 146.00 | Aldrich Chemical Company; Aldrich Catalog-Handbook of Fine C... | | 147.00 | Alfa Aesar |
|
|
| | | 4-chloro-2-methoxyphenol C7H7ClO23, 64 |
 | | Compound Data | | Melting point | 16.75 °C | 289.90 K | | CSID | 26091 | H bond acceptors | 2 | Rule of 5 violations | 0 | | Molecular weight | 158.5823 | H bond donors | 1 | ACD/LogP | 2.36 | | Phase 25 °C | liquid/gas | Rotatable bonds | 2 | Predicted density | 1.28 g/cm3 | | SMILES | Clc1cc(OC)c(O)cc1 | | STD InChIKey | FVZQMMMRFNURSH-UHFFFAOYAH | | Melting Points | | mp °C | source | |
|---|
| 17.00 | Alfa Aesar | | 16.50 | PHYSPROP |
|
|
| | | 4-chloro-2-methylphenol C7H7ClO2, 3, 64 |
 | |
|
| | | 4-chloro-2-nitroaniline C6H5ClN2O22, 3, 61, 64 |
 | |
|
| | | 4-chloro-2-nitrophenol C6H4ClNO33, 48, 64 |
 | |
|
| | | 4-chloro-2-nitrotoluene C7H6ClNO22, 3, 64 |
 | |
|
| | | 4-chloro-3-methylaniline C7H8ClN3, 64 |
 | | Compound Data | | Melting point | 83.75 °C | 356.90 K | | CSID | 22006 | H bond acceptors | 1 | Rule of 5 violations | 0 | | Molecular weight | 141.5981 | H bond donors | 2 | ACD/LogP | 2.22 | | Phase 25 °C | solid | Rotatable bonds | 1 | Predicted density | 1.18 g/cm3 | | SMILES | Clc1ccc(N)cc1C | | STD InChIKey | HIHCTGNZNHSZPP-UHFFFAOYAB | | Melting Points | | mp °C | source | |
|---|
| 84.00 | Alfa Aesar | | 83.50 | PHYSPROP |
|
|
| | | 4-chloro-3-methylphenol C7H7ClO2, 3, 61, 64 |
 | |
|
| | | 4-chloro-3-nitroaniline C6H5ClN2O22, 3, 64 |
 | |
|
| | | 4-chloro-3-nitrobenzoic acid C7H4ClNO43, 35, 64 |
 | | Compound Data | | Melting point | 182.53 °C | 455.68 K | | CSID | 7044 | H bond acceptors | 5 | Rule of 5 violations | 0 | | Molecular weight | 201.564 | H bond donors | 1 | ACD/LogP | 2.37 | | Phase 25 °C | solid | Rotatable bonds | 2 | Predicted density | 1.60 g/cm3 | | SMILES | O=[N+]([O-])c1cc(ccc1Cl)C(=O)O | | STD InChIKey | DFXQXFGFOLXAPO-UHFFFAOYAM | | Melting Points | | mp °C | source | |
|---|
| 182.00 | Alfa Aesar | | 182.80 | EPISuite-ChemSpider | | 182.80 | PHYSPROP |
|
|
| | | 4-chloro-3-nitrobenzonitrile C7H3ClN2O23, 64 |
 | | Compound Data | | Melting point | 99.50 °C | 372.65 K | | CSID | 13066 | H bond acceptors | 4 | Rule of 5 violations | 0 | | Molecular weight | 182.5639 | H bond donors | 0 | ACD/LogP | 1.87 | | Phase 25 °C | solid | Rotatable bonds | 1 | Predicted density | 1.48 g/cm3 | | SMILES | c1cc(c(cc1C#N)[N+](=O)[O-])Cl | | STD InChIKey | XBLPHYSLHRGMNW-UHFFFAOYAQ | | Melting Points | | mp °C | source | |
|---|
| 100.00 | Alfa Aesar | | 99.00 | PHYSPROP |
|
|
| | | 4-chloro-3-nitrobenzotrifluoride C7H3ClF3NO23, 64 |
 | | Compound Data | | Melting point | -2.75 °C | 270.40 K | | CSID | 8151 | H bond acceptors | 3 | Rule of 5 violations | 0 | | Molecular weight | 225.5524 | H bond donors | 0 | ACD/LogP | 3.02 | | Phase 25 °C | liquid/gas | Rotatable bonds | 1 | Predicted density | 1.54 g/cm3 | | SMILES | c1cc(c(cc1C(F)(F)F)[N+](=O)[O-])Cl | | STD InChIKey | TZGFQIXRVUHDLE-UHFFFAOYAM | | Melting Points | | mp °C | source | |
|---|
| -3.00 | Alfa Aesar | | -2.50 | PHYSPROP |
|
|
| | | 4-chloro-3-sulfamoylbenzoic acid C7H6ClNO4S3, 64 |
 | | Compound Data | | Melting point | 257.50 °C | 530.65 K | | CSID | 13909 | H bond acceptors | 5 | Rule of 5 violations | 0 | | Molecular weight | 235.6448 | H bond donors | 3 | ACD/LogP | 0.92 | | Phase 25 °C | solid | Rotatable bonds | 2 | Predicted density | 1.65 g/cm3 | | SMILES | O=S(=O)(c1cc(ccc1Cl)C(=O)O)N | | STD InChIKey | FHQAWINGVCDTTG-UHFFFAOYAK | | Melting Points | | mp °C | source | |
|---|
| 258.00 | Alfa Aesar | | 257.00 | PHYSPROP |
|
|
| | | 4-chloro-3,5-dimethylphenol C8H9ClO2, 3, 61, 64 |
 | |
|
| | | 4-chloro-3,5-dinitrobenzonitrile C7H2ClN3O43, 64 |
 | | Compound Data | | Melting point | 140.88 °C | 414.02 K | | CSID | 15209 | H bond acceptors | 7 | Rule of 5 violations | 0 | | Molecular weight | 227.5615 | H bond donors | 0 | ACD/LogP | 0.75 | | Phase 25 °C | solid | Rotatable bonds | 2 | Predicted density | 1.68 g/cm3 | | SMILES | O=[N+]([O-])c1cc(C#N)cc([N+]([O-])=O)c1Cl | | STD InChIKey | SCGDEDHSPCXGEC-UHFFFAOYAA | | Melting Points | | mp °C | source | |
|---|
| 141.00 | Alfa Aesar | | 140.75 | PHYSPROP |
|
|
| | | 4-chloroacetanilide C8H8ClNO2, 3, 64 |
 | |
|
| | | 4-chloroacetophenone C8H7ClO3, 31, 64 |
 | |
|
| | | 4-chloroaniline C6H6ClN2, 3, 61, 64 |
 | |
|
| | | 4-chlorobenzaldehyde C7H5ClO2, 3, 3, 61, 64 |
 | |
|
| | | 4-chlorobenzamide C7H6ClNO2, 3, 64 |
 | |
|
| | | 4-chlorobenzenesulfonamide C6H6ClNO2S2, 3 |
 | | Compound Data | | Melting point | 145.50 °C | 418.65 K | | CSID | 60188 | H bond acceptors | 3 | Rule of 5 violations | 0 | | Molecular weight | 191.6353 | H bond donors | 2 | ACD/LogP | 0.84 | | Phase 25 °C | solid | Rotatable bonds | 1 | Predicted density | 1.47 g/cm3 | | SMILES | O=S(=O)(c1ccc(Cl)cc1)N | | STD InChIKey | HHHDJHHNEURCNV-UHFFFAOYAK | | Melting Points | | mp °C | source | |
|---|
| 145.00 | Aldrich Chemical Company; Aldrich Catalog-Handbook of Fine C... | | 146.00 | Alfa Aesar |
|
|
| | | 4-chlorobenzenesulfonyl chloride C6H4Cl2O2S3, 64 |
 | | Compound Data | | Melting point | 51.50 °C | 324.65 K | | CSID | 7120 | H bond acceptors | 2 | Rule of 5 violations | 0 | | Molecular weight | 211.0658 | H bond donors | 0 | ACD/LogP | 2.84 | | Phase 25 °C | solid | Rotatable bonds | 1 | Predicted density | 1.53 g/cm3 | | SMILES | O=S(Cl)(=O)c1ccc(Cl)cc1 | | STD InChIKey | ZLYBFBAHAQEEQQ-UHFFFAOYAF | | Melting Points | | mp °C | source | |
|---|
| 52.00 | Alfa Aesar | | 51.00 | PHYSPROP |
|
|
| | | 4-chlorobenzoic acid C7H5ClO22, 3, 61, 64 |
 | |
|
| | | 4-chlorobenzonitrile C7H4ClN2, 3, 64 |
 | |
|
| | | 4-chlorobenzophenone C13H9ClO2, 3, 64 |
 | |
|
| | | 4-chlorobenzoyl chloride C7H4Cl2O3, 61, 64 |
 | | Compound Data | | Melting point | 13.67 °C | 286.82 K | | CSID | 8187 | H bond acceptors | 1 | Rule of 5 violations | 0 | | Molecular weight | 175.0121 | H bond donors | 0 | ACD/LogP | 2.97 | | Phase 25 °C | liquid/gas | Rotatable bonds | 1 | Predicted density | 1.37 g/cm3 | | SMILES | O=C(Cl)c1ccc(Cl)cc1 | | STD InChIKey | RKIDDEGICSMIJA-UHFFFAOYAV | | Melting Points | | mp °C | source | |
|---|
| 12.00 | Alfa Aesar | | 13.00 | Oxford University MSDS | | 16.00 | PHYSPROP |
|
|
| | | 4-chlorobenzyl chloride C7H6Cl22, 3, 64 |
 | |
|
| | | 4-chlorobenzyl cyanide C8H6ClN2, 3 |
 | | Compound Data | | Melting point | 30.50 °C | 303.65 K | | CSID | 211145 | H bond acceptors | 1 | Rule of 5 violations | 0 | | Molecular weight | 151.5929 | H bond donors | 0 | ACD/LogP | 2.04 | | Phase 25 °C | solid | Rotatable bonds | 1 | Predicted density | 1.19 g/cm3 | | SMILES | Clc1ccc(cc1)CC#N | | STD InChIKey | IVYMIRMKXZAHRV-UHFFFAOYAK | | Melting Points | | mp °C | source | |
|---|
| 31.00 | Aldrich Chemical Company; Aldrich Catalog-Handbook of Fine C... | | 30.00 | Alfa Aesar |
|
|
| | | 4-chlorobenzyl mercaptan C7H7ClS2, 3, 64 |
 | |
|
| | | 4-chlorobiphenyl C12H9Cl7, 64 |
 | | Compound Data | | Melting point | 78.40 °C | 351.55 K | | CSID | 15489 | H bond acceptors | 0 | Rule of 5 violations | 0 | | Molecular weight | 188.6529 | H bond donors | 0 | ACD/LogP | 4.55 | | Phase 25 °C | solid | Rotatable bonds | 1 | Predicted density | 1.13 g/cm3 | | SMILES | Clc2ccc(c1ccccc1)cc2 | | STD InChIKey | FPWNLURCHDRMHC-UHFFFAOYAG | | Melting Points | | mp °C | source | |
|---|
| 78.00 | Beilstein F. K.; Beilsteins Handbuch der Organischen Chemie.... | | 78.80 | PHYSPROP |
|
|
| | | 4-chlorodiphenyl sulfone C12H9ClO2S3, 64 |
 | | Compound Data | | Melting point | 93.00 °C | 366.15 K | | CSID | 6369 | H bond acceptors | 2 | Rule of 5 violations | 0 | | Molecular weight | 252.7167 | H bond donors | 0 | ACD/LogP | 3.30 | | Phase 25 °C | solid | Rotatable bonds | 2 | Predicted density | 1.33 g/cm3 | | SMILES | O=S(=O)(c1ccc(Cl)cc1)c2ccccc2 | | STD InChIKey | OFCFYWOKHPOXKF-UHFFFAOYAJ | | Melting Points | | mp °C | source | |
|---|
| 92.00 | Alfa Aesar | | 94.00 | PHYSPROP |
|
|
| | | 4-chloroiodobenzene C6H4ClI2, 3, 64 |
 | |
|
| | | 4-chlorophenol C6H5ClO2, 3, 61, 64 |
 | |
|
| | | 4-chlorophenoxyacetic acid C8H7ClO33, 64 |
 | | Compound Data | | Melting point | 161.50 °C | 434.65 K | | CSID | 24438 | H bond acceptors | 3 | Rule of 5 violations | 0 | | Molecular weight | 186.5924 | H bond donors | 1 | ACD/LogP | 2.03 | | Phase 25 °C | solid | Rotatable bonds | 3 | Predicted density | 1.37 g/cm3 | | SMILES | Clc1ccc(OCC(=O)O)cc1 | | STD InChIKey | SODPIMGUZLOIPE-UHFFFAOYAE | | Melting Points | | mp °C | source | |
|---|
| 159.00 | Alfa Aesar | | 164.00 | PHYSPROP |
|
|
| | | 4-chlorophenyl isothiocyanate C7H4ClNS3, 64 |
 | | Compound Data | | Melting point | 45.50 °C | 318.65 K | | CSID | 15622 | H bond acceptors | 1 | Rule of 5 violations | 0 | | Molecular weight | 169.6314 | H bond donors | 0 | ACD/LogP | 3.91 | | Phase 25 °C | solid | Rotatable bonds | 1 | Predicted density | 1.21 g/cm3 | | SMILES | Clc1ccc(\N=C=S)cc1 | | STD InChIKey | MZZVFXMTZTVUFO-UHFFFAOYAL | | Melting Points | | mp °C | source | |
|---|
| 45.00 | Alfa Aesar | | 46.00 | PHYSPROP |
|
|
| | | 4-chlorophenylacetic acid C8H7ClO22, 3, 35, 64 |
 | |
|
| | | 4-chlorophenylmethanol C7H7ClO2, 3, 61, 64 |
 | |
|
| | | 4-chloropropiophenone C9H9ClO3, 47, 64 |
 | | Compound Data | | Melting point | 35.93 °C | 309.08 K | | CSID | 21278 | H bond acceptors | 1 | Rule of 5 violations | 0 | | Molecular weight | 168.6202 | H bond donors | 0 | ACD/LogP | 2.88 | | Phase 25 °C | solid | Rotatable bonds | 2 | Predicted density | 1.13 g/cm3 | | SMILES | O=C(c1ccc(Cl)cc1)CC | | STD InChIKey | ADCYRBXQAJXJTD-UHFFFAOYAE | | Melting Points | | mp °C | source | |
|---|
| 35.00 | Alfa Aesar | | 35.50 | IUCr | | 37.30 | PHYSPROP |
|
|
| | | 4-chlororesorcinol C6H5ClO22, 3, 61, 64 |
 | |
|
| | | 4-cumylphenol C15H16O2, 3, 61, 64 |
 | |
|
| | | 4-cyanoacetanilide C9H8N2O3, 64 |
 | | Compound Data | | Melting point | 206.00 °C | 479.15 K | | CSID | 34195 | H bond acceptors | 3 | Rule of 5 violations | 0 | | Molecular weight | 160.1726 | H bond donors | 1 | ACD/LogP | 1.37 | | Phase 25 °C | solid | Rotatable bonds | 1 | Predicted density | 1.16 g/cm3 | | SMILES | O=C(Nc1ccc(C#N)cc1)C | | STD InChIKey | UFKRTEWFEYWIHD-UHFFFAOYAT | | Melting Points | | mp °C | source | |
|---|
| 205.00 | Alfa Aesar | | 207.00 | PHYSPROP |
|
|
| | | 4-cyanobenzaldehyde C8H5NO2, 3, 64 |
 | |
|
| | | 4-cyanobenzamide C8H6N2O3, 7 |
 | | Compound Data | | Melting point | 225.50 °C | 498.65 K | | CSID | 68899 | H bond acceptors | 3 | Rule of 5 violations | 0 | | Molecular weight | 146.146 | H bond donors | 2 | ACD/LogP | 0.48 | | Phase 25 °C | solid | Rotatable bonds | 1 | Predicted density | 1.24 g/cm3 | | SMILES | N#Cc1ccc(C(=O)N)cc1 | | STD InChIKey | FUKWTMJZHKZKFA-UHFFFAOYAG | | Melting Points | | mp °C | source | |
|---|
| 227.00 | Alfa Aesar | | 224.00 | Beilstein F. K.; Beilsteins Handbuch der Organischen Chemie.... |
|
|
| | | 4-cyanopyridine C6H4N23, 61, 64 |
 | | Compound Data | | Melting point | 77.67 °C | 350.82 K | | CSID | 7225 | H bond acceptors | 2 | Rule of 5 violations | 0 | | Molecular weight | 104.1094 | H bond donors | 0 | ACD/LogP | 0.41 | | Phase 25 °C | solid | Rotatable bonds | 0 | Predicted density | 1.12 g/cm3 | | SMILES | N#Cc1ccncc1 | | STD InChIKey | GPHQHTOMRSGBNZ-UHFFFAOYAF | | Melting Points | | mp °C | source | |
|---|
| 78.00 | Alfa Aesar | | 76.00 | Oxford University MSDS | | 79.00 | PHYSPROP |
|
|
| | | 4-cyclohexylaniline C12H17N2, 3, 64 |
 | |
|
| | | 4-decylaniline C16H27N3, 64 |
 | | Compound Data | | Melting point | 24.50 °C | 297.65 K | | CSID | 83338 | H bond acceptors | 1 | Rule of 5 violations | 1 | | Molecular weight | 233.3923 | H bond donors | 2 | ACD/LogP | 6.18 | | Phase 25 °C | liquid/gas | Rotatable bonds | 10 | Predicted density | 0.91 g/cm3 | | SMILES | Nc1ccc(cc1)CCCCCCCCCC | | STD InChIKey | WGENWPANMZLPIH-UHFFFAOYAC | | Melting Points | | mp °C | source | |
|---|
| 24.00 | Alfa Aesar | | 25.00 | PHYSPROP |
|
|
| | | 4-diethylaminobenzaldehyde C11H15NO2, 3, 64 |
 | |
|
| | | 4-dimethylaminobenzophenone C15H15NO3, 64 |
 | | Compound Data | | Melting point | 90.75 °C | 363.90 K | | CSID | 10284 | H bond acceptors | 2 | Rule of 5 violations | 0 | | Molecular weight | 225.2857 | H bond donors | 0 | ACD/LogP | 3.52 | | Phase 25 °C | solid | Rotatable bonds | 3 | Predicted density | 1.10 g/cm3 | | SMILES | O=C(c1ccc(N(C)C)cc1)c2ccccc2 | | STD InChIKey | BEUGBYXJXMVRFO-UHFFFAOYAL | | Melting Points | | mp °C | source | |
|---|
| 89.00 | Alfa Aesar | | 92.50 | PHYSPROP |
|
|
| | | 4-dimethylaminopyridine C7H10N23, 61, 64 |
 | | Compound Data | | Melting point | 111.67 °C | 384.82 K | | CSID | 13646 | H bond acceptors | 2 | Rule of 5 violations | 0 | | Molecular weight | 122.1677 | H bond donors | 0 | ACD/LogP | 1.34 | | Phase 25 °C | solid | Rotatable bonds | 1 | Predicted density | 1.01 g/cm3 | | SMILES | n1ccc(N(C)C)cc1 | | STD InChIKey | VHYFNPMBLIVWCW-UHFFFAOYAL | | Melting Points | | mp °C | source | |
|---|
| 112.00 | Alfa Aesar | | 111.00 | Oxford University MSDS | | 112.00 | PHYSPROP |
|
|
| | | 4-ethoxy-3-methoxybenzaldehyde C10H12O33, 64 |
 | | Compound Data | | Melting point | 62.75 °C | 335.90 K | | CSID | 60464 | H bond acceptors | 3 | Rule of 5 violations | 0 | | Molecular weight | 180.2005 | H bond donors | 0 | ACD/LogP | 2.14 | | Phase 25 °C | solid | Rotatable bonds | 4 | Predicted density | 1.09 g/cm3 | | SMILES | O=Cc1cc(OC)c(OCC)cc1 | | STD InChIKey | BERFDQAMXIBOHM-UHFFFAOYAQ | | Melting Points | | mp °C | source | |
|---|
| 61.00 | Alfa Aesar | | 64.50 | PHYSPROP |
|
|
| | | 4-ethoxyacetophenone C10H12O23, 7 |
 | | Compound Data | | Melting point | 38.00 °C | 311.15 K | | CSID | 65704 | H bond acceptors | 2 | Rule of 5 violations | 0 | | Molecular weight | 164.2011 | H bond donors | 0 | ACD/LogP | 2.27 | | Phase 25 °C | solid | Rotatable bonds | 3 | Predicted density | 1.02 g/cm3 | | SMILES | O=C(c1ccc(OCC)cc1)C | | STD InChIKey | YJFNFQHMQJCPRG-UHFFFAOYAX | | Melting Points | | mp °C | source | |
|---|
| 37.00 | Alfa Aesar | | 39.00 | Beilstein F. K.; Beilsteins Handbuch der Organischen Chemie.... |
|
|
| | | 4-ethoxyaniline C8H11NO2, 3, 61, 64 |
 | |
|
| | | 4-ethoxybenzaldehyde C9H10O22, 3, 64 |
 | |
|
| | | 4-ethoxybenzonitrile C9H9NO3, 64 |
 | | Compound Data | | Melting point | 61.75 °C | 334.90 K | | CSID | 124526 | H bond acceptors | 2 | Rule of 5 violations | 0 | | Molecular weight | 147.1739 | H bond donors | 0 | ACD/LogP | 2.40 | | Phase 25 °C | solid | Rotatable bonds | 2 | Predicted density | 1.05 g/cm3 | | SMILES | N#Cc1ccc(OCC)cc1 | | STD InChIKey | PJRLUGQMEZZDIY-UHFFFAOYAE | | Melting Points | | mp °C | source | |
|---|
| 62.00 | Alfa Aesar | | 61.50 | PHYSPROP |
|
|
| | | 4-ethoxyphenol C8H10O23, 64 |
 | | Compound Data | | Melting point | 66.25 °C | 339.40 K | | CSID | 11651 | H bond acceptors | 2 | Rule of 5 violations | 0 | | Molecular weight | 138.1638 | H bond donors | 1 | ACD/LogP | 1.86 | | Phase 25 °C | solid | Rotatable bonds | 3 | Predicted density | 1.08 g/cm3 | | SMILES | CCOc1ccc(cc1)O | | STD InChIKey | LKVFCSWBKOVHAH-UHFFFAOYAY | | Melting Points | | mp °C | source | |
|---|
| 66.00 | Alfa Aesar | | 66.50 | PHYSPROP |
|
|
| | | 4-ethoxyphenylacetic acid C10H12O33, 64 |
 | | Compound Data | | Melting point | 88.75 °C | 361.90 K | | CSID | 70988 | H bond acceptors | 3 | Rule of 5 violations | 0 | | Molecular weight | 180.2005 | H bond donors | 1 | ACD/LogP | 1.95 | | Phase 25 °C | solid | Rotatable bonds | 4 | Predicted density | 1.14 g/cm3 | | SMILES | O=C(O)Cc1ccc(OCC)cc1 | | STD InChIKey | ZVVWZNFSMIFGEP-UHFFFAOYAB | | Melting Points | | mp °C | source | |
|---|
| 89.00 | Alfa Aesar | | 88.50 | PHYSPROP |
|
|
| | | 4-ethylaniline C8H11N3, 31, 64 |
 | |
|
| | | 4-ethylbenzoic acid C9H10O23, 64 |
 | | Compound Data | | Melting point | 112.75 °C | 385.90 K | | CSID | 11589 | H bond acceptors | 2 | Rule of 5 violations | 0 | | Molecular weight | 150.1745 | H bond donors | 1 | ACD/LogP | 2.89 | | Phase 25 °C | solid | Rotatable bonds | 2 | Predicted density | 1.11 g/cm3 | | SMILES | O=C(O)c1ccc(cc1)CC | | STD InChIKey | ZQVKTHRQIXSMGY-UHFFFAOYAV | | Melting Points | | mp °C | source | |
|---|
| 113.00 | Alfa Aesar | | 112.50 | PHYSPROP |
|
|
| | | 4-ethylmorpholine C6H13NO3, 61, 64 |
 | | Compound Data | | Melting point | -63.33 °C | 209.82 K | | CSID | 7244 | H bond acceptors | 2 | Rule of 5 violations | 0 | | Molecular weight | 115.1735 | H bond donors | 0 | ACD/LogP | 0.20 | | Phase 25 °C | liquid/gas | Rotatable bonds | 1 | Predicted density | 0.91 g/cm3 | | SMILES | O1CCN(CC)CC1 | | STD InChIKey | HVCNXQOWACZAFN-UHFFFAOYAU | | Melting Points | | mp °C | source | |
|---|
| -63.00 | Alfa Aesar | | -63.00 | Oxford University MSDS | | -64.00 | PHYSPROP |
|
|
| | | 4-ethylphenol C8H10O3, 31, 61, 64 |
 | |
|
| | | 4-ethylpyridine C7H9N3, 64 |
 | | Compound Data | | Melting point | -90.75 °C | 182.40 K | | CSID | 21106560 | H bond acceptors | 1 | Rule of 5 violations | 0 | | Molecular weight | 107.1531 | H bond donors | 0 | ACD/LogP | 1.72 | | Phase 25 °C | liquid/gas | Rotatable bonds | 1 | Predicted density | 0.93 g/cm3 | | SMILES | CCc1ccncc1 | | STD InChIKey | VJXRKZJMGVSXPX-UHFFFAOYAD | | Melting Points | | mp °C | source | |
|---|
| -91.00 | Alfa Aesar | | -90.50 | PHYSPROP |
|
|
| | | 4-ethyltoluene C9H123, 4, 64 |
 | |
|
| | | 4-fluoro-2-nitrophenol C6H4FNO33, 48 |
 | | Compound Data | | Melting point | 74.00 °C | 347.15 K | | CSID | 120011 | H bond acceptors | 4 | Rule of 5 violations | 0 | | Molecular weight | 157.0993 | H bond donors | 1 | ACD/LogP | 1.90 | | Phase 25 °C | solid | Rotatable bonds | 2 | Predicted density | 1.51 g/cm3 | | SMILES | O=[N+]([O-])c1cc(F)ccc1O | | STD InChIKey | ZHRLVDHMIJDWSS-UHFFFAOYAS | | Melting Points | | mp °C | source | |
|---|
| 75.00 | Alfa Aesar | | 73.00 | Karthikeyan M.; Glen R.C.; Bender A. General melting point p... |
|
|
| | | 4-fluoro-2-nitrotoluene C7H6FNO23, 64 |
 | | Compound Data | | Melting point | 26.50 °C | 299.65 K | | CSID | 61280 | H bond acceptors | 3 | Rule of 5 violations | 0 | | Molecular weight | 155.1264 | H bond donors | 0 | ACD/LogP | 2.36 | | Phase 25 °C | solid | Rotatable bonds | 1 | Predicted density | 1.27 g/cm3 | | SMILES | Fc1cc([N+]([O-])=O)c(cc1)C | | STD InChIKey | SKWTUNAAJNDEIK-UHFFFAOYAG | | Melting Points | | mp °C | source | |
|---|
| 26.00 | Alfa Aesar | | 27.00 | PHYSPROP |
|
|
| | | 4-fluoro-3-nitroaniline C6H5FN2O23, 64 |
 | | Compound Data | | Melting point | 96.75 °C | 369.90 K | | CSID | 61087 | H bond acceptors | 4 | Rule of 5 violations | 0 | | Molecular weight | 156.1145 | H bond donors | 2 | ACD/LogP | 1.27 | | Phase 25 °C | solid | Rotatable bonds | 2 | Predicted density | 1.45 g/cm3 | | SMILES | O=[N+]([O-])c1c(F)ccc(N)c1 | | STD InChIKey | LLIOADBCFIXIEU-UHFFFAOYAJ | | Melting Points | | mp °C | source | |
|---|
| 96.00 | Alfa Aesar | | 97.50 | PHYSPROP |
|
|
| | | 4-fluoroaniline C6H6FN3, 64 |
 | | Compound Data | | Melting point | -1.40 °C | 271.75 K | | CSID | 9349 | H bond acceptors | 1 | Rule of 5 violations | 0 | | Molecular weight | 111.1169 | H bond donors | 2 | ACD/LogP | 1.15 | | Phase 25 °C | liquid/gas | Rotatable bonds | 1 | Predicted density | 1.16 g/cm3 | | SMILES | Fc1ccc(N)cc1 | | STD InChIKey | KRZCOLNOCZKSDF-UHFFFAOYAY | | Melting Points | | mp °C | source | |
|---|
| -2.00 | Alfa Aesar | | -0.80 | PHYSPROP |
|
|
| | | 4-fluorobenzamide C7H6FNO3, 64 |
 | | Compound Data | | Melting point | 155.75 °C | 428.90 K | | CSID | 64644 | H bond acceptors | 2 | Rule of 5 violations | 0 | | Molecular weight | 139.127 | H bond donors | 2 | ACD/LogP | 0.91 | | Phase 25 °C | solid | Rotatable bonds | 1 | Predicted density | 1.24 g/cm3 | | SMILES | O=C(c1ccc(F)cc1)N | | STD InChIKey | VNDHYTGVCGVETQ-UHFFFAOYAF | | Melting Points | | mp °C | source | |
|---|
| 156.00 | Alfa Aesar | | 155.50 | PHYSPROP |
|
|
| | | 4-fluorobenzonitrile C7H4FN3, 64 |
 | | Compound Data | | Melting point | 35.40 °C | 308.55 K | | CSID | 13861 | H bond acceptors | 1 | Rule of 5 violations | 0 | | Molecular weight | 121.1118 | H bond donors | 0 | ACD/LogP | 1.70 | | Phase 25 °C | solid | Rotatable bonds | 0 | Predicted density | 1.15 g/cm3 | | SMILES | N#Cc1ccc(F)cc1 | | STD InChIKey | AEKVBBNGWBBYLL-UHFFFAOYAJ | | Melting Points | | mp °C | source | |
|---|
| 36.00 | Alfa Aesar | | 34.80 | PHYSPROP |
|
|
| | | 4-fluorobenzotrifluoride C7H4F43, 64 |
 | | Compound Data | | Melting point | -41.85 °C | 231.30 K | | CSID | 61190 | H bond acceptors | 0 | Rule of 5 violations | 0 | | Molecular weight | 164.1003 | H bond donors | 0 | ACD/LogP | 2.96 | | Phase 25 °C | liquid/gas | Rotatable bonds | 0 | Predicted density | 1.29 g/cm3 | | SMILES | FC(F)(F)c1ccc(F)cc1 | | STD InChIKey | UNNNAIWPDLRVRN-UHFFFAOYAF | | Melting Points | | mp °C | source | |
|---|
| -42.00 | Alfa Aesar | | -41.70 | PHYSPROP |
|
|
| | | 4-fluorobenzoyl chloride C7H4ClFO3, 64 |
 | | Compound Data | | Melting point | 9.50 °C | 282.65 K | | CSID | 61196 | H bond acceptors | 1 | Rule of 5 violations | 0 | | Molecular weight | 158.5575 | H bond donors | 0 | ACD/LogP | 2.43 | | Phase 25 °C | liquid/gas | Rotatable bonds | 1 | Predicted density | 1.32 g/cm3 | | SMILES | O=C(Cl)c1ccc(F)cc1 | | STD InChIKey | CZKLEJHVLCMVQR-UHFFFAOYAL | | Melting Points | | mp °C | source | |
|---|
| 10.00 | Alfa Aesar | | 9.00 | PHYSPROP |
|
|
| | | 4-fluorobiphenyl C12H9F3, 64 |
 | | Compound Data | | Melting point | 74.10 °C | 347.25 K | | CSID | 9089 | H bond acceptors | 0 | Rule of 5 violations | 0 | | Molecular weight | 172.1983 | H bond donors | 0 | ACD/LogP | 3.91 | | Phase 25 °C | solid | Rotatable bonds | 1 | Predicted density | 1.08 g/cm3 | | SMILES | Fc2ccc(c1ccccc1)cc2 | | STD InChIKey | RUYZJEIKQYLEGZ-UHFFFAOYAQ | | Melting Points | | mp °C | source | |
|---|
| 74.00 | Alfa Aesar | | 74.20 | PHYSPROP |
|
|
| | | 4-fluorophenol C6H5FO3, 61, 64, 72, 72 |
 | | Compound Data | | Melting point | 46.10 °C | 319.25 K | | CSID | 9350 | H bond acceptors | 1 | Rule of 5 violations | 0 | | Molecular weight | 112.1017 | H bond donors | 1 | ACD/LogP | 1.77 | | Phase 25 °C | solid | Rotatable bonds | 1 | Predicted density | 1.22 g/cm3 | | SMILES | Fc1ccc(O)cc1 | | STD InChIKey | RHMPLDJJXGPMEX-UHFFFAOYAV | | Melting Points | | mp °C | source | |
|---|
| 46.00 | Alfa Aesar | | 45.50 | Oxford University MSDS | | 48.00 | PHYSPROP | | 44.50 | Sigma-Aldrich | | 46.50 | Sigma-Aldrich |
|
|
| | | 4-fluorophenoxyacetic acid C8H7FO33, 64 |
 | | Compound Data | | Melting point | 104.62 °C | 377.77 K | | CSID | 61199 | H bond acceptors | 3 | Rule of 5 violations | 0 | | Molecular weight | 170.1378 | H bond donors | 1 | ACD/LogP | 1.47 | | Phase 25 °C | solid | Rotatable bonds | 3 | Predicted density | 1.32 g/cm3 | | SMILES | Fc1ccc(OCC(=O)O)cc1 | | STD InChIKey | ZBIULCVFFJJYTN-UHFFFAOYAV | | Melting Points | | mp °C | source | |
|---|
| 105.00 | Alfa Aesar | | 104.25 | PHYSPROP |
|
|
| | | 4-fluorophenyl isothiocyanate C7H4FNS3, 64 |
 | | Compound Data | | Melting point | 26.50 °C | 299.65 K | | CSID | 14507 | H bond acceptors | 1 | Rule of 5 violations | 0 | | Molecular weight | 153.1768 | H bond donors | 0 | ACD/LogP | 3.28 | | Phase 25 °C | solid | Rotatable bonds | 1 | Predicted density | 1.15 g/cm3 | | SMILES | Fc1ccc(\N=C=S)cc1 | | STD InChIKey | NFIUJHJMCQQYDL-UHFFFAOYAS | | Melting Points | | mp °C | source | |
|---|
| 26.00 | Alfa Aesar | | 27.00 | PHYSPROP |
|
|
| | | 4-fluorophenylacetic acid C8H7FO23, 64 |
 | | Compound Data | | Melting point | 84.50 °C | 357.65 K | | CSID | 9454 | H bond acceptors | 2 | Rule of 5 violations | 0 | | Molecular weight | 154.1384 | H bond donors | 1 | ACD/LogP | 1.56 | | Phase 25 °C | solid | Rotatable bonds | 2 | Predicted density | 1.27 g/cm3 | | SMILES | Fc1ccc(cc1)CC(=O)O | | STD InChIKey | MGKPFALCNDRSQD-UHFFFAOYAI | | Melting Points | | mp °C | source | |
|---|
| 83.00 | Alfa Aesar | | 86.00 | PHYSPROP |
|
|
| | | 4-fluorostyrene C8H7F3, 64 |
 | | Compound Data | | Melting point | -35.25 °C | 237.90 K | | CSID | 61200 | H bond acceptors | 0 | Rule of 5 violations | 0 | | Molecular weight | 122.1396 | H bond donors | 0 | ACD/LogP | 2.71 | | Phase 25 °C | liquid/gas | Rotatable bonds | 1 | Predicted density | 1.02 g/cm3 | | SMILES | Fc1ccc(\C=C)cc1 | | STD InChIKey | JWVTWJNGILGLAT-UHFFFAOYAH | | Melting Points | | mp °C | source | |
|---|
| -36.00 | Alfa Aesar | | -34.50 | PHYSPROP |
|
|
| | | 4-formylbenzoic acid C8H6O32, 3 |
 | | Compound Data | | Melting point | 246.00 °C | 519.15 K | | CSID | 11591 | H bond acceptors | 3 | Rule of 5 violations | 0 | | Molecular weight | 150.1314 | H bond donors | 1 | ACD/LogP | 1.76 | | Phase 25 °C | solid | Rotatable bonds | 2 | Predicted density | 1.32 g/cm3 | | SMILES | O=C(O)c1ccc(C=O)cc1 | | STD InChIKey | GOUHYARYYWKXHS-UHFFFAOYAP | | Melting Points | | mp °C | source | |
|---|
| 247.00 | Aldrich Chemical Company; Aldrich Catalog-Handbook of Fine C... | | 245.00 | Alfa Aesar |
|
|
| | | 4-heptanol C7H16O64, 82 |
 | | Compound Data | | Melting point | -41.60 °C | 231.55 K | | CSID | 11029 | H bond acceptors | 1 | Rule of 5 violations | 0 | | Molecular weight | 116.2013 | H bond donors | 1 | ACD/LogP | 2.29 | | Phase 25 °C | liquid/gas | Rotatable bonds | 5 | Predicted density | 0.82 g/cm3 | | SMILES | OC(CCC)CCC | | STD InChIKey | YVBCULSIZWMTFY-UHFFFAOYAT | | Melting Points | | mp °C | source | |
|---|
| -41.20 | PHYSPROP | | -42.00 | Wilhoit R. C. Physical and Thermodynamic Properties of Aliph... |
|
|
| | | 4-hexylbenzene-1,3-diol C12H18O23, 61, 64 |
 | | Compound Data | | Melting point | 66.33 °C | 339.48 K | | CSID | 21106121 | H bond acceptors | 2 | Rule of 5 violations | 0 | | Molecular weight | 194.2701 | H bond donors | 2 | ACD/LogP | 3.88 | | Phase 25 °C | solid | Rotatable bonds | 7 | Predicted density | 1.05 g/cm3 | | SMILES | Oc1cc(O)ccc1CCCCCC | | STD InChIKey | WFJIVOKAWHGMBH-UHFFFAOYAH | | Melting Points | | mp °C | source | |
|---|
| 66.00 | Alfa Aesar | | 65.00 | Oxford University MSDS | | 68.00 | PHYSPROP |
|
|
| | | 4-hydroxy-1-methylpiperidine C6H13NO3, 64 |
 | | Compound Data | | Melting point | 28.50 °C | 301.65 K | | CSID | 59438 | H bond acceptors | 2 | Rule of 5 violations | 0 | | Molecular weight | 115.1735 | H bond donors | 1 | ACD/LogP | -0.52 | | Phase 25 °C | solid | Rotatable bonds | 1 | Predicted density | 1.00 g/cm3 | | SMILES | OC1CCN(C)CC1 | | STD InChIKey | BAUWRHPMUVYFOD-UHFFFAOYAG | | Melting Points | | mp °C | source | |
|---|
| 28.00 | Alfa Aesar | | 29.00 | PHYSPROP |
|
|
| | | 4-hydroxy-3-methoxybenzonitrile C8H7NO23, 64 |
 | | Compound Data | | Melting point | 86.50 °C | 359.65 K | | CSID | 70511 | H bond acceptors | 3 | Rule of 5 violations | 0 | | Molecular weight | 149.1467 | H bond donors | 1 | ACD/LogP | 1.18 | | Phase 25 °C | solid | Rotatable bonds | 2 | Predicted density | 1.24 g/cm3 | | SMILES | N#Cc1cc(OC)c(O)cc1 | | STD InChIKey | QJRWLNLUIAJTAD-UHFFFAOYAP | | Melting Points | | mp °C | source | |
|---|
| 87.00 | Alfa Aesar | | 86.00 | PHYSPROP |
|
|
| | | 4-hydroxy-3-nitrobenzaldehyde C7H5NO43, 64 |
 | | Compound Data | | Melting point | 141.50 °C | 414.65 K | | CSID | 17162 | H bond acceptors | 5 | Rule of 5 violations | 0 | | Molecular weight | 167.1189 | H bond donors | 1 | ACD/LogP | 2.00 | | Phase 25 °C | solid | Rotatable bonds | 3 | Predicted density | 1.50 g/cm3 | | SMILES | O=[N+]([O-])c1cc(ccc1O)C=O | | STD InChIKey | YTHJCZRFJGXPTL-UHFFFAOYAA | | Melting Points | | mp °C | source | |
|---|
| 142.00 | Alfa Aesar | | 141.00 | PHYSPROP |
|
|
| | | 4-hydroxyacetophenone C8H8O22, 3, 64 |
 | |
|
| | | 4-hydroxybenzaldehyde C7H6O23, 3, 64 |
 | | Compound Data | | Melting point | 117.33 °C | 390.48 K | | CSID | 123 | H bond acceptors | 2 | Rule of 5 violations | 0 | | Molecular weight | 122.1213 | H bond donors | 1 | ACD/LogP | 1.39 | | Phase 25 °C | solid | Rotatable bonds | 2 | Predicted density | 1.23 g/cm3 | | SMILES | O=Cc1ccc(O)cc1 | | STD InChIKey | RGHHSNMVTDWUBI-UHFFFAOYAN | | Melting Points | | mp °C | source | |
|---|
| 118.00 | Alfa Aesar | | 117.00 | Alfa Aesar | | 117.00 | PHYSPROP |
|
|
| | | 4-hydroxybenzamide C7H7NO22, 3, 64 |
 | |
|
| | | 4-hydroxybenzoic acid C7H6O32, 3, 35, 64 |
 | |
|
| | | 4-hydroxybenzonitrile C7H5NO2, 3, 61, 64 |
 | |
|
| | | 4-hydroxybenzyl cyanide C8H7NO2, 3, 7 |
 | |
|
| | | 4-hydroxydiphenylamine C12H11NO3, 64 |
 | | Compound Data | | Melting point | 71.00 °C | 344.15 K | | CSID | 21111849 | H bond acceptors | 2 | Rule of 5 violations | 0 | | Molecular weight | 185.2218 | H bond donors | 2 | ACD/LogP | 2.82 | | Phase 25 °C | solid | Rotatable bonds | 3 | Predicted density | 1.20 g/cm3 | | SMILES | Oc2ccc(Nc1ccccc1)cc2 | | STD InChIKey | JTTMYKSFKOOQLP-UHFFFAOYAT | | Melting Points | | mp °C | source | |
|---|
| 69.00 | Alfa Aesar | | 73.00 | PHYSPROP |
|
|
| | | 4-hydroxyindole C8H7NO3, 64 |
 | | Compound Data | | Melting point | 99.00 °C | 372.15 K | | CSID | 67953 | H bond acceptors | 2 | Rule of 5 violations | 0 | | Molecular weight | 133.1473 | H bond donors | 2 | ACD/LogP | 1.41 | | Phase 25 °C | solid | Rotatable bonds | 1 | Predicted density | 1.33 g/cm3 | | SMILES | c1cc2c(cc[nH]2)c(c1)O | | STD InChIKey | NLMQHXUGJIAKTH-UHFFFAOYAU | | Melting Points | | mp °C | source | |
|---|
| 98.00 | Alfa Aesar | | 100.00 | PHYSPROP |
|
|
| | | 4-hydroxyphenylacetic acid C8H8O33, 35, 64 |
 | | Compound Data | | Melting point | 151.00 °C | 424.15 K | | CSID | 124 | H bond acceptors | 3 | Rule of 5 violations | 0 | | Molecular weight | 152.1473 | H bond donors | 2 | ACD/LogP | 0.77 | | Phase 25 °C | solid | Rotatable bonds | 3 | Predicted density | 1.32 g/cm3 | | SMILES | O=C(O)Cc1ccc(O)cc1 | | STD InChIKey | XQXPVVBIMDBYFF-UHFFFAOYAR | | Melting Points | | mp °C | source | |
|---|
| 149.00 | Alfa Aesar | | 152.00 | EPISuite-ChemSpider | | 152.00 | PHYSPROP |
|
|
| | | 4-hydroxypyridine C5H5NO3, 64 |
 | | Compound Data | | Melting point | 147.40 °C | 420.55 K | | CSID | 11787 | H bond acceptors | 2 | Rule of 5 violations | 0 | | Molecular weight | 95.0993 | H bond donors | 1 | ACD/LogP | -0.99 | | Phase 25 °C | solid | Rotatable bonds | 0 | Predicted density | 1.11 g/cm3 | | SMILES | O=C\1\C=C/N/C=C/1 | | STD InChIKey | GCNTZFIIOFTKIY-UHFFFAOYAB | | Melting Points | | mp °C | source | |
|---|
| 145.00 | Alfa Aesar | | 149.80 | PHYSPROP |
|
|
| | | 4-hydroxyquinazoline C8H6N2O3, 64 |
 | | Compound Data | | Melting point | 217.75 °C | 490.90 K | | CSID | 56797 | H bond acceptors | 3 | Rule of 5 violations | 0 | | Molecular weight | 146.146 | H bond donors | 1 | ACD/LogP | 0.77 | | Phase 25 °C | solid | Rotatable bonds | 0 | Predicted density | 1.31 g/cm3 | | SMILES | O=C2\N=C/Nc1ccccc12 | | STD InChIKey | QMNUDYFKZYBWQX-UHFFFAOYAB | | Melting Points | | mp °C | source | |
|---|
| 218.00 | Alfa Aesar | | 217.50 | PHYSPROP |
|
|
| | | 4-iodoacetophenone C8H7IO3, 47, 47, 64 |
 | | Compound Data | | Melting point | 84.80 °C | 357.95 K | | CSID | 65701 | H bond acceptors | 1 | Rule of 5 violations | 0 | | Molecular weight | 246.045 | H bond donors | 0 | ACD/LogP | 2.87 | | Phase 25 °C | solid | Rotatable bonds | 1 | Predicted density | 1.72 g/cm3 | | SMILES | O=C(c1ccc(I)cc1)C | | STD InChIKey | JZJWCDQGIPQBAO-UHFFFAOYAH | | Melting Points | | mp °C | source | |
|---|
| 83.00 | Alfa Aesar | | 84.85 | IUCr | | 85.35 | IUCr | | 86.00 | PHYSPROP |
|
|
| | | 4-iodoanisole C7H7IO2, 3, 64 |
 | |
|
| | | 4-iodobenzaldehyde C7H5IO3, 7 |
 | |
|
| | | 4-iodobenzoic acid C7H5IO22, 35, 64 |
 | |
|
| | | 4-iodobenzonitrile C7H4IN3, 7 |
 | | Compound Data | | Melting point | 125.50 °C | 398.65 K | | CSID | 68939 | H bond acceptors | 1 | Rule of 5 violations | 0 | | Molecular weight | 229.0178 | H bond donors | 0 | ACD/LogP | 2.68 | | Phase 25 °C | solid | Rotatable bonds | 0 | Predicted density | 1.91 g/cm3 | | SMILES | N#Cc1ccc(I)cc1 | | STD InChIKey | XOKDXPVXJWTSRM-UHFFFAOYAU | | Melting Points | | mp °C | source | |
|---|
| 126.00 | Alfa Aesar | | 125.00 | Beilstein F. K.; Beilsteins Handbuch der Organischen Chemie.... |
|
|
| | | 4-iodobiphenyl C12H9I3, 7, 64 |
 | |
|
| | | 4-iodophenetole C8H9IO3, 64 |
 | | Compound Data | | Melting point | 28.50 °C | 301.65 K | | CSID | 191427 | H bond acceptors | 1 | Rule of 5 violations | 0 | | Molecular weight | 248.0609 | H bond donors | 0 | ACD/LogP | 3.92 | | Phase 25 °C | solid | Rotatable bonds | 2 | Predicted density | 1.63 g/cm3 | | SMILES | Ic1ccc(OCC)cc1 | | STD InChIKey | VSIIHWOJPSSIDI-UHFFFAOYAA | | Melting Points | | mp °C | source | |
|---|
| 28.00 | Alfa Aesar | | 29.00 | PHYSPROP |
|
|
| | | 4-iodophenol C6H5IO2, 3, 61, 64 |
 | |
|
| | | 4-isopropylbenzoic acid C10H12O23, 64 |
 | | Compound Data | | Melting point | 118.25 °C | 391.40 K | | CSID | 10363 | H bond acceptors | 2 | Rule of 5 violations | 0 | | Molecular weight | 164.2011 | H bond donors | 1 | ACD/LogP | 3.23 | | Phase 25 °C | solid | Rotatable bonds | 2 | Predicted density | 1.08 g/cm3 | | SMILES | O=C(O)c1ccc(cc1)C(C)C | | STD InChIKey | CKMXAIVXVKGGFM-UHFFFAOYAY | | Melting Points | | mp °C | source | |
|---|
| 119.00 | Alfa Aesar | | 117.50 | PHYSPROP |
|
|
| | | 4-isopropylbenzyl alcohol C10H14O3, 64 |
 | | Compound Data | | Melting point | 27.50 °C | 300.65 K | | CSID | 21105932 | H bond acceptors | 1 | Rule of 5 violations | 0 | | Molecular weight | 150.2176 | H bond donors | 1 | ACD/LogP | 2.37 | | Phase 25 °C | solid | Rotatable bonds | 3 | Predicted density | 0.98 g/cm3 | | SMILES | OCc1ccc(cc1)C(C)C | | STD InChIKey | OIGWAXDAPKFNCQ-UHFFFAOYAM | | Melting Points | | mp °C | source | |
|---|
| 27.00 | Alfa Aesar | | 28.00 | PHYSPROP |
|
|
| | | 4-isopropylphenol C9H12O2, 2, 3, 64, 72 |
 | |
|
| | | 4-methoxy-1-naphthaldehyde C12H10O23, 64 |
 | | Compound Data | | Melting point | 34.40 °C | 307.55 K | | CSID | 76852 | H bond acceptors | 2 | Rule of 5 violations | 0 | | Molecular weight | 186.2066 | H bond donors | 0 | ACD/LogP | 2.93 | | Phase 25 °C | solid | Rotatable bonds | 2 | Predicted density | 1.17 g/cm3 | | SMILES | O=Cc2c1ccccc1c(OC)cc2 | | STD InChIKey | MVXMNHYVCLMLDD-UHFFFAOYAE | | Melting Points | | mp °C | source | |
|---|
| 34.00 | Alfa Aesar | | 34.80 | PHYSPROP |
|
|
| | | 4-methoxy-2-nitroaniline C7H8N2O33, 64 |
 | | Compound Data | | Melting point | 125.50 °C | 398.65 K | | CSID | 60158 | H bond acceptors | 5 | Rule of 5 violations | 0 | | Molecular weight | 168.15 | H bond donors | 2 | ACD/LogP | 1.94 | | Phase 25 °C | solid | Rotatable bonds | 3 | Predicted density | 1.32 g/cm3 | | SMILES | [O-][N+](=O)c1c(ccc(OC)c1)N | | STD InChIKey | QFMJFXFXQAFGBO-UHFFFAOYAL | | Melting Points | | mp °C | source | |
|---|
| 127.00 | Alfa Aesar | | 124.00 | PHYSPROP |
|
|
| | | 4-methoxyacetanilide C9H11NO23, 64 |
 | | Compound Data | | Melting point | 129.00 °C | 402.15 K | | CSID | 5622 | H bond acceptors | 3 | Rule of 5 violations | 0 | | Molecular weight | 165.1891 | H bond donors | 1 | ACD/LogP | 1.09 | | Phase 25 °C | solid | Rotatable bonds | 2 | Predicted density | 1.13 g/cm3 | | SMILES | O=C(Nc1ccc(OC)cc1)C | | STD InChIKey | XVAIDCNLVLTVFM-UHFFFAOYAL | | Melting Points | | mp °C | source | |
|---|
| 127.00 | Alfa Aesar | | 131.00 | PHYSPROP |
|
|
| | | 4-methoxyacetophenone C9H10O22, 3, 64 |
 | |
|
| | | 4-methoxyaniline C7H9NO2, 3, 61, 64 |
 | |
|
| | | 4-methoxybenzaldehyde C8H8O22, 3, 3, 64 |
 | |
|
| | | 4-methoxybenzamide C8H9NO22, 3, 64 |
 | |
|
| | | 4-methoxybenzoic acid C8H8O32, 3, 32, 35, 61, 64 |
 | |
|
| | | 4-methoxybenzoic anhydride C16H14O53, 64 |
 | | Compound Data | | Melting point | 95.75 °C | 368.90 K | | CSID | 63122 | H bond acceptors | 5 | Rule of 5 violations | 0 | | Molecular weight | 286.2794 | H bond donors | 0 | ACD/LogP | 3.35 | | Phase 25 °C | solid | Rotatable bonds | 6 | Predicted density | 1.22 g/cm3 | | SMILES | O=C(OC(=O)c1ccc(OC)cc1)c2ccc(OC)cc2 | | STD InChIKey | YGMHIBLUWGDWKP-UHFFFAOYAW | | Melting Points | | mp °C | source | |
|---|
| 97.00 | Alfa Aesar | | 94.50 | PHYSPROP |
|
|
| | | 4-methoxybenzonitrile C8H7NO2, 3, 64 |
 | |
|
| | | 4-methoxybenzophenone C14H12O23, 64 |
 | | Compound Data | | Melting point | 61.75 °C | 334.90 K | | CSID | 62361 | H bond acceptors | 2 | Rule of 5 violations | 0 | | Molecular weight | 212.2439 | H bond donors | 0 | ACD/LogP | 3.23 | | Phase 25 °C | solid | Rotatable bonds | 3 | Predicted density | 1.11 g/cm3 | | SMILES | O=C(c1ccc(OC)cc1)c2ccccc2 | | STD InChIKey | SWFHGTMLYIBPPA-UHFFFAOYAU | | Melting Points | | mp °C | source | |
|---|
| 62.00 | Alfa Aesar | | 61.50 | PHYSPROP |
|
|
| | | 4-methoxybenzophenone C10H12O3, 64 |
 | | Compound Data | | Melting point | -0.15 °C | 273.00 K | | CSID | 62359 | H bond acceptors | 1 | Rule of 5 violations | 0 | | Molecular weight | 148.2017 | H bond donors | 0 | ACD/LogP | 2.54 | | Phase 25 °C | liquid/gas | Rotatable bonds | 2 | Predicted density | 0.96 g/cm3 | | SMILES | O=C(c1ccccc1)C(C)C | | STD InChIKey | BSMGLVDZZMBWQB-UHFFFAOYAD | | Melting Points | | mp °C | source | |
|---|
| 1.00 | Alfa Aesar | | -1.30 | PHYSPROP |
|
|
| | | 4-methoxybenzyl alcohol C8H10O22, 3, 64 |
 | |
|
| | | 4-methoxybiphenyl C13H12O3, 7, 64 |
 | |
|
| | | 4-methoxyphenol C7H8O22, 3, 61, 64, 72, 72 |
 | |
|
| | | 4-methoxyphenyl isothiocyanate C8H7NOS3, 64 |
 | | Compound Data | | Melting point | 18.50 °C | 291.65 K | | CSID | 67835 | H bond acceptors | 2 | Rule of 5 violations | 0 | | Molecular weight | 165.2123 | H bond donors | 0 | ACD/LogP | 3.58 | | Phase 25 °C | liquid/gas | Rotatable bonds | 2 | Predicted density | 1.08 g/cm3 | | SMILES | S=C=N/c1ccc(OC)cc1 | | STD InChIKey | VRPQCVLBOZOYCG-UHFFFAOYAU | | Melting Points | | mp °C | source | |
|---|
| 19.00 | Alfa Aesar | | 18.00 | PHYSPROP |
|
|
| | | 4-methyl-1-pentene C6H123, 4, 64 |
 | |
|
| | | 4-methyl-1-pentyne C6H104, 64 |
 | | Compound Data | | Melting point | -104.80 °C | 168.35 K | | CSID | 122546 | H bond acceptors | 0 | Rule of 5 violations | 0 | | Molecular weight | 82.1436 | H bond donors | 0 | ACD/LogP | 2.41 | | Phase 25 °C | liquid/gas | Rotatable bonds | 1 | Predicted density | 0.73 g/cm3 | | SMILES | C#CCC(C)C | | STD InChIKey | OXRWICUICBZVAE-UHFFFAOYAK | | Melting Points | | mp °C | source | |
|---|
| -105.00 | American Petroleum Institute. Research Project 44; Selected ... | | -104.60 | PHYSPROP |
|
|
| | | 4-methyl-2-nitrophenol C7H7NO33, 64 |
 | | Compound Data | | Melting point | 35.25 °C | 308.40 K | | CSID | 8086 | H bond acceptors | 4 | Rule of 5 violations | 0 | | Molecular weight | 153.1354 | H bond donors | 1 | ACD/LogP | 2.17 | | Phase 25 °C | solid | Rotatable bonds | 2 | Predicted density | 1.32 g/cm3 | | SMILES | O=[N+]([O-])c1cc(ccc1O)C | | STD InChIKey | SYDNSSSQVSOXTN-UHFFFAOYAL | | Melting Points | | mp °C | source | |
|---|
| 34.00 | Alfa Aesar | | 36.50 | PHYSPROP |
|
|
| | | 4-methyl-7-diethylaminocoumarin C14H17NO23, 61 |
 | | Compound Data | | Melting point | 72.00 °C | 345.15 K | | CSID | 6783 | H bond acceptors | 3 | Rule of 5 violations | 0 | | Molecular weight | 231.2903 | H bond donors | 0 | ACD/LogP | 4.15 | | Phase 25 °C | solid | Rotatable bonds | 3 | Predicted density | 1.12 g/cm3 | | SMILES | O=C/2Oc1cc(ccc1\C(=C\2)C)N(CC)CC | | STD InChIKey | AFYCEAFSNDLKSX-UHFFFAOYAZ | | Melting Points | | mp °C | source | |
|---|
| 74.00 | Alfa Aesar | | 70.00 | Oxford University MSDS |
|
|
| | | 4-methylbenzene-1,2-diamine C7H10N22, 3, 61, 64 |
 | |
|
| | | 4-methylbenzene-1,2-dithiol C7H8S23, 61, 64 |
 | | Compound Data | | Melting point | 30.00 °C | 303.15 K | | CSID | 9910 | H bond acceptors | 0 | Rule of 5 violations | 0 | | Molecular weight | 156.2684 | H bond donors | 0 | ACD/LogP | 3.28 | | Phase 25 °C | solid | Rotatable bonds | 2 | Predicted density | 1.19 g/cm3 | | SMILES | Sc1ccc(cc1S)C | | STD InChIKey | NIAAGQAEVGMHPM-UHFFFAOYAZ | | Melting Points | | mp °C | source | |
|---|
| 30.00 | Alfa Aesar | | 31.00 | Oxford University MSDS | | 29.00 | PHYSPROP |
|
|
| | | 4-methylbenzoic acid C8H8O22, 3, 35, 61, 64, 70 |
 | |
|
| | | 4-methylbenzonitrile C8H7N2, 3, 61, 64 |
 | |
|
| | | 4-methylbenzoyl chloride C8H7ClO3, 64 |
 | | Compound Data | | Melting point | -2.50 °C | 270.65 K | | CSID | 12831 | H bond acceptors | 1 | Rule of 5 violations | 0 | | Molecular weight | 154.5936 | H bond donors | 0 | ACD/LogP | 2.67 | | Phase 25 °C | liquid/gas | Rotatable bonds | 1 | Predicted density | 1.17 g/cm3 | | SMILES | O=C(Cl)c1ccc(cc1)C | | STD InChIKey | NQUVCRCCRXRJCK-UHFFFAOYAS | | Melting Points | | mp °C | source | |
|---|
| -2.00 | Alfa Aesar | | -3.00 | PHYSPROP |
|
|
| | | 4-methylbenzyl alcohol C8H10O2, 3, 64 |
 | |
|
| | | 4-methylbenzyl chloride C8H9Cl2, 3 |
 | | Compound Data | | Melting point | 4.50 °C | 277.65 K | | CSID | 21111850 | H bond acceptors | 0 | Rule of 5 violations | 0 | | Molecular weight | 140.6101 | H bond donors | 0 | ACD/LogP | 2.95 | | Phase 25 °C | liquid/gas | Rotatable bonds | 1 | Predicted density | 1.05 g/cm3 | | SMILES | Cc1ccc(CCl)cc1 | | STD InChIKey | DMHZDOTYAVHSEH-UHFFFAOYAF | | Melting Points | | mp °C | source | |
|---|
| 4.00 | Aldrich Chemical Company; Aldrich Catalog-Handbook of Fine C... | | 5.00 | Alfa Aesar |
|
|
| | | 4-methylbenzylamine C8H11N3, 64 |
 | | Compound Data | | Melting point | 12.25 °C | 285.40 K | | CSID | 59426 | H bond acceptors | 1 | Rule of 5 violations | 0 | | Molecular weight | 121.1796 | H bond donors | 2 | ACD/LogP | 1.55 | | Phase 25 °C | liquid/gas | Rotatable bonds | 2 | Predicted density | 0.96 g/cm3 | | SMILES | NCc1ccc(cc1)C | | STD InChIKey | HMTSWYPNXFHGEP-UHFFFAOYAJ | | Melting Points | | mp °C | source | |
|---|
| 12.00 | Alfa Aesar | | 12.50 | PHYSPROP |
|
|
| | | 4-methylcatechol C7H8O23, 64 |
 | | Compound Data | | Melting point | 66.50 °C | 339.65 K | | CSID | 9564 | H bond acceptors | 2 | Rule of 5 violations | 0 | | Molecular weight | 124.1372 | H bond donors | 2 | ACD/LogP | 1.34 | | Phase 25 °C | solid | Rotatable bonds | 2 | Predicted density | 1.21 g/cm3 | | SMILES | Oc1ccc(cc1O)C | | STD InChIKey | ZBCATMYQYDCTIZ-UHFFFAOYAF | | Melting Points | | mp °C | source | |
|---|
| 68.00 | Alfa Aesar | | 65.00 | PHYSPROP |
|
|
| | | 4-methylcyclohexanone C7H12O3, 64 |
 | | Compound Data | | Melting point | -40.80 °C | 232.35 K | | CSID | 11041 | H bond acceptors | 1 | Rule of 5 violations | 0 | | Molecular weight | 112.1696 | H bond donors | 0 | ACD/LogP | 1.25 | | Phase 25 °C | liquid/gas | Rotatable bonds | 0 | Predicted density | 0.91 g/cm3 | | SMILES | O=C1CCC(C)CC1 | | STD InChIKey | VGVHNLRUAMRIEW-UHFFFAOYAE | | Melting Points | | mp °C | source | |
|---|
| -41.00 | Alfa Aesar | | -40.60 | PHYSPROP |
|
|
| | | 4-methylcyclopentene C6H104, 64 |
 | | Compound Data | | Melting point | -160.90 °C | 112.25 K | | CSID | 14893 | H bond acceptors | 0 | Rule of 5 violations | 0 | | Molecular weight | 82.1436 | H bond donors | 0 | ACD/LogP | 2.82 | | Phase 25 °C | liquid/gas | Rotatable bonds | 0 | Predicted density | 0.81 g/cm3 | | SMILES | C\1=C\CC(C)C/1 | | STD InChIKey | FWMRUAODTCVEQK-UHFFFAOYAW | | Melting Points | | mp °C | source | |
|---|
| -161.00 | American Petroleum Institute. Research Project 44; Selected ... | | -160.80 | PHYSPROP |
|
|
| | | 4-methylimidazole C4H6N23, 64 |
 | | Compound Data | | Melting point | 53.50 °C | 326.65 K | | CSID | 12640 | H bond acceptors | 2 | Rule of 5 violations | 0 | | Molecular weight | 82.1038 | H bond donors | 1 | ACD/LogP | 0.30 | | Phase 25 °C | solid | Rotatable bonds | 0 | Predicted density | 1.06 g/cm3 | | SMILES | n1cc(nc1)C | | STD InChIKey | XLSZMDLNRCVEIJ-UHFFFAOYAA | | Melting Points | | mp °C | source | |
|---|
| 51.00 | Alfa Aesar | | 56.00 | PHYSPROP |
|
|
| | | 4-methylpentan-2-one C6H12O3, 4, 61, 64 |
 | |
|
| | | 4-methylphenacyl bromide C9H9BrO3, 64 |
 | | Compound Data | | Melting point | 51.50 °C | 324.65 K | | CSID | 62483 | H bond acceptors | 1 | Rule of 5 violations | 0 | | Molecular weight | 213.0712 | H bond donors | 0 | ACD/LogP | 2.65 | | Phase 25 °C | solid | Rotatable bonds | 2 | Predicted density | 1.42 g/cm3 | | SMILES | O=C(c1ccc(cc1)C)CBr | | STD InChIKey | KRVGXFREOJHJAX-UHFFFAOYAC | | Melting Points | | mp °C | source | |
|---|
| 52.00 | Alfa Aesar | | 51.00 | PHYSPROP |
|
|
| | | 4-methylphenoxyacetic acid C9H10O33, 64 |
 | | Compound Data | | Melting point | 140.50 °C | 413.65 K | | CSID | 63512 | H bond acceptors | 3 | Rule of 5 violations | 0 | | Molecular weight | 166.1739 | H bond donors | 1 | ACD/LogP | 1.80 | | Phase 25 °C | solid | Rotatable bonds | 3 | Predicted density | 1.18 g/cm3 | | SMILES | O=C(O)COc1ccc(cc1)C | | STD InChIKey | SFTDDFBJWUWKMN-UHFFFAOYAF | | Melting Points | | mp °C | source | |
|---|
| 140.00 | Alfa Aesar | | 141.00 | PHYSPROP |
|
|
| | | 4-methylpropiophenone C10H12O3, 64 |
 | | Compound Data | | Melting point | 7.10 °C | 280.25 K | | CSID | 20140 | H bond acceptors | 1 | Rule of 5 violations | 0 | | Molecular weight | 148.2017 | H bond donors | 0 | ACD/LogP | 2.66 | | Phase 25 °C | liquid/gas | Rotatable bonds | 2 | Predicted density | 0.96 g/cm3 | | SMILES | O=C(c1ccc(cc1)C)CC | | STD InChIKey | PATYHUUYADUHQS-UHFFFAOYAY | | Melting Points | | mp °C | source | |
|---|
| 7.00 | Alfa Aesar | | 7.20 | PHYSPROP |
|
|
| | | 4-methylsalicylic acid C8H8O33, 64 |
 | | Compound Data | | Melting point | 177.50 °C | 450.65 K | | CSID | 5584 | H bond acceptors | 3 | Rule of 5 violations | 0 | | Molecular weight | 152.1473 | H bond donors | 2 | ACD/LogP | 2.52 | | Phase 25 °C | solid | Rotatable bonds | 2 | Predicted density | 1.30 g/cm3 | | SMILES | O=C(O)c1ccc(cc1O)C | | STD InChIKey | NJESAXZANHETJV-UHFFFAOYAQ | | Melting Points | | mp °C | source | |
|---|
| 178.00 | Alfa Aesar | | 177.00 | PHYSPROP |
|
|
| | | 4-methylvaleric acid C6H12O23, 64 |
 | | Compound Data | | Melting point | -34.00 °C | 239.15 K | | CSID | 12067 | H bond acceptors | 2 | Rule of 5 violations | 0 | | Molecular weight | 116.1583 | H bond donors | 1 | ACD/LogP | 1.66 | | Phase 25 °C | liquid/gas | Rotatable bonds | 3 | Predicted density | 0.95 g/cm3 | | SMILES | O=C(O)CCC(C)C | | STD InChIKey | FGKJLKRYENPLQH-UHFFFAOYAB | | Melting Points | | mp °C | source | |
|---|
| -35.00 | Alfa Aesar | | -33.00 | PHYSPROP |
|
|
| | | 4-morpholineethanol C6H13NO23, 64 |
 | | Compound Data | | Melting point | 0.20 °C | 273.35 K | | CSID | 55110 | H bond acceptors | 3 | Rule of 5 violations | 0 | | Molecular weight | 131.1729 | H bond donors | 1 | ACD/LogP | -0.60 | | Phase 25 °C | liquid/gas | Rotatable bonds | 3 | Predicted density | 1.06 g/cm3 | | SMILES | OCCN1CCOCC1 | | STD InChIKey | KKFDCBRMNNSAAW-UHFFFAOYAD | | Melting Points | | mp °C | source | |
|---|
| 2.00 | Alfa Aesar | | -1.60 | PHYSPROP |
|
|
| | | 4-nitroacetanilide C8H8N2O33, 61, 64 |
 | | Compound Data | | Melting point | 215.67 °C | 488.82 K | | CSID | 7407 | H bond acceptors | 5 | Rule of 5 violations | 0 | | Molecular weight | 180.1607 | H bond donors | 1 | ACD/LogP | 1.66 | | Phase 25 °C | solid | Rotatable bonds | 2 | Predicted density | 1.34 g/cm3 | | SMILES | O=C(Nc1ccc(cc1)[N+]([O-])=O)C | | STD InChIKey | NQRLPDFELNCFHW-UHFFFAOYAB | | Melting Points | | mp °C | source | |
|---|
| 216.00 | Alfa Aesar | | 215.00 | Oxford University MSDS | | 216.00 | PHYSPROP |
|
|
| | | 4-nitroaniline C6H6N2O22, 3, 61, 64, 72 |
 | |
|
| | | 4-nitrobenzaldehyde C7H5NO32, 3, 3, 64 |
 | |
|
| | | 4-nitrobenzamide C7H6N2O33, 7, 61, 64 |
 | |
|
| | | 4-nitrobenzene-1,2-diamine C6H7N3O23, 61, 64 |
 | | Compound Data | | Melting point | 199.83 °C | 472.98 K | | CSID | 4286892 | H bond acceptors | 5 | Rule of 5 violations | 0 | | Molecular weight | 153.1387 | H bond donors | 4 | ACD/LogP | 1.21 | | Phase 25 °C | solid | Rotatable bonds | 3 | Predicted density | 1.45 g/cm3 | | SMILES | [O-][N+](=O)c1cc(N)c(N)cc1 | | STD InChIKey | RAUWPNXIALNKQM-UHFFFAOYAF | | Melting Points | | mp °C | source | |
|---|
| 201.00 | Alfa Aesar | | 199.00 | Oxford University MSDS | | 199.50 | PHYSPROP |
|
|
| | | 4-nitrobenzenesulfonamide C6H6N2O4S3, 64 |
 | | Compound Data | | Melting point | 179.50 °C | 452.65 K | | CSID | 21360 | H bond acceptors | 6 | Rule of 5 violations | 0 | | Molecular weight | 202.1878 | H bond donors | 2 | ACD/LogP | 0.65 | | Phase 25 °C | solid | Rotatable bonds | 2 | Predicted density | 1.55 g/cm3 | | SMILES | O=S(=O)(N)c1ccc([N+]([O-])=O)cc1 | | STD InChIKey | QWKKYJLAUWFPDB-UHFFFAOYAH | | Melting Points | | mp °C | source | |
|---|
| 180.00 | Alfa Aesar | | 179.00 | PHYSPROP |
|
|
| | | 4-nitrobenzoic acid C7H5NO42, 3, 35, 61, 64 |
 | |
|
| | | 4-nitrobenzonitrile C7H4N2O22, 3, 64 |
 | |
|
| | | 4-nitrobenzophenone C13H9NO33, 64 |
 | | Compound Data | | Melting point | 137.50 °C | 410.65 K | | CSID | 64003 | H bond acceptors | 4 | Rule of 5 violations | 0 | | Molecular weight | 227.2155 | H bond donors | 0 | ACD/LogP | 3.05 | | Phase 25 °C | solid | Rotatable bonds | 3 | Predicted density | 1.27 g/cm3 | | SMILES | O=[N+]([O-])c2ccc(C(=O)c1ccccc1)cc2 | | STD InChIKey | ZYMCBJWUWHHVRX-UHFFFAOYAN | | Melting Points | | mp °C | source | |
|---|
| 137.00 | Alfa Aesar | | 138.00 | PHYSPROP |
|
|
| | | 4-nitrobenzotrifluoride C7H4F3NO23, 61, 64 |
 | | Compound Data | | Melting point | 39.33 °C | 312.48 K | | CSID | 9438 | H bond acceptors | 3 | Rule of 5 violations | 0 | | Molecular weight | 191.1074 | H bond donors | 0 | ACD/LogP | 2.52 | | Phase 25 °C | solid | Rotatable bonds | 1 | Predicted density | 1.42 g/cm3 | | SMILES | c1cc(ccc1C(F)(F)F)[N+](=O)[O-] | | STD InChIKey | XKYLCLMYQDFGKO-UHFFFAOYAM | | Melting Points | | mp °C | source | |
|---|
| 40.00 | Alfa Aesar | | 39.00 | Oxford University MSDS | | 39.00 | PHYSPROP |
|
|
| | | 4-nitrobenzoyl chloride C7H4ClNO33, 61, 64 |
 | | Compound Data | | Melting point | 74.33 °C | 347.48 K | | CSID | 8188 | H bond acceptors | 4 | Rule of 5 violations | 0 | | Molecular weight | 185.5646 | H bond donors | 0 | ACD/LogP | 2.17 | | Phase 25 °C | solid | Rotatable bonds | 2 | Predicted density | 1.45 g/cm3 | | SMILES | O=[N+]([O-])c1ccc(C(Cl)=O)cc1 | | STD InChIKey | SKDHHIUENRGTHK-UHFFFAOYAC | | Melting Points | | mp °C | source | |
|---|
| 73.00 | Alfa Aesar | | 75.00 | Oxford University MSDS | | 75.00 | PHYSPROP |
|
|
| | | 4-nitrobenzyl alcohol C7H7NO32, 3, 64 |
 | |
|
| | | 4-nitrobenzyl alcohol C8H9NO2, 3, 64 |
 | |
|
| | | 4-nitrobenzyl chloride C7H6ClNO22, 3, 61, 64 |
 | |
|
| | | 4-nitrocatechol C6H5NO43, 64 |
 | | Compound Data | | Melting point | 175.50 °C | 448.65 K | | CSID | 2745027 | H bond acceptors | 5 | Rule of 5 violations | 0 | | Molecular weight | 155.1082 | H bond donors | 2 | ACD/LogP | 1.68 | | Phase 25 °C | solid | Rotatable bonds | 3 | Predicted density | 1.58 g/cm3 | | SMILES | [O-][N+](=O)c1cc(O)c(O)cc1 | | STD InChIKey | XJNPNXSISMKQEX-UHFFFAOYAU | | Melting Points | | mp °C | source | |
|---|
| 176.00 | Alfa Aesar | | 175.00 | PHYSPROP |
|
|
| | | 4-nitrophenol C6H5NO32, 3, 48, 64, 72 |
 | |
|
| | | 4-nitrophenyl benzoate C13H9NO43, 48 |
 | | Compound Data | | Melting point | 141.00 °C | 414.15 K | | CSID | 63575 | H bond acceptors | 5 | Rule of 5 violations | 0 | | Molecular weight | 243.2149 | H bond donors | 0 | ACD/LogP | 3.77 | | Phase 25 °C | solid | Rotatable bonds | 4 | Predicted density | 1.32 g/cm3 | | SMILES | O=C(Oc1ccc(cc1)[N+]([O-])=O)c2ccccc2 | | STD InChIKey | GMKZBFFLCONHDE-UHFFFAOYAZ | | Melting Points | | mp °C | source | |
|---|
| 143.00 | Alfa Aesar | | 139.00 | Karthikeyan M.; Glen R.C.; Bender A. General melting point p... |
|
|
| | | 4-nitrophenyl chloroformate C7H4ClNO43, 61 |
 | | Compound Data | | Melting point | 78.50 °C | 351.65 K | | CSID | 74123 | H bond acceptors | 5 | Rule of 5 violations | 0 | | Molecular weight | 201.564 | H bond donors | 0 | ACD/LogP | 2.84 | | Phase 25 °C | solid | Rotatable bonds | 3 | Predicted density | 1.51 g/cm3 | | SMILES | O=C(Cl)Oc1ccc(cc1)[N+]([O-])=O | | STD InChIKey | NXLNNXIXOYSCMB-UHFFFAOYAH | | Melting Points | | mp °C | source | |
|---|
| 79.00 | Alfa Aesar | | 78.00 | Oxford University MSDS |
|
|
| | | 4-nitrophenyl isocyanate C7H4N2O33, 64 |
 | | Compound Data | | Melting point | 57.50 °C | 330.65 K | | CSID | 59403 | H bond acceptors | 5 | Rule of 5 violations | 0 | | Molecular weight | 164.1183 | H bond donors | 0 | ACD/LogP | 2.96 | | Phase 25 °C | solid | Rotatable bonds | 2 | Predicted density | 1.32 g/cm3 | | SMILES | O=C=N\c1ccc(cc1)[N+]([O-])=O | | STD InChIKey | GFNKTLQTQSALEJ-UHFFFAOYAM | | Melting Points | | mp °C | source | |
|---|
| 58.00 | Alfa Aesar | | 57.00 | PHYSPROP |
|
|
| | | 4-nitrophenyl isothiocyanate C7H4N2O2S3, 64 |
 | | Compound Data | | Melting point | 109.50 °C | 382.65 K | | CSID | 67597 | H bond acceptors | 4 | Rule of 5 violations | 0 | | Molecular weight | 180.1839 | H bond donors | 0 | ACD/LogP | 3.62 | | Phase 25 °C | solid | Rotatable bonds | 2 | Predicted density | 1.33 g/cm3 | | SMILES | S=C=N\c1ccc(cc1)[N+]([O-])=O | | STD InChIKey | NXHSSIGRWJENBH-UHFFFAOYAJ | | Melting Points | | mp °C | source | |
|---|
| 108.00 | Alfa Aesar | | 111.00 | PHYSPROP |
|
|
| | | 4-nitrophenylacetonitrile C8H6N2O22, 3, 48, 64 |
 | |
|
| | | 4-nitrophthalic acid C8H5NO63, 48 |
 | | Compound Data | | Melting point | 162.50 °C | 435.65 K | | CSID | 62338 | H bond acceptors | 7 | Rule of 5 violations | 0 | | Molecular weight | 211.1284 | H bond donors | 2 | ACD/LogP | 1.00 | | Phase 25 °C | solid | Rotatable bonds | 3 | Predicted density | 1.67 g/cm3 | | SMILES | O=[N+]([O-])c1cc(c(C(=O)O)cc1)C(=O)O | | STD InChIKey | SLBQXWXKPNIVSQ-UHFFFAOYAK | | Melting Points | | mp °C | source | |
|---|
| 163.00 | Alfa Aesar | | 162.00 | Karthikeyan M.; Glen R.C.; Bender A. General melting point p... |
|
|
| | | 4-nitroquinoline N-oxide C9H6N2O33, 61, 64 |
 | | Compound Data | | Melting point | 154.33 °C | 427.48 K | | CSID | 5740 | H bond acceptors | 5 | Rule of 5 violations | 0 | | Molecular weight | 190.1555 | H bond donors | 0 | ACD/LogP | 0.92 | | Phase 25 °C | solid | Rotatable bonds | 1 | Predicted density | 1.42 g/cm3 | | SMILES | [O-][N+](=O)c2c1c(cccc1)[n+]([O-])cc2 | | STD InChIKey | YHQDZJICGQWFHK-UHFFFAOYAP | | Melting Points | | mp °C | source | |
|---|
| 155.00 | Alfa Aesar | | 154.00 | Oxford University MSDS | | 154.00 | PHYSPROP |
|
|
| | | 4-nitrostyrene C8H7NO23, 7 |
 | | Compound Data | | Melting point | 28.00 °C | 301.15 K | | CSID | 7201 | H bond acceptors | 3 | Rule of 5 violations | 0 | | Molecular weight | 149.1467 | H bond donors | 0 | ACD/LogP | 2.48 | | Phase 25 °C | solid | Rotatable bonds | 2 | Predicted density | 1.17 g/cm3 | | SMILES | O=[N+]([O-])c1ccc(\C=C)cc1 | | STD InChIKey | YFZHODLXYNDBSM-UHFFFAOYAA | | Melting Points | | mp °C | source | |
|---|
| 27.00 | Alfa Aesar | | 29.00 | Beilstein F. K.; Beilsteins Handbuch der Organischen Chemie.... |
|
|
| | | 4-nonylphenol C15H24O3, 64 |
 | | Compound Data | | Melting point | 43.50 °C | 316.65 K | | CSID | 1688 | H bond acceptors | 1 | Rule of 5 violations | 1 | | Molecular weight | 220.3505 | H bond donors | 1 | ACD/LogP | 6.19 | | Phase 25 °C | solid | Rotatable bonds | 9 | Predicted density | 0.93 g/cm3 | | SMILES | Oc1ccc(cc1)CCCCCCCCC | | STD InChIKey | IGFHQQFPSIBGKE-UHFFFAOYAO | | Melting Points | | mp °C | source | |
|---|
| 45.00 | Alfa Aesar | | 42.00 | PHYSPROP |
|
|
| | | 4-octyloxybenzoic acid C15H22O33, 48 |
 | | Compound Data | | Melting point | 102.00 °C | 375.15 K | | CSID | 16310 | H bond acceptors | 3 | Rule of 5 violations | 1 | | Molecular weight | 250.3334 | H bond donors | 1 | ACD/LogP | 5.68 | | Phase 25 °C | solid | Rotatable bonds | 9 | Predicted density | 1.04 g/cm3 | | SMILES | O=C(O)c1ccc(OCCCCCCCC)cc1 | | STD InChIKey | IALWCYFULVHLEC-UHFFFAOYAX | | Melting Points | | mp °C | source | |
|---|
| 103.00 | Alfa Aesar | | 101.00 | Karthikeyan M.; Glen R.C.; Bender A. General melting point p... |
|
|
| | | 4-octyne C8H142, 64 |
 | | Compound Data | | Melting point | -102.00 °C | 171.15 K | | CSID | 15221 | H bond acceptors | 0 | Rule of 5 violations | 0 | | Molecular weight | 110.1968 | H bond donors | 0 | ACD/LogP | 3.51 | | Phase 25 °C | liquid/gas | Rotatable bonds | 3 | Predicted density | 0.77 g/cm3 | | SMILES | CCCC#CCCC | | STD InChIKey | GZTNBKQTTZSQNS-UHFFFAOYAB | | Melting Points | | mp °C | source | |
|---|
| -103.00 | Aldrich Chemical Company; Aldrich Catalog-Handbook of Fine C... | | -101.00 | PHYSPROP |
|
|
| | | 4-pentenoic acid C5H8O23, 64 |
 | | Compound Data | | Melting point | -22.25 °C | 250.90 K | | CSID | 55085 | H bond acceptors | 2 | Rule of 5 violations | 0 | | Molecular weight | 100.1158 | H bond donors | 1 | ACD/LogP | 0.99 | | Phase 25 °C | liquid/gas | Rotatable bonds | 3 | Predicted density | 0.99 g/cm3 | | SMILES | O=C(O)CC\C=C | | STD InChIKey | HVAMZGADVCBITI-UHFFFAOYAW | | Melting Points | | mp °C | source | |
|---|
| -22.00 | Alfa Aesar | | -22.50 | PHYSPROP |
|
|
| | | 4-pentylphenol C11H16O3, 64 |
 | | Compound Data | | Melting point | 23.50 °C | 296.65 K | | CSID | 25119 | H bond acceptors | 1 | Rule of 5 violations | 0 | | Molecular weight | 164.2441 | H bond donors | 1 | ACD/LogP | 4.07 | | Phase 25 °C | liquid/gas | Rotatable bonds | 5 | Predicted density | 0.96 g/cm3 | | SMILES | Oc1ccc(cc1)CCCCC | | STD InChIKey | ZNPSUQQXTRRSBM-UHFFFAOYAD | | Melting Points | | mp °C | source | |
|---|
| 24.00 | Alfa Aesar | | 23.00 | PHYSPROP |
|
|
| | | 4-pentynoic acid C5H6O23, 64 |
 | | Compound Data | | Melting point | 56.85 °C | 330.00 K | | CSID | 21069 | H bond acceptors | 2 | Rule of 5 violations | 0 | | Molecular weight | 98.0999 | H bond donors | 1 | ACD/LogP | 0.43 | | Phase 25 °C | solid | Rotatable bonds | 2 | Predicted density | 1.10 g/cm3 | | SMILES | O=C(O)CCC#C | | STD InChIKey | MLBYLEUJXUBIJJ-UHFFFAOYAV | | Melting Points | | mp °C | source | |
|---|
| 56.00 | Alfa Aesar | | 57.70 | PHYSPROP |
|
|
| | | 4-phenoxyaniline C12H11NO3, 64 |
 | | Compound Data | | Melting point | 83.50 °C | 356.65 K | | CSID | 8434 | H bond acceptors | 2 | Rule of 5 violations | 0 | | Molecular weight | 185.2218 | H bond donors | 2 | ACD/LogP | 2.36 | | Phase 25 °C | solid | Rotatable bonds | 3 | Predicted density | 1.14 g/cm3 | | SMILES | O(c1ccccc1)c2ccc(cc2)N | | STD InChIKey | WOYZXEVUWXQVNV-UHFFFAOYAE | | Melting Points | | mp °C | source | |
|---|
| 84.00 | Alfa Aesar | | 83.00 | PHYSPROP |
|
|
| | | 4-phenoxybenzaldehyde C13H10O23, 64 |
 | | Compound Data | | Melting point | 24.75 °C | 297.90 K | | CSID | 59526 | H bond acceptors | 2 | Rule of 5 violations | 0 | | Molecular weight | 198.2173 | H bond donors | 0 | ACD/LogP | 3.84 | | Phase 25 °C | liquid/gas | Rotatable bonds | 3 | Predicted density | 1.15 g/cm3 | | SMILES | O=Cc2ccc(Oc1ccccc1)cc2 | | STD InChIKey | QWLHJVDRPZNVBS-UHFFFAOYAO | | Melting Points | | mp °C | source | |
|---|
| 25.00 | Alfa Aesar | | 24.50 | PHYSPROP |
|
|
| | | 4-phenoxyphenol C12H10O23, 61, 64 |
 | | Compound Data | | Melting point | 82.67 °C | 355.82 K | | CSID | 12696 | H bond acceptors | 2 | Rule of 5 violations | 0 | | Molecular weight | 186.2066 | H bond donors | 1 | ACD/LogP | 3.35 | | Phase 25 °C | solid | Rotatable bonds | 3 | Predicted density | 1.18 g/cm3 | | SMILES | O(c1ccccc1)c2ccc(O)cc2 | | STD InChIKey | ZSBDGXGICLIJGD-UHFFFAOYAU | | Melting Points | | mp °C | source | |
|---|
| 84.00 | Alfa Aesar | | 80.00 | Oxford University MSDS | | 84.00 | PHYSPROP |
|
|
| | | 4-phenyl-3-thiosemicarbazide C7H9N3S3, 64 |
 | | Compound Data | | Melting point | 138.50 °C | 411.65 K | | CSID | 638258 | H bond acceptors | 3 | Rule of 5 violations | 0 | | Molecular weight | 167.2315 | H bond donors | 4 | ACD/LogP | 0.93 | | Phase 25 °C | solid | Rotatable bonds | 2 | Predicted density | 1.32 g/cm3 | | SMILES | S=C(Nc1ccccc1)NN | | STD InChIKey | KKIGUVBJOHCXSP-UHFFFAOYAT | | Melting Points | | mp °C | source | |
|---|
| 138.00 | Alfa Aesar | | 139.00 | PHYSPROP |
|
|
| | | 4-phenylbutyric acid C10H12O23, 35, 48, 64 |
 | |
|
| | | 4-phenylcyclohexanone C12H14O3, 64 |
 | | Compound Data | | Melting point | 79.75 °C | 352.90 K | | CSID | 70962 | H bond acceptors | 1 | Rule of 5 violations | 0 | | Molecular weight | 174.239 | H bond donors | 0 | ACD/LogP | 2.45 | | Phase 25 °C | solid | Rotatable bonds | 1 | Predicted density | 1.04 g/cm3 | | SMILES | O=C2CCC(c1ccccc1)CC2 | | STD InChIKey | YKAYMASDSHFOGI-UHFFFAOYAM | | Melting Points | | mp °C | source | |
|---|
| 80.00 | Alfa Aesar | | 79.50 | PHYSPROP |
|
|
| | | 4-phenylsemicarbazide C7H9N3O3, 64 |
 | | Compound Data | | Melting point | 126.00 °C | 399.15 K | | CSID | 10380 | H bond acceptors | 4 | Rule of 5 violations | 0 | | Molecular weight | 151.1659 | H bond donors | 4 | ACD/LogP | 0.13 | | Phase 25 °C | solid | Rotatable bonds | 2 | Predicted density | 1.27 g/cm3 | | SMILES | O=C(Nc1ccccc1)NN | | STD InChIKey | MOCKWYUCPREFCZ-UHFFFAOYAJ | | Melting Points | | mp °C | source | |
|---|
| 124.00 | Alfa Aesar | | 128.00 | PHYSPROP |
|
|
| | | 4-picoline C6H7N3, 64 |
 | | Compound Data | | Melting point | 3.33 °C | 276.48 K | | CSID | 13874733 | H bond acceptors | 1 | Rule of 5 violations | 0 | | Molecular weight | 93.1265 | H bond donors | 0 | ACD/LogP | 1.33 | | Phase 25 °C | liquid/gas | Rotatable bonds | 0 | Predicted density | 0.94 g/cm3 | | SMILES | Cc1ccncc1 | | STD InChIKey | FKNQCJSGGFJEIZ-UHFFFAOYAZ | | Melting Points | | mp °C | source | |
|---|
| 3.00 | Alfa Aesar | | 3.66 | PHYSPROP |
|
|
| | | 4-picoline N-oxide C6H7NO3, 11, 17, 64 |
 | | Compound Data | | Melting point | 184.50 °C | 457.65 K | | CSID | 13257 | H bond acceptors | 2 | Rule of 5 violations | 0 | | Molecular weight | 109.1259 | H bond donors | 0 | ACD/LogP | -0.74 | | Phase 25 °C | solid | Rotatable bonds | 0 | Predicted density | 1.01 g/cm3 | | SMILES | [O-][n+]1ccc(cc1)C | | STD InChIKey | IWYYIZOHWPCALJ-UHFFFAOYAY | | Melting Points | | mp °C | source | |
|---|
| 184.00 | Alfa Aesar | | 185.50 | Boekelheide V; Linn WJ. Journal of the American Chemical Soc... | | 184.00 | ChemBlink | | Values not used in calculating the average melting point | | 39.00 | PHYSPROP1 | | 1. clearly out of range JCB |
|
|
| | | 4-picolinylamine C6H8N23, 64 |
 | | Compound Data | | Melting point | -7.80 °C | 265.35 K | | CSID | 69736 | H bond acceptors | 2 | Rule of 5 violations | 0 | | Molecular weight | 108.1411 | H bond donors | 2 | ACD/LogP | -0.40 | | Phase 25 °C | liquid/gas | Rotatable bonds | 2 | Predicted density | 1.05 g/cm3 | | SMILES | n1ccc(cc1)CN | | STD InChIKey | TXQWFIVRZNOPCK-UHFFFAOYAD | | Melting Points | | mp °C | source | |
|---|
| -8.00 | Alfa Aesar | | -7.60 | PHYSPROP |
|
|
| | | 4-propylbenzoic acid C10H12O23, 64 |
 | | Compound Data | | Melting point | 142.50 °C | 415.65 K | | CSID | 121262 | H bond acceptors | 2 | Rule of 5 violations | 0 | | Molecular weight | 164.2011 | H bond donors | 1 | ACD/LogP | 3.42 | | Phase 25 °C | solid | Rotatable bonds | 3 | Predicted density | 1.08 g/cm3 | | SMILES | O=C(O)c1ccc(cc1)CCC | | STD InChIKey | ATZHGRNFEFVDDJ-UHFFFAOYAC | | Melting Points | | mp °C | source | |
|---|
| 142.00 | Alfa Aesar | | 143.00 | PHYSPROP |
|
|
| | | 4-propylphenol C9H12O3, 31, 64 |
 | |
|
| | | 4-pyridinemethanol C6H7NO3, 64 |
 | | Compound Data | | Melting point | 53.50 °C | 326.65 K | | CSID | 10988 | H bond acceptors | 2 | Rule of 5 violations | 0 | | Molecular weight | 109.1259 | H bond donors | 1 | ACD/LogP | -0.46 | | Phase 25 °C | solid | Rotatable bonds | 2 | Predicted density | 1.13 g/cm3 | | SMILES | OCc1ccncc1 | | STD InChIKey | PTMBWNZJOQBTBK-UHFFFAOYAW | | Melting Points | | mp °C | source | |
|---|
| 54.00 | Alfa Aesar | | 53.00 | PHYSPROP |
|
|
| | | 4-pyrimidinamine C4H5N33, 64 |
 | | Compound Data | | Melting point | 152.50 °C | 425.65 K | | CSID | 62181 | H bond acceptors | 3 | Rule of 5 violations | 0 | | Molecular weight | 95.1026 | H bond donors | 2 | ACD/LogP | -0.25 | | Phase 25 °C | solid | Rotatable bonds | 0 | Predicted density | 1.22 g/cm3 | | SMILES | n1ccc(nc1)N | | STD InChIKey | OYRRZWATULMEPF-UHFFFAOYAG | | Melting Points | | mp °C | source | |
|---|
| 150.00 | Alfa Aesar | | 155.00 | PHYSPROP |
|
|
| | | 4-quinolinecarboxylic acid C10H7NO23, 64 |
 | | Compound Data | | Melting point | 254.25 °C | 527.40 K | | CSID | 9826 | H bond acceptors | 3 | Rule of 5 violations | 0 | | Molecular weight | 173.1681 | H bond donors | 1 | ACD/LogP | 1.76 | | Phase 25 °C | solid | Rotatable bonds | 1 | Predicted density | 1.34 g/cm3 | | SMILES | O=C(O)c1c2ccccc2ncc1 | | STD InChIKey | VQMSRUREDGBWKT-UHFFFAOYAV | | Melting Points | | mp °C | source | |
|---|
| 254.00 | Alfa Aesar | | 254.50 | PHYSPROP |
|
|
| | | 4-quinolone C9H7NO3, 64 |
 | | Compound Data | | Melting point | 202.00 °C | 475.15 K | | CSID | 62357 | H bond acceptors | 2 | Rule of 5 violations | 0 | | Molecular weight | 145.158 | H bond donors | 1 | ACD/LogP | 2.50 | | Phase 25 °C | solid | Rotatable bonds | 0 | Predicted density | 1.19 g/cm3 | | SMILES | O=C\2c1c(cccc1)N/C=C/2 | | STD InChIKey | PMZDQRJGMBOQBF-UHFFFAOYAZ | | Melting Points | | mp °C | source | |
|---|
| 203.00 | Alfa Aesar | | 201.00 | PHYSPROP |
|
|
| | | 4-t-butylaniline C10H15N2, 3, 64 |
 | |
|
| | | 4-t-butylbenzoic acid C11H14O22, 3, 64 |
 | |
|
| | | 4-t-butylcatechol C10H14O23, 64 |
 | | Compound Data | | Melting point | 54.65 °C | 327.80 K | | CSID | 7103 | H bond acceptors | 2 | Rule of 5 violations | 0 | | Molecular weight | 166.217 | H bond donors | 2 | ACD/LogP | 2.57 | | Phase 25 °C | solid | Rotatable bonds | 3 | Predicted density | 1.09 g/cm3 | | SMILES | Oc1ccc(cc1O)C(C)(C)C | | STD InChIKey | XESZUVZBAMCAEJ-UHFFFAOYAR | | Melting Points | | mp °C | source | |
|---|
| 55.00 | Alfa Aesar | | 54.30 | PHYSPROP |
|
|
| | | 4-t-butylcyclohexanone C10H18O2, 3, 64 |
 | |
|
| | | 4-t-butylphenol C10H14O3, 31, 64, 72 |
 | |
|
| | | 4-toluenesulfonyl fluoride C7H7FO2S3, 64 |
 | | Compound Data | | Melting point | 41.25 °C | 314.40 K | | CSID | 9571 | H bond acceptors | 2 | Rule of 5 violations | 0 | | Molecular weight | 174.1927 | H bond donors | 0 | ACD/LogP | 2.74 | | Phase 25 °C | solid | Rotatable bonds | 1 | Predicted density | 1.28 g/cm3 | | SMILES | O=S(F)(=O)c1ccc(cc1)C | | STD InChIKey | IZZYABADQVQHLC-UHFFFAOYAQ | | Melting Points | | mp °C | source | |
|---|
| 41.00 | Alfa Aesar | | 41.50 | PHYSPROP |
|
|
| | | 4-toluenesulfonylmethyl isocyanide C9H9NO2S3, 3 |
 | | Compound Data | | Melting point | 112.25 °C | 385.40 K | | CSID | 142204 | H bond acceptors | 3 | Rule of 5 violations | NA | | Molecular weight | 195.2383 | H bond donors | 0 | ACD/LogP | 0.00 | | Phase 25 °C | solid | Rotatable bonds | 2 | Predicted density | 0.00 g/cm3 | | SMILES | O=S(=O)(c1ccc(cc1)C)C[N+]#[C-] | | STD InChIKey | CFOAUYCPAUGDFF-UHFFFAOYAC | | Melting Points | | mp °C | source | |
|---|
| 112.50 | Alfa Aesar | | 112.00 | Alfa Aesar |
|
|
| | | 4-tolyl benzoate C14H12O27, 48, 64 |
 | |
|
| | | 4-tolyl isothiocyanate C8H7NS3, 64 |
 | | Compound Data | | Melting point | 25.25 °C | 298.40 K | | CSID | 11650 | H bond acceptors | 1 | Rule of 5 violations | 0 | | Molecular weight | 149.2129 | H bond donors | 0 | ACD/LogP | 3.70 | | Phase 25 °C | solid | Rotatable bonds | 1 | Predicted density | 1.02 g/cm3 | | SMILES | S=C=N\c1ccc(cc1)C | | STD InChIKey | ABQKHKWXTUVKGF-UHFFFAOYAX | | Melting Points | | mp °C | source | |
|---|
| 25.00 | Alfa Aesar | | 25.50 | PHYSPROP |
|
|
| | | 4-tolyl sulfone C14H14O2S3, 64 |
 | | Compound Data | | Melting point | 158.00 °C | 431.15 K | | CSID | 62252 | H bond acceptors | 2 | Rule of 5 violations | 0 | | Molecular weight | 246.3248 | H bond donors | 0 | ACD/LogP | 3.32 | | Phase 25 °C | solid | Rotatable bonds | 2 | Predicted density | 1.17 g/cm3 | | SMILES | O=S(=O)(c1ccc(cc1)C)c2ccc(cc2)C | | STD InChIKey | WEAYCYAIVOIUMG-UHFFFAOYAO | | Melting Points | | mp °C | source | |
|---|
| 157.00 | Alfa Aesar | | 159.00 | PHYSPROP |
|
|
| | | 4-tolylacetic acid C9H10O23, 64 |
 | | Compound Data | | Melting point | 92.50 °C | 365.65 K | | CSID | 217532 | H bond acceptors | 2 | Rule of 5 violations | 0 | | Molecular weight | 150.1745 | H bond donors | 1 | ACD/LogP | 1.97 | | Phase 25 °C | solid | Rotatable bonds | 2 | Predicted density | 1.13 g/cm3 | | SMILES | O=C(O)Cc1ccc(cc1)C | | STD InChIKey | GXXXUZIRGXYDFP-UHFFFAOYAI | | Melting Points | | mp °C | source | |
|---|
| 92.00 | Alfa Aesar | | 93.00 | PHYSPROP |
|
|
| | | 4-vinylbenzoic acid C9H8O22, 3, 64 |
 | |
|
| | | 4-vinylbiphenyl C14H123, 7 |
 | | Compound Data | | Melting point | 117.50 °C | 390.65 K | | CSID | 15998 | H bond acceptors | 0 | Rule of 5 violations | 0 | | Molecular weight | 180.2451 | H bond donors | 0 | ACD/LogP | 4.46 | | Phase 25 °C | solid | Rotatable bonds | 2 | Predicted density | 1.00 g/cm3 | | SMILES | c1cc(ccc1)c2ccc(cc2)\C=C | | STD InChIKey | HDBWAWNLGGMZRQ-UHFFFAOYAS | | Melting Points | | mp °C | source | |
|---|
| 116.00 | Alfa Aesar | | 119.00 | Beilstein F. K.; Beilsteins Handbuch der Organischen Chemie.... |
|
|
| | | 4-vinylphenol C8H8O7, 64 |
 | | Compound Data | | Melting point | 73.25 °C | 346.40 K | | CSID | 56234 | H bond acceptors | 1 | Rule of 5 violations | 0 | | Molecular weight | 120.1485 | H bond donors | 1 | ACD/LogP | 2.16 | | Phase 25 °C | solid | Rotatable bonds | 2 | Predicted density | 1.05 g/cm3 | | SMILES | Oc1ccc(\C=C)cc1 | | STD InChIKey | FUGYGGDSWSUORM-UHFFFAOYAQ | | Melting Points | | mp °C | source | |
|---|
| 73.00 | Beilstein F. K.; Beilsteins Handbuch der Organischen Chemie.... | | 73.50 | PHYSPROP |
|
|
| | | 4,4-dimethyl-1-pentene C7H144, 64 |
 | | Compound Data | | Melting point | -136.80 °C | 136.35 K | | CSID | 12444 | H bond acceptors | 0 | Rule of 5 violations | 0 | | Molecular weight | 98.1861 | H bond donors | 0 | ACD/LogP | 3.60 | | Phase 25 °C | liquid/gas | Rotatable bonds | 2 | Predicted density | 0.70 g/cm3 | | SMILES | C=C\CC(C)(C)C | | STD InChIKey | KLCNJIQZXOQYTE-UHFFFAOYAT | | Melting Points | | mp °C | source | |
|---|
| -137.00 | American Petroleum Institute. Research Project 44; Selected ... | | -136.60 | PHYSPROP |
|
|
| | | 4,4-dimethylcyclohexene C8H144, 64 |
 | | Compound Data | | Melting point | -74.20 °C | 198.95 K | | CSID | 24634 | H bond acceptors | 0 | Rule of 5 violations | 0 | | Molecular weight | 110.1968 | H bond donors | 0 | ACD/LogP | 3.93 | | Phase 25 °C | liquid/gas | Rotatable bonds | 0 | Predicted density | 0.80 g/cm3 | | SMILES | C\1=C\CCC(C)(C)C/1 | | STD InChIKey | DRORSPJLYCDESA-UHFFFAOYAG | | Melting Points | | mp °C | source | |
|---|
| -74.00 | American Petroleum Institute. Research Project 44; Selected ... | | -74.40 | PHYSPROP |
|
|
| | | 4,4'-(hexafluoroisopropylidene)diphenol C15H10F6O23, 64 |
 | | Compound Data | | Melting point | 161.00 °C | 434.15 K | | CSID | 66498 | H bond acceptors | 2 | Rule of 5 violations | 0 | | Molecular weight | 336.2291 | H bond donors | 2 | ACD/LogP | 2.82 | | Phase 25 °C | solid | Rotatable bonds | 4 | Predicted density | 1.45 g/cm3 | | SMILES | FC(F)(F)C(c1ccc(O)cc1)(c2ccc(O)cc2)C(F)(F)F | | STD InChIKey | ZFVMWEVVKGLCIJ-UHFFFAOYAS | | Melting Points | | mp °C | source | |
|---|
| 160.00 | Alfa Aesar | | 162.00 | PHYSPROP |
|
|
| | | 4,4'-bipyridine C10H8N23, 64 |
 | | Compound Data | | Melting point | 112.00 °C | 385.15 K | | CSID | 21105699 | H bond acceptors | 2 | Rule of 5 violations | 0 | | Molecular weight | 156.1839 | H bond donors | 0 | ACD/LogP | 1.23 | | Phase 25 °C | solid | Rotatable bonds | 1 | Predicted density | 1.11 g/cm3 | | SMILES | c1cnccc1c2ccncc2 | | STD InChIKey | MWVTWFVJZLCBMC-UHFFFAOYAB | | Melting Points | | mp °C | source | |
|---|
| 113.00 | Alfa Aesar | | 111.00 | PHYSPROP |
|
|
| | | 4,4'-diacetoxybiphenyl C16H14O43, 48 |
 | | Compound Data | | Melting point | 162.50 °C | 435.65 K | | CSID | 525308 | H bond acceptors | 4 | Rule of 5 violations | 0 | | Molecular weight | 270.28 | H bond donors | 0 | ACD/LogP | 3.15 | | Phase 25 °C | solid | Rotatable bonds | 5 | Predicted density | 1.18 g/cm3 | | SMILES | O=C(Oc1ccc(cc1)c2ccc(OC(=O)C)cc2)C | | STD InChIKey | RQMBBMQDXFZFCC-UHFFFAOYAJ | | Melting Points | | mp °C | source | |
|---|
| 164.00 | Alfa Aesar | | 161.00 | Karthikeyan M.; Glen R.C.; Bender A. General melting point p... |
|
|
| | | 4,4'-diaminodiphenyl sulfone C12H12N2O2S3, 32, 44, 64 |
 | |
|
| | | 4,4'-diaminodiphenylmethane C13H14N23, 64 |
 | | Compound Data | | Melting point | 91.25 °C | 364.40 K | | CSID | 7296 | H bond acceptors | 2 | Rule of 5 violations | 0 | | Molecular weight | 198.2637 | H bond donors | 4 | ACD/LogP | 1.64 | | Phase 25 °C | solid | Rotatable bonds | 4 | Predicted density | 1.14 g/cm3 | | SMILES | c1(ccc(N)cc1)Cc2ccc(N)cc2 | | STD InChIKey | YBRVSVVVWCFQMG-UHFFFAOYAE | | Melting Points | | mp °C | source | |
|---|
| 90.00 | Alfa Aesar | | 92.50 | PHYSPROP |
|
|
| | | 4,4'-dibromobenzophenone C13H8Br2O3, 7, 64 |
 | |
|
| | | 4,4'-dichlorobenzophenone C13H8Cl2O3, 64 |
 | | Compound Data | | Melting point | 146.25 °C | 419.40 K | | CSID | 6767 | H bond acceptors | 1 | Rule of 5 violations | 0 | | Molecular weight | 251.108 | H bond donors | 0 | ACD/LogP | 4.62 | | Phase 25 °C | solid | Rotatable bonds | 2 | Predicted density | 1.31 g/cm3 | | SMILES | O=C(c1ccc(Cl)cc1)c2ccc(Cl)cc2 | | STD InChIKey | OKISUZLXOYGIFP-UHFFFAOYAC | | Melting Points | | mp °C | source | |
|---|
| 145.00 | Alfa Aesar | | 147.50 | PHYSPROP |
|
|
| | | 4,4'-dichlorobiphenyl C12H8Cl264, 70 |
 | | Compound Data | | Melting point | 149.15 °C | 422.30 K | | CSID | 15474 | H bond acceptors | 0 | Rule of 5 violations | 1 | | Molecular weight | 223.0979 | H bond donors | 0 | ACD/LogP | 5.12 | | Phase 25 °C | solid | Rotatable bonds | 1 | Predicted density | 1.25 g/cm3 | | SMILES | Clc2ccc(c1ccc(Cl)cc1)cc2 | | STD InChIKey | YTBRNEUEFCNVHC-UHFFFAOYAH | | Melting Points | | mp °C | source | |
|---|
| 149.30 | PHYSPROP | | 149.00 | Sepassi K; Yalkowsky SH. AAPS PharmSciTech 7(1) E1-E8 (2006) |
|
|
| | | 4,4'-dicyanobiphenyl C14H8N23, 7, 64 |
 | |
|
| | | 4,4'-difluorobenzophenone C13H8F2O3, 64 |
 | | Compound Data | | Melting point | 105.75 °C | 378.90 K | | CSID | 9206 | H bond acceptors | 1 | Rule of 5 violations | 0 | | Molecular weight | 218.1988 | H bond donors | 0 | ACD/LogP | 3.62 | | Phase 25 °C | solid | Rotatable bonds | 2 | Predicted density | 1.24 g/cm3 | | SMILES | O=C(c1ccc(F)cc1)c2ccc(F)cc2 | | STD InChIKey | LSQARZALBDFYQZ-UHFFFAOYAZ | | Melting Points | | mp °C | source | |
|---|
| 108.00 | Alfa Aesar | | 103.50 | PHYSPROP |
|
|
| | | 4,4'-dihydroxybiphenyl C12H10O22, 3, 64 |
 | |
|
| | | 4,4'-dihydroxydiphenylmethane C13H12O23, 64 |
 | | Compound Data | | Melting point | 161.75 °C | 434.90 K | | CSID | 11614 | H bond acceptors | 2 | Rule of 5 violations | 0 | | Molecular weight | 200.2332 | H bond donors | 2 | ACD/LogP | 2.73 | | Phase 25 °C | solid | Rotatable bonds | 4 | Predicted density | 1.21 g/cm3 | | SMILES | Oc1ccc(cc1)Cc2ccc(O)cc2 | | STD InChIKey | PXKLMJQFEQBVLD-UHFFFAOYAW | | Melting Points | | mp °C | source | |
|---|
| 161.00 | Alfa Aesar | | 162.50 | PHYSPROP |
|
|
| | | 4,4'-dimethyl-2,2'-bipyridine C12H12N23, 64 |
 | | Compound Data | | Melting point | 174.50 °C | 447.65 K | | CSID | 13699 | H bond acceptors | 2 | Rule of 5 violations | 0 | | Molecular weight | 184.2371 | H bond donors | 0 | ACD/LogP | 2.68 | | Phase 25 °C | solid | Rotatable bonds | 1 | Predicted density | 1.06 g/cm3 | | SMILES | Cc1ccnc(c1)c2cc(ccn2)C | | STD InChIKey | NBPGPQJFYXNFKN-UHFFFAOYAL | | Melting Points | | mp °C | source | |
|---|
| 174.00 | Alfa Aesar | | 175.00 | PHYSPROP |
|
|
| | | 4,4'-dimethylbiphenyl C14H143, 4 |
 | | Compound Data | | Melting point | 120.50 °C | 393.65 K | | CSID | 11447 | H bond acceptors | 0 | Rule of 5 violations | 0 | | Molecular weight | 182.261 | H bond donors | 0 | ACD/LogP | 4.90 | | Phase 25 °C | solid | Rotatable bonds | 1 | Predicted density | 0.97 g/cm3 | | SMILES | c2c(c1ccc(cc1)C)ccc(c2)C | | STD InChIKey | RZTDESRVPFKCBH-UHFFFAOYAT | | Melting Points | | mp °C | source | |
|---|
| 120.00 | Alfa Aesar | | 121.00 | American Petroleum Institute. Research Project 44; Selected ... |
|
|
| | | 4,4'-dimethyldiphenylmethane C15H164, 64 |
 | | Compound Data | | Melting point | 28.50 °C | 301.65 K | | CSID | 19816 | H bond acceptors | 0 | Rule of 5 violations | 1 | | Molecular weight | 196.2875 | H bond donors | 0 | ACD/LogP | 5.13 | | Phase 25 °C | solid | Rotatable bonds | 2 | Predicted density | 0.97 g/cm3 | | SMILES | c1c(ccc(c1)C)Cc2ccc(cc2)C | | STD InChIKey | HZAWPPRBCALFRN-UHFFFAOYAV | | Melting Points | | mp °C | source | |
|---|
| 29.00 | American Petroleum Institute. Research Project 44; Selected ... | | 28.00 | PHYSPROP |
|
|
| | | 4,4'-methylenebis(N,N-dimethylaniline) C17H22N23, 64 |
 | | Compound Data | | Melting point | 89.25 °C | 362.40 K | | CSID | 21106506 | H bond acceptors | 2 | Rule of 5 violations | 0 | | Molecular weight | 254.37 | H bond donors | 0 | ACD/LogP | 4.42 | | Phase 25 °C | solid | Rotatable bonds | 4 | Predicted density | 1.04 g/cm3 | | SMILES | CN(C)c2ccc(Cc1ccc(cc1)N(C)C)cc2 | | STD InChIKey | JNRLEMMIVRBKJE-UHFFFAOYAR | | Melting Points | | mp °C | source | |
|---|
| 87.00 | Alfa Aesar | | 91.50 | PHYSPROP |
|
|
| | | 4,4'-thiodiphenol C12H10O2S3, 64 |
 | | Compound Data | | Melting point | 154.00 °C | 427.15 K | | CSID | 16612 | H bond acceptors | 2 | Rule of 5 violations | 0 | | Molecular weight | 218.2716 | H bond donors | 2 | ACD/LogP | 3.34 | | Phase 25 °C | solid | Rotatable bonds | 4 | Predicted density | 1.37 g/cm3 | | SMILES | S(c1ccc(O)cc1)c2ccc(O)cc2 | | STD InChIKey | VWGKEVWFBOUAND-UHFFFAOYAP | | Melting Points | | mp °C | source | |
|---|
| 153.00 | Alfa Aesar | | 155.00 | PHYSPROP |
|
|
| | | 4,6-dichlororesorcinol C6H4Cl2O23, 64 |
 | | Compound Data | | Melting point | 114.00 °C | 387.15 K | | CSID | 60631 | H bond acceptors | 2 | Rule of 5 violations | 0 | | Molecular weight | 179.0008 | H bond donors | 2 | ACD/LogP | 2.58 | | Phase 25 °C | solid | Rotatable bonds | 2 | Predicted density | 1.62 g/cm3 | | SMILES | Clc1cc(Cl)c(O)cc1O | | STD InChIKey | GRLQBYQELUWBIO-UHFFFAOYAC | | Melting Points | | mp °C | source | |
|---|
| 115.00 | Alfa Aesar | | 113.00 | PHYSPROP |
|
|
| | | 5-amino-1-pentanol C5H13NO2, 3, 64 |
 | |
|
| | | 5-aminoindane C9H11N3, 64 |
 | | Compound Data | | Melting point | 36.25 °C | 309.40 K | | CSID | 81705 | H bond acceptors | 1 | Rule of 5 violations | 0 | | Molecular weight | 133.1903 | H bond donors | 2 | ACD/LogP | 2.06 | | Phase 25 °C | solid | Rotatable bonds | 1 | Predicted density | 1.10 g/cm3 | | SMILES | c1cc(cc2c1CCC2)N | | STD InChIKey | LEWZOBYWGWKNCK-UHFFFAOYAR | | Melting Points | | mp °C | source | |
|---|
| 35.00 | Alfa Aesar | | 37.50 | PHYSPROP |
|
|
| | | 5-aminoindazole C7H7N33, 64 |
 | | Compound Data | | Melting point | 175.75 °C | 448.90 K | | CSID | 79400 | H bond acceptors | 3 | Rule of 5 violations | 0 | | Molecular weight | 133.1506 | H bond donors | 3 | ACD/LogP | 0.65 | | Phase 25 °C | solid | Rotatable bonds | 1 | Predicted density | 1.37 g/cm3 | | SMILES | n2cc1cc(ccc1n2)N | | STD InChIKey | XBTOSRUBOXQWBO-UHFFFAOYAK | | Melting Points | | mp °C | source | |
|---|
| 175.00 | Alfa Aesar | | 176.50 | PHYSPROP |
|
|
| | | 5-aminoisoquinoline C9H8N23, 64 |
 | | Compound Data | | Melting point | 128.50 °C | 401.65 K | | CSID | 63931 | H bond acceptors | 2 | Rule of 5 violations | 0 | | Molecular weight | 144.1732 | H bond donors | 2 | ACD/LogP | 0.68 | | Phase 25 °C | solid | Rotatable bonds | 1 | Predicted density | 1.21 g/cm3 | | SMILES | n2ccc1c(cccc1N)c2 | | STD InChIKey | DTVYNUOOZIKEEX-UHFFFAOYAV | | Melting Points | | mp °C | source | |
|---|
| 129.00 | Alfa Aesar | | 128.00 | PHYSPROP |
|
|
| | | 5-aminoquinoline C9H8N23, 64 |
 | | Compound Data | | Melting point | 109.00 °C | 382.15 K | | CSID | 11417 | H bond acceptors | 2 | Rule of 5 violations | 0 | | Molecular weight | 144.1732 | H bond donors | 2 | ACD/LogP | 0.92 | | Phase 25 °C | solid | Rotatable bonds | 1 | Predicted density | 1.21 g/cm3 | | SMILES | n1cccc2c(cccc12)N | | STD InChIKey | XMIAFAKRAAMSGX-UHFFFAOYAV | | Melting Points | | mp °C | source | |
|---|
| 108.00 | Alfa Aesar | | 110.00 | PHYSPROP |
|
|
| | | 5-benzyloxyindole C15H13NO3, 64 |
 | | Compound Data | | Melting point | 100.50 °C | 373.65 K | | CSID | 13959 | H bond acceptors | 2 | Rule of 5 violations | 0 | | Molecular weight | 223.2698 | H bond donors | 1 | ACD/LogP | 3.71 | | Phase 25 °C | solid | Rotatable bonds | 3 | Predicted density | 1.20 g/cm3 | | SMILES | O(c1cc2c(cc1)ncc2)Cc3ccccc3 | | STD InChIKey | JCQLPDZCNSVBMS-UHFFFAOYAN | | Melting Points | | mp °C | source | |
|---|
| 99.00 | Alfa Aesar | | 102.00 | PHYSPROP |
|
|
| | | 5-bromo-2-furaldehyde C5H3BrO23, 64 |
 | | Compound Data | | Melting point | 83.75 °C | 356.90 K | | CSID | 521915 | H bond acceptors | 2 | Rule of 5 violations | 0 | | Molecular weight | 174.9801 | H bond donors | 0 | ACD/LogP | 1.64 | | Phase 25 °C | solid | Rotatable bonds | 1 | Predicted density | 1.75 g/cm3 | | SMILES | c1cc(oc1C=O)Br | | STD InChIKey | WJTFHWXMITZNHS-UHFFFAOYAM | | Melting Points | | mp °C | source | |
|---|
| 84.00 | Alfa Aesar | | 83.50 | PHYSPROP |
|
|
| | | 5-bromo-2-hydroxybenzyl alcohol C7H7BrO23, 64 |
 | | Compound Data | | Melting point | 111.00 °C | 384.15 K | | CSID | 67879 | H bond acceptors | 2 | Rule of 5 violations | 0 | | Molecular weight | 203.0333 | H bond donors | 2 | ACD/LogP | 1.31 | | Phase 25 °C | solid | Rotatable bonds | 3 | Predicted density | 1.72 g/cm3 | | SMILES | Brc1cc(c(O)cc1)CO | | STD InChIKey | KNKRHSVKIORZQB-UHFFFAOYAQ | | Melting Points | | mp °C | source | |
|---|
| 109.00 | Alfa Aesar | | 113.00 | PHYSPROP |
|
|
| | | 5-bromovaleric acid C5H9BrO23, 64 |
 | | Compound Data | | Melting point | 39.50 °C | 312.65 K | | CSID | 15526 | H bond acceptors | 2 | Rule of 5 violations | 0 | | Molecular weight | 181.0278 | H bond donors | 1 | ACD/LogP | 1.38 | | Phase 25 °C | solid | Rotatable bonds | 4 | Predicted density | 1.52 g/cm3 | | SMILES | BrCCCCC(=O)O | | STD InChIKey | WNXNUPJZWYOKMW-UHFFFAOYAD | | Melting Points | | mp °C | source | |
|---|
| 40.00 | Alfa Aesar | | 39.00 | PHYSPROP |
|
|
| | | 5-chloro-1,3-dimethoxybenzene C8H9ClO22, 3, 64 |
 | |
|
| | | 5-chloro-2-hydroxyaniline C6H6ClNO2, 3, 64 |
 | |
|
| | | 5-chloro-2-methylaniline C7H8ClN3, 64 |
 | | Compound Data | | Melting point | 24.50 °C | 297.65 K | | CSID | 6990 | H bond acceptors | 1 | Rule of 5 violations | 0 | | Molecular weight | 141.5981 | H bond donors | 2 | ACD/LogP | 2.27 | | Phase 25 °C | liquid/gas | Rotatable bonds | 1 | Predicted density | 1.18 g/cm3 | | SMILES | Clc1cc(N)c(cc1)C | | STD InChIKey | WRZOMWDJOLIVQP-UHFFFAOYAU | | Melting Points | | mp °C | source | |
|---|
| 23.00 | Alfa Aesar | | 26.00 | PHYSPROP |
|
|
| | | 5-chloro-2-nitrobenzoic acid C7H4ClNO43, 64 |
 | | Compound Data | | Melting point | 138.50 °C | 411.65 K | | CSID | 16358 | H bond acceptors | 5 | Rule of 5 violations | 0 | | Molecular weight | 201.564 | H bond donors | 1 | ACD/LogP | 2.62 | | Phase 25 °C | solid | Rotatable bonds | 2 | Predicted density | 1.60 g/cm3 | | SMILES | O=[N+]([O-])c1c(cc(Cl)cc1)C(=O)O | | STD InChIKey | ZKUYSJHXBFFGPU-UHFFFAOYAZ | | Melting Points | | mp °C | source | |
|---|
| 138.00 | Alfa Aesar | | 139.00 | PHYSPROP |
|
|
| | | 5-chlorodibenzosuberane C15H13Cl3, 64 |
 | | Compound Data | | Melting point | 106.75 °C | 379.90 K | | CSID | 13925 | H bond acceptors | 0 | Rule of 5 violations | 0 | | Molecular weight | 228.7167 | H bond donors | 0 | ACD/LogP | 3.62 | | Phase 25 °C | solid | Rotatable bonds | 0 | Predicted density | 1.19 g/cm3 | | SMILES | c1ccc2c(c1)CCc3ccccc3C2Cl | | STD InChIKey | QPERNSDCEUTOTE-UHFFFAOYAZ | | Melting Points | | mp °C | source | |
|---|
| 107.00 | Alfa Aesar | | 106.50 | PHYSPROP |
|
|
| | | 5-chlorosalicylaldehyde C7H5ClO23, 64 |
 | | Compound Data | | Melting point | 100.65 °C | 373.80 K | | CSID | 11971 | H bond acceptors | 2 | Rule of 5 violations | 0 | | Molecular weight | 156.5664 | H bond donors | 1 | ACD/LogP | 2.57 | | Phase 25 °C | solid | Rotatable bonds | 2 | Predicted density | 1.40 g/cm3 | | SMILES | Clc1cc(C=O)c(O)cc1 | | STD InChIKey | FUGKCSRLAQKUHG-UHFFFAOYAF | | Melting Points | | mp °C | source | |
|---|
| 101.00 | Alfa Aesar | | 100.30 | PHYSPROP |
|
|
| | | 5-chlorosalicylic acid C7H5ClO32, 3, 64 |
 | |
|
| | | 5-cyanoindole C9H6N23, 64 |
 | | Compound Data | | Melting point | 106.50 °C | 379.65 K | | CSID | 25604 | H bond acceptors | 2 | Rule of 5 violations | 0 | | Molecular weight | 142.1573 | H bond donors | 1 | ACD/LogP | 2.36 | | Phase 25 °C | solid | Rotatable bonds | 0 | Predicted density | 1.24 g/cm3 | | SMILES | N#Cc1cc2c(cc1)ncc2 | | STD InChIKey | YHYLDEVWYOFIJK-UHFFFAOYAP | | Melting Points | | mp °C | source | |
|---|
| 106.00 | Alfa Aesar | | 107.00 | PHYSPROP |
|
|
| | | 5-ethyl-2-methylpyridine C8H11N3, 61, 64 |
 | | Compound Data | | Melting point | -70.97 °C | 202.18 K | | CSID | 21105900 | H bond acceptors | 1 | Rule of 5 violations | 0 | | Molecular weight | 121.1796 | H bond donors | 0 | ACD/LogP | 2.18 | | Phase 25 °C | liquid/gas | Rotatable bonds | 1 | Predicted density | 0.92 g/cm3 | | SMILES | CCc1cnc(C)cc1 | | STD InChIKey | NTSLROIKFLNUIJ-UHFFFAOYAH | | Melting Points | | mp °C | source | |
|---|
| -71.00 | Alfa Aesar | | -71.00 | Oxford University MSDS | | -70.90 | PHYSPROP |
|
|
| | | 5-fluoro-2-nitrophenol C6H4FNO33, 64 |
 | | Compound Data | | Melting point | 34.50 °C | 307.65 K | | CSID | 9549 | H bond acceptors | 4 | Rule of 5 violations | 0 | | Molecular weight | 157.0993 | H bond donors | 1 | ACD/LogP | 1.96 | | Phase 25 °C | solid | Rotatable bonds | 2 | Predicted density | 1.51 g/cm3 | | SMILES | O=[N+]([O-])c1ccc(F)cc1O | | STD InChIKey | QQURWFRNETXFTN-UHFFFAOYAE | | Melting Points | | mp °C | source | |
|---|
| 33.00 | Alfa Aesar | | 36.00 | PHYSPROP |
|
|
| | | 5-fluorouracil C4H3FN2O232, 44, 64 |
 | |
|
| | | 5-hydrofuran-2-one C4H4O23, 64 |
 | | Compound Data | | Melting point | 4.25 °C | 277.40 K | | CSID | 9917 | H bond acceptors | 2 | Rule of 5 violations | 0 | | Molecular weight | 84.0734 | H bond donors | 0 | ACD/LogP | -0.84 | | Phase 25 °C | liquid/gas | Rotatable bonds | 0 | Predicted density | 1.21 g/cm3 | | SMILES | O=C\1OC/C=C/1 | | STD InChIKey | VIHAEDVKXSOUAT-UHFFFAOYAD | | Melting Points | | mp °C | source | |
|---|
| 4.00 | Alfa Aesar | | 4.50 | PHYSPROP |
|
|
| | | 5-hydroxy-3,4-dimethoxybenzoic acid C9H10O53, 48 |
 | | Compound Data | | Melting point | 195.50 °C | 468.65 K | | CSID | 67282 | H bond acceptors | 5 | Rule of 5 violations | 0 | | Molecular weight | 198.1727 | H bond donors | 2 | ACD/LogP | 1.50 | | Phase 25 °C | solid | Rotatable bonds | 4 | Predicted density | 1.33 g/cm3 | | SMILES | O=C(O)c1cc(O)c(OC)c(OC)c1 | | STD InChIKey | WFIBQVFJXGQICQ-UHFFFAOYAL | | Melting Points | | mp °C | source | |
|---|
| 196.00 | Alfa Aesar | | 195.00 | Karthikeyan M.; Glen R.C.; Bender A. General melting point p... |
|
|
| | | 5-hydroxyindole C8H7NO3, 64 |
 | | Compound Data | | Melting point | 108.25 °C | 381.40 K | | CSID | 15244 | H bond acceptors | 2 | Rule of 5 violations | 0 | | Molecular weight | 133.1473 | H bond donors | 2 | ACD/LogP | 0.97 | | Phase 25 °C | solid | Rotatable bonds | 1 | Predicted density | 1.33 g/cm3 | | SMILES | c1cc2c(cc[nH]2)cc1O | | STD InChIKey | LMIQERWZRIFWNZ-UHFFFAOYAS | | Melting Points | | mp °C | source | |
|---|
| 109.00 | Alfa Aesar | | 107.50 | PHYSPROP |
|
|
| | | 5-hydroxymethylfurfural C6H6O33, 64 |
 | | Compound Data | | Melting point | 32.75 °C | 305.90 K | | CSID | 207215 | H bond acceptors | 3 | Rule of 5 violations | 0 | | Molecular weight | 126.11 | H bond donors | 1 | ACD/LogP | 0.00 | | Phase 25 °C | solid | Rotatable bonds | 3 | Predicted density | 1.29 g/cm3 | | SMILES | c1cc(oc1CO)C=O | | STD InChIKey | NOEGNKMFWQHSLB-UHFFFAOYAB | | Melting Points | | mp °C | source | |
|---|
| 34.00 | Alfa Aesar | | 31.50 | PHYSPROP |
|
|
| | | 5-indanol C9H10O3, 64 |
 | | Compound Data | | Melting point | 55.50 °C | 328.65 K | | CSID | 14390 | H bond acceptors | 1 | Rule of 5 violations | 0 | | Molecular weight | 134.1751 | H bond donors | 1 | ACD/LogP | 2.60 | | Phase 25 °C | solid | Rotatable bonds | 1 | Predicted density | 1.15 g/cm3 | | SMILES | Oc1ccc2c(c1)CCC2 | | STD InChIKey | PEHSSTUGJUBZBI-UHFFFAOYAE | | Melting Points | | mp °C | source | |
|---|
| 53.00 | Alfa Aesar | | 58.00 | PHYSPROP |
|
|
| | | 5-isopropyl-2-methylphenol C10H14O61, 64 |
 | | Compound Data | | Melting point | 1.50 °C | 274.65 K | | CSID | 21105867 | H bond acceptors | 1 | Rule of 5 violations | 0 | | Molecular weight | 150.2176 | H bond donors | 1 | ACD/LogP | 3.28 | | Phase 25 °C | liquid/gas | Rotatable bonds | 2 | Predicted density | 0.97 g/cm3 | | SMILES | Cc1ccc(cc1O)C(C)C | | STD InChIKey | RECUKUPTGUEGMW-UHFFFAOYAI | | Melting Points | | mp °C | source | |
|---|
| 2.00 | Oxford University MSDS | | 1.00 | PHYSPROP |
|
|
| | | 5-mercapto-1-methyltetrazole C2H4N4S3, 48 |
 | | Compound Data | | Melting point | 124.50 °C | 397.65 K | | CSID | 2005963 | H bond acceptors | 4 | Rule of 5 violations | 0 | | Molecular weight | 116.145 | H bond donors | 1 | ACD/LogP | -1.09 | | Phase 25 °C | solid | Rotatable bonds | 0 | Predicted density | 1.69 g/cm3 | | SMILES | S=C1/N=N\NN1C | | STD InChIKey | XOHZHMUQBFJTNH-UHFFFAOYAZ | | Melting Points | | mp °C | source | |
|---|
| 127.00 | Alfa Aesar | | 122.00 | Karthikeyan M.; Glen R.C.; Bender A. General melting point p... |
|
|
| | | 5-methoxybenzofuroxan C7H6N2O33, 48 |
 | | Compound Data | | Melting point | 117.50 °C | 390.65 K | | CSID | 284177 | H bond acceptors | 5 | Rule of 5 violations | 0 | | Molecular weight | 166.1341 | H bond donors | 0 | ACD/LogP | 1.34 | | Phase 25 °C | solid | Rotatable bonds | 1 | Predicted density | 1.46 g/cm3 | | SMILES | [O-][n+]1onc2cc(OC)ccc12 | | STD InChIKey | ABSKHUSUHODMEL-UHFFFAOYAG | | Melting Points | | mp °C | source | |
|---|
| 117.00 | Alfa Aesar | | 118.00 | Karthikeyan M.; Glen R.C.; Bender A. General melting point p... |
|
|
| | | 5-methoxyindole C9H9NO3, 64 |
 | | Compound Data | | Melting point | 55.50 °C | 328.65 K | | CSID | 13272 | H bond acceptors | 2 | Rule of 5 violations | 0 | | Molecular weight | 147.1739 | H bond donors | 1 | ACD/LogP | 2.06 | | Phase 25 °C | solid | Rotatable bonds | 1 | Predicted density | 1.17 g/cm3 | | SMILES | COc1ccc2c(c1)cc[nH]2 | | STD InChIKey | DWAQDRSOVMLGRQ-UHFFFAOYAJ | | Melting Points | | mp °C | source | |
|---|
| 54.00 | Alfa Aesar | | 57.00 | PHYSPROP |
|
|
| | | 5-methyl-1-hexyne C7H124, 64 |
 | | Compound Data | | Melting point | -124.50 °C | 148.65 K | | CSID | 121154 | H bond acceptors | 0 | Rule of 5 violations | 0 | | Molecular weight | 96.1702 | H bond donors | 0 | ACD/LogP | 2.94 | | Phase 25 °C | liquid/gas | Rotatable bonds | 2 | Predicted density | 0.75 g/cm3 | | SMILES | C#CCCC(C)C | | STD InChIKey | HKNANEMUCJGPMS-UHFFFAOYAS | | Melting Points | | mp °C | source | |
|---|
| -124.00 | American Petroleum Institute. Research Project 44; Selected ... | | -125.00 | PHYSPROP |
|
|
| | | 5-methyl-2-hexyne C7H124, 64 |
 | | Compound Data | | Melting point | -92.95 °C | 180.20 K | | CSID | 126201 | H bond acceptors | 0 | Rule of 5 violations | 0 | | Molecular weight | 96.1702 | H bond donors | 0 | ACD/LogP | 2.87 | | Phase 25 °C | liquid/gas | Rotatable bonds | 1 | Predicted density | 0.75 g/cm3 | | SMILES | C(#CCC(C)C)C | | STD InChIKey | SVGAHRUSRQTQES-UHFFFAOYAO | | Melting Points | | mp °C | source | |
|---|
| -93.00 | American Petroleum Institute. Research Project 44; Selected ... | | -92.90 | PHYSPROP |
|
|
| | | 5-methyl-2-nitrophenol C7H7NO33, 64 |
 | | Compound Data | | Melting point | 54.00 °C | 327.15 K | | CSID | 12263 | H bond acceptors | 4 | Rule of 5 violations | 0 | | Molecular weight | 153.1354 | H bond donors | 1 | ACD/LogP | 2.17 | | Phase 25 °C | solid | Rotatable bonds | 2 | Predicted density | 1.32 g/cm3 | | SMILES | O=[N+]([O-])c1ccc(cc1O)C | | STD InChIKey | NQXUSSVLFOBRSE-UHFFFAOYAG | | Melting Points | | mp °C | source | |
|---|
| 55.00 | Alfa Aesar | | 53.00 | PHYSPROP |
|
|
| | | 5-methylbenzimidazole C8H8N23, 32, 64 |
 | | Compound Data | | Melting point | 114.17 °C | 387.32 K | | CSID | 11484 | H bond acceptors | 2 | Rule of 5 violations | 0 | | Molecular weight | 132.1625 | H bond donors | 1 | ACD/LogP | 1.84 | | Phase 25 °C | solid | Rotatable bonds | 0 | Predicted density | 1.19 g/cm3 | | SMILES | n2c1ccc(cc1nc2)C | | STD InChIKey | RWXZXCZBMQPOBF-UHFFFAOYAW | | Melting Points | | mp °C | source | |
|---|
| 115.00 | Alfa Aesar | | 112.00 | DrugBank | | 115.50 | PHYSPROP |
|
|
| | | 5-methylbenzofurazan N-oxide C7H6N2O23, 48 |
 | | Compound Data | | Melting point | 96.50 °C | 369.65 K | | CSID | 123905 | H bond acceptors | 4 | Rule of 5 violations | 0 | | Molecular weight | 150.1347 | H bond donors | 0 | ACD/LogP | 1.89 | | Phase 25 °C | solid | Rotatable bonds | 0 | Predicted density | 1.40 g/cm3 | | SMILES | [O-][n+]1onc2cc(ccc12)C | | STD InChIKey | HCWVKDOCXDWFEH-UHFFFAOYAO | | Melting Points | | mp °C | source | |
|---|
| 97.00 | Alfa Aesar | | 96.00 | Karthikeyan M.; Glen R.C.; Bender A. General melting point p... |
|
|
| | | 5-methylbenzotriazole C7H7N33, 61, 64 |
 | | Compound Data | | Melting point | 81.17 °C | 354.32 K | | CSID | 8381 | H bond acceptors | 3 | Rule of 5 violations | 0 | | Molecular weight | 133.1506 | H bond donors | 1 | ACD/LogP | 1.60 | | Phase 25 °C | solid | Rotatable bonds | 0 | Predicted density | 1.27 g/cm3 | | SMILES | n1c2ccc(cc2nn1)C | | STD InChIKey | LRUDIIUSNGCQKF-UHFFFAOYAO | | Melting Points | | mp °C | source | |
|---|
| 81.00 | Alfa Aesar | | 81.50 | Oxford University MSDS | | 81.00 | PHYSPROP |
|
|
| | | 5-methylnonane C10H224, 64 |
 | | Compound Data | | Melting point | -87.85 °C | 185.30 K | | CSID | 25609 | H bond acceptors | 0 | Rule of 5 violations | 1 | | Molecular weight | 142.2817 | H bond donors | 0 | ACD/LogP | 5.88 | | Phase 25 °C | liquid/gas | Rotatable bonds | 6 | Predicted density | 0.73 g/cm3 | | SMILES | CCCCC(CCCC)C | | STD InChIKey | TYSIILFJZXHVPU-UHFFFAOYAA | | Melting Points | | mp °C | source | |
|---|
| -88.00 | American Petroleum Institute. Research Project 44; Selected ... | | -87.70 | PHYSPROP |
|
|
| | | 5-methylpyrimidine C5H6N23, 64, 64 |
 | | Compound Data | | Melting point | 30.83 °C | 303.98 K | | CSID | 67424 | H bond acceptors | 2 | Rule of 5 violations | 0 | | Molecular weight | 94.1145 | H bond donors | 0 | ACD/LogP | 0.01 | | Phase 25 °C | solid | Rotatable bonds | 0 | Predicted density | 1.02 g/cm3 | | SMILES | Cc1cncnc1 | | STD InChIKey | TWGNOYAGHYUFFR-UHFFFAOYAP | | Melting Points | | mp °C | source | |
|---|
| 30.00 | Alfa Aesar | | 32.00 | PHYSPROP | | 30.50 | PHYSPROP |
|
|
| | | 5-methylsalicylic acid C8H8O33, 64 |
 | | Compound Data | | Melting point | 152.00 °C | 425.15 K | | CSID | 6707 | H bond acceptors | 3 | Rule of 5 violations | 0 | | Molecular weight | 152.1473 | H bond donors | 2 | ACD/LogP | 2.52 | | Phase 25 °C | solid | Rotatable bonds | 2 | Predicted density | 1.30 g/cm3 | | SMILES | O=C(O)c1cc(ccc1O)C | | STD InChIKey | DLGBEGBHXSAQOC-UHFFFAOYAZ | | Melting Points | | mp °C | source | |
|---|
| 153.00 | Alfa Aesar | | 151.00 | PHYSPROP |
|
|
| | | 5-nitro-1,2-dihydroacenaphthylene C12H9NO261, 64 |
 | | Compound Data | | Melting point | 103.25 °C | 376.40 K | | CSID | 11276 | H bond acceptors | 3 | Rule of 5 violations | 0 | | Molecular weight | 199.2054 | H bond donors | 0 | ACD/LogP | 3.92 | | Phase 25 °C | solid | Rotatable bonds | 1 | Predicted density | 1.36 g/cm3 | | SMILES | [O-][N+](=O)c1ccc3c2c1cccc2CC3 | | STD InChIKey | CUARLQDWYSRQDF-UHFFFAOYAL | | Melting Points | | mp °C | source | |
|---|
| 103.50 | Oxford University MSDS | | 103.00 | PHYSPROP |
|
|
| | | 5-nitro-1,3-dimethylbenzene C8H9NO22, 3, 64 |
 | |
|
| | | 5-nitro-2-furaldehyde C5H3NO43, 64 |
 | | Compound Data | | Melting point | 35.75 °C | 308.90 K | | CSID | 12249 | H bond acceptors | 5 | Rule of 5 violations | 0 | | Molecular weight | 141.0816 | H bond donors | 0 | ACD/LogP | 0.51 | | Phase 25 °C | solid | Rotatable bonds | 2 | Predicted density | 1.47 g/cm3 | | SMILES | O=Cc1oc([N+](=O)[O-])cc1 | | STD InChIKey | SXINBFXPADXIEY-UHFFFAOYAX | | Melting Points | | mp °C | source | |
|---|
| 36.00 | Alfa Aesar | | 35.50 | PHYSPROP |
|
|
| | | 5-nitro-2-furaldehyde diacetate C9H9NO73, 64 |
 | | Compound Data | | Melting point | 90.50 °C | 363.65 K | | CSID | 6830 | H bond acceptors | 8 | Rule of 5 violations | 0 | | Molecular weight | 243.1703 | H bond donors | 0 | ACD/LogP | 0.18 | | Phase 25 °C | solid | Rotatable bonds | 6 | Predicted density | 1.40 g/cm3 | | SMILES | O=[N+]([O-])c1oc(cc1)C(OC(=O)C)OC(=O)C | | STD InChIKey | HSXKWKJCZNRMJO-UHFFFAOYAS | | Melting Points | | mp °C | source | |
|---|
| 90.00 | Alfa Aesar | | 91.00 | PHYSPROP |
|
|
| | | 5-nitro-2-furoic acid C5H3NO53, 48, 64 |
 | |
|
| | | 5-nitroisoquinoline C9H6N2O23, 64 |
 | | Compound Data | | Melting point | 109.00 °C | 382.15 K | | CSID | 62303 | H bond acceptors | 4 | Rule of 5 violations | 0 | | Molecular weight | 174.1561 | H bond donors | 0 | ACD/LogP | 1.69 | | Phase 25 °C | solid | Rotatable bonds | 1 | Predicted density | 1.35 g/cm3 | | SMILES | [O-][N+](=O)c1cccc2c1ccnc2 | | STD InChIKey | PYGMPFQCCWBTJQ-UHFFFAOYAT | | Melting Points | | mp °C | source | |
|---|
| 108.00 | Alfa Aesar | | 110.00 | PHYSPROP |
|
|
| | | 5-nitrosalicylic acid C7H5NO53, 64 |
 | | Compound Data | | Melting point | 230.75 °C | 503.90 K | | CSID | 7042 | H bond acceptors | 6 | Rule of 5 violations | 0 | | Molecular weight | 183.1183 | H bond donors | 2 | ACD/LogP | 2.35 | | Phase 25 °C | solid | Rotatable bonds | 3 | Predicted density | 1.63 g/cm3 | | SMILES | O=C(O)c1cc(ccc1O)[N+]([O-])=O | | STD InChIKey | PPDRLQLKHRZIJC-UHFFFAOYAT | | Melting Points | | mp °C | source | |
|---|
| 232.00 | Alfa Aesar | | 229.50 | PHYSPROP |
|
|
| | | 5-oxohexanoic acid C6H10O33, 64 |
 | | Compound Data | | Melting point | 12.75 °C | 285.90 K | | CSID | 17383 | H bond acceptors | 3 | Rule of 5 violations | 0 | | Molecular weight | 130.1418 | H bond donors | 1 | ACD/LogP | -0.13 | | Phase 25 °C | liquid/gas | Rotatable bonds | 4 | Predicted density | 1.09 g/cm3 | | SMILES | O=C(C)CCCC(=O)O | | STD InChIKey | MGTZCLMLSSAXLD-UHFFFAOYAE | | Melting Points | | mp °C | source | |
|---|
| 12.00 | Alfa Aesar | | 13.50 | PHYSPROP |
|
|
| | | 5-phenylvaleric acid C11H14O23, 64 |
 | | Compound Data | | Melting point | 58.25 °C | 331.40 K | | CSID | 15886 | H bond acceptors | 2 | Rule of 5 violations | 0 | | Molecular weight | 178.2277 | H bond donors | 1 | ACD/LogP | 2.70 | | Phase 25 °C | solid | Rotatable bonds | 5 | Predicted density | 1.07 g/cm3 | | SMILES | O=C(O)CCCCc1ccccc1 | | STD InChIKey | BYHDDXPKOZIZRV-UHFFFAOYAD | | Melting Points | | mp °C | source | |
|---|
| 59.00 | Alfa Aesar | | 57.50 | PHYSPROP |
|
|
| | | 5-t-butyl-1,3-dimethylbenzene C12H183, 64 |
 | | Compound Data | | Melting point | -20.00 °C | 253.15 K | | CSID | 7100 | H bond acceptors | 0 | Rule of 5 violations | 0 | | Molecular weight | 162.2713 | H bond donors | 0 | ACD/LogP | 4.83 | | Phase 25 °C | liquid/gas | Rotatable bonds | 1 | Predicted density | 0.86 g/cm3 | | SMILES | c1c(cc(cc1C(C)(C)C)C)C | | STD InChIKey | FZSPYHREEHYLCB-UHFFFAOYAL | | Melting Points | | mp °C | source | |
|---|
| -22.00 | Alfa Aesar | | -18.00 | PHYSPROP |
|
|
| | | 5,5-dimethylcyclohexane-1,3-dione C8H12O23, 61 |
 | | Compound Data | | Melting point | 148.25 °C | 421.40 K | | CSID | 29091 | H bond acceptors | 2 | Rule of 5 violations | 0 | | Molecular weight | 140.1797 | H bond donors | 0 | ACD/LogP | 0.15 | | Phase 25 °C | solid | Rotatable bonds | 0 | Predicted density | 1.02 g/cm3 | | SMILES | O=C1CC(=O)CC(C)(C)C1 | | STD InChIKey | BADXJIPKFRBFOT-UHFFFAOYAX | | Melting Points | | mp °C | source | |
|---|
| 148.00 | Alfa Aesar | | 148.50 | Oxford University MSDS |
|
|
| | | 5,5-dimethylhydantoin C5H8N2O23, 64 |
 | | Compound Data | | Melting point | 177.00 °C | 450.15 K | | CSID | 6246 | H bond acceptors | 4 | Rule of 5 violations | 0 | | Molecular weight | 128.1292 | H bond donors | 2 | ACD/LogP | -0.66 | | Phase 25 °C | solid | Rotatable bonds | 0 | Predicted density | 1.14 g/cm3 | | SMILES | O=C1NC(=O)NC1(C)C | | STD InChIKey | YIROYDNZEPTFOL-UHFFFAOYAJ | | Melting Points | | mp °C | source | |
|---|
| 176.00 | Alfa Aesar | | 178.00 | PHYSPROP |
|
|
| | | 5,5-dimethyloxazolidine-2,4-dione C5H7NO33, 64 |
 | | Compound Data | | Melting point | 77.75 °C | 350.90 K | | CSID | 2972 | H bond acceptors | 4 | Rule of 5 violations | 0 | | Molecular weight | 129.114 | H bond donors | 1 | ACD/LogP | 0.15 | | Phase 25 °C | solid | Rotatable bonds | 0 | Predicted density | 1.20 g/cm3 | | SMILES | O=C1NC(=O)OC1(C)C | | STD InChIKey | JYJFNDQBESEHJQ-UHFFFAOYAJ | | Melting Points | | mp °C | source | |
|---|
| 79.00 | Alfa Aesar | | 76.50 | PHYSPROP |
|
|
| | | 5,6-dichloro-2-benzofuran-1,3-dione C8H2Cl2O348, 64 |
 | | Compound Data | | Melting point | 187.00 °C | 460.15 K | | CSID | 63515 | H bond acceptors | 3 | Rule of 5 violations | 0 | | Molecular weight | 217.0057 | H bond donors | 0 | ACD/LogP | 2.67 | | Phase 25 °C | solid | Rotatable bonds | 0 | Predicted density | 1.72 g/cm3 | | SMILES | Clc1cc2C(=O)OC(=O)c2cc1Cl | | STD InChIKey | ULSOWUBMELTORB-UHFFFAOYAF | | Melting Points | | mp °C | source | |
|---|
| 186.00 | Karthikeyan M.; Glen R.C.; Bender A. General melting point p... | | 188.00 | PHYSPROP |
|
|
| | | 5,6-dimethylbenzimidazole C9H10N23, 32, 64 |
 | | Compound Data | | Melting point | 205.00 °C | 478.15 K | | CSID | 655 | H bond acceptors | 2 | Rule of 5 violations | 0 | | Molecular weight | 146.1891 | H bond donors | 1 | ACD/LogP | 2.31 | | Phase 25 °C | solid | Rotatable bonds | 0 | Predicted density | 1.15 g/cm3 | | SMILES | n2c1cc(c(cc1nc2)C)C | | STD InChIKey | LJUQGASMPRMWIW-UHFFFAOYAV | | Melting Points | | mp °C | source | |
|---|
| 204.00 | Alfa Aesar | | 205.50 | DrugBank | | 205.50 | PHYSPROP |
|
|
| | | 5,6,7,8-tetrahydro-2-naphthol C10H12O3, 64 |
 | | Compound Data | | Melting point | 59.50 °C | 332.65 K | | CSID | 13667 | H bond acceptors | 1 | Rule of 5 violations | 0 | | Molecular weight | 148.2017 | H bond donors | 1 | ACD/LogP | 3.17 | | Phase 25 °C | solid | Rotatable bonds | 1 | Predicted density | 1.10 g/cm3 | | SMILES | Oc1ccc2c(c1)CCCC2 | | STD InChIKey | UMKXSOXZAXIOPJ-UHFFFAOYAJ | | Melting Points | | mp °C | source | |
|---|
| 62.00 | Alfa Aesar | | 57.00 | PHYSPROP |
|
|
| | | 5,7-dibromo-8-hydroxyquinoline C9H5Br2NO3, 64 |
 | | Compound Data | | Melting point | 198.50 °C | 471.65 K | | CSID | 2359 | H bond acceptors | 2 | Rule of 5 violations | 0 | | Molecular weight | 302.9501 | H bond donors | 1 | ACD/LogP | 3.88 | | Phase 25 °C | solid | Rotatable bonds | 1 | Predicted density | 2.05 g/cm3 | | SMILES | Brc1c(O)c2ncccc2c(Br)c1 | | STD InChIKey | ZDASUJMDVPTNTF-UHFFFAOYAL | | Melting Points | | mp °C | source | |
|---|
| 201.00 | Alfa Aesar | | 196.00 | PHYSPROP |
|
|
| | | 5,7-dichloro-8-hydroxyquinoline C9H5Cl2NO3, 32, 64 |
 | | Compound Data | | Melting point | 180.00 °C | 453.15 K | | CSID | 2621 | H bond acceptors | 2 | Rule of 5 violations | 0 | | Molecular weight | 214.0481 | H bond donors | 1 | ACD/LogP | 3.75 | | Phase 25 °C | solid | Rotatable bonds | 1 | Predicted density | 1.54 g/cm3 | | SMILES | Clc1c(O)c2ncccc2c(Cl)c1 | | STD InChIKey | WDFKMLRRRCGAKS-UHFFFAOYAZ | | Melting Points | | mp °C | source | |
|---|
| 181.00 | Alfa Aesar | | 179.50 | DrugBank | | 179.50 | PHYSPROP |
|
|
| | | 5,7-dimethoxycoumarin C11H10O43, 64 |
 | | Compound Data | | Melting point | 148.50 °C | 421.65 K | | CSID | 2673 | H bond acceptors | 4 | Rule of 5 violations | 0 | | Molecular weight | 206.1947 | H bond donors | 0 | ACD/LogP | 2.06 | | Phase 25 °C | solid | Rotatable bonds | 2 | Predicted density | 1.25 g/cm3 | | SMILES | O=C/2Oc1cc(OC)cc(OC)c1\C=C\2 | | STD InChIKey | NXJCRELRQHZBQA-UHFFFAOYAC | | Melting Points | | mp °C | source | |
|---|
| 148.00 | Alfa Aesar | | 149.00 | PHYSPROP |
|
|
| | | 6-(3,4,5-trimethoxybenzamido)hexanoic acid C16H23NO69, 48, 64 |
 | |
|
| | | 6-acetamidohexanoic acid C8H15NO33, 64 |
 | | Compound Data | | Melting point | 104.25 °C | 377.40 K | | CSID | 1928 | H bond acceptors | 4 | Rule of 5 violations | 0 | | Molecular weight | 173.2096 | H bond donors | 2 | ACD/LogP | -0.50 | | Phase 25 °C | solid | Rotatable bonds | 6 | Predicted density | 1.07 g/cm3 | | SMILES | O=C(NCCCCCC(=O)O)C | | STD InChIKey | WDSCBUNMANHPFH-UHFFFAOYAB | | Melting Points | | mp °C | source | |
|---|
| 104.00 | Alfa Aesar | | 104.50 | PHYSPROP |
|
|
| | | 6-amino-1-hexanol C6H15NO2, 3, 61, 64 |
 | |
|
| | | 6-aminobenzothiazole C7H6N2S3, 64 |
 | | Compound Data | | Melting point | 87.50 °C | 360.65 K | | CSID | 61585 | H bond acceptors | 2 | Rule of 5 violations | 0 | | Molecular weight | 150.2009 | H bond donors | 2 | ACD/LogP | 0.73 | | Phase 25 °C | solid | Rotatable bonds | 1 | Predicted density | 1.38 g/cm3 | | SMILES | n1c2ccc(cc2sc1)N | | STD InChIKey | FAYAYUOZWYJNBD-UHFFFAOYAX | | Melting Points | | mp °C | source | |
|---|
| 88.00 | Alfa Aesar | | 87.00 | PHYSPROP |
|
|
| | | 6-aminonicotinamide C6H7N3O3, 64 |
 | | Compound Data | | Melting point | 246.75 °C | 519.90 K | | CSID | 9128 | H bond acceptors | 4 | Rule of 5 violations | 0 | | Molecular weight | 137.1393 | H bond donors | 4 | ACD/LogP | 0.41 | | Phase 25 °C | solid | Rotatable bonds | 1 | Predicted density | 1.32 g/cm3 | | SMILES | O=C(c1cnc(N)cc1)N | | STD InChIKey | ZLWYEPMDOUQDBW-UHFFFAOYAD | | Melting Points | | mp °C | source | |
|---|
| 247.00 | Alfa Aesar | | 246.50 | PHYSPROP |
|
|
| | | 6-aminoquinoline C9H8N23, 64 |
 | | Compound Data | | Melting point | 115.50 °C | 388.65 K | | CSID | 10895 | H bond acceptors | 2 | Rule of 5 violations | 0 | | Molecular weight | 144.1732 | H bond donors | 2 | ACD/LogP | 1.26 | | Phase 25 °C | solid | Rotatable bonds | 1 | Predicted density | 1.21 g/cm3 | | SMILES | n1cccc2cc(ccc12)N | | STD InChIKey | RJSRSRITMWVIQT-UHFFFAOYAK | | Melting Points | | mp °C | source | |
|---|
| 117.00 | Alfa Aesar | | 114.00 | PHYSPROP |
|
|
| | | 6-aza-2-thiothymine C4H5N3OS3, 64 |
 | | Compound Data | | Melting point | 219.25 °C | 492.40 K | | CSID | 1061203 | H bond acceptors | 4 | Rule of 5 violations | 0 | | Molecular weight | 143.167 | H bond donors | 2 | ACD/LogP | -1.46 | | Phase 25 °C | solid | Rotatable bonds | 0 | Predicted density | 1.63 g/cm3 | | SMILES | O=C1\C(=N/NC(=S)N1)C | | STD InChIKey | NKOPQOSBROLOFP-UHFFFAOYAI | | Melting Points | | mp °C | source | |
|---|
| 220.00 | Alfa Aesar | | 218.50 | PHYSPROP |
|
|
| | | 6-azathymine C4H5N3O23, 64 |
 | | Compound Data | | Melting point | 212.00 °C | 485.15 K | | CSID | 63453 | H bond acceptors | 5 | Rule of 5 violations | 0 | | Molecular weight | 127.1014 | H bond donors | 2 | ACD/LogP | -0.31 | | Phase 25 °C | solid | Rotatable bonds | 0 | Predicted density | 1.67 g/cm3 | | SMILES | O=C1\C(=N/NC(=O)N1)C | | STD InChIKey | XZWMZFQOHTWGQE-UHFFFAOYAT | | Melting Points | | mp °C | source | |
|---|
| 213.00 | Alfa Aesar | | 211.00 | PHYSPROP |
|
|
| | | 6-azauracil C3H3N3O23, 64 |
 | | Compound Data | | Melting point | 275.25 °C | 548.40 K | | CSID | 61352 | H bond acceptors | 5 | Rule of 5 violations | 0 | | Molecular weight | 113.0748 | H bond donors | 2 | ACD/LogP | -0.59 | | Phase 25 °C | solid | Rotatable bonds | 0 | Predicted density | 1.86 g/cm3 | | SMILES | O=C1\C=N/NC(=O)N1 | | STD InChIKey | SSPYSWLZOPCOLO-UHFFFAOYAO | | Melting Points | | mp °C | source | |
|---|
| 276.00 | Alfa Aesar | | 274.50 | PHYSPROP |
|
|
| | | 6-benzylaminopurine C12H11N53, 61, 64 |
 | | Compound Data | | Melting point | 232.17 °C | 505.32 K | | CSID | 56177 | H bond acceptors | 5 | Rule of 5 violations | 0 | | Molecular weight | 225.2492 | H bond donors | 2 | ACD/LogP | 0.54 | | Phase 25 °C | solid | Rotatable bonds | 2 | Predicted density | 1.39 g/cm3 | | SMILES | n1c(c2c(nc1)ncn2)NCc3ccccc3 | | STD InChIKey | NWBJYWHLCVSVIJ-UHFFFAOYAZ | | Melting Points | | mp °C | source | |
|---|
| 231.00 | Alfa Aesar | | 231.00 | Oxford University MSDS | | 234.50 | PHYSPROP |
|
|
| | | 6-bromohexanoic acid C6H11BrO23, 64 |
 | | Compound Data | | Melting point | 34.50 °C | 307.65 K | | CSID | 19037 | H bond acceptors | 2 | Rule of 5 violations | 0 | | Molecular weight | 195.0543 | H bond donors | 1 | ACD/LogP | 1.70 | | Phase 25 °C | solid | Rotatable bonds | 5 | Predicted density | 1.44 g/cm3 | | SMILES | BrCCCCCC(=O)O | | STD InChIKey | NVRVNSHHLPQGCU-UHFFFAOYAQ | | Melting Points | | mp °C | source | |
|---|
| 34.00 | Alfa Aesar | | 35.00 | PHYSPROP |
|
|
| | | 6-chloro-2,4-dinitroaniline C6H4ClN3O42, 3 |
 | | Compound Data | | Melting point | 155.50 °C | 428.65 K | | CSID | 17987 | H bond acceptors | 7 | Rule of 5 violations | 0 | | Molecular weight | 217.5667 | H bond donors | 2 | ACD/LogP | 3.38 | | Phase 25 °C | solid | Rotatable bonds | 3 | Predicted density | 1.71 g/cm3 | | SMILES | Clc1cc(cc([N+]([O-])=O)c1N)[N+]([O-])=O | | STD InChIKey | LHRIICYSGQGXSX-UHFFFAOYAO | | Melting Points | | mp °C | source | |
|---|
| 157.00 | Aldrich Chemical Company; Aldrich Catalog-Handbook of Fine C... | | 154.00 | Alfa Aesar |
|
|
| | | 6-chloroindole C8H6ClN3, 64 |
 | | Compound Data | | Melting point | 89.50 °C | 362.65 K | | CSID | 78578 | H bond acceptors | 1 | Rule of 5 violations | 0 | | Molecular weight | 151.5929 | H bond donors | 1 | ACD/LogP | 2.74 | | Phase 25 °C | solid | Rotatable bonds | 0 | Predicted density | 1.33 g/cm3 | | SMILES | Clc1ccc2c(c1)ncc2 | | STD InChIKey | YTYIMDRWPTUAHP-UHFFFAOYAC | | Melting Points | | mp °C | source | |
|---|
| 89.00 | Alfa Aesar | | 90.00 | PHYSPROP |
|
|
| | | 6-chorothymol C10H13ClO3, 61, 64 |
 | | Compound Data | | Melting point | 60.67 °C | 333.82 K | | CSID | 6716 | H bond acceptors | 1 | Rule of 5 violations | 0 | | Molecular weight | 184.6626 | H bond donors | 1 | ACD/LogP | 4.22 | | Phase 25 °C | solid | Rotatable bonds | 2 | Predicted density | 1.11 g/cm3 | | SMILES | Clc1cc(c(O)cc1C)C(C)C | | STD InChIKey | KFZXVMNBUMVKLN-UHFFFAOYAM | | Melting Points | | mp °C | source | |
|---|
| 60.00 | Alfa Aesar | | 59.00 | Oxford University MSDS | | 63.00 | PHYSPROP |
|
|
| | | 6-ethylresorcinol C8H10O23, 64 |
 | | Compound Data | | Melting point | 97.75 °C | 370.90 K | | CSID | 16931 | H bond acceptors | 2 | Rule of 5 violations | 0 | | Molecular weight | 138.1638 | H bond donors | 2 | ACD/LogP | 1.75 | | Phase 25 °C | solid | Rotatable bonds | 3 | Predicted density | 1.16 g/cm3 | | SMILES | Oc1cc(O)ccc1CC | | STD InChIKey | VGMJYYDKPUPTID-UHFFFAOYAW | | Melting Points | | mp °C | source | |
|---|
| 97.00 | Alfa Aesar | | 98.50 | PHYSPROP |
|
|
| | | 6-heptenoic acid C7H12O23, 64 |
 | | Compound Data | | Melting point | -6.25 °C | 266.90 K | | CSID | 63871 | H bond acceptors | 2 | Rule of 5 violations | 0 | | Molecular weight | 128.169 | H bond donors | 1 | ACD/LogP | 1.93 | | Phase 25 °C | liquid/gas | Rotatable bonds | 5 | Predicted density | 0.96 g/cm3 | | SMILES | O=C(O)CCCC\C=C | | STD InChIKey | RWNJOXUVHRXHSD-UHFFFAOYAN | | Melting Points | | mp °C | source | |
|---|
| -6.00 | Alfa Aesar | | -6.50 | PHYSPROP |
|
|
| | | 6-methoxy-1-tetralone C11H12O23, 64 |
 | | Compound Data | | Melting point | 78.50 °C | 351.65 K | | CSID | 13490 | H bond acceptors | 2 | Rule of 5 violations | 0 | | Molecular weight | 176.2118 | H bond donors | 0 | ACD/LogP | 2.69 | | Phase 25 °C | solid | Rotatable bonds | 1 | Predicted density | 1.12 g/cm3 | | SMILES | O=C2c1c(cc(OC)cc1)CCC2 | | STD InChIKey | MNALUTYMBUBKNX-UHFFFAOYAS | | Melting Points | | mp °C | source | |
|---|
| 79.00 | Alfa Aesar | | 78.00 | PHYSPROP |
|
|
| | | 6-methoxyacacetin C17H14O647, 64 |
 | | Compound Data | | Melting point | 223.00 °C | 496.15 K | | CSID | 4478521 | H bond acceptors | 6 | Rule of 5 violations | 0 | | Molecular weight | 314.2895 | H bond donors | 2 | ACD/LogP | 2.64 | | Phase 25 °C | solid | Rotatable bonds | 5 | Predicted density | 1.40 g/cm3 | | SMILES | O=C\1c3c(O)c(OC)c(O)cc3O/C(=C/1)c2ccc(OC)cc2 | | STD InChIKey | GPQLHGCIAUEJQK-UHFFFAOYAB | | Melting Points | | mp °C | source | |
|---|
| 225.00 | IUCr | | 221.00 | PHYSPROP |
|
|
| | | 6-methyl-5-hepten-2-one C8H14O3, 64 |
 | | Compound Data | | Melting point | -67.05 °C | 206.10 K | | CSID | 9478 | H bond acceptors | 1 | Rule of 5 violations | 0 | | Molecular weight | 126.1962 | H bond donors | 0 | ACD/LogP | 2.09 | | Phase 25 °C | liquid/gas | Rotatable bonds | 3 | Predicted density | 0.83 g/cm3 | | SMILES | O=C(C)CC\C=C(/C)C | | STD InChIKey | UHEPJGULSIKKTP-UHFFFAOYAX | | Melting Points | | mp °C | source | |
|---|
| -67.00 | Alfa Aesar | | -67.10 | PHYSPROP |
|
|
| | | 6-methylcoumarin C10H8O23, 64 |
 | | Compound Data | | Melting point | 76.25 °C | 349.40 K | | CSID | 6825 | H bond acceptors | 2 | Rule of 5 violations | 0 | | Molecular weight | 160.1693 | H bond donors | 0 | ACD/LogP | 1.85 | | Phase 25 °C | solid | Rotatable bonds | 0 | Predicted density | 1.20 g/cm3 | | SMILES | O=C/2Oc1ccc(cc1\C=C\2)C | | STD InChIKey | FXFYOPQLGGEACP-UHFFFAOYAB | | Melting Points | | mp °C | source | |
|---|
| 76.00 | Alfa Aesar | | 76.50 | PHYSPROP |
|
|
| | | 6-nitrobenzimidazole C7H5N3O23, 61, 64 |
 | | Compound Data | | Melting point | 208.33 °C | 481.48 K | | CSID | 6927 | H bond acceptors | 5 | Rule of 5 violations | 0 | | Molecular weight | 163.1335 | H bond donors | 1 | ACD/LogP | 1.64 | | Phase 25 °C | solid | Rotatable bonds | 1 | Predicted density | 1.52 g/cm3 | | SMILES | [O-][N+](=O)c1ccc2ncnc2c1 | | STD InChIKey | XPAZGLFMMUODDK-UHFFFAOYAW | | Melting Points | | mp °C | source | |
|---|
| 209.00 | Alfa Aesar | | 208.00 | Oxford University MSDS | | 208.00 | PHYSPROP |
|
|
| | | 6-nitrophthalide C8H5NO43, 64 |
 | | Compound Data | | Melting point | 144.00 °C | 417.15 K | | CSID | 194210 | H bond acceptors | 5 | Rule of 5 violations | 0 | | Molecular weight | 179.1296 | H bond donors | 0 | ACD/LogP | 0.61 | | Phase 25 °C | solid | Rotatable bonds | 1 | Predicted density | 1.52 g/cm3 | | SMILES | [O-][N+](=O)c1cc2C(=O)OCc2cc1 | | STD InChIKey | RNWGZXAHUPFXLL-UHFFFAOYAN | | Melting Points | | mp °C | source | |
|---|
| 143.00 | Alfa Aesar | | 145.00 | PHYSPROP |
|
|
| | | 6-nitropiperonal C8H5NO53, 64 |
 | | Compound Data | | Melting point | 94.25 °C | 367.40 K | | CSID | 12310 | H bond acceptors | 6 | Rule of 5 violations | 0 | | Molecular weight | 195.129 | H bond donors | 0 | ACD/LogP | 1.56 | | Phase 25 °C | solid | Rotatable bonds | 2 | Predicted density | 1.57 g/cm3 | | SMILES | [O-][N+](=O)c1c(cc2OCOc2c1)C=O | | STD InChIKey | NRZWECORTTWSEF-UHFFFAOYAY | | Melting Points | | mp °C | source | |
|---|
| 95.00 | Alfa Aesar | | 93.50 | PHYSPROP |
|
|
| | | 6-phenylhexanoic acid C12H16O23, 64 |
 | | Compound Data | | Melting point | 20.50 °C | 293.65 K | | CSID | 71995 | H bond acceptors | 2 | Rule of 5 violations | 0 | | Molecular weight | 192.2542 | H bond donors | 1 | ACD/LogP | 3.23 | | Phase 25 °C | liquid/gas | Rotatable bonds | 6 | Predicted density | 1.05 g/cm3 | | SMILES | O=C(O)CCCCCc1ccccc1 | | STD InChIKey | JTXZPQIXIXYMDY-UHFFFAOYAZ | | Melting Points | | mp °C | source | |
|---|
| 18.00 | Alfa Aesar | | 23.00 | PHYSPROP |
|
|
| | | 6-undecanone C11H22O2, 64 |
 | | Compound Data | | Melting point | 14.75 °C | 287.90 K | | CSID | 12972 | H bond acceptors | 1 | Rule of 5 violations | 0 | | Molecular weight | 170.2918 | H bond donors | 0 | ACD/LogP | 4.09 | | Phase 25 °C | liquid/gas | Rotatable bonds | 8 | Predicted density | 0.82 g/cm3 | | SMILES | O=C(CCCCC)CCCCC | | STD InChIKey | ZPQAKYPOZRXKFA-UHFFFAOYAY | | Melting Points | | mp °C | source | |
|---|
| 15.00 | Aldrich Chemical Company; Aldrich Catalog-Handbook of Fine C... | | 14.50 | PHYSPROP |
|
|
| | | 7-azaindole C7H6N23, 64 |
 | | Compound Data | | Melting point | 105.50 °C | 378.65 K | | CSID | 8867 | H bond acceptors | 2 | Rule of 5 violations | 0 | | Molecular weight | 118.1359 | H bond donors | 1 | ACD/LogP | 1.82 | | Phase 25 °C | solid | Rotatable bonds | 0 | Predicted density | 1.24 g/cm3 | | SMILES | c1cc2cc[nH]c2nc1 | | STD InChIKey | MVXVYAKCVDQRLW-UHFFFAOYAE | | Melting Points | | mp °C | source | |
|---|
| 105.00 | Alfa Aesar | | 106.00 | PHYSPROP |
|
|
| | | 7-hydroxycoumarin C9H6O33, 64 |
 | | Compound Data | | Melting point | 230.25 °C | 503.40 K | | CSID | 4444774 | H bond acceptors | 3 | Rule of 5 violations | 0 | | Molecular weight | 162.1421 | H bond donors | 1 | ACD/LogP | 1.58 | | Phase 25 °C | solid | Rotatable bonds | 1 | Predicted density | 1.40 g/cm3 | | SMILES | c1cc(cc2c1ccc(=O)o2)O | | STD InChIKey | ORHBXUUXSCNDEV-UHFFFAOYAL | | Melting Points | | mp °C | source | |
|---|
| 230.00 | Alfa Aesar | | 230.50 | PHYSPROP |
|
|
| | | 7-isopropyl-1-methylphenanthrene C18H1861, 64 |
 | | Compound Data | | Melting point | 100.00 °C | 373.15 K | | CSID | 9805 | H bond acceptors | 0 | Rule of 5 violations | 1 | | Molecular weight | 234.3355 | H bond donors | 0 | ACD/LogP | 6.49 | | Phase 25 °C | solid | Rotatable bonds | 1 | Predicted density | 1.05 g/cm3 | | SMILES | Cc1cccc2c1ccc3c2ccc(c3)C(C)C | | STD InChIKey | NXLOLUFNDSBYTP-UHFFFAOYAL | | Melting Points | | mp °C | source | |
|---|
| 99.00 | Oxford University MSDS | | 101.00 | PHYSPROP |
|
|
| | | 7-methylindole C9H8N3, 64 |
 | | Compound Data | | Melting point | 84.50 °C | 357.65 K | | CSID | 63459 | H bond acceptors | NA | Rule of 5 violations | NA | | Molecular weight | 130.1665 | H bond donors | NA | ACD/LogP | 0.00 | | Phase 25 °C | solid | Rotatable bonds | NA | Predicted density | 0.00 g/cm3 | | SMILES | Cc1cccc2c1[nH]cc2 | | STD InChIKey | KGWPHCDTOLQQEP-UHFFFAOYAX | | Melting Points | | mp °C | source | |
|---|
| 84.00 | Alfa Aesar | | 85.00 | PHYSPROP |
|
|
| | | 7-methylquinoline C10H9N61, 64 |
 | | Compound Data | | Melting point | 37.75 °C | 310.90 K | | CSID | 11433 | H bond acceptors | 1 | Rule of 5 violations | 0 | | Molecular weight | 143.1852 | H bond donors | 0 | ACD/LogP | 2.54 | | Phase 25 °C | solid | Rotatable bonds | 0 | Predicted density | 1.08 g/cm3 | | SMILES | n1cccc2ccc(cc12)C | | STD InChIKey | KDYVCOSVYOSHOL-UHFFFAOYAQ | | Melting Points | | mp °C | source | |
|---|
| 36.50 | Oxford University MSDS | | 39.00 | PHYSPROP |
|
|
| | | 7-oxobenz[de]anthracene C17H10O3, 61, 64 |
 | | Compound Data | | Melting point | 171.00 °C | 444.15 K | | CSID | 6442 | H bond acceptors | 1 | Rule of 5 violations | 0 | | Molecular weight | 230.2607 | H bond donors | 0 | ACD/LogP | 4.81 | | Phase 25 °C | solid | Rotatable bonds | 0 | Predicted density | 1.29 g/cm3 | | SMILES | O=C3c4c(c2cccc1cccc3c12)cccc4 | | STD InChIKey | HUKPVYBUJRAUAG-UHFFFAOYAL | | Melting Points | | mp °C | source | |
|---|
| 173.00 | Alfa Aesar | | 170.00 | Oxford University MSDS | | 170.00 | PHYSPROP |
|
|
| | | 8-amino-2-naphthol C10H9NO3, 64 |
 | | Compound Data | | Melting point | 207.00 °C | 480.15 K | | CSID | 8055 | H bond acceptors | 2 | Rule of 5 violations | 0 | | Molecular weight | 159.1846 | H bond donors | 3 | ACD/LogP | 1.43 | | Phase 25 °C | solid | Rotatable bonds | 2 | Predicted density | 1.28 g/cm3 | | SMILES | Oc2ccc1c(c(ccc1)N)c2 | | STD InChIKey | KVHHMYZBFBSVDI-UHFFFAOYAQ | | Melting Points | | mp °C | source | |
|---|
| 208.00 | Alfa Aesar | | 206.00 | PHYSPROP |
|
|
| | | 8-aminoquinoline C9H8N23, 64 |
 | | Compound Data | | Melting point | 67.50 °C | 340.65 K | | CSID | 10881 | H bond acceptors | 2 | Rule of 5 violations | 0 | | Molecular weight | 144.1732 | H bond donors | 2 | ACD/LogP | 1.88 | | Phase 25 °C | solid | Rotatable bonds | 1 | Predicted density | 1.21 g/cm3 | | SMILES | n1cccc2cccc(N)c12 | | STD InChIKey | WREVVZMUNPAPOV-UHFFFAOYAR | | Melting Points | | mp °C | source | |
|---|
| 65.00 | Alfa Aesar | | 70.00 | PHYSPROP |
|
|
| | | 8-bromooctanoic acid C8H15BrO23, 35, 64 |
 | | Compound Data | | Melting point | 38.67 °C | 311.82 K | | CSID | 477171 | H bond acceptors | 2 | Rule of 5 violations | 0 | | Molecular weight | 223.1075 | H bond donors | 1 | ACD/LogP | 2.76 | | Phase 25 °C | solid | Rotatable bonds | 7 | Predicted density | 1.32 g/cm3 | | SMILES | BrCCCCCCCC(=O)O | | STD InChIKey | BKJFDZSBZWHRNH-UHFFFAOYAK | | Melting Points | | mp °C | source | |
|---|
| 39.00 | Alfa Aesar | | 38.50 | EPISuite-ChemSpider | | 38.50 | PHYSPROP |
|
|
| | | 8-hydroxy-2-methylquinoline C10H9NO3, 64 |
 | | Compound Data | | Melting point | 72.90 °C | 346.05 K | | CSID | 12669 | H bond acceptors | 2 | Rule of 5 violations | 0 | | Molecular weight | 159.1846 | H bond donors | 1 | ACD/LogP | 2.33 | | Phase 25 °C | solid | Rotatable bonds | 1 | Predicted density | 1.21 g/cm3 | | SMILES | Oc1cccc2ccc(nc12)C | | STD InChIKey | NBYLBWHHTUWMER-UHFFFAOYAF | | Melting Points | | mp °C | source | |
|---|
| 72.00 | Alfa Aesar | | 73.80 | PHYSPROP |
|
|
| | | 8-hydroxyquinoline C9H7NO3, 61, 64 |
 | | Compound Data | | Melting point | 75.17 °C | 348.32 K | | CSID | 1847 | H bond acceptors | 2 | Rule of 5 violations | 0 | | Molecular weight | 145.158 | H bond donors | 1 | ACD/LogP | 1.90 | | Phase 25 °C | solid | Rotatable bonds | 1 | Predicted density | 1.26 g/cm3 | | SMILES | c1cc2cccnc2c(c1)O | | STD InChIKey | MCJGNVYPOGVAJF-UHFFFAOYAG | | Melting Points | | mp °C | source | |
|---|
| 74.00 | Alfa Aesar | | 76.00 | Oxford University MSDS | | 75.50 | PHYSPROP |
|
|
| | | 8-nitroquinoline C9H6N2O23, 64 |
 | | Compound Data | | Melting point | 89.00 °C | 362.15 K | | CSID | 11337 | H bond acceptors | 4 | Rule of 5 violations | 0 | | Molecular weight | 174.1561 | H bond donors | 0 | ACD/LogP | 1.47 | | Phase 25 °C | solid | Rotatable bonds | 1 | Predicted density | 1.35 g/cm3 | | SMILES | [O-][N+](=O)c1cccc2cccnc12 | | STD InChIKey | OQHHSGRZCKGLCY-UHFFFAOYAK | | Melting Points | | mp °C | source | |
|---|
| 88.00 | Alfa Aesar | | 90.00 | PHYSPROP |
|
|
| | | 9-bromofluorene C13H9Br3, 64 |
 | | Compound Data | | Melting point | 103.25 °C | 376.40 K | | CSID | 15216 | H bond acceptors | 0 | Rule of 5 violations | 0 | | Molecular weight | 245.1146 | H bond donors | 0 | ACD/LogP | 4.28 | | Phase 25 °C | solid | Rotatable bonds | 0 | Predicted density | 1.51 g/cm3 | | SMILES | BrC3c1ccccc1c2c3cccc2 | | STD InChIKey | AHCDKANCCBEQJJ-UHFFFAOYAL | | Melting Points | | mp °C | source | |
|---|
| 103.00 | Alfa Aesar | | 103.50 | PHYSPROP |
|
|
| | | 9-bromophenanthrene C14H9Br3, 64 |
 | | Compound Data | | Melting point | 64.25 °C | 337.40 K | | CSID | 10834 | H bond acceptors | 0 | Rule of 5 violations | 1 | | Molecular weight | 257.1253 | H bond donors | 0 | ACD/LogP | 5.45 | | Phase 25 °C | solid | Rotatable bonds | 0 | Predicted density | 1.48 g/cm3 | | SMILES | Brc2cc3c(c1c2cccc1)cccc3 | | STD InChIKey | RSQXKVWKJVUZDG-UHFFFAOYAG | | Melting Points | | mp °C | source | |
|---|
| 64.00 | Alfa Aesar | | 64.50 | PHYSPROP |
|
|
| | | 9-ethylcarbazole C14H13N3, 61, 64 |
 | | Compound Data | | Melting point | 68.67 °C | 341.82 K | | CSID | 6575 | H bond acceptors | 1 | Rule of 5 violations | 0 | | Molecular weight | 195.2597 | H bond donors | 0 | ACD/LogP | 4.52 | | Phase 25 °C | solid | Rotatable bonds | 1 | Predicted density | 1.07 g/cm3 | | SMILES | c1cccc3c1c2c(cccc2)n3CC | | STD InChIKey | PLAZXGNBGZYJSA-UHFFFAOYAZ | | Melting Points | | mp °C | source | |
|---|
| 69.00 | Alfa Aesar | | 69.00 | Oxford University MSDS | | 68.00 | PHYSPROP |
|
|
| | | 9-fluorenol C13H10O3, 61, 64 |
 | | Compound Data | | Melting point | 154.33 °C | 427.48 K | | CSID | 66916 | H bond acceptors | 1 | Rule of 5 violations | 0 | | Molecular weight | 182.2179 | H bond donors | 1 | ACD/LogP | 2.51 | | Phase 25 °C | solid | Rotatable bonds | 1 | Predicted density | 1.25 g/cm3 | | SMILES | OC3c1ccccc1c2c3cccc2 | | STD InChIKey | AFMVESZOYKHDBJ-UHFFFAOYAM | | Melting Points | | mp °C | source | |
|---|
| 156.00 | Alfa Aesar | | 153.50 | Oxford University MSDS | | 153.50 | PHYSPROP |
|
|
| | | 9-fluorenone C13H8O3, 35, 61, 64 |
 | | Compound Data | | Melting point | 83.75 °C | 356.90 K | | CSID | 9824 | H bond acceptors | 1 | Rule of 5 violations | 0 | | Molecular weight | 180.202 | H bond donors | 0 | ACD/LogP | 3.49 | | Phase 25 °C | solid | Rotatable bonds | 0 | Predicted density | 1.24 g/cm3 | | SMILES | c1ccc2c(c1)-c3ccccc3C2=O | | STD InChIKey | YLQWCDOCJODRMT-UHFFFAOYAR | | Melting Points | | mp °C | source | |
|---|
| 84.00 | Alfa Aesar | | 84.00 | EPISuite-ChemSpider | | 83.00 | Oxford University MSDS | | 84.00 | PHYSPROP |
|
|
| | | 9-fluorenone oxime C13H9NO3, 64 |
 | | Compound Data | | Melting point | 194.75 °C | 467.90 K | | CSID | 15683 | H bond acceptors | 2 | Rule of 5 violations | 0 | | Molecular weight | 195.2167 | H bond donors | 1 | ACD/LogP | 3.39 | | Phase 25 °C | solid | Rotatable bonds | 1 | Predicted density | 1.23 g/cm3 | | SMILES | O\N=C3/c1ccccc1c2c3cccc2 | | STD InChIKey | CRNNFEKVPRFZKJ-UHFFFAOYAD | | Melting Points | | mp °C | source | |
|---|
| 194.00 | Alfa Aesar | | 195.50 | PHYSPROP |
|
|
| | | 9-fluorenylmethanol C14H12O3, 64 |
 | | Compound Data | | Melting point | 105.00 °C | 378.15 K | | CSID | 81679 | H bond acceptors | 1 | Rule of 5 violations | 0 | | Molecular weight | 196.2445 | H bond donors | 1 | ACD/LogP | 3.33 | | Phase 25 °C | solid | Rotatable bonds | 2 | Predicted density | 1.18 g/cm3 | | SMILES | OCC3c1ccccc1c2c3cccc2 | | STD InChIKey | XXSCONYSQQLHTH-UHFFFAOYAS | | Melting Points | | mp °C | source | |
|---|
| 104.00 | Alfa Aesar | | 106.00 | PHYSPROP |
|
|
| | | 9-heptadecanone C17H34O3, 64 |
 | | Compound Data | | Melting point | 52.50 °C | 325.65 K | | CSID | 10425 | H bond acceptors | 1 | Rule of 5 violations | 1 | | Molecular weight | 254.4513 | H bond donors | 0 | ACD/LogP | 7.28 | | Phase 25 °C | solid | Rotatable bonds | 14 | Predicted density | 0.83 g/cm3 | | SMILES | O=C(CCCCCCCC)CCCCCCCC | | STD InChIKey | WTJKUFMLQFLJOT-UHFFFAOYAB | | Melting Points | | mp °C | source | |
|---|
| 52.00 | Alfa Aesar | | 53.00 | PHYSPROP |
|
|
| | | 9-hexadecenoic acid C16H30O264, 64 |
 | | Compound Data | | Melting point | 0.20 °C | 273.35 K | | CSID | 4445872 | H bond acceptors | 2 | Rule of 5 violations | 1 | | Molecular weight | 254.4082 | H bond donors | 1 | ACD/LogP | 6.63 | | Phase 25 °C | liquid/gas | Rotatable bonds | 13 | Predicted density | 0.91 g/cm3 | | SMILES | O=C(O)CCCCCCC/C=C/CCCCCC | | STD InChIKey | SECPZKHBENQXJG-BQYQJAHWBY | | Melting Points | | mp °C | source | |
|---|
| 0.50 | PHYSPROP | | -0.10 | PHYSPROP |
|
|
| | | 9-methylanthracene C15H123, 61, 64 |
 | | Compound Data | | Melting point | 79.83 °C | 352.98 K | | CSID | 12524 | H bond acceptors | 0 | Rule of 5 violations | 1 | | Molecular weight | 192.2558 | H bond donors | 0 | ACD/LogP | 5.09 | | Phase 25 °C | solid | Rotatable bonds | 0 | Predicted density | 1.10 g/cm3 | | SMILES | Cc1c2ccccc2cc3c1cccc3 | | STD InChIKey | CPGPAVAKSZHMBP-UHFFFAOYAW | | Melting Points | | mp °C | source | |
|---|
| 80.00 | Alfa Aesar | | 78.00 | Oxford University MSDS | | 81.50 | PHYSPROP |
|
|
| | | 9-methylcarbazole C13H11N61, 64 |
 | | Compound Data | | Melting point | 90.17 °C | 363.32 K | | CSID | 14413 | H bond acceptors | 1 | Rule of 5 violations | 0 | | Molecular weight | 181.2331 | H bond donors | 0 | ACD/LogP | 3.99 | | Phase 25 °C | solid | Rotatable bonds | 0 | Predicted density | 1.09 g/cm3 | | SMILES | c1cccc3c1c2c(cccc2)n3C | | STD InChIKey | SDFLTYHTFPTIGX-UHFFFAOYAX | | Melting Points | | mp °C | source | |
|---|
| 91.00 | Oxford University MSDS | | 89.34 | PHYSPROP |
|
|
| | | 9-nitroanthracene C14H9NO23, 64 |
 | | Compound Data | | Melting point | 143.50 °C | 416.65 K | | CSID | 11274 | H bond acceptors | 3 | Rule of 5 violations | 0 | | Molecular weight | 223.2268 | H bond donors | 0 | ACD/LogP | 4.41 | | Phase 25 °C | solid | Rotatable bonds | 1 | Predicted density | 1.32 g/cm3 | | SMILES | [O-][N+](=O)c2c3c(cc1c2cccc1)cccc3 | | STD InChIKey | LSIKFJXEYJIZNB-UHFFFAOYAH | | Melting Points | | mp °C | source | |
|---|
| 141.00 | Alfa Aesar | | 146.00 | PHYSPROP |
|
|
| | | 9-octadecynoic acid C18H32O23, 64 |
 | | Compound Data | | Melting point | 46.50 °C | 319.65 K | | CSID | 61475 | H bond acceptors | 2 | Rule of 5 violations | 1 | | Molecular weight | 280.4455 | H bond donors | 1 | ACD/LogP | 6.79 | | Phase 25 °C | solid | Rotatable bonds | 14 | Predicted density | 0.92 g/cm3 | | SMILES | O=C(O)CCCCCCCC#CCCCCCCCC | | STD InChIKey | RGTIBVZDHOMOKC-UHFFFAOYAM | | Melting Points | | mp °C | source | |
|---|
| 45.00 | Alfa Aesar | | 48.00 | PHYSPROP |
|
|
| | | 9,10-dihydroanthracene C14H1248, 61, 64 |
 | |
|
| | | 9,10-dihydrophenanthrene C14H1248, 64 |
 | | Compound Data | | Melting point | 34.25 °C | 307.40 K | | CSID | 12515 | H bond acceptors | 0 | Rule of 5 violations | 1 | | Molecular weight | 180.2451 | H bond donors | 0 | ACD/LogP | 5.04 | | Phase 25 °C | solid | Rotatable bonds | 0 | Predicted density | 1.08 g/cm3 | | SMILES | c3ccc2c(c1c(cccc1)CC2)c3 | | STD InChIKey | XXPBFNVKTVJZKF-UHFFFAOYAZ | | Melting Points | | mp °C | source | |
|---|
| 34.00 | Karthikeyan M.; Glen R.C.; Bender A. General melting point p... | | 34.50 | PHYSPROP |
|
|
| | | 9,10-diphenylanthracene C26H183, 61, 64 |
 | | Compound Data | | Melting point | 248.67 °C | 521.82 K | | CSID | 14430 | H bond acceptors | 0 | Rule of 5 violations | 1 | | Molecular weight | 330.4211 | H bond donors | 0 | ACD/LogP | 8.46 | | Phase 25 °C | solid | Rotatable bonds | 2 | Predicted density | 1.15 g/cm3 | | SMILES | c1ccc(cc1)c2c3ccccc3c(c4c2cccc4)c5ccccc5 | | STD InChIKey | FCNCGHJSNVOIKE-UHFFFAOYAL | | Melting Points | | mp °C | source | |
|---|
| 251.00 | Alfa Aesar | | 249.00 | Oxford University MSDS | | 246.00 | PHYSPROP |
|
|
| | | acedapsone C16H16N2O4S9, 64 |
 | | Compound Data | | Melting point | 289.50 °C | 562.65 K | | CSID | 6232 | H bond acceptors | 6 | Rule of 5 violations | 0 | | Molecular weight | 332.3742 | H bond donors | 2 | ACD/LogP | 1.53 | | Phase 25 °C | solid | Rotatable bonds | 4 | Predicted density | 1.36 g/cm3 | | SMILES | O=S(=O)(c1ccc(NC(=O)C)cc1)c2ccc(NC(=O)C)cc2 | | STD InChIKey | AMTPYFGPPVFBBI-UHFFFAOYAQ | | Melting Points | | mp °C | source | |
|---|
| 289.00 | Bergstrom C. A. S.; Norinder U.; Luthman K.; Artursson P. Mo... | | 290.00 | PHYSPROP |
|
|
| | | acedoben C9H9NO32, 32, 35, 61 |
 | |
|
| | | acefylline C9H10N4O43, 9, 48 |
 | |
|
| | | acemetacin C21H18ClNO69, 48, 64 |
 | |
|
| | | acenaphthenequinone C12H6O23, 64 |
 | | Compound Data | | Melting point | 259.50 °C | 532.65 K | | CSID | 6468 | H bond acceptors | 2 | Rule of 5 violations | 0 | | Molecular weight | 182.1748 | H bond donors | 0 | ACD/LogP | 2.28 | | Phase 25 °C | solid | Rotatable bonds | 0 | Predicted density | 1.42 g/cm3 | | SMILES | O=C3c2cccc1cccc(c12)C3=O | | STD InChIKey | AFPRJLBZLPBTPZ-UHFFFAOYAC | | Melting Points | | mp °C | source | |
|---|
| 258.00 | Alfa Aesar | | 261.00 | PHYSPROP |
|
|
| | | acenaphthylene C12H861, 64 |
 | | Compound Data | | Melting point | 91.75 °C | 364.90 K | | CSID | 8807 | H bond acceptors | 0 | Rule of 5 violations | 0 | | Molecular weight | 152.1919 | H bond donors | 0 | ACD/LogP | 3.27 | | Phase 25 °C | solid | Rotatable bonds | 0 | Predicted density | 1.19 g/cm3 | | SMILES | c1cc2cccc3c2c(c1)C=C3 | | STD InChIKey | HXGDTGSAIMULJN-UHFFFAOYAQ | | Melting Points | | mp °C | source | |
|---|
| 91.00 | Oxford University MSDS | | 92.50 | PHYSPROP |
|
|
| | | acetaldehyde C2H4O2, 3, 61, 64 |
 | |
|
| | | acetaldehyde dimethyl acetal C4H10O23, 64 |
 | | Compound Data | | Melting point | -113.10 °C | 160.05 K | | CSID | 13854808 | H bond acceptors | 2 | Rule of 5 violations | 0 | | Molecular weight | 90.121 | H bond donors | 0 | ACD/LogP | 0.08 | | Phase 25 °C | liquid/gas | Rotatable bonds | 2 | Predicted density | 0.84 g/cm3 | | SMILES | CC(OC)OC | | STD InChIKey | SPEUIVXLLWOEMJ-UHFFFAOYAV | | Melting Points | | mp °C | source | |
|---|
| -113.00 | Alfa Aesar | | -113.20 | PHYSPROP |
|
|
| | | acetamide C2H5NO2, 3, 61, 64, 64 |
 | |
|
| | | acetanilide C8H9NO2, 3, 35, 44, 48, 61, 64, 70 |
 | |
|
| | | acetazolamide C4H6N4O3S232, 44, 64 |
 | |
|
| | | acetic acid C2H4O23, 4, 35, 61, 64 |
 | |
|
| | | acetic hydrazide C2H6N2O3, 64 |
 | | Compound Data | | Melting point | 65.50 °C | 338.65 K | | CSID | 13420 | H bond acceptors | 3 | Rule of 5 violations | 0 | | Molecular weight | 74.0818 | H bond donors | 3 | ACD/LogP | -1.64 | | Phase 25 °C | solid | Rotatable bonds | 1 | Predicted density | 1.04 g/cm3 | | SMILES | O=C(NN)C | | STD InChIKey | OFLXLNCGODUUOT-UHFFFAOYAS | | Melting Points | | mp °C | source | |
|---|
| 64.00 | Alfa Aesar | | 67.00 | PHYSPROP |
|
|
| | | acetoacetanilide C10H11NO23, 61, 64 |
 | | Compound Data | | Melting point | 85.67 °C | 358.82 K | | CSID | 7311 | H bond acceptors | 3 | Rule of 5 violations | 0 | | Molecular weight | 177.1998 | H bond donors | 1 | ACD/LogP | 0.85 | | Phase 25 °C | solid | Rotatable bonds | 3 | Predicted density | 1.16 g/cm3 | | SMILES | O=C(Nc1ccccc1)CC(=O)C | | STD InChIKey | DYRDKSSFIWVSNM-UHFFFAOYAR | | Melting Points | | mp °C | source | |
|---|
| 85.00 | Alfa Aesar | | 86.00 | Oxford University MSDS | | 86.00 | PHYSPROP |
|
|
| | | acetohexamide C15H20N2O4S9, 32 |
 | | Compound Data | | Melting point | 188.50 °C | 461.65 K | | CSID | 1912 | H bond acceptors | 6 | Rule of 5 violations | 0 | | Molecular weight | 324.3953 | H bond donors | 2 | ACD/LogP | 2.44 | | Phase 25 °C | solid | Rotatable bonds | 3 | Predicted density | 1.30 g/cm3 | | SMILES | O=C(NC1CCCCC1)NS(=O)(=O)c2ccc(C(=O)C)cc2 | | STD InChIKey | VGZSUPCWNCWDAN-UHFFFAOYAN | | Melting Points | | mp °C | source | |
|---|
| 188.00 | Bergstrom C. A. S.; Norinder U.; Luthman K.; Artursson P. Mo... | | 189.00 | DrugBank |
|
|
| | | acetohydroxamic acid C2H5NO23, 64 |
 | | Compound Data | | Melting point | 89.25 °C | 362.40 K | | CSID | 1913 | H bond acceptors | 3 | Rule of 5 violations | 0 | | Molecular weight | 75.0666 | H bond donors | 2 | ACD/LogP | -1.59 | | Phase 25 °C | solid | Rotatable bonds | 1 | Predicted density | 1.16 g/cm3 | | SMILES | O=C(NO)C | | STD InChIKey | RRUDCFGSUDOHDG-UHFFFAOYAW | | Melting Points | | mp °C | source | |
|---|
| 88.00 | Alfa Aesar | | 90.50 | PHYSPROP |
|
|
| | | acetone C3H6O3, 4, 64 |
 | |
|
| | | acetone oxime C3H7NO3, 64 |
 | | Compound Data | | Melting point | 61.50 °C | 334.65 K | | CSID | 60524 | H bond acceptors | 2 | Rule of 5 violations | 0 | | Molecular weight | 73.0938 | H bond donors | 1 | ACD/LogP | 0.12 | | Phase 25 °C | solid | Rotatable bonds | 1 | Predicted density | 0.91 g/cm3 | | SMILES | N(/O)=C(/C)C | | STD InChIKey | PXAJQJMDEXJWFB-UHFFFAOYAK | | Melting Points | | mp °C | source | |
|---|
| 62.00 | Alfa Aesar | | 61.00 | PHYSPROP |
|
|
| | | acetonitrile C2H3N3, 3, 19, 31, 61, 64, 72, 81, 84 |
 | |
|
| | | acetyl chloride C2H3ClO2, 3, 61, 64 |
 | |
|
| | | acetylene C2H261, 64 |
 | | Compound Data | | Melting point | -80.75 °C | 192.40 K | | CSID | 6086 | H bond acceptors | 0 | Rule of 5 violations | 0 | | Molecular weight | 26.0373 | H bond donors | 0 | ACD/LogP | 0.37 | | Phase 25 °C | liquid/gas | Rotatable bonds | 0 | Predicted density | 0.57 g/cm3 | | SMILES | C#C | | STD InChIKey | HSFWRNGVRCDJHI-UHFFFAOYAY | | Melting Points | | mp °C | source | |
|---|
| -80.80 | Oxford University MSDS | | -80.70 | PHYSPROP |
|
|
| | | acridine C13H9N3, 64 |
 | | Compound Data | | Melting point | 108.50 °C | 381.65 K | | CSID | 8860 | H bond acceptors | 1 | Rule of 5 violations | 0 | | Molecular weight | 179.2173 | H bond donors | 0 | ACD/LogP | 3.45 | | Phase 25 °C | solid | Rotatable bonds | 0 | Predicted density | 1.19 g/cm3 | | SMILES | c1ccc2c(c1)cc3ccccc3n2 | | STD InChIKey | DZBUGLKDJFMEHC-UHFFFAOYAF | | Melting Points | | mp °C | source | |
|---|
| 109.00 | Alfa Aesar | | 108.00 | PHYSPROP |
|
|
| | | acrylaldehyde C3H4O2, 3, 61, 64 |
 | |
|
| | | acrylamide C3H5NO2, 3, 64 |
 | |
|
| | | acrylic acid C3H4O22, 3, 32, 64 |
 | |
|
| | | acrylonitrile C3H3N3, 64 |
 | | Compound Data | | Melting point | -83.75 °C | 189.40 K | | CSID | 7567 | H bond acceptors | 1 | Rule of 5 violations | 0 | | Molecular weight | 53.0626 | H bond donors | 0 | ACD/LogP | 0.17 | | Phase 25 °C | liquid/gas | Rotatable bonds | 0 | Predicted density | 0.80 g/cm3 | | SMILES | C=CC#N | | STD InChIKey | NLHHRLWOUZZQLW-UHFFFAOYAG | | Melting Points | | mp °C | source | |
|---|
| -84.00 | Alfa Aesar | | -83.50 | PHYSPROP |
|
|
| | | adamantane-1-carboxylic acid C11H16O23, 64 |
 | | Compound Data | | Melting point | 174.75 °C | 447.90 K | | CSID | 12680 | H bond acceptors | 2 | Rule of 5 violations | 0 | | Molecular weight | 180.2435 | H bond donors | 1 | ACD/LogP | 2.59 | | Phase 25 °C | solid | Rotatable bonds | 1 | Predicted density | 1.23 g/cm3 | | SMILES | C1C2CC3CC1CC(C2)(C3)C(=O)O | | STD InChIKey | JIMXXGFJRDUSRO-UHFFFAOYAT | | Melting Points | | mp °C | source | |
|---|
| 175.00 | Alfa Aesar | | 174.50 | PHYSPROP |
|
|
| | | adipic acid C6H10O42, 3, 61, 64 |
 | |
|
| | | albendazole C12H15N3O2S3, 9, 32, 48, 64 |
 | |
|
| | | alclofenac C11H11ClO39, 44, 48, 64 |
 | |
|
| | | allyl bromide C3H5Br3, 59, 59, 64 |
 | |
|
| | | allyl chloride C3H5Cl3, 31, 61, 64 |
 | |
|
| | | allyl iodide C3H5I3, 31, 64 |
 | |
|
| | | allylamine C3H7N2, 3, 64 |
 | |
|
| | | allylcyclopentane C8H143, 64 |
 | | Compound Data | | Melting point | -110.85 °C | 162.30 K | | CSID | 69505 | H bond acceptors | 0 | Rule of 5 violations | 0 | | Molecular weight | 110.1968 | H bond donors | 0 | ACD/LogP | 3.87 | | Phase 25 °C | liquid/gas | Rotatable bonds | 2 | Predicted density | 0.80 g/cm3 | | SMILES | C=C\CC1CCCC1 | | STD InChIKey | NHIDGVQVYHCGEK-UHFFFAOYAF | | Melting Points | | mp °C | source | |
|---|
| -111.00 | Alfa Aesar | | -110.70 | PHYSPROP |
|
|
| | | allylmalonic acid C6H8O43, 64 |
 | | Compound Data | | Melting point | 104.50 °C | 377.65 K | | CSID | 68265 | H bond acceptors | 4 | Rule of 5 violations | 0 | | Molecular weight | 144.1253 | H bond donors | 2 | ACD/LogP | 0.73 | | Phase 25 °C | solid | Rotatable bonds | 4 | Predicted density | 1.28 g/cm3 | | SMILES | O=C(O)C(C(=O)O)C\C=C | | STD InChIKey | ZDZVKPXKLLLOOA-UHFFFAOYAQ | | Melting Points | | mp °C | source | |
|---|
| 104.00 | Alfa Aesar | | 105.00 | PHYSPROP |
|
|
| | | alpha-methylstyrene C9H103, 4, 64 |
 | |
|
| | | alphenal C13H12N2O39, 44, 48, 64 |
 | |
|
| | | alprazolam C17H13ClN432, 44 |
 | | Compound Data | | Melting point | 229.12 °C | 502.27 K | | CSID | 2034 | H bond acceptors | 4 | Rule of 5 violations | 0 | | Molecular weight | 308.7649 | H bond donors | 0 | ACD/LogP | 1.92 | | Phase 25 °C | solid | Rotatable bonds | 1 | Predicted density | 1.37 g/cm3 | | SMILES | Cc1nnc2n1-c3ccc(cc3C(=NC2)c4ccccc4)Cl | | STD InChIKey | VREFGVBLTWBCJP-UHFFFAOYAT | | Melting Points | | mp °C | source | |
|---|
| 228.25 | DrugBank | | 230.00 | Hughes LD; Palmer DS; Nigsch F and Mitchell JBO. 2008 Why ar... |
|
|
| | | amiloride C6H8ClN7O32, 64 |
 | | Compound Data | | Melting point | 240.50 °C | 513.65 K | | CSID | 15403 | H bond acceptors | 8 | Rule of 5 violations | 1 | | Molecular weight | 229.627 | H bond donors | 8 | ACD/LogP | 2.06 | | Phase 25 °C | solid | Rotatable bonds | 2 | Predicted density | 2.11 g/cm3 | | SMILES | Clc1nc(C(=O)\N=C(/N)N)c(nc1N)N | | STD InChIKey | XSDQTOBWRPYKKA-UHFFFAOYAR | | Melting Points | | mp °C | source | |
|---|
| 240.00 | DrugBank | | 241.00 | PHYSPROP |
|
|
| | | aminohippuric acid C9H10N2O332, 64 |
 | | Compound Data | | Melting point | 199.00 °C | 472.15 K | | CSID | 2063 | H bond acceptors | 5 | Rule of 5 violations | 0 | | Molecular weight | 194.1873 | H bond donors | 4 | ACD/LogP | -0.58 | | Phase 25 °C | solid | Rotatable bonds | 4 | Predicted density | 1.36 g/cm3 | | SMILES | O=C(c1ccc(N)cc1)NCC(=O)O | | STD InChIKey | HSMNQINEKMPTIC-UHFFFAOYAW | | Melting Points | | mp °C | source | |
|---|
| 199.50 | DrugBank | | 198.50 | PHYSPROP |
|
|
| | | amitriptyline C20H23N32, 44, 64 |
 | | Compound Data | | Melting point | 196.33 °C | 469.48 K | | CSID | 2075 | H bond acceptors | 1 | Rule of 5 violations | 0 | | Molecular weight | 277.4033 | H bond donors | 0 | ACD/LogP | 4.92 | | Phase 25 °C | solid | Rotatable bonds | 3 | Predicted density | 1.08 g/cm3 | | SMILES | c3cc2c(/C(c1c(cccc1)CC2)=C\CCN(C)C)cc3 | | STD InChIKey | KRMDCWKBEZIMAB-UHFFFAOYAI | | Melting Points | | mp °C | source | |
|---|
| 196.50 | DrugBank | | 196.00 | Hughes LD; Palmer DS; Nigsch F and Mitchell JBO. 2008 Why ar... | | 196.50 | PHYSPROP |
|
|
| | | amobarbital C11H18N2O39, 35, 44, 48, 64 |
 | |
|
| | | amphotalide C19H20N2O39, 48, 64 |
 | |
|
| | | ampyrone C11H13N3O3, 61, 64 |
 | | Compound Data | | Melting point | 108.00 °C | 381.15 K | | CSID | 2066 | H bond acceptors | 4 | Rule of 5 violations | 0 | | Molecular weight | 203.2404 | H bond donors | 2 | ACD/LogP | -0.40 | | Phase 25 °C | solid | Rotatable bonds | 2 | Predicted density | 1.21 g/cm3 | | SMILES | O=C2\C(=C(/N(N2c1ccccc1)C)C)N | | STD InChIKey | RLFWWDJHLFCNIJ-UHFFFAOYAT | | Melting Points | | mp °C | source | |
|---|
| 108.00 | Alfa Aesar | | 107.00 | Oxford University MSDS | | 109.00 | PHYSPROP |
|
|
| | | anilazine C9H5Cl3N461, 64 |
 | | Compound Data | | Melting point | 159.75 °C | 432.90 K | | CSID | 7260 | H bond acceptors | 4 | Rule of 5 violations | 0 | | Molecular weight | 275.5218 | H bond donors | 1 | ACD/LogP | 3.07 | | Phase 25 °C | solid | Rotatable bonds | 1 | Predicted density | 1.61 g/cm3 | | SMILES | Clc1nc(nc(Cl)n1)Nc2ccccc2Cl | | STD InChIKey | IMHBYKMAHXWHRP-UHFFFAOYAQ | | Melting Points | | mp °C | source | |
|---|
| 159.50 | Oxford University MSDS | | 160.00 | PHYSPROP |
|
|
| | | aniline C6H7N3, 18, 20, 31, 35, 46, 61, 61, 64, 81 |
 | |
|
| | | anisole C7H8O2, 3, 61, 64 |
 | |
|
| | | anthracene C14H102, 3, 44, 64, 70, 70 |
 | |
|
| | | anthracene-9-carbonitrile C15H9N3, 61, 64 |
 | | Compound Data | | Melting point | 175.67 °C | 448.82 K | | CSID | 13924 | H bond acceptors | 1 | Rule of 5 violations | 0 | | Molecular weight | 203.2387 | H bond donors | 0 | ACD/LogP | 4.12 | | Phase 25 °C | solid | Rotatable bonds | 0 | Predicted density | 1.20 g/cm3 | | SMILES | N#Cc2c3c(cc1c2cccc1)cccc3 | | STD InChIKey | KEQZHLAEKAVZLY-UHFFFAOYAB | | Melting Points | | mp °C | source | |
|---|
| 177.00 | Alfa Aesar | | 175.00 | Oxford University MSDS | | 175.00 | PHYSPROP |
|
|
| | | anthranilic acid C7H7NO22, 3, 64 |
 | |
|
| | | anthraquinone C14H8O22, 3, 64 |
 | |
|
| | | anthrone C14H10O3, 61, 64 |
 | | Compound Data | | Melting point | 156.17 °C | 429.32 K | | CSID | 6751 | H bond acceptors | 1 | Rule of 5 violations | 0 | | Molecular weight | 194.2286 | H bond donors | 0 | ACD/LogP | 3.58 | | Phase 25 °C | solid | Rotatable bonds | 0 | Predicted density | 1.19 g/cm3 | | SMILES | O=C2c1c(cccc1)Cc3c2cccc3 | | STD InChIKey | RJGDLRCDCYRQOQ-UHFFFAOYAA | | Melting Points | | mp °C | source | |
|---|
| 157.00 | Alfa Aesar | | 156.50 | Oxford University MSDS | | 155.00 | PHYSPROP |
|
|
| | | apocynin C9H10O33, 3, 64 |
 | | Compound Data | | Melting point | 114.50 °C | 387.65 K | | CSID | 21106900 | H bond acceptors | 3 | Rule of 5 violations | 0 | | Molecular weight | 166.1739 | H bond donors | 1 | ACD/LogP | 1.39 | | Phase 25 °C | solid | Rotatable bonds | 3 | Predicted density | 1.16 g/cm3 | | SMILES | Oc1ccc(cc1OC)C(C)=O | | STD InChIKey | DFYRUELUNQRZTB-UHFFFAOYAW | | Melting Points | | mp °C | source | |
|---|
| 114.50 | Alfa Aesar | | 114.00 | Alfa Aesar | | 115.00 | PHYSPROP |
|
|
| | | aprobarbital C10H14N2O332, 44, 64 |
 | |
|
| | | astemizole C28H31FN4O9, 32, 48, 64 |
 | |
|
| | | atrazine C8H14ClN544, 64, 70 |
 | |
|
| | | azacyclonol C18H21NO9, 48, 64 |
 | |
|
| | | azelaic acid C9H16O43, 32, 64 |
 | | Compound Data | | Melting point | 105.00 °C | 378.15 K | | CSID | 2179 | H bond acceptors | 4 | Rule of 5 violations | 0 | | Molecular weight | 188.2209 | H bond donors | 2 | ACD/LogP | 1.33 | | Phase 25 °C | solid | Rotatable bonds | 8 | Predicted density | 1.13 g/cm3 | | SMILES | O=C(O)CCCCCCCC(=O)O | | STD InChIKey | BDJRBEYXGGNYIS-UHFFFAOYAK | | Melting Points | | mp °C | source | |
|---|
| 102.00 | Alfa Aesar | | 106.50 | DrugBank | | 106.50 | PHYSPROP |
|
|
| | | azinphos-methyl C10H12N3O3PS261, 64 |
 | | Compound Data | | Melting point | 72.50 °C | 345.65 K | | CSID | 2181 | H bond acceptors | 6 | Rule of 5 violations | 0 | | Molecular weight | 317.3243 | H bond donors | 0 | ACD/LogP | 2.54 | | Phase 25 °C | solid | Rotatable bonds | 5 | Predicted density | 1.51 g/cm3 | | SMILES | S=P(OC)(OC)SCN1\N=N/c2ccccc2C1=O | | STD InChIKey | CJJOSEISRRTUQB-UHFFFAOYAL | | Melting Points | | mp °C | source | |
|---|
| 72.00 | Oxford University MSDS | | 73.00 | PHYSPROP |
|
|
| | | azoxybenzene C12H10N2O3, 64 |
 | | Compound Data | | Melting point | 35.50 °C | 308.65 K | | CSID | 9894 | H bond acceptors | 3 | Rule of 5 violations | 0 | | Molecular weight | 198.2206 | H bond donors | 0 | ACD/LogP | 4.09 | | Phase 25 °C | solid | Rotatable bonds | 2 | Predicted density | 1.09 g/cm3 | | SMILES | [O-]\[N+](=N/c1ccccc1)c2ccccc2 | | STD InChIKey | GAUZCKBSTZFWCT-YPKPFQOOBT | | Melting Points | | mp °C | source | |
|---|
| 35.00 | Alfa Aesar | | 36.00 | PHYSPROP |
|
|
| | | azulene C10H83, 61, 64 |
 | | Compound Data | | Melting point | 99.50 °C | 372.65 K | | CSID | 8876 | H bond acceptors | 0 | Rule of 5 violations | 0 | | Molecular weight | 128.1705 | H bond donors | 0 | ACD/LogP | 3.45 | | Phase 25 °C | solid | Rotatable bonds | 0 | Predicted density | 1.04 g/cm3 | | SMILES | c1cccc2cccc2c1 | | STD InChIKey | CUFNKYGDVFVPHO-UHFFFAOYAT | | Melting Points | | mp °C | source | |
|---|
| 100.00 | Alfa Aesar | | 99.50 | Oxford University MSDS | | 99.00 | PHYSPROP |
|
|
| | | bamipine C19H24N29, 48, 64 |
 | |
|
| | | bathophenanthroline C24H16N23, 61 |
 | | Compound Data | | Melting point | 219.00 °C | 492.15 K | | CSID | 65648 | H bond acceptors | 2 | Rule of 5 violations | 1 | | Molecular weight | 332.3972 | H bond donors | 0 | ACD/LogP | 6.16 | | Phase 25 °C | solid | Rotatable bonds | 2 | Predicted density | 1.21 g/cm3 | | SMILES | c1ccc(cc1)c2ccnc3c2ccc4c3nccc4c5ccccc5 | | STD InChIKey | DHDHJYNTEFLIHY-UHFFFAOYAP | | Melting Points | | mp °C | source | |
|---|
| 220.00 | Alfa Aesar | | 218.00 | Oxford University MSDS |
|
|
| | | benperidol C22H24FN3O29, 44, 48, 64 |
 | |
|
| | | benz(a)anthracene C18H1244, 61, 64 |
 | | Compound Data | | Melting point | 159.00 °C | 432.15 K | | CSID | 5739 | H bond acceptors | 0 | Rule of 5 violations | 1 | | Molecular weight | 228.2879 | H bond donors | 0 | ACD/LogP | 5.73 | | Phase 25 °C | solid | Rotatable bonds | 0 | Predicted density | 1.19 g/cm3 | | SMILES | c1ccc2c(c1)ccc3c2cc4ccccc4c3 | | STD InChIKey | DXBHBZVCASKNBY-UHFFFAOYAM | | Melting Points | | mp °C | source | |
|---|
| 160.00 | Hughes LD; Palmer DS; Nigsch F and Mitchell JBO. 2008 Why ar... | | 158.00 | Oxford University MSDS | | Values not used in calculating the average melting point | | 84.00 | PHYSPROP1 | | 1. All other sources support 156-162 - EC |
|
|
| | | benzal chloride C7H6Cl22, 3, 64 |
 | |
|
| | | benzamide C7H7NO2, 3, 44, 61, 64, 72 |
 | |
|
| | | benzanilide C13H11NO2, 3, 64 |
 | |
|
| | | benzene C6H63, 3, 4, 28, 34, 58, 61, 64, 81 |
 | |
|
| | | benzene-1,2-diamine C6H8N22, 3, 61, 64 |
 | |
|
| | | benzenepropanenitrile C9H9N2, 3, 64 |
 | |
|
| | | benzenesulfonamide C6H7NO2S2, 3, 64 |
 | |
|
| | | benzenesulfonyl chloride C6H5ClO2S3, 61, 64 |
 | | Compound Data | | Melting point | 14.83 °C | 287.98 K | | CSID | 7091 | H bond acceptors | 2 | Rule of 5 violations | 0 | | Molecular weight | 176.6207 | H bond donors | 0 | ACD/LogP | 1.99 | | Phase 25 °C | liquid/gas | Rotatable bonds | 1 | Predicted density | 1.40 g/cm3 | | SMILES | O=S(=O)(Cl)c1ccccc1 | | STD InChIKey | CSKNSYBAZOQPLR-UHFFFAOYAR | | Melting Points | | mp °C | source | |
|---|
| 15.00 | Alfa Aesar | | 15.00 | Oxford University MSDS | | 14.50 | PHYSPROP |
|
|
| | | benzenesulfonyl hydrazide C6H8N2O2S3, 64 |
 | | Compound Data | | Melting point | 102.50 °C | 375.65 K | | CSID | 59146 | H bond acceptors | 4 | Rule of 5 violations | 0 | | Molecular weight | 172.2049 | H bond donors | 3 | ACD/LogP | -0.14 | | Phase 25 °C | solid | Rotatable bonds | 2 | Predicted density | 1.35 g/cm3 | | SMILES | O=S(=O)(NN)c1ccccc1 | | STD InChIKey | VJRITMATACIYAF-UHFFFAOYAH | | Melting Points | | mp °C | source | |
|---|
| 103.00 | Alfa Aesar | | 102.00 | PHYSPROP |
|
|
| | | benzhydryl chloride C13H11Cl2, 3, 64 |
 | |
|
| | | benzil C14H10O22, 3, 61, 64, 70 |
 | |
|
| | | benzimidazole C7H6N23, 35, 61, 64 |
 | | Compound Data | | Melting point | 171.00 °C | 444.15 K | | CSID | 5593 | H bond acceptors | 2 | Rule of 5 violations | 0 | | Molecular weight | 118.1359 | H bond donors | 1 | ACD/LogP | 1.32 | | Phase 25 °C | solid | Rotatable bonds | 0 | Predicted density | 1.24 g/cm3 | | SMILES | c1ccc2c(c1)[nH]cn2 | | STD InChIKey | HYZJCKYKOHLVJF-UHFFFAOYAX | | Melting Points | | mp °C | source | |
|---|
| 172.00 | Alfa Aesar | | 170.50 | EPISuite-ChemSpider | | 171.00 | Oxford University MSDS | | 170.50 | PHYSPROP |
|
|
| | | benzimidazole-2-thiol C7H6N2S3, 61, 64 |
 | | Compound Data | | Melting point | 301.33 °C | 574.48 K | | CSID | 616466 | H bond acceptors | 2 | Rule of 5 violations | 0 | | Molecular weight | 150.2009 | H bond donors | 2 | ACD/LogP | 1.66 | | Phase 25 °C | solid | Rotatable bonds | 0 | Predicted density | 1.39 g/cm3 | | SMILES | S=C2Nc1ccccc1N2 | | STD InChIKey | YHMYGUUIMTVXNW-UHFFFAOYAG | | Melting Points | | mp °C | source | |
|---|
| 303.00 | Alfa Aesar | | 303.00 | Oxford University MSDS | | 298.00 | PHYSPROP |
|
|
| | | benzo-15-crown-5 C14H20O53, 64 |
 | | Compound Data | | Melting point | 79.50 °C | 352.65 K | | CSID | 75956 | H bond acceptors | 5 | Rule of 5 violations | 0 | | Molecular weight | 268.3056 | H bond donors | 0 | ACD/LogP | 0.65 | | Phase 25 °C | solid | Rotatable bonds | 0 | Predicted density | 1.07 g/cm3 | | SMILES | O1c2c(OCCOCCOCCOCC1)cccc2 | | STD InChIKey | FNEPSTUXZLEUCK-UHFFFAOYAC | | Melting Points | | mp °C | source | |
|---|
| 80.00 | Alfa Aesar | | 79.00 | PHYSPROP |
|
|
| | | benzo(a)pyrene C20H123, 44, 61, 64, 70 |
 | |
|
| | | benzo(b)fluorene C17H1264, 70 |
 | | Compound Data | | Melting point | 210.00 °C | 483.15 K | | CSID | 8846 | H bond acceptors | 0 | Rule of 5 violations | 1 | | Molecular weight | 216.2772 | H bond donors | 0 | ACD/LogP | 5.39 | | Phase 25 °C | solid | Rotatable bonds | 0 | Predicted density | 1.19 g/cm3 | | SMILES | c1cccc4c1c2c(cc3c(c2)cccc3)C4 | | STD InChIKey | HAPOJKSPCGLOOD-UHFFFAOYAL | | Melting Points | | mp °C | source | |
|---|
| 212.00 | PHYSPROP | | 208.00 | Sepassi K; Yalkowsky SH. AAPS PharmSciTech 7(1) E1-E8 (2006) |
|
|
| | | benzo[b]fluoranthene C20H1261, 64 |
 | | Compound Data | | Melting point | 166.00 °C | 439.15 K | | CSID | 8799 | H bond acceptors | 0 | Rule of 5 violations | 1 | | Molecular weight | 252.3093 | H bond donors | 0 | ACD/LogP | 6.19 | | Phase 25 °C | solid | Rotatable bonds | 0 | Predicted density | 1.29 g/cm3 | | SMILES | c1ccc2c(c1)cc-3c4c2cccc4-c5c3cccc5 | | STD InChIKey | FTOVXSOBNPWTSH-UHFFFAOYAM | | Melting Points | | mp °C | source | |
|---|
| 164.00 | Oxford University MSDS | | 168.00 | PHYSPROP |
|
|
| | | benzo[h]flavone C19H12O23, 61 |
 | | Compound Data | | Melting point | 155.50 °C | 428.65 K | | CSID | 11297 | H bond acceptors | 2 | Rule of 5 violations | 0 | | Molecular weight | 272.2974 | H bond donors | 0 | ACD/LogP | 4.79 | | Phase 25 °C | solid | Rotatable bonds | 1 | Predicted density | 1.28 g/cm3 | | SMILES | O=C\1c4c(O/C(=C/1)c2ccccc2)c3ccccc3cc4 | | STD InChIKey | VFMMPHCGEFXGIP-UHFFFAOYAW | | Melting Points | | mp °C | source | |
|---|
| 158.00 | Alfa Aesar | | 153.00 | Oxford University MSDS |
|
|
| | | benzo[h]quinoline C13H9N3, 64 |
 | | Compound Data | | Melting point | 51.00 °C | 324.15 K | | CSID | 8836 | H bond acceptors | 1 | Rule of 5 violations | 0 | | Molecular weight | 179.2173 | H bond donors | 0 | ACD/LogP | 3.31 | | Phase 25 °C | solid | Rotatable bonds | 0 | Predicted density | 1.19 g/cm3 | | SMILES | n2cccc3ccc1ccccc1c23 | | STD InChIKey | WZJYKHNJTSNBHV-UHFFFAOYAX | | Melting Points | | mp °C | source | |
|---|
| 50.00 | Alfa Aesar | | 52.00 | PHYSPROP |
|
|
| | | benzo[k]fluoranthene C20H1261, 64 |
 | | Compound Data | | Melting point | 216.50 °C | 489.65 K | | CSID | 8804 | H bond acceptors | 0 | Rule of 5 violations | 1 | | Molecular weight | 252.3093 | H bond donors | 0 | ACD/LogP | 6.19 | | Phase 25 °C | solid | Rotatable bonds | 0 | Predicted density | 1.29 g/cm3 | | SMILES | c1ccc2cc-3c(cc2c1)-c4cccc5c4c3ccc5 | | STD InChIKey | HAXBIWFMXWRORI-UHFFFAOYAA | | Melting Points | | mp °C | source | |
|---|
| 216.00 | Oxford University MSDS | | 217.00 | PHYSPROP |
|
|
| | | benzocaine C9H11NO22, 3, 35, 44, 61, 64, 70 |
 | |
|
| | | benzofuroxan C6H4N2O23, 48, 64 |
 | |
|
| | | benzoguanamine C9H9N53, 64 |
 | | Compound Data | | Melting point | 226.75 °C | 499.90 K | | CSID | 6797 | H bond acceptors | 5 | Rule of 5 violations | 0 | | Molecular weight | 187.2013 | H bond donors | 4 | ACD/LogP | 1.36 | | Phase 25 °C | solid | Rotatable bonds | 1 | Predicted density | 1.35 g/cm3 | | SMILES | n1c(nc(nc1c2ccccc2)N)N | | STD InChIKey | GZVHEAJQGPRDLQ-UHFFFAOYAJ | | Melting Points | | mp °C | source | |
|---|
| 227.00 | Alfa Aesar | | 226.50 | PHYSPROP |
|
|
| | | benzoic acid C7H6O22, 3, 9, 28, 35, 44, 48, 56, 61, 64, 70, 70, 72 |
 | |
|
| | | benzoic anhydride C14H10O33, 64 |
 | | Compound Data | | Melting point | 42.25 °C | 315.40 K | | CSID | 6899 | H bond acceptors | 3 | Rule of 5 violations | 0 | | Molecular weight | 226.2274 | H bond donors | 0 | ACD/LogP | 3.02 | | Phase 25 °C | solid | Rotatable bonds | 4 | Predicted density | 1.21 g/cm3 | | SMILES | O=C(OC(=O)c1ccccc1)c2ccccc2 | | STD InChIKey | CHIHQLCVLOXUJW-UHFFFAOYAU | | Melting Points | | mp °C | source | |
|---|
| 42.00 | Alfa Aesar | | 42.50 | PHYSPROP |
|
|
| | | benzonitrile C7H5N2, 3, 61, 64 |
 | |
|
| | | benzophenone C13H10O3, 31, 32, 61, 64 |
 | |
|
| | | benzoquinone C6H4O22, 3, 61, 64 |
 | |
|
| | | benzoresorcinol C10H8O23, 64 |
 | | Compound Data | | Melting point | 124.25 °C | 397.40 K | | CSID | 8282 | H bond acceptors | 2 | Rule of 5 violations | 0 | | Molecular weight | 160.1693 | H bond donors | 2 | ACD/LogP | 1.99 | | Phase 25 °C | solid | Rotatable bonds | 2 | Predicted density | 1.33 g/cm3 | | SMILES | Oc2c1c(cccc1)cc(O)c2 | | STD InChIKey | XOOMNEFVDUTJPP-UHFFFAOYAY | | Melting Points | | mp °C | source | |
|---|
| 125.00 | Alfa Aesar | | 123.50 | PHYSPROP |
|
|
| | | benzothiophene C8H6S3, 64, 64 |
 | | Compound Data | | Melting point | 31.17 °C | 304.32 K | | CSID | 6951 | H bond acceptors | 0 | Rule of 5 violations | 0 | | Molecular weight | 134.1982 | H bond donors | 0 | ACD/LogP | 4.38 | | Phase 25 °C | solid | Rotatable bonds | 0 | Predicted density | 1.19 g/cm3 | | SMILES | s2c1ccccc1cc2 | | STD InChIKey | FCEHBMOGCRZNNI-UHFFFAOYAI | | Melting Points | | mp °C | source | |
|---|
| 30.00 | Alfa Aesar | | 32.00 | PHYSPROP | | 31.50 | PHYSPROP |
|
|
| | | benzotriazole C6H5N33, 61, 64 |
 | | Compound Data | | Melting point | 98.33 °C | 371.48 K | | CSID | 6950 | H bond acceptors | 3 | Rule of 5 violations | 0 | | Molecular weight | 119.124 | H bond donors | 1 | ACD/LogP | 1.14 | | Phase 25 °C | solid | Rotatable bonds | 0 | Predicted density | 1.35 g/cm3 | | SMILES | n1c2ccccc2nn1 | | STD InChIKey | QRUDEWIWKLJBPS-UHFFFAOYAH | | Melting Points | | mp °C | source | |
|---|
| 98.00 | Alfa Aesar | | 97.00 | Oxford University MSDS | | 100.00 | PHYSPROP |
|
|
| | | benzotrichloride C7H5Cl32, 3, 61, 64 |
 | |
|
| | | benzoxazole C7H5NO3, 64 |
 | | Compound Data | | Melting point | 30.50 °C | 303.65 K | | CSID | 8873 | H bond acceptors | 2 | Rule of 5 violations | 0 | | Molecular weight | 119.1207 | H bond donors | 0 | ACD/LogP | 1.59 | | Phase 25 °C | solid | Rotatable bonds | 0 | Predicted density | 1.20 g/cm3 | | SMILES | n1c2ccccc2oc1 | | STD InChIKey | BCMCBBGGLRIHSE-UHFFFAOYAP | | Melting Points | | mp °C | source | |
|---|
| 30.00 | Alfa Aesar | | 31.00 | PHYSPROP |
|
|
| | | benzoyl thiol C11H8OS3, 61, 64 |
 | | Compound Data | | Melting point | 56.50 °C | 329.65 K | | CSID | 60596 | H bond acceptors | 1 | Rule of 5 violations | 0 | | Molecular weight | 188.2456 | H bond donors | 0 | ACD/LogP | 2.86 | | Phase 25 °C | solid | Rotatable bonds | 2 | Predicted density | 1.20 g/cm3 | | SMILES | O=C(c1ccccc1)c2sccc2 | | STD InChIKey | DWYFUJJWTRPARQ-UHFFFAOYAX | | Melting Points | | mp °C | source | |
|---|
| 56.00 | Alfa Aesar | | 57.00 | Oxford University MSDS | | 56.50 | PHYSPROP |
|
|
| | | benzoylacetone C10H10O22, 64 |
 | | Compound Data | | Melting point | 57.50 °C | 330.65 K | | CSID | 6898 | H bond acceptors | 2 | Rule of 5 violations | 0 | | Molecular weight | 162.1852 | H bond donors | 0 | ACD/LogP | 2.52 | | Phase 25 °C | solid | Rotatable bonds | 3 | Predicted density | 1.07 g/cm3 | | SMILES | O=C(c1ccccc1)CC(=O)C | | STD InChIKey | CVBUKMMMRLOKQR-UHFFFAOYAW | | Melting Points | | mp °C | source | |
|---|
| 59.00 | Aldrich Chemical Company; Aldrich Catalog-Handbook of Fine C... | | 56.00 | PHYSPROP |
|
|
| | | benzoylacetonitrile C9H7NO3, 48, 64 |
 | |
|
| | | benzoylcyclohexane C13H16O2, 3, 64 |
 | |
|
| | | benzoylformic acid C8H6O33, 64 |
 | | Compound Data | | Melting point | 65.50 °C | 338.65 K | | CSID | 11421 | H bond acceptors | 3 | Rule of 5 violations | 0 | | Molecular weight | 150.1314 | H bond donors | 1 | ACD/LogP | 0.69 | | Phase 25 °C | solid | Rotatable bonds | 2 | Predicted density | 1.30 g/cm3 | | SMILES | O=C(C(=O)O)c1ccccc1 | | STD InChIKey | FAQJJMHZNSSFSM-UHFFFAOYAS | | Melting Points | | mp °C | source | |
|---|
| 65.00 | Alfa Aesar | | 66.00 | PHYSPROP |
|
|
| | | benzyl acetate C9H10O22, 3, 64 |
 | |
|
| | | benzyl alcohol C7H8O3, 31, 61, 64 |
 | |
|
| | | benzyl benzoate C14H12O22, 3, 32, 61, 64 |
 | |
|
| | | benzyl carbamate C8H9NO23, 64 |
 | | Compound Data | | Melting point | 87.50 °C | 360.65 K | | CSID | 11638 | H bond acceptors | 3 | Rule of 5 violations | 0 | | Molecular weight | 151.1626 | H bond donors | 2 | ACD/LogP | 1.20 | | Phase 25 °C | solid | Rotatable bonds | 3 | Predicted density | 1.17 g/cm3 | | SMILES | O=C(OCc1ccccc1)N | | STD InChIKey | PUJDIJCNWFYVJX-UHFFFAOYAU | | Melting Points | | mp °C | source | |
|---|
| 87.00 | Alfa Aesar | | 88.00 | PHYSPROP |
|
|
| | | benzyl chloride C7H7Cl2, 3, 64 |
 | |
|
| | | benzyl cyanide C8H7N2, 3, 64 |
 | |
|
| | | benzyl methyl ether C8H10O3, 7, 64 |
 | |
|
| | | benzyl phenyl ether C13H12O3, 64 |
 | | Compound Data | | Melting point | 39.50 °C | 312.65 K | | CSID | 63533 | H bond acceptors | 1 | Rule of 5 violations | 0 | | Molecular weight | 184.2338 | H bond donors | 0 | ACD/LogP | 3.79 | | Phase 25 °C | solid | Rotatable bonds | 3 | Predicted density | 1.06 g/cm3 | | SMILES | O(c1ccccc1)Cc2ccccc2 | | STD InChIKey | BOTNYLSAWDQNEX-UHFFFAOYAS | | Melting Points | | mp °C | source | |
|---|
| 39.00 | Alfa Aesar | | 40.00 | PHYSPROP |
|
|
| | | benzyl phenyl sulfide C13H12S3, 64 |
 | | Compound Data | | Melting point | 42.25 °C | 315.40 K | | CSID | 12697 | H bond acceptors | 0 | Rule of 5 violations | 0 | | Molecular weight | 200.2994 | H bond donors | 0 | ACD/LogP | 3.80 | | Phase 25 °C | solid | Rotatable bonds | 3 | Predicted density | 1.10 g/cm3 | | SMILES | S(c1ccccc1)Cc2ccccc2 | | STD InChIKey | LKMCJXXOBRCATQ-UHFFFAOYAC | | Melting Points | | mp °C | source | |
|---|
| 41.00 | Alfa Aesar | | 43.50 | PHYSPROP |
|
|
| | | benzyl phenyl sulfone C13H12O2S3, 64 |
 | | Compound Data | | Melting point | 147.50 °C | 420.65 K | | CSID | 69027 | H bond acceptors | 2 | Rule of 5 violations | 0 | | Molecular weight | 232.2982 | H bond donors | 0 | ACD/LogP | 2.35 | | Phase 25 °C | solid | Rotatable bonds | 3 | Predicted density | 1.21 g/cm3 | | SMILES | O=S(=O)(c1ccccc1)Cc2ccccc2 | | STD InChIKey | FABCMLOTUSCWOR-UHFFFAOYAK | | Melting Points | | mp °C | source | |
|---|
| 149.00 | Alfa Aesar | | 146.00 | PHYSPROP |
|
|
| | | benzyl sulfide C7H8S3, 17, 55, 64 |
 | |
|
| | | benzyl thiocyanate C8H7NS3, 64 |
 | | Compound Data | | Melting point | 42.50 °C | 315.65 K | | CSID | 17163 | H bond acceptors | 1 | Rule of 5 violations | 0 | | Molecular weight | 149.2129 | H bond donors | 0 | ACD/LogP | 1.99 | | Phase 25 °C | solid | Rotatable bonds | 2 | Predicted density | 1.15 g/cm3 | | SMILES | N#CSCc1ccccc1 | | STD InChIKey | ABNDFSOIUFLJAH-UHFFFAOYAN | | Melting Points | | mp °C | source | |
|---|
| 42.00 | Alfa Aesar | | 43.00 | PHYSPROP |
|
|
| | | benzylbromide C7H7Br2, 3, 61, 64 |
 | |
|
| | | benzylideneacetone C10H10O2, 3, 64, 64 |
 | |
|
| | | benzylthioacetic acid C9H10O2S3, 64 |
 | | Compound Data | | Melting point | 61.50 °C | 334.65 K | | CSID | 60259 | H bond acceptors | 2 | Rule of 5 violations | 0 | | Molecular weight | 182.2395 | H bond donors | 1 | ACD/LogP | 2.10 | | Phase 25 °C | solid | Rotatable bonds | 4 | Predicted density | 1.24 g/cm3 | | SMILES | O=C(O)CSCc1ccccc1 | | STD InChIKey | AWLVTQRRKPBQEQ-UHFFFAOYAW | | Melting Points | | mp °C | source | |
|---|
| 62.00 | Alfa Aesar | | 61.00 | PHYSPROP |
|
|
| | | benzylurea C8H10N2O3, 64 |
 | | Compound Data | | Melting point | 148.50 °C | 421.65 K | | CSID | 10396 | H bond acceptors | 3 | Rule of 5 violations | 0 | | Molecular weight | 150.1778 | H bond donors | 3 | ACD/LogP | 0.73 | | Phase 25 °C | solid | Rotatable bonds | 2 | Predicted density | 1.14 g/cm3 | | SMILES | O=C(NCc1ccccc1)N | | STD InChIKey | RJNJWHFSKNJCTB-UHFFFAOYAZ | | Melting Points | | mp °C | source | |
|---|
| 149.00 | Alfa Aesar | | 148.00 | PHYSPROP |
|
|
| | | beta-alanine C3H7NO235, 61 |
 | | Compound Data | | Melting point | 198.00 °C | 471.15 K | | CSID | 234 | H bond acceptors | 3 | Rule of 5 violations | 0 | | Molecular weight | 89.0932 | H bond donors | 3 | ACD/LogP | -0.86 | | Phase 25 °C | solid | Rotatable bonds | 3 | Predicted density | 1.17 g/cm3 | | SMILES | O=C(O)CCN | | STD InChIKey | UCMIRNVEIXFBKS-UHFFFAOYAL | | Melting Points | | mp °C | source | |
|---|
| 200.00 | EPISuite-ChemSpider | | 196.00 | Oxford University MSDS |
|
|
| | | biacetyl C4H6O23, 61, 64 |
 | | Compound Data | | Melting point | -2.40 °C | 270.75 K | | CSID | 630 | H bond acceptors | 2 | Rule of 5 violations | 0 | | Molecular weight | 86.0892 | H bond donors | 0 | ACD/LogP | -1.33 | | Phase 25 °C | liquid/gas | Rotatable bonds | 1 | Predicted density | 0.97 g/cm3 | | SMILES | O=C(C(=O)C)C | | STD InChIKey | QSJXEFYPDANLFS-UHFFFAOYAX | | Melting Points | | mp °C | source | |
|---|
| -3.00 | Alfa Aesar | | -3.00 | Oxford University MSDS | | -1.20 | PHYSPROP |
|
|
| | | binol C20H14O23, 48, 64 |
 | |
|
| | | biphenyl C12H103, 4, 35, 44, 59, 64, 64, 70 |
 | |
|
| | | biphenyl-2-carboxylic acid C13H10O23, 7, 64 |
 | |
|
| | | biphenyl-2-ol C12H10O2, 3, 61, 64 |
 | |
|
| | | biphenyl-4-carboxaldehyde C13H10O3, 7 |
 | | Compound Data | | Melting point | 59.50 °C | 332.65 K | | CSID | 69150 | H bond acceptors | 1 | Rule of 5 violations | 0 | | Molecular weight | 182.2179 | H bond donors | 0 | ACD/LogP | 3.83 | | Phase 25 °C | solid | Rotatable bonds | 2 | Predicted density | 1.09 g/cm3 | | SMILES | O=Cc2ccc(c1ccccc1)cc2 | | STD InChIKey | ISDBWOPVZKNQDW-UHFFFAOYAQ | | Melting Points | | mp °C | source | |
|---|
| 59.00 | Alfa Aesar | | 60.00 | Beilstein F. K.; Beilsteins Handbuch der Organischen Chemie.... |
|
|
| | | biphenyl-4-carboxamide C13H11NO3, 7 |
 | | Compound Data | | Melting point | 225.50 °C | 498.65 K | | CSID | 523754 | H bond acceptors | 2 | Rule of 5 violations | 0 | | Molecular weight | 197.2325 | H bond donors | 2 | ACD/LogP | 2.93 | | Phase 25 °C | solid | Rotatable bonds | 2 | Predicted density | 1.14 g/cm3 | | SMILES | O=C(c2ccc(c1ccccc1)cc2)N | | STD InChIKey | LUQVCHRDAGWYMG-UHFFFAOYAA | | Melting Points | | mp °C | source | |
|---|
| 228.00 | Alfa Aesar | | 223.00 | Beilstein F. K.; Beilsteins Handbuch der Organischen Chemie.... |
|
|
| | | biphenyl-4-carboxylic acid C13H10O23, 7, 64 |
 | |
|
| | | biphenyl-4-ol C12H10O2, 3, 61, 64, 72 |
 | |
|
| | | bis(2-chloroethyl) ether C4H8Cl2O3, 61, 64 |
 | | Compound Data | | Melting point | -49.63 °C | 223.52 K | | CSID | 21106016 | H bond acceptors | 1 | Rule of 5 violations | 0 | | Molecular weight | 143.0117 | H bond donors | 0 | ACD/LogP | 1.19 | | Phase 25 °C | liquid/gas | Rotatable bonds | 4 | Predicted density | 1.16 g/cm3 | | SMILES | ClCCOCCCl | | STD InChIKey | ZNSMNVMLTJELDZ-UHFFFAOYAN | | Melting Points | | mp °C | source | |
|---|
| -50.00 | Alfa Aesar | | -47.00 | Oxford University MSDS | | -51.90 | PHYSPROP |
|
|
| | | bis(2-ethylhexyl) adipate C22H42O43, 64 |
 | | Compound Data | | Melting point | -67.40 °C | 205.75 K | | CSID | 7358 | H bond acceptors | 4 | Rule of 5 violations | 1 | | Molecular weight | 370.5665 | H bond donors | 0 | ACD/LogP | 8.10 | | Phase 25 °C | liquid/gas | Rotatable bonds | 19 | Predicted density | 0.93 g/cm3 | | SMILES | O=C(OCC(CC)CCCC)CCCCC(=O)OCC(CCCC)CC | | STD InChIKey | SAOKZLXYCUGLFA-UHFFFAOYAQ | | Melting Points | | mp °C | source | |
|---|
| -67.00 | Alfa Aesar | | -67.80 | PHYSPROP |
|
|
| | | bis(2-ethylhexyl) phthalate C24H38O42, 3, 64 |
 | | Compound Data | | Melting point | -53.33 °C | 219.82 K | | CSID | 21106505 | H bond acceptors | 4 | Rule of 5 violations | 1 | | Molecular weight | 390.5561 | H bond donors | 0 | ACD/LogP | 8.52 | | Phase 25 °C | liquid/gas | Rotatable bonds | 16 | Predicted density | 0.98 g/cm3 | | SMILES | CCCCC(CC)COC(=O)c1ccccc1C(=O)OCC(CC)CCCC | | STD InChIKey | BJQHLKABXJIVAM-UHFFFAOYAB | | Melting Points | | mp °C | source | |
|---|
| -50.00 | Aldrich Chemical Company; Aldrich Catalog-Handbook of Fine C... | | -55.00 | Alfa Aesar | | -55.00 | PHYSPROP |
|
|
| | | bis(2-hydroxyethyl) disulfide C4H10O2S23, 32, 64 |
 | | Compound Data | | Melting point | 25.67 °C | 298.82 K | | CSID | 15117 | H bond acceptors | 2 | Rule of 5 violations | 0 | | Molecular weight | 154.251 | H bond donors | 2 | ACD/LogP | 0.52 | | Phase 25 °C | solid | Rotatable bonds | 7 | Predicted density | 1.31 g/cm3 | | SMILES | OCCSSCCO | | STD InChIKey | KYNFOMQIXZUKRK-UHFFFAOYAC | | Melting Points | | mp °C | source | |
|---|
| 25.00 | Alfa Aesar | | 26.00 | DrugBank | | 26.00 | PHYSPROP |
|
|
| | | bis(2-nitrophenyl) disulfide C12H8N2O4S23, 64 |
 | | Compound Data | | Melting point | 195.25 °C | 468.40 K | | CSID | 64024 | H bond acceptors | 6 | Rule of 5 violations | 0 | | Molecular weight | 308.3329 | H bond donors | 0 | ACD/LogP | 3.37 | | Phase 25 °C | solid | Rotatable bonds | 5 | Predicted density | 1.52 g/cm3 | | SMILES | [O-][N+](=O)c2c(SSc1ccccc1[N+]([O-])=O)cccc2 | | STD InChIKey | NXCKJENHTITELM-UHFFFAOYAN | | Melting Points | | mp °C | source | |
|---|
| 194.00 | Alfa Aesar | | 196.50 | PHYSPROP |
|
|
| | | bis(2-propanol)amine C6H15NO23, 64 |
 | | Compound Data | | Melting point | 43.25 °C | 316.40 K | | CSID | 7795 | H bond acceptors | 3 | Rule of 5 violations | 0 | | Molecular weight | 133.1888 | H bond donors | 3 | ACD/LogP | -0.81 | | Phase 25 °C | solid | Rotatable bonds | 6 | Predicted density | 1.01 g/cm3 | | SMILES | OC(C)CNCC(O)C | | STD InChIKey | LVTYICIALWPMFW-UHFFFAOYAD | | Melting Points | | mp °C | source | |
|---|
| 42.00 | Alfa Aesar | | 44.50 | PHYSPROP |
|
|
| | | bis(4-bromophenyl) ether C12H8Br2O3, 7, 64 |
 | |
|
| | | bis(4-chlorophenyl) disulfide C12H8Cl2S23, 64 |
 | | Compound Data | | Melting point | 70.50 °C | 343.65 K | | CSID | 13721 | H bond acceptors | 0 | Rule of 5 violations | 1 | | Molecular weight | 287.2279 | H bond donors | 0 | ACD/LogP | 6.02 | | Phase 25 °C | solid | Rotatable bonds | 3 | Predicted density | 1.43 g/cm3 | | SMILES | c1cc(ccc1SSc2ccc(cc2)Cl)Cl | | STD InChIKey | ZIXXRXGPBFMPFD-UHFFFAOYAI | | Melting Points | | mp °C | source | |
|---|
| 73.00 | Alfa Aesar | | 68.00 | PHYSPROP |
|
|
| | | bis(4-chlorophenyl) sulfone C12H8Cl2O2S3, 64 |
 | | Compound Data | | Melting point | 148.45 °C | 421.60 K | | CSID | 6373 | H bond acceptors | 2 | Rule of 5 violations | 0 | | Molecular weight | 287.1617 | H bond donors | 0 | ACD/LogP | 4.20 | | Phase 25 °C | solid | Rotatable bonds | 2 | Predicted density | 1.42 g/cm3 | | SMILES | O=S(=O)(c1ccc(Cl)cc1)c2ccc(Cl)cc2 | | STD InChIKey | GPAPPPVRLPGFEQ-UHFFFAOYAQ | | Melting Points | | mp °C | source | |
|---|
| 149.00 | Alfa Aesar | | 147.90 | PHYSPROP |
|
|
| | | bis(4-fluoro-3-nitrophenyl) sulfone C12H6F2N2O6S3, 64 |
 | | Compound Data | | Melting point | 193.75 °C | 466.90 K | | CSID | 9028 | H bond acceptors | 8 | Rule of 5 violations | 0 | | Molecular weight | 344.2476 | H bond donors | 0 | ACD/LogP | 3.23 | | Phase 25 °C | solid | Rotatable bonds | 4 | Predicted density | 1.64 g/cm3 | | SMILES | O=[N+]([O-])c1cc(ccc1F)S(=O)(=O)c2cc([N+]([O-])=O)c(F)cc2 | | STD InChIKey | KHAWDEWNXJIVCJ-UHFFFAOYAC | | Melting Points | | mp °C | source | |
|---|
| 194.00 | Alfa Aesar | | 193.50 | PHYSPROP |
|
|
| | | bis(4-tolyl)ketone C15H14O3, 64 |
 | | Compound Data | | Melting point | 95.25 °C | 368.40 K | | CSID | 62363 | H bond acceptors | 1 | Rule of 5 violations | 0 | | Molecular weight | 210.2711 | H bond donors | 0 | ACD/LogP | 4.10 | | Phase 25 °C | solid | Rotatable bonds | 2 | Predicted density | 1.05 g/cm3 | | SMILES | O=C(c1ccc(cc1)C)c2ccc(cc2)C | | STD InChIKey | ZWPWLKXZYNXATK-UHFFFAOYAV | | Melting Points | | mp °C | source | |
|---|
| 94.00 | Alfa Aesar | | 96.50 | PHYSPROP |
|
|
| | | bis(diphenylphosphino)methane C25H22P23, 48 |
 | | Compound Data | | Melting point | 120.00 °C | 393.15 K | | CSID | 67509 | H bond acceptors | 0 | Rule of 5 violations | 1 | | Molecular weight | 384.3897 | H bond donors | 0 | ACD/LogP | 8.57 | | Phase 25 °C | solid | Rotatable bonds | 6 | Predicted density | 0.00 g/cm3 | | SMILES | P(c1ccccc1)(c2ccccc2)CP(c3ccccc3)c4ccccc4 | | STD InChIKey | XGCDBGRZEKYHNV-UHFFFAOYAH | | Melting Points | | mp °C | source | |
|---|
| 119.00 | Alfa Aesar | | 121.00 | Karthikeyan M.; Glen R.C.; Bender A. General melting point p... |
|
|
| | | bis(pentabromophenyl) ether C12Br10O3, 64 |
 | | Compound Data | | Melting point | 305.50 °C | 578.65 K | | CSID | 13764 | H bond acceptors | 1 | Rule of 5 violations | 2 | | Molecular weight | 959.1678 | H bond donors | 0 | ACD/LogP | 11.24 | | Phase 25 °C | solid | Rotatable bonds | 2 | Predicted density | 2.98 g/cm3 | | SMILES | Brc2c(Oc1c(Br)c(Br)c(Br)c(Br)c1Br)c(Br)c(Br)c(Br)c2Br | | STD InChIKey | WHHGLZMJPXIBIX-UHFFFAOYAY | | Melting Points | | mp °C | source | |
|---|
| 306.00 | Alfa Aesar | | 305.00 | PHYSPROP |
|
|
| | | bis(trimethylsilyl)acetylene C8H18Si23, 64 |
 | | Compound Data | | Melting point | 24.00 °C | 297.15 K | | CSID | 76286 | H bond acceptors | 0 | Rule of 5 violations | 0 | | Molecular weight | 170.3995 | H bond donors | 0 | ACD/LogP | 4.04 | | Phase 25 °C | liquid/gas | Rotatable bonds | 1 | Predicted density | 0.79 g/cm3 | | SMILES | C(#C[Si](C)(C)C)[Si](C)(C)C | | STD InChIKey | ZDWYFWIBTZJGOR-UHFFFAOYAF | | Melting Points | | mp °C | source | |
|---|
| 22.00 | Alfa Aesar | | 26.00 | PHYSPROP |
|
|
| | | bisphenol A C15H16O23, 64 |
 | | Compound Data | | Melting point | 154.50 °C | 427.65 K | | CSID | 6371 | H bond acceptors | 2 | Rule of 5 violations | 0 | | Molecular weight | 228.2863 | H bond donors | 2 | ACD/LogP | 3.64 | | Phase 25 °C | solid | Rotatable bonds | 4 | Predicted density | 1.14 g/cm3 | | SMILES | CC(C)(c1ccc(cc1)O)c2ccc(cc2)O | | STD InChIKey | IISBACLAFKSPIT-UHFFFAOYAI | | Melting Points | | mp °C | source | |
|---|
| 156.00 | Alfa Aesar | | 153.00 | PHYSPROP |
|
|
| | | boc-glycine C7H13NO43, 3, 72 |
 | | Compound Data | | Melting point | 88.33 °C | 361.48 K | | CSID | 70660 | H bond acceptors | 5 | Rule of 5 violations | 0 | | Molecular weight | 175.1824 | H bond donors | 2 | ACD/LogP | 0.75 | | Phase 25 °C | solid | Rotatable bonds | 4 | Predicted density | 1.16 g/cm3 | | SMILES | O=C(OC(C)(C)C)NCC(=O)O | | STD InChIKey | VRPJIFMKZZEXLR-UHFFFAOYAN | | Melting Points | | mp °C | source | |
|---|
| 89.00 | Alfa Aesar | | 88.50 | Alfa Aesar | | 87.50 | Sigma-Aldrich |
|
|
| | | bromeosin C20H8Br4O561, 64 |
 | | Compound Data | | Melting point | 297.75 °C | 570.90 K | | CSID | 10581 | H bond acceptors | 5 | Rule of 5 violations | 2 | | Molecular weight | 647.8905 | H bond donors | 2 | ACD/LogP | 6.36 | | Phase 25 °C | solid | Rotatable bonds | 3 | Predicted density | 2.41 g/cm3 | | SMILES | O=C(O)c4ccccc4C=1c3cc(Br)c(O)c(Br)c3OC=2C=1\C=C(\Br)C(=O)C=2Br | | STD InChIKey | AZXGXVQWEUFULR-UHFFFAOYAC | | Melting Points | | mp °C | source | |
|---|
| 300.00 | Oxford University MSDS | | 295.50 | PHYSPROP |
|
|
| | | bromoacetic acid C2H3BrO23, 32, 64 |
 | | Compound Data | | Melting point | 49.00 °C | 322.15 K | | CSID | 10301338 | H bond acceptors | 2 | Rule of 5 violations | 0 | | Molecular weight | 138.948 | H bond donors | 1 | ACD/LogP | 0.51 | | Phase 25 °C | solid | Rotatable bonds | 1 | Predicted density | 2.00 g/cm3 | | SMILES | BrCC(O)=O | | STD InChIKey | KDPAWGWELVVRCH-UHFFFAOYAM | | Melting Points | | mp °C | source | |
|---|
| 47.00 | Alfa Aesar | | 50.00 | DrugBank | | 50.00 | PHYSPROP |
|
|
| | | bromobenzene C6H5Br3, 31, 61, 64 |
 | |
|
| | | bromochloromethane CH2BrCl2, 61, 64 |
 | |
|
| | | bromocresol purple C21H16Br2O5S61, 64 |
 | | Compound Data | | Melting point | 241.25 °C | 514.40 K | | CSID | 7974 | H bond acceptors | 5 | Rule of 5 violations | 2 | | Molecular weight | 540.2217 | H bond donors | 2 | ACD/LogP | 5.92 | | Phase 25 °C | solid | Rotatable bonds | 4 | Predicted density | 1.77 g/cm3 | | SMILES | Brc1c(O)c(cc(c1)C3(OS(=O)(=O)c2ccccc23)c4cc(c(O)c(Br)c4)C)C | | STD InChIKey | ABIUHPWEYMSGSR-UHFFFAOYAH | | Melting Points | | mp °C | source | |
|---|
| 241.00 | Oxford University MSDS | | 241.50 | PHYSPROP |
|
|
| | | bromocyclohexane C6H11Br3, 64 |
 | | Compound Data | | Melting point | -56.75 °C | 216.40 K | | CSID | 7672 | H bond acceptors | 0 | Rule of 5 violations | 0 | | Molecular weight | 163.0555 | H bond donors | 0 | ACD/LogP | 3.21 | | Phase 25 °C | liquid/gas | Rotatable bonds | 0 | Predicted density | 1.35 g/cm3 | | SMILES | BrC1CCCCC1 | | STD InChIKey | AQNQQHJNRPDOQV-UHFFFAOYAD | | Melting Points | | mp °C | source | |
|---|
| -57.00 | Alfa Aesar | | -56.50 | PHYSPROP |
|
|
| | | bromodichloromethane CHBrCl22, 3, 64 |
 | |
|
| | | bromodurene C10H13Br3, 48 |
 | | Compound Data | | Melting point | 58.00 °C | 331.15 K | | CSID | 66847 | H bond acceptors | 0 | Rule of 5 violations | 0 | | Molecular weight | 213.1142 | H bond donors | 0 | ACD/LogP | 4.83 | | Phase 25 °C | solid | Rotatable bonds | 0 | Predicted density | 1.25 g/cm3 | | SMILES | Brc1c(c(cc(c1C)C)C)C | | STD InChIKey | WJKBPTLQJXKEHC-UHFFFAOYAB | | Melting Points | | mp °C | source | |
|---|
| 60.00 | Alfa Aesar | | 56.00 | Karthikeyan M.; Glen R.C.; Bender A. General melting point p... |
|
|
| | | bromoethane C2H5Br2, 3, 31, 61, 64 |
 | |
|
| | | bromoethene C2H3Br61, 64 |
 | | Compound Data | | Melting point | -138.40 °C | 134.75 K | | CSID | 11151 | H bond acceptors | 0 | Rule of 5 violations | 0 | | Molecular weight | 106.9492 | H bond donors | 0 | ACD/LogP | 1.57 | | Phase 25 °C | liquid/gas | Rotatable bonds | 0 | Predicted density | 1.53 g/cm3 | | SMILES | C=CBr | | STD InChIKey | INLLPKCGLOXCIV-UHFFFAOYAI | | Melting Points | | mp °C | source | |
|---|
| -139.00 | Oxford University MSDS | | -137.80 | PHYSPROP |
|
|
| | | bromoform CHBr32, 3, 61, 64 |
 | |
|
| | | bromopentamethylbenzene C11H15Br3, 48 |
 | | Compound Data | | Melting point | 163.50 °C | 436.65 K | | CSID | 71166 | H bond acceptors | 0 | Rule of 5 violations | 1 | | Molecular weight | 227.1408 | H bond donors | 0 | ACD/LogP | 5.29 | | Phase 25 °C | solid | Rotatable bonds | 0 | Predicted density | 1.21 g/cm3 | | SMILES | Brc1c(c(c(c(c1C)C)C)C)C | | STD InChIKey | XPDQRULPGCFCLX-UHFFFAOYAA | | Melting Points | | mp °C | source | |
|---|
| 162.00 | Alfa Aesar | | 165.00 | Karthikeyan M.; Glen R.C.; Bender A. General melting point p... |
|
|
| | | bromotrichloromethane CBrCl33, 64 |
 | | Compound Data | | Melting point | -5.85 °C | 267.30 K | | CSID | 6143 | H bond acceptors | 0 | Rule of 5 violations | 0 | | Molecular weight | 198.2737 | H bond donors | 0 | ACD/LogP | 3.17 | | Phase 25 °C | liquid/gas | Rotatable bonds | 0 | Predicted density | 2.15 g/cm3 | | SMILES | BrC(Cl)(Cl)Cl | | STD InChIKey | XNNQFQFUQLJSQT-UHFFFAOYAX | | Melting Points | | mp °C | source | |
|---|
| -6.00 | Alfa Aesar | | -5.70 | PHYSPROP |
|
|
| | | bromthymol blue C27H28Br2O5S3, 61, 64 |
 | | Compound Data | | Melting point | 200.67 °C | 473.82 K | | CSID | 6208 | H bond acceptors | 5 | Rule of 5 violations | 2 | | Molecular weight | 624.3812 | H bond donors | 2 | ACD/LogP | 8.60 | | Phase 25 °C | solid | Rotatable bonds | 6 | Predicted density | 1.54 g/cm3 | | SMILES | Brc1c(O)c(cc(c1C)C3(OS(=O)(=O)c2ccccc23)c4cc(c(O)c(Br)c4C)C(C)C)C(C)C | | STD InChIKey | NUHCTOLBWMJMLX-UHFFFAOYAD | | Melting Points | | mp °C | source | |
|---|
| 201.00 | Alfa Aesar | | 200.00 | Oxford University MSDS | | 201.00 | PHYSPROP |
|
|
| | | bronopol C3H6BrNO43, 64 |
 | | Compound Data | | Melting point | 129.25 °C | 402.40 K | | CSID | 2356 | H bond acceptors | 5 | Rule of 5 violations | 0 | | Molecular weight | 199.988 | H bond donors | 2 | ACD/LogP | 1.72 | | Phase 25 °C | solid | Rotatable bonds | 5 | Predicted density | 2.02 g/cm3 | | SMILES | [O-][N+](=O)C(Br)(CO)CO | | STD InChIKey | LVDKZNITIUWNER-UHFFFAOYAZ | | Melting Points | | mp °C | source | |
|---|
| 127.00 | Alfa Aesar | | 131.50 | PHYSPROP |
|
|
| | | bufexamac C12H17NO39, 48, 64 |
 | |
|
| | | busulfan C6H14O6S244, 64, 72 |
 | | Compound Data | | Melting point | 115.83 °C | 388.98 K | | CSID | 2384 | H bond acceptors | 6 | Rule of 5 violations | 0 | | Molecular weight | 246.3018 | H bond donors | 0 | ACD/LogP | -0.52 | | Phase 25 °C | solid | Rotatable bonds | 7 | Predicted density | 1.35 g/cm3 | | SMILES | O=S(=O)(OCCCCOS(=O)(=O)C)C | | STD InChIKey | COVZYZSDYWQREU-UHFFFAOYAO | | Melting Points | | mp °C | source | |
|---|
| 116.00 | Hughes LD; Palmer DS; Nigsch F and Mitchell JBO. 2008 Why ar... | | 116.00 | PHYSPROP | | 115.50 | Sigma-Aldrich | | Values not used in calculating the average melting point | | 287.00 | DrugBank1 | | 1. clearly out of range JCB |
|
|
| | | butadiene C4H661, 64 |
 | | Compound Data | | Melting point | -110.95 °C | 162.20 K | | CSID | 7557 | H bond acceptors | 0 | Rule of 5 violations | 0 | | Molecular weight | 54.0904 | H bond donors | 0 | ACD/LogP | 1.93 | | Phase 25 °C | liquid/gas | Rotatable bonds | 1 | Predicted density | 0.64 g/cm3 | | SMILES | C=CC=C | | STD InChIKey | KAKZBPTYRLMSJV-UHFFFAOYAZ | | Melting Points | | mp °C | source | |
|---|
| -113.00 | Oxford University MSDS | | -108.90 | PHYSPROP |
|
|
| | | butalbital C11H16N2O39, 32, 44, 48, 64 |
 | |
|
| | | butamben C11H15NO244, 64, 70, 72, 72 |
 | |
|
| | | butane C4H104, 15, 59, 64 |
 | |
|
| | | butane-1,4-diol C4H10O22, 3, 32, 61, 64 |
 | |
|
| | | butanone C4H8O3, 4, 61, 64 |
 | |
|
| | | butobarbital C10H16N2O332, 35, 44, 64 |
 | |
|
| | | butyl acrylate C7H12O23, 64 |
 | | Compound Data | | Melting point | -64.30 °C | 208.85 K | | CSID | 8514 | H bond acceptors | 2 | Rule of 5 violations | 0 | | Molecular weight | 128.169 | H bond donors | 0 | ACD/LogP | 2.39 | | Phase 25 °C | liquid/gas | Rotatable bonds | 5 | Predicted density | 0.90 g/cm3 | | SMILES | O=C(OCCCC)\C=C | | STD InChIKey | CQEYYJKEWSMYFG-UHFFFAOYAL | | Melting Points | | mp °C | source | |
|---|
| -64.00 | Alfa Aesar | | -64.60 | PHYSPROP |
|
|
| | | butyl butyrate C8H16O21, 3, 19, 28, 37, 64, 81 |
 | |
|
| | | butyl formate C5H10O23, 64 |
 | | Compound Data | | Melting point | -91.75 °C | 181.40 K | | CSID | 11125 | H bond acceptors | 2 | Rule of 5 violations | 0 | | Molecular weight | 102.1317 | H bond donors | 0 | ACD/LogP | 1.36 | | Phase 25 °C | liquid/gas | Rotatable bonds | 4 | Predicted density | 0.89 g/cm3 | | SMILES | O=COCCCC | | STD InChIKey | NMJJFJNHVMGPGM-UHFFFAOYAQ | | Melting Points | | mp °C | source | |
|---|
| -92.00 | Alfa Aesar | | -91.50 | PHYSPROP |
|
|
| | | butyl methyl ether C5H12O4, 64 |
 | | Compound Data | | Melting point | -115.25 °C | 157.90 K | | CSID | 11833 | H bond acceptors | 1 | Rule of 5 violations | 0 | | Molecular weight | 88.1482 | H bond donors | 0 | ACD/LogP | 1.51 | | Phase 25 °C | liquid/gas | Rotatable bonds | 3 | Predicted density | 0.75 g/cm3 | | SMILES | O(CCCC)C | | STD InChIKey | CXBDYQVECUFKRK-UHFFFAOYAP | | Melting Points | | mp °C | source | |
|---|
| -115.00 | American Petroleum Institute. Research Project 44; Selected ... | | -115.50 | PHYSPROP |
|
|
| | | butyl phenyl ether C10H14O2, 3, 64 |
 | |
|
| | | butylcyclohexane C10H203, 4, 61, 64 |
 | |
|
| | | butylparaben C11H14O33, 35, 44, 48, 61, 64, 70, 72, 72 |
 | |
|
| | | butyraldehyde C4H8O3, 4, 61, 64 |
 | |
|
| | | butyramide C4H9NO2, 3, 32, 64 |
 | |
|
| | | butyric acid C4H8O23, 4, 35, 61, 64 |
 | |
|
| | | butyric acid hydrazide C4H10N2O3, 64 |
 | | Compound Data | | Melting point | 44.75 °C | 317.90 K | | CSID | 69525 | H bond acceptors | 3 | Rule of 5 violations | 0 | | Molecular weight | 102.135 | H bond donors | 3 | ACD/LogP | -0.57 | | Phase 25 °C | solid | Rotatable bonds | 3 | Predicted density | 0.98 g/cm3 | | SMILES | O=C(NN)CCC | | STD InChIKey | FCCCRBDJBTVFSJ-UHFFFAOYAB | | Melting Points | | mp °C | source | |
|---|
| 44.00 | Alfa Aesar | | 45.50 | PHYSPROP |
|
|
| | | butyronitrile C4H7N3, 31, 64 |
 | |
|
| | | caffeine C8H10N4O23, 32, 35, 44, 61, 64, 64, 70 |
 | |
|
| | | cannabinol C21H26O261, 64 |
 | | Compound Data | | Melting point | 76.75 °C | 349.90 K | | CSID | 2447 | H bond acceptors | 2 | Rule of 5 violations | 1 | | Molecular weight | 310.4299 | H bond donors | 1 | ACD/LogP | 7.35 | | Phase 25 °C | solid | Rotatable bonds | 5 | Predicted density | 1.06 g/cm3 | | SMILES | Oc2cc(cc1OC(c3c(c12)cc(cc3)C)(C)C)CCCCC | | STD InChIKey | VBGLYOIFKLUMQG-UHFFFAOYAM | | Melting Points | | mp °C | source | |
|---|
| 76.50 | Oxford University MSDS | | 77.00 | PHYSPROP |
|
|
| | | caprolactam C6H11NO3, 61, 64 |
 | | Compound Data | | Melting point | 69.43 °C | 342.58 K | | CSID | 7480 | H bond acceptors | 2 | Rule of 5 violations | 0 | | Molecular weight | 113.1576 | H bond donors | 1 | ACD/LogP | -0.32 | | Phase 25 °C | solid | Rotatable bonds | 0 | Predicted density | 0.97 g/cm3 | | SMILES | O=C1NCCCCC1 | | STD InChIKey | JBKVHLHDHHXQEQ-UHFFFAOYAF | | Melting Points | | mp °C | source | |
|---|
| 70.00 | Alfa Aesar | | 69.00 | Oxford University MSDS | | 69.30 | PHYSPROP |
|
|
| | | carbamazepine C15H12N2O9, 28, 32, 35, 44, 48, 56, 64, 72 |
 | |
|
| | | carbaryl C12H11NO29, 48, 61, 64 |
 | |
|
| | | carbazole C12H9N3, 61, 64 |
 | | Compound Data | | Melting point | 244.90 °C | 518.05 K | | CSID | 6593 | H bond acceptors | 1 | Rule of 5 violations | 0 | | Molecular weight | 167.2066 | H bond donors | 1 | ACD/LogP | 3.76 | | Phase 25 °C | solid | Rotatable bonds | 0 | Predicted density | 1.23 g/cm3 | | SMILES | c1ccc2c(c1)c3ccccc3[nH]2 | | STD InChIKey | UJOBWOGCFQCDNV-UHFFFAOYAV | | Melting Points | | mp °C | source | |
|---|
| 243.00 | Alfa Aesar | | 245.50 | Oxford University MSDS | | 246.20 | PHYSPROP |
|
|
| | | carbimazole C7H10N2O2S3, 32, 64 |
 | | Compound Data | | Melting point | 123.67 °C | 396.82 K | | CSID | 28829 | H bond acceptors | 4 | Rule of 5 violations | 0 | | Molecular weight | 186.2315 | H bond donors | 0 | ACD/LogP | 0.34 | | Phase 25 °C | solid | Rotatable bonds | 2 | Predicted density | 1.31 g/cm3 | | SMILES | S=C1N(\C=C/N1C(=O)OCC)C | | STD InChIKey | CFOYWRHIYXMDOT-UHFFFAOYAV | | Melting Points | | mp °C | source | |
|---|
| 124.00 | Alfa Aesar | | 123.50 | DrugBank | | 123.50 | PHYSPROP |
|
|
| | | carbitol C6H14O33, 61, 64 |
 | | Compound Data | | Melting point | -77.33 °C | 195.82 K | | CSID | 13839107 | H bond acceptors | 3 | Rule of 5 violations | 0 | | Molecular weight | 134.1736 | H bond donors | 1 | ACD/LogP | 0.00 | | Phase 25 °C | liquid/gas | Rotatable bonds | 7 | Predicted density | 0.97 g/cm3 | | SMILES | OCCOCCOCC | | STD InChIKey | XXJWXESWEXIICW-UHFFFAOYAC | | Melting Points | | mp °C | source | |
|---|
| -80.00 | Alfa Aesar | | -76.00 | Oxford University MSDS | | -76.00 | PHYSPROP |
|
|
| | | carbofuran C12H15NO344, 64 |
 | | Compound Data | | Melting point | 151.25 °C | 424.40 K | | CSID | 2468 | H bond acceptors | 4 | Rule of 5 violations | 0 | | Molecular weight | 221.2524 | H bond donors | 1 | ACD/LogP | 1.76 | | Phase 25 °C | solid | Rotatable bonds | 2 | Predicted density | 1.14 g/cm3 | | SMILES | O=C(Oc2cccc1c2OC(C1)(C)C)NC | | STD InChIKey | DUEPRVBVGDRKAG-UHFFFAOYAB | | Melting Points | | mp °C | source | |
|---|
| 151.50 | Hughes LD; Palmer DS; Nigsch F and Mitchell JBO. 2008 Why ar... | | 151.00 | PHYSPROP |
|
|
| | | carbon disulfide CS23, 61, 64 |
 | | Compound Data | | Melting point | -111.83 °C | 161.32 K | | CSID | 6108 | H bond acceptors | 0 | Rule of 5 violations | 0 | | Molecular weight | 76.1407 | H bond donors | 0 | ACD/LogP | 1.94 | | Phase 25 °C | liquid/gas | Rotatable bonds | 0 | Predicted density | 1.26 g/cm3 | | SMILES | C(=S)=S | | STD InChIKey | QGJOPFRUJISHPQ-UHFFFAOYAS | | Melting Points | | mp °C | source | |
|---|
| -112.00 | Alfa Aesar | | -112.00 | Oxford University MSDS | | -111.50 | PHYSPROP |
|
|
| | | carbonohydrazide CH6N4O3, 61, 64 |
 | | Compound Data | | Melting point | 155.83 °C | 428.98 K | | CSID | 66578 | H bond acceptors | 5 | Rule of 5 violations | 1 | | Molecular weight | 90.0845 | H bond donors | 6 | ACD/LogP | -1.94 | | Phase 25 °C | solid | Rotatable bonds | 2 | Predicted density | 1.34 g/cm3 | | SMILES | O=C(NN)NN | | STD InChIKey | XEVRDFDBXJMZFG-UHFFFAOYAS | | Melting Points | | mp °C | source | |
|---|
| 156.00 | Alfa Aesar | | 157.50 | Oxford University MSDS | | 154.00 | PHYSPROP |
|
|
| | | carbonyl sulfide COS61, 64 |
 | | Compound Data | | Melting point | -138.90 °C | 134.25 K | | CSID | 9644 | H bond acceptors | 1 | Rule of 5 violations | 0 | | Molecular weight | 60.0751 | H bond donors | 0 | ACD/LogP | 0.84 | | Phase 25 °C | liquid/gas | Rotatable bonds | 0 | Predicted density | 1.14 g/cm3 | | SMILES | O=C=S | | STD InChIKey | JJWKPURADFRFRB-UHFFFAOYAF | | Melting Points | | mp °C | source | |
|---|
| -139.00 | Oxford University MSDS | | -138.80 | PHYSPROP |
|
|
| | | carbonyldiimidazole C7H6N4O3, 64 |
 | | Compound Data | | Melting point | 118.50 °C | 391.65 K | | CSID | 61561 | H bond acceptors | 5 | Rule of 5 violations | 0 | | Molecular weight | 162.1487 | H bond donors | 0 | ACD/LogP | -0.64 | | Phase 25 °C | solid | Rotatable bonds | 0 | Predicted density | 1.39 g/cm3 | | SMILES | O=C(n1cncc1)n2ccnc2 | | STD InChIKey | PFKFTWBEEFSNDU-UHFFFAOYAX | | Melting Points | | mp °C | source | |
|---|
| 118.00 | Alfa Aesar | | 119.00 | PHYSPROP |
|
|
| | | carbutamide C11H17N3O3S9, 64 |
 | | Compound Data | | Melting point | 144.25 °C | 417.40 K | | CSID | 9189 | H bond acceptors | 6 | Rule of 5 violations | 0 | | Molecular weight | 271.336 | H bond donors | 4 | ACD/LogP | 1.01 | | Phase 25 °C | solid | Rotatable bonds | 5 | Predicted density | 1.27 g/cm3 | | SMILES | O=S(=O)(c1ccc(N)cc1)NC(=O)NCCCC | | STD InChIKey | VDTNNGKXZGSZIP-UHFFFAOYAW | | Melting Points | | mp °C | source | |
|---|
| 144.00 | Bergstrom C. A. S.; Norinder U.; Luthman K.; Artursson P. Mo... | | 144.50 | PHYSPROP |
|
|
| | | caroxazone C10H10N2O39, 48, 64 |
 | |
|
| | | catechol C6H6O22, 3, 32, 61, 64 |
 | |
|
| | | celecoxib C17H14F3N3O2S32, 35, 64 |
 | | Compound Data | | Melting point | 157.83 °C | 430.98 K | | CSID | 2562 | H bond acceptors | 5 | Rule of 5 violations | 0 | | Molecular weight | 381.3722 | H bond donors | 2 | ACD/LogP | 3.90 | | Phase 25 °C | solid | Rotatable bonds | 3 | Predicted density | 1.43 g/cm3 | | SMILES | O=S(=O)(c3ccc(n1nc(cc1c2ccc(cc2)C)C(F)(F)F)cc3)N | | STD InChIKey | RZEKVGVHFLEQIL-UHFFFAOYAD | | Melting Points | | mp °C | source | |
|---|
| 157.50 | DrugBank | | 158.00 | EPISuite-ChemSpider | | 158.00 | PHYSPROP |
|
|
| | | chlorambucil C14H19Cl2NO261, 64 |
 | | Compound Data | | Melting point | 64.50 °C | 337.65 K | | CSID | 2607 | H bond acceptors | 3 | Rule of 5 violations | 0 | | Molecular weight | 304.2122 | H bond donors | 1 | ACD/LogP | 2.61 | | Phase 25 °C | solid | Rotatable bonds | 9 | Predicted density | 1.25 g/cm3 | | SMILES | c1cc(ccc1CCCC(=O)O)N(CCCl)CCCl | | STD InChIKey | JCKYGMPEJWAADB-UHFFFAOYAO | | Melting Points | | mp °C | source | |
|---|
| 64.00 | Oxford University MSDS | | 65.00 | PHYSPROP |
|
|
| | | chloranilic acid C6H2Cl2O461, 64 |
 | | Compound Data | | Melting point | 283.25 °C | 556.40 K | | CSID | 59971 | H bond acceptors | 4 | Rule of 5 violations | 0 | | Molecular weight | 208.9837 | H bond donors | 2 | ACD/LogP | 0.18 | | Phase 25 °C | solid | Rotatable bonds | 2 | Predicted density | 1.93 g/cm3 | | SMILES | Cl\C1=C(/O)C(=O)C(\Cl)=C(\O)C1=O | | STD InChIKey | IPPWILKGXFOXHO-UHFFFAOYAU | | Melting Points | | mp °C | source | |
|---|
| 283.00 | Oxford University MSDS | | 283.50 | PHYSPROP |
|
|
| | | chlorazanil C9H8ClN59, 48, 64 |
 | |
|
| | | chlordiazepoxide C16H14ClN3O44, 64 |
 | | Compound Data | | Melting point | 236.10 °C | 509.25 K | | CSID | 10248513 | H bond acceptors | 4 | Rule of 5 violations | 0 | | Molecular weight | 299.7549 | H bond donors | 1 | ACD/LogP | 2.16 | | Phase 25 °C | solid | Rotatable bonds | 1 | Predicted density | 1.30 g/cm3 | | SMILES | Clc1ccc2\N=C(/C[N+](/[O-])=C(\c2c1)c3ccccc3)NC | | STD InChIKey | ANTSCNMPPGJYLG-UHFFFAOYAM | | Melting Points | | mp °C | source | |
|---|
| 236.00 | Hughes LD; Palmer DS; Nigsch F and Mitchell JBO. 2008 Why ar... | | 236.20 | PHYSPROP |
|
|
| | | chloroacetic acid C2H3ClO23, 3, 61, 64 |
 | | Compound Data | | Melting point | 62.38 °C | 335.52 K | | CSID | 10772140 | H bond acceptors | 2 | Rule of 5 violations | 0 | | Molecular weight | 94.497 | H bond donors | 1 | ACD/LogP | 0.00 | | Phase 25 °C | solid | Rotatable bonds | 1 | Predicted density | 1.40 g/cm3 | | SMILES | ClCC(O)=O | | STD InChIKey | FOCAUTSVDIKZOP-UHFFFAOYAR | | Melting Points | | mp °C | source | |
|---|
| 61.50 | Alfa Aesar | | 62.00 | Alfa Aesar | | 63.00 | Oxford University MSDS | | 63.00 | PHYSPROP |
|
|
| | | chloroacetone C3H5ClO3, 32, 61, 64 |
 | | Compound Data | | Melting point | -44.62 °C | 228.52 K | | CSID | 6323 | H bond acceptors | 1 | Rule of 5 violations | 0 | | Molecular weight | 92.5242 | H bond donors | 0 | ACD/LogP | 0.42 | | Phase 25 °C | liquid/gas | Rotatable bonds | 1 | Predicted density | 1.07 g/cm3 | | SMILES | ClCC(=O)C | | STD InChIKey | BULLHNJGPPOUOX-UHFFFAOYAY | | Melting Points | | mp °C | source | |
|---|
| -45.00 | Alfa Aesar | | -44.50 | DrugBank | | -44.50 | Oxford University MSDS | | -44.50 | PHYSPROP |
|
|
| | | chlorobenzene C6H5Cl3, 31, 61, 64 |
 | |
|
| | | chlorocyclopropylmethane C4H7Cl3, 64 |
 | | Compound Data | | Melting point | -90.95 °C | 182.20 K | | CSID | 72268 | H bond acceptors | 0 | Rule of 5 violations | 0 | | Molecular weight | 90.5514 | H bond donors | 0 | ACD/LogP | 1.87 | | Phase 25 °C | liquid/gas | Rotatable bonds | 1 | Predicted density | 1.06 g/cm3 | | SMILES | ClCC1CC1 | | STD InChIKey | ZVTQWXCKQTUVPY-UHFFFAOYAG | | Melting Points | | mp °C | source | |
|---|
| -91.00 | Alfa Aesar | | -90.90 | PHYSPROP |
|
|
| | | chlorodifluoroacetic acid C2HClF2O23, 64 |
 | | Compound Data | | Melting point | 23.50 °C | 296.65 K | | CSID | 10800462 | H bond acceptors | 2 | Rule of 5 violations | 0 | | Molecular weight | 130.4779 | H bond donors | 1 | ACD/LogP | 1.45 | | Phase 25 °C | liquid/gas | Rotatable bonds | 1 | Predicted density | 1.66 g/cm3 | | SMILES | ClC(F)(F)C(O)=O | | STD InChIKey | OAWAZQITIZDJRB-UHFFFAOYAY | | Melting Points | | mp °C | source | |
|---|
| 22.00 | Alfa Aesar | | 25.00 | PHYSPROP |
|
|
| | | chloroethane C2H5Cl61, 64 |
 | | Compound Data | | Melting point | -138.85 °C | 134.30 K | | CSID | 6097 | H bond acceptors | 0 | Rule of 5 violations | 0 | | Molecular weight | 64.5141 | H bond donors | 0 | ACD/LogP | 1.50 | | Phase 25 °C | liquid/gas | Rotatable bonds | 0 | Predicted density | 0.88 g/cm3 | | SMILES | ClCC | | STD InChIKey | HRYZWHHZPQKTII-UHFFFAOYAJ | | Melting Points | | mp °C | source | |
|---|
| -139.00 | Oxford University MSDS | | -138.70 | PHYSPROP |
|
|
| | | chloroform CHCl33, 5, 13, 28, 31, 58, 58, 61, 61, 64, 72 |
 | |
|
| | | chloromethane CH3Cl61, 64 |
 | | Compound Data | | Melting point | -97.35 °C | 175.80 K | | CSID | 6087 | H bond acceptors | 0 | Rule of 5 violations | 0 | | Molecular weight | 50.4875 | H bond donors | 0 | ACD/LogP | 1.11 | | Phase 25 °C | liquid/gas | Rotatable bonds | 0 | Predicted density | 0.90 g/cm3 | | SMILES | CCl | | STD InChIKey | NEHMKBQYUWJMIP-UHFFFAOYAW | | Melting Points | | mp °C | source | |
|---|
| -97.00 | Oxford University MSDS | | -97.70 | PHYSPROP |
|
|
| | | chlorotriphenylmethane C19H15Cl3, 64 |
 | | Compound Data | | Melting point | 112.75 °C | 385.90 K | | CSID | 6214 | H bond acceptors | 0 | Rule of 5 violations | 1 | | Molecular weight | 278.7754 | H bond donors | 0 | ACD/LogP | 5.57 | | Phase 25 °C | solid | Rotatable bonds | 3 | Predicted density | 1.14 g/cm3 | | SMILES | ClC(c1ccccc1)(c2ccccc2)c3ccccc3 | | STD InChIKey | JBWKIWSBJXDJDT-UHFFFAOYAW | | Melting Points | | mp °C | source | |
|---|
| 112.00 | Alfa Aesar | | 113.50 | PHYSPROP |
|
|
| | | chlorotriphenylsilane C18H15ClSi3, 64 |
 | | Compound Data | | Melting point | 92.75 °C | 365.90 K | | CSID | 6216 | H bond acceptors | 0 | Rule of 5 violations | 1 | | Molecular weight | 294.8502 | H bond donors | 0 | ACD/LogP | 7.43 | | Phase 25 °C | solid | Rotatable bonds | 3 | Predicted density | 1.14 g/cm3 | | SMILES | Cl[Si](c1ccccc1)(c2ccccc2)c3ccccc3 | | STD InChIKey | MNKYQPOFRKPUAE-UHFFFAOYAQ | | Melting Points | | mp °C | source | |
|---|
| 94.00 | Alfa Aesar | | 91.50 | PHYSPROP |
|
|
| | | chlorpropamide C10H13ClN2O3S32, 44, 61, 64 |
 | |
|
| | | chlorpyrifos C9H11Cl3NO3PS44, 61, 64 |
 | |
|
| | | chlorzoxazone C7H4ClNO23, 32, 64 |
 | | Compound Data | | Melting point | 191.33 °C | 464.48 K | | CSID | 2632 | H bond acceptors | 3 | Rule of 5 violations | 0 | | Molecular weight | 169.5652 | H bond donors | 1 | ACD/LogP | 2.19 | | Phase 25 °C | solid | Rotatable bonds | 0 | Predicted density | 1.49 g/cm3 | | SMILES | Clc2cc1c(OC(=O)N1)cc2 | | STD InChIKey | TZFWDZFKRBELIQ-UHFFFAOYAQ | | Melting Points | | mp °C | source | |
|---|
| 191.00 | Alfa Aesar | | 191.50 | DrugBank | | 191.50 | PHYSPROP |
|
|
| | | chromanone C9H8O23, 64 |
 | | Compound Data | | Melting point | 37.25 °C | 310.40 K | | CSID | 61418 | H bond acceptors | 2 | Rule of 5 violations | 0 | | Molecular weight | 148.1586 | H bond donors | 0 | ACD/LogP | 1.62 | | Phase 25 °C | solid | Rotatable bonds | 0 | Predicted density | 1.20 g/cm3 | | SMILES | c1ccc2c(c1)C(=O)CCO2 | | STD InChIKey | MSTDXOZUKAQDRL-UHFFFAOYAG | | Melting Points | | mp °C | source | |
|---|
| 38.00 | Alfa Aesar | | 36.50 | PHYSPROP |
|
|
| | | chrysin C15H10O43, 64 |
 | | Compound Data | | Melting point | 286.25 °C | 559.40 K | | CSID | 4444926 | H bond acceptors | 4 | Rule of 5 violations | 0 | | Molecular weight | 254.2375 | H bond donors | 2 | ACD/LogP | 2.88 | | Phase 25 °C | solid | Rotatable bonds | 3 | Predicted density | 1.44 g/cm3 | | SMILES | O=C\1c3c(O/C(=C/1)c2ccccc2)cc(O)cc3O | | STD InChIKey | RTIXKCRFFJGDFG-UHFFFAOYAO | | Melting Points | | mp °C | source | |
|---|
| 287.00 | Alfa Aesar | | 285.50 | PHYSPROP |
|
|
| | | cinchophen C16H11NO23, 64 |
 | | Compound Data | | Melting point | 214.75 °C | 487.90 K | | CSID | 8274 | H bond acceptors | 3 | Rule of 5 violations | 0 | | Molecular weight | 249.264 | H bond donors | 1 | ACD/LogP | 3.76 | | Phase 25 °C | solid | Rotatable bonds | 2 | Predicted density | 1.28 g/cm3 | | SMILES | O=C(O)c1c3ccccc3nc(c1)c2ccccc2 | | STD InChIKey | YTRMTPPVNRALON-UHFFFAOYAJ | | Melting Points | | mp °C | source | |
|---|
| 215.00 | Alfa Aesar | | 214.50 | PHYSPROP |
|
|
| | | citric acid C6H8O73, 35, 35, 61, 64 |
 | | Compound Data | | Melting point | 153.25 °C | 426.40 K | | CSID | 305 | H bond acceptors | 7 | Rule of 5 violations | 0 | | Molecular weight | 192.1235 | H bond donors | 4 | ACD/LogP | 0.00 | | Phase 25 °C | solid | Rotatable bonds | 6 | Predicted density | 1.76 g/cm3 | | SMILES | C(C(=O)O)C(CC(=O)O)(C(=O)O)O | | STD InChIKey | KRKNYBCHXYNGOX-UHFFFAOYAM | | Melting Points | | mp °C | source | |
|---|
| 154.00 | Alfa Aesar | | 153.00 | EPISuite-ChemSpider | | 153.00 | Oxford University MSDS | | 153.00 | PHYSPROP | | Values not used in calculating the average melting point | | 153.00 | EPISuite-ChemSpider1 | | 1. hydrate JCB |
|
|
| | | clofibric acid C10H11ClO33, 64 |
 | | Compound Data | | Melting point | 119.25 °C | 392.40 K | | CSID | 2695 | H bond acceptors | 3 | Rule of 5 violations | 0 | | Molecular weight | 214.6455 | H bond donors | 1 | ACD/LogP | 2.72 | | Phase 25 °C | solid | Rotatable bonds | 3 | Predicted density | 1.26 g/cm3 | | SMILES | Clc1ccc(OC(C(=O)O)(C)C)cc1 | | STD InChIKey | TXCGAZHTZHNUAI-UHFFFAOYAP | | Melting Points | | mp °C | source | |
|---|
| 120.00 | Alfa Aesar | | 118.50 | PHYSPROP |
|
|
| | | clotrimazole C22H17ClN29, 32, 48, 64 |
 | |
|
| | | clozapine C18H19ClN432, 44, 64 |
 | | Compound Data | | Melting point | 183.63 °C | 456.78 K | | CSID | 10442628 | H bond acceptors | 4 | Rule of 5 violations | 0 | | Molecular weight | 326.8233 | H bond donors | 1 | ACD/LogP | 3.94 | | Phase 25 °C | solid | Rotatable bonds | 1 | Predicted density | 1.32 g/cm3 | | SMILES | CN1CCN(CC1)C2=Nc3cc(ccc3Nc4c2cccc4)Cl | | STD InChIKey | QZUDBNBUXVUHMW-UHFFFAOYAL | | Melting Points | | mp °C | source | |
|---|
| 183.50 | DrugBank | | 183.90 | Hughes LD; Palmer DS; Nigsch F and Mitchell JBO. 2008 Why ar... | | 183.50 | PHYSPROP |
|
|
| | | coronene C24H1264, 70 |
 | | Compound Data | | Melting point | 437.65 °C | 710.80 K | | CSID | 8761 | H bond acceptors | 0 | Rule of 5 violations | 1 | | Molecular weight | 300.3521 | H bond donors | 0 | ACD/LogP | 7.11 | | Phase 25 °C | solid | Rotatable bonds | 0 | Predicted density | 1.47 g/cm3 | | SMILES | c1cc2ccc3ccc4ccc5ccc6ccc1c7c2c3c4c5c67 | | STD InChIKey | VPUGDVKSAQVFFS-UHFFFAOYAQ | | Melting Points | | mp °C | source | |
|---|
| 437.30 | PHYSPROP | | 438.00 | Sepassi K; Yalkowsky SH. AAPS PharmSciTech 7(1) E1-E8 (2006) |
|
|
| | | coumarin C9H6O23, 64 |
 | | Compound Data | | Melting point | 70.50 °C | 343.65 K | | CSID | 13848793 | H bond acceptors | 2 | Rule of 5 violations | 0 | | Molecular weight | 146.1427 | H bond donors | 0 | ACD/LogP | 1.39 | | Phase 25 °C | solid | Rotatable bonds | 0 | Predicted density | 1.25 g/cm3 | | SMILES | c1ccc2c(c1)ccc(=O)o2 | | STD InChIKey | ZYGHJZDHTFUPRJ-UHFFFAOYAC | | Melting Points | | mp °C | source | |
|---|
| 70.00 | Alfa Aesar | | 71.00 | PHYSPROP |
|
|
| | | cresolphthalein C22H18O43, 64 |
 | | Compound Data | | Melting point | 223.50 °C | 496.65 K | | CSID | 62217 | H bond acceptors | 4 | Rule of 5 violations | 0 | | Molecular weight | 346.3759 | H bond donors | 2 | ACD/LogP | 3.55 | | Phase 25 °C | solid | Rotatable bonds | 4 | Predicted density | 1.32 g/cm3 | | SMILES | O=C1OC(c2ccccc12)(c3ccc(O)c(c3)C)c4ccc(O)c(c4)C | | STD InChIKey | CPBJMKMKNCRKQB-UHFFFAOYAJ | | Melting Points | | mp °C | source | |
|---|
| 224.00 | Alfa Aesar | | 223.00 | PHYSPROP |
|
|
| | | cyanamide CH2N23, 61, 64 |
 | | Compound Data | | Melting point | 44.85 °C | 318.00 K | | CSID | 9480 | H bond acceptors | 2 | Rule of 5 violations | 0 | | Molecular weight | 42.04 | H bond donors | 2 | ACD/LogP | -0.82 | | Phase 25 °C | solid | Rotatable bonds | 0 | Predicted density | 1.00 g/cm3 | | SMILES | N#CN | | STD InChIKey | XZMCDFZZKTWFGF-UHFFFAOYAW | | Melting Points | | mp °C | source | |
|---|
| 45.00 | Alfa Aesar | | 44.00 | Oxford University MSDS | | 45.56 | PHYSPROP |
|
|
| | | cyanic iodide CIN61, 64 |
 | | Compound Data | | Melting point | 146.35 °C | 419.50 K | | CSID | 10046 | H bond acceptors | 1 | Rule of 5 violations | 0 | | Molecular weight | 152.9219 | H bond donors | 0 | ACD/LogP | 1.33 | | Phase 25 °C | solid | Rotatable bonds | 0 | Predicted density | 2.67 g/cm3 | | SMILES | IC#N | | STD InChIKey | WPBXOELOQKLBDF-UHFFFAOYAT | | Melting Points | | mp °C | source | |
|---|
| 146.00 | Oxford University MSDS | | 146.70 | PHYSPROP |
|
|
| | | cyanoacetamide C3H4N2O3, 48, 64 |
 | |
|
| | | cyanoacetic acid C3H3NO23, 64 |
 | | Compound Data | | Melting point | 66.50 °C | 339.65 K | | CSID | 9357 | H bond acceptors | 3 | Rule of 5 violations | 0 | | Molecular weight | 85.0614 | H bond donors | 1 | ACD/LogP | -0.76 | | Phase 25 °C | solid | Rotatable bonds | 1 | Predicted density | 1.29 g/cm3 | | SMILES | N#CCC(=O)O | | STD InChIKey | MLIREBYILWEBDM-UHFFFAOYAD | | Melting Points | | mp °C | source | |
|---|
| 67.00 | Alfa Aesar | | 66.00 | PHYSPROP |
|
|
| | | cyclam C10H24N43, 64 |
 | | Compound Data | | Melting point | 185.50 °C | 458.65 K | | CSID | 58489 | H bond acceptors | 4 | Rule of 5 violations | 0 | | Molecular weight | 200.3244 | H bond donors | 4 | ACD/LogP | -0.97 | | Phase 25 °C | solid | Rotatable bonds | 0 | Predicted density | 0.86 g/cm3 | | SMILES | N1CCNCCCNCCNCCC1 | | STD InChIKey | MDAXKAUIABOHTD-UHFFFAOYAV | | Melting Points | | mp °C | source | |
|---|
| 186.00 | Alfa Aesar | | 185.00 | PHYSPROP |
|
|
| | | cyclobarbital C12H16N2O344, 64 |
 | | Compound Data | | Melting point | 172.75 °C | 445.90 K | | CSID | 5632 | H bond acceptors | 5 | Rule of 5 violations | 0 | | Molecular weight | 236.267 | H bond donors | 2 | ACD/LogP | 1.62 | | Phase 25 °C | solid | Rotatable bonds | 2 | Predicted density | 1.21 g/cm3 | | SMILES | O=C1NC(=O)NC(=O)C1(/C2=C/CCCC2)CC | | STD InChIKey | WTYGAUXICFETTC-UHFFFAOYAC | | Melting Points | | mp °C | source | |
|---|
| 172.50 | Hughes LD; Palmer DS; Nigsch F and Mitchell JBO. 2008 Why ar... | | 173.00 | PHYSPROP |
|
|
| | | cyclobutane C4H84, 25, 64 |
 | |
|
| | | cyclobutanone C4H6O3, 64, 66 |
 | |
|
| | | cyclobutylmethane C5H1052, 64 |
 | | Compound Data | | Melting point | -161.50 °C | 111.64 K | | CSID | 11232 | H bond acceptors | 0 | Rule of 5 violations | 0 | | Molecular weight | 70.1329 | H bond donors | 0 | ACD/LogP | 2.75 | | Phase 25 °C | liquid/gas | Rotatable bonds | 0 | Predicted density | 0.77 g/cm3 | | SMILES | CC1CCC1 | | STD InChIKey | BDJAEZRIGNCQBZ-UHFFFAOYAR | | Melting Points | | mp °C | source | |
|---|
| -161.51 | Lemaire HP; Livingston RL. Journal of the American Chemical ... | | -161.50 | PHYSPROP |
|
|
| | | cyclodecanol C10H20O47, 64 |
 | | Compound Data | | Melting point | 40.17 °C | 313.32 K | | CSID | 14436 | H bond acceptors | 1 | Rule of 5 violations | 0 | | Molecular weight | 156.2652 | H bond donors | 1 | ACD/LogP | 3.60 | | Phase 25 °C | solid | Rotatable bonds | 1 | Predicted density | 0.90 g/cm3 | | SMILES | OC1CCCCCCCCC1 | | STD InChIKey | WFRBMXFCEAHLGH-UHFFFAOYAJ | | Melting Points | | mp °C | source | |
|---|
| 39.85 | IUCr | | 40.50 | PHYSPROP |
|
|
| | | cyclodecanone C10H18O2, 64 |
 | | Compound Data | | Melting point | 26.00 °C | 299.15 K | | CSID | 66551 | H bond acceptors | 1 | Rule of 5 violations | 0 | | Molecular weight | 154.2493 | H bond donors | 0 | ACD/LogP | 3.02 | | Phase 25 °C | solid | Rotatable bonds | 0 | Predicted density | 0.89 g/cm3 | | SMILES | O=C1CCCCCCCCC1 | | STD InChIKey | SXOZDDAFVJANJP-UHFFFAOYAD | | Melting Points | | mp °C | source | |
|---|
| 24.00 | Aldrich Chemical Company; Aldrich Catalog-Handbook of Fine C... | | 28.00 | PHYSPROP |
|
|
| | | cyclododecane C12H244, 61, 64, 64 |
 | |
|
| | | cyclododecanol C12H24O2, 3, 64 |
 | |
|
| | | cyclododecanone C12H22O2, 3 |
 | | Compound Data | | Melting point | 60.50 °C | 333.65 K | | CSID | 12690 | H bond acceptors | 1 | Rule of 5 violations | 0 | | Molecular weight | 182.3025 | H bond donors | 0 | ACD/LogP | 4.15 | | Phase 25 °C | solid | Rotatable bonds | 0 | Predicted density | 0.87 g/cm3 | | SMILES | O=C1CCCCCCCCCCC1 | | STD InChIKey | SXVPOSFURRDKBO-UHFFFAOYAN | | Melting Points | | mp °C | source | |
|---|
| 60.00 | Aldrich Chemical Company; Aldrich Catalog-Handbook of Fine C... | | 61.00 | Alfa Aesar |
|
|
| | | cycloheptatriene C7H83, 64 |
 | | Compound Data | | Melting point | -79.75 °C | 193.40 K | | CSID | 10534 | H bond acceptors | 0 | Rule of 5 violations | 0 | | Molecular weight | 92.1384 | H bond donors | 0 | ACD/LogP | 2.42 | | Phase 25 °C | liquid/gas | Rotatable bonds | 0 | Predicted density | 0.89 g/cm3 | | SMILES | C1=C\C/C=C\C=C1 | | STD InChIKey | CHVJITGCYZJHLR-UHFFFAOYAI | | Melting Points | | mp °C | source | |
|---|
| -80.00 | Alfa Aesar | | -79.50 | PHYSPROP |
|
|
| | | cyclohexanamine C6H13N2, 3, 35, 61, 64 |
 | |
|
| | | cyclohexane C6H123, 4, 59, 61, 64 |
 | |
|
| | | cyclohexanecarbaldehyde C7H12O3, 3 |
 | | Compound Data | | Melting point | 34.75 °C | 307.90 K | | CSID | 15443 | H bond acceptors | 1 | Rule of 5 violations | 0 | | Molecular weight | 112.1696 | H bond donors | 0 | ACD/LogP | 1.90 | | Phase 25 °C | solid | Rotatable bonds | 1 | Predicted density | 0.99 g/cm3 | | SMILES | O=CC1CCCCC1 | | STD InChIKey | KVFDZFBHBWTVID-UHFFFAOYAG | | Melting Points | | mp °C | source | |
|---|
| 34.50 | Alfa Aesar | | 35.00 | Alfa Aesar |
|
|
| | | cyclohexanecarboxylic acid C7H12O23, 35, 42, 64 |
 | | Compound Data | | Melting point | 31.00 °C | 304.15 K | | CSID | 7135 | H bond acceptors | 2 | Rule of 5 violations | 0 | | Molecular weight | 128.169 | H bond donors | 1 | ACD/LogP | 1.77 | | Phase 25 °C | solid | Rotatable bonds | 1 | Predicted density | 1.08 g/cm3 | | SMILES | O=C(O)C1CCCCC1 | | STD InChIKey | NZNMSOFKMUBTKW-UHFFFAOYAH | | Melting Points | | mp °C | source | |
|---|
| 31.00 | Alfa Aesar | | 31.50 | EPISuite-ChemSpider | | 30.00 | GoodScents | | 31.50 | PHYSPROP |
|
|
| | | cyclohexanol C6H12O2, 3, 28, 61, 64 |
 | |
|
| | | cyclohexanone oxime C6H11NO3, 48, 61, 64 |
 | |
|
| | | cyclohexene C6H103, 4, 61, 64 |
 | |
|
| | | cyclohexylbenzene C12H162, 3, 61, 64 |
 | |
|
| | | cyclooctane C8H163, 4, 64 |
 | |
|
| | | cyclopentadecane C15H304, 64 |
 | | Compound Data | | Melting point | 61.65 °C | 334.80 K | | CSID | 60848 | H bond acceptors | 0 | Rule of 5 violations | 1 | | Molecular weight | 210.3987 | H bond donors | 0 | ACD/LogP | 8.46 | | Phase 25 °C | solid | Rotatable bonds | 0 | Predicted density | 0.79 g/cm3 | | SMILES | C1CCCCCCCCCCCCCC1 | | STD InChIKey | SRONXYPFSAKOGH-UHFFFAOYAZ | | Melting Points | | mp °C | source | |
|---|
| 62.00 | American Petroleum Institute. Research Project 44; Selected ... | | 61.30 | PHYSPROP |
|
|
| | | cyclopentane C5H103, 4, 59, 61, 64 |
 | |
|
| | | cyclopentanol C5H10O2, 3, 28, 61, 62, 64, 79 |
 | |
|
| | | cyclopentanone C5H8O2, 3, 28, 61, 64 |
 | |
|
| | | cyclopentanone oxime C5H9NO3, 64 |
 | | Compound Data | | Melting point | 56.90 °C | 330.05 K | | CSID | 13844 | H bond acceptors | 2 | Rule of 5 violations | 0 | | Molecular weight | 99.1311 | H bond donors | 1 | ACD/LogP | 0.56 | | Phase 25 °C | solid | Rotatable bonds | 1 | Predicted density | 1.15 g/cm3 | | SMILES | O\N=C1/CCCC1 | | STD InChIKey | YGNXYFLJZILPEK-UHFFFAOYAT | | Melting Points | | mp °C | source | |
|---|
| 56.00 | Alfa Aesar | | 57.80 | PHYSPROP |
|
|
| | | cyclopentene C5H83, 4, 61, 64 |
 | |
|
| | | cyclopentylamine C5H11N3, 57, 64 |
 | |
|
| | | cyclopropane C3H659, 64, 68 |
 | |
|
| | | cyclopropanecarboxylic acid C4H6O217, 19, 24, 64, 74 |
 | |
|
| | | cyclopropylmethane C4H843, 59, 64 |
 | |
|
| | | cyproheptadine C21H21N44, 59, 64 |
 | | Compound Data | | Melting point | 112.37 °C | 385.52 K | | CSID | 2810 | H bond acceptors | 1 | Rule of 5 violations | 1 | | Molecular weight | 287.3981 | H bond donors | 0 | ACD/LogP | 6.41 | | Phase 25 °C | solid | Rotatable bonds | 0 | Predicted density | 1.11 g/cm3 | | SMILES | c43\C(=C1/CCN(C)CC1)c2ccccc2\C=C/c3cccc4 | | STD InChIKey | JJCFRYNCJDLXIK-UHFFFAOYAW | | Melting Points | | mp °C | source | |
|---|
| 112.80 | Hughes LD; Palmer DS; Nigsch F and Mitchell JBO. 2008 Why ar... | | 111.50 | NIST Web Book | | 112.80 | PHYSPROP | | Values not used in calculating the average melting point | | 216.00 | DrugBank1 | | 1. HCl salt JCB |
|
|
| | | dabco C6H12N23, 64 |
 | | Compound Data | | Melting point | 158.50 °C | 431.65 K | | CSID | 8882 | H bond acceptors | 2 | Rule of 5 violations | 0 | | Molecular weight | 112.1729 | H bond donors | 0 | ACD/LogP | -0.85 | | Phase 25 °C | solid | Rotatable bonds | 0 | Predicted density | 1.08 g/cm3 | | SMILES | N12CCN(CC1)CC2 | | STD InChIKey | IMNIMPAHZVJRPE-UHFFFAOYAP | | Melting Points | | mp °C | source | |
|---|
| 158.00 | Alfa Aesar | | 159.00 | PHYSPROP |
|
|
| | | dansyl amide C12H14N2O2S3, 64 |
 | | Compound Data | | Melting point | 219.75 °C | 492.90 K | | CSID | 58587 | H bond acceptors | 4 | Rule of 5 violations | 0 | | Molecular weight | 250.3168 | H bond donors | 2 | ACD/LogP | 2.01 | | Phase 25 °C | solid | Rotatable bonds | 2 | Predicted density | 1.31 g/cm3 | | SMILES | O=S(=O)(c1cccc2c1cccc2N(C)C)N | | STD InChIKey | TYNBFJJKZPTRKS-UHFFFAOYAD | | Melting Points | | mp °C | source | |
|---|
| 220.00 | Alfa Aesar | | 219.50 | PHYSPROP |
|
|
| | | dansyl chloride C12H12ClNO2S3, 64 |
 | | Compound Data | | Melting point | 71.00 °C | 344.15 K | | CSID | 11308 | H bond acceptors | 3 | Rule of 5 violations | 0 | | Molecular weight | 269.7472 | H bond donors | 0 | ACD/LogP | 3.67 | | Phase 25 °C | solid | Rotatable bonds | 2 | Predicted density | 1.36 g/cm3 | | SMILES | ClS(=O)(=O)c1cccc2c1cccc2N(C)C | | STD InChIKey | XPDXVDYUQZHFPV-UHFFFAOYAI | | Melting Points | | mp °C | source | |
|---|
| 72.00 | Alfa Aesar | | 70.00 | PHYSPROP |
|
|
| | | DCC C13H22N23, 3, 19, 55, 64, 72, 84 |
 | |
|
| | | DDT C14H9Cl527, 58, 61, 61, 64, 65, 70, 70, 80 |
 | |
|
| | | decachlorobiphenyl C12Cl1064, 70 |
 | | Compound Data | | Melting point | 305.90 °C | 579.05 K | | CSID | 15484 | H bond acceptors | 0 | Rule of 5 violations | 1 | | Molecular weight | 498.6584 | H bond donors | 0 | ACD/LogP | 8.10 | | Phase 25 °C | solid | Rotatable bonds | 1 | Predicted density | 1.82 g/cm3 | | SMILES | Clc1c(c(Cl)c(Cl)c(Cl)c1Cl)c2c(Cl)c(Cl)c(Cl)c(Cl)c2Cl | | STD InChIKey | ONXPZLFXDMAPRO-UHFFFAOYAX | | Melting Points | | mp °C | source | |
|---|
| 305.80 | PHYSPROP | | 306.00 | Sepassi K; Yalkowsky SH. AAPS PharmSciTech 7(1) E1-E8 (2006) |
|
|
| | | decafluorobiphenyl C12F103, 61, 64 |
 | | Compound Data | | Melting point | 67.50 °C | 340.65 K | | CSID | 61266 | H bond acceptors | 0 | Rule of 5 violations | 1 | | Molecular weight | 334.1124 | H bond donors | 0 | ACD/LogP | 6.73 | | Phase 25 °C | solid | Rotatable bonds | 1 | Predicted density | 1.70 g/cm3 | | SMILES | Fc1c(c(F)c(F)c(F)c1F)c2c(F)c(F)c(F)c(F)c2F | | STD InChIKey | ONUFSRWQCKNVSL-UHFFFAOYAP | | Melting Points | | mp °C | source | |
|---|
| 68.00 | Alfa Aesar | | 67.00 | Oxford University MSDS | | 67.50 | PHYSPROP |
|
|
| | | decanal C10H20O3, 4, 64 |
 | |
|
| | | decane C10H223, 4, 32, 59, 61, 64 |
 | |
|
| | | decanoic acid C10H20O23, 4, 61, 61, 64 |
 | |
|
| | | decanonitrile C10H19N3, 31, 64 |
 | |
|
| | | decanoyl chloride C10H19ClO3, 64 |
 | | Compound Data | | Melting point | -34.75 °C | 238.40 K | | CSID | 60340 | H bond acceptors | 1 | Rule of 5 violations | 0 | | Molecular weight | 190.7103 | H bond donors | 0 | ACD/LogP | 4.71 | | Phase 25 °C | liquid/gas | Rotatable bonds | 8 | Predicted density | 0.94 g/cm3 | | SMILES | ClC(=O)CCCCCCCCC | | STD InChIKey | IPIVAXLHTVNRBS-UHFFFAOYAH | | Melting Points | | mp °C | source | |
|---|
| -35.00 | Alfa Aesar | | -34.50 | PHYSPROP |
|
|
| | | decylbenzene C16H264, 61, 64 |
 | |
|
| | | decylcyclohexane C16H324, 64 |
 | | Compound Data | | Melting point | -1.85 °C | 271.30 K | | CSID | 14942 | H bond acceptors | 0 | Rule of 5 violations | 1 | | Molecular weight | 224.4253 | H bond donors | 0 | ACD/LogP | 8.66 | | Phase 25 °C | liquid/gas | Rotatable bonds | 9 | Predicted density | 0.81 g/cm3 | | SMILES | C(CCC1CCCCC1)CCCCCCC | | STD InChIKey | STWFZICHPLEOIC-UHFFFAOYAF | | Melting Points | | mp °C | source | |
|---|
| -2.00 | American Petroleum Institute. Research Project 44; Selected ... | | -1.70 | PHYSPROP |
|
|
| | | deferoxamine C25H48N6O832, 64 |
 | | Compound Data | | Melting point | 139.50 °C | 412.65 K | | CSID | 2867 | H bond acceptors | 14 | Rule of 5 violations | 3 | | Molecular weight | 560.684 | H bond donors | 7 | ACD/LogP | 0.00 | | Phase 25 °C | solid | Rotatable bonds | 27 | Predicted density | 1.21 g/cm3 | | SMILES | CC(=O)N(CCCCCNC(=O)CCC(=O)N(CCCCCNC(=O)CCC(=O)N(CCCCCN)O)O)O | | STD InChIKey | UBQYURCVBFRUQT-UHFFFAOYAW | | Melting Points | | mp °C | source | |
|---|
| 139.00 | DrugBank | | 140.00 | PHYSPROP |
|
|
| | | delavirdine C22H28N6O3S9, 32 |
 | | Compound Data | | Melting point | 226.50 °C | 499.65 K | | CSID | 5423 | H bond acceptors | 9 | Rule of 5 violations | 0 | | Molecular weight | 456.5611 | H bond donors | 3 | ACD/LogP | -0.84 | | Phase 25 °C | solid | Rotatable bonds | 5 | Predicted density | 1.39 g/cm3 | | SMILES | O=S(=O)(Nc1cc2cc(nc2cc1)C(=O)N4CCN(c3ncccc3NC(C)C)CC4)C | | STD InChIKey | WHBIGIKBNXZKFE-UHFFFAOYAY | | Melting Points | | mp °C | source | |
|---|
| 226.00 | Bergstrom C. A. S.; Norinder U.; Luthman K.; Artursson P. Mo... | | 227.00 | DrugBank |
|
|
| | | deoxybenzoin C14H12O3, 64 |
 | | Compound Data | | Melting point | 57.50 °C | 330.65 K | | CSID | 9554 | H bond acceptors | 1 | Rule of 5 violations | 0 | | Molecular weight | 196.2445 | H bond donors | 0 | ACD/LogP | 3.18 | | Phase 25 °C | solid | Rotatable bonds | 3 | Predicted density | 1.08 g/cm3 | | SMILES | O=C(c1ccccc1)Cc2ccccc2 | | STD InChIKey | OTKCEEWUXHVZQI-UHFFFAOYAG | | Melting Points | | mp °C | source | |
|---|
| 55.00 | Alfa Aesar | | 60.00 | PHYSPROP |
|
|
| | | desaminotyrosine C9H10O33, 48, 64 |
 | |
|
| | | desyl chloride C14H11ClO3, 64 |
 | | Compound Data | | Melting point | 67.75 °C | 340.90 K | | CSID | 86040 | H bond acceptors | 1 | Rule of 5 violations | 0 | | Molecular weight | 230.6895 | H bond donors | 0 | ACD/LogP | 3.30 | | Phase 25 °C | solid | Rotatable bonds | 3 | Predicted density | 1.19 g/cm3 | | SMILES | ClC(C(=O)c1ccccc1)c2ccccc2 | | STD InChIKey | RXDYOLRABMJTEF-UHFFFAOYAQ | | Melting Points | | mp °C | source | |
|---|
| 67.00 | Alfa Aesar | | 68.50 | PHYSPROP |
|
|
| | | di-butyl sebacate C18H34O43, 64 |
 | | Compound Data | | Melting point | -10.50 °C | 262.65 K | | CSID | 13837584 | H bond acceptors | 4 | Rule of 5 violations | 1 | | Molecular weight | 314.4602 | H bond donors | 0 | ACD/LogP | 5.97 | | Phase 25 °C | liquid/gas | Rotatable bonds | 17 | Predicted density | 0.94 g/cm3 | | SMILES | CCCCOC(=O)CCCCCCCCC(=O)OCCCC | | STD InChIKey | PYGXAGIECVVIOZ-UHFFFAOYAE | | Melting Points | | mp °C | source | |
|---|
| -11.00 | Alfa Aesar | | -10.00 | PHYSPROP |
|
|
| | | di-n-butyl sulfoxide C8H18OS3, 64 |
 | | Compound Data | | Melting point | 32.80 °C | 305.95 K | | CSID | 15708 | H bond acceptors | 1 | Rule of 5 violations | 0 | | Molecular weight | 162.2929 | H bond donors | 0 | ACD/LogP | 1.84 | | Phase 25 °C | solid | Rotatable bonds | 6 | Predicted density | 0.95 g/cm3 | | SMILES | O=S(CCCC)CCCC | | STD InChIKey | LOWMYOWHQMKBTM-UHFFFAOYAX | | Melting Points | | mp °C | source | |
|---|
| 33.00 | Alfa Aesar | | 32.60 | PHYSPROP |
|
|
| | | di-n-pentyl sulfide C10H22S3, 64 |
 | | Compound Data | | Melting point | -51.15 °C | 222.00 K | | CSID | 12810 | H bond acceptors | 0 | Rule of 5 violations | 1 | | Molecular weight | 174.3467 | H bond donors | 0 | ACD/LogP | 5.14 | | Phase 25 °C | liquid/gas | Rotatable bonds | 8 | Predicted density | 0.84 g/cm3 | | SMILES | S(CCCCC)CCCCC | | STD InChIKey | JOZDADPMWLVEJK-UHFFFAOYAV | | Melting Points | | mp °C | source | |
|---|
| -51.00 | Alfa Aesar | | -51.30 | PHYSPROP |
|
|
| | | di-n-propyl disulfide C6H14S23, 64 |
 | | Compound Data | | Melting point | -85.80 °C | 187.35 K | | CSID | 11871 | H bond acceptors | 0 | Rule of 5 violations | 0 | | Molecular weight | 150.3054 | H bond donors | 0 | ACD/LogP | 3.90 | | Phase 25 °C | liquid/gas | Rotatable bonds | 5 | Predicted density | 0.97 g/cm3 | | SMILES | S(SCCC)CCC | | STD InChIKey | ALVPFGSHPUPROW-UHFFFAOYAZ | | Melting Points | | mp °C | source | |
|---|
| -86.00 | Alfa Aesar | | -85.60 | PHYSPROP |
|
|
| | | di-n-propyl sulfide C6H14S3, 4, 64 |
 | |
|
| | | diacetone acrylamide C9H15NO23, 64 |
 | | Compound Data | | Melting point | 56.25 °C | 329.40 K | | CSID | 16896 | H bond acceptors | 3 | Rule of 5 violations | 0 | | Molecular weight | 169.2209 | H bond donors | 1 | ACD/LogP | -0.05 | | Phase 25 °C | solid | Rotatable bonds | 4 | Predicted density | 0.96 g/cm3 | | SMILES | O=C(CC(NC(=O)\C=C)(C)C)C | | STD InChIKey | OMNKZBIFPJNNIO-UHFFFAOYAV | | Melting Points | | mp °C | source | |
|---|
| 55.00 | Alfa Aesar | | 57.50 | PHYSPROP |
|
|
| | | diallyl sulfide C6H10S3, 64 |
 | | Compound Data | | Melting point | -84.00 °C | 189.15 K | | CSID | 11128 | H bond acceptors | 0 | Rule of 5 violations | 0 | | Molecular weight | 114.2086 | H bond donors | 0 | ACD/LogP | 2.60 | | Phase 25 °C | liquid/gas | Rotatable bonds | 4 | Predicted density | 0.87 g/cm3 | | SMILES | S(C\C=C)C\C=C | | STD InChIKey | UBJVUCKUDDKUJF-UHFFFAOYAC | | Melting Points | | mp °C | source | |
|---|
| -83.00 | Alfa Aesar | | -85.00 | PHYSPROP |
|
|
| | | diallylamine C6H11N3, 64 |
 | | Compound Data | | Melting point | -88.20 °C | 184.95 K | | CSID | 21106561 | H bond acceptors | 1 | Rule of 5 violations | 0 | | Molecular weight | 97.1582 | H bond donors | 1 | ACD/LogP | 1.11 | | Phase 25 °C | liquid/gas | Rotatable bonds | 4 | Predicted density | 0.77 g/cm3 | | SMILES | C=CCNCC=C | | STD InChIKey | DYUWTXWIYMHBQS-UHFFFAOYAO | | Melting Points | | mp °C | source | |
|---|
| -88.00 | Alfa Aesar | | -88.40 | PHYSPROP |
|
|
| | | diazoxide C8H7ClN2O2S32, 44, 64 |
 | | Compound Data | | Melting point | 329.40 °C | 602.55 K | | CSID | 2911 | H bond acceptors | 4 | Rule of 5 violations | 0 | | Molecular weight | 230.6714 | H bond donors | 1 | ACD/LogP | 1.07 | | Phase 25 °C | solid | Rotatable bonds | 0 | Predicted density | 1.61 g/cm3 | | SMILES | Clc1ccc2c(c1)S(=O)(=O)/N=C(\N2)C | | STD InChIKey | GDLBFKVLRPITMI-UHFFFAOYAC | | Melting Points | | mp °C | source | |
|---|
| 330.50 | DrugBank | | 327.20 | Hughes LD; Palmer DS; Nigsch F and Mitchell JBO. 2008 Why ar... | | 330.50 | PHYSPROP |
|
|
| | | dibenzo-18-crown-6 C20H24O63, 64 |
 | | Compound Data | | Melting point | 162.50 °C | 435.65 K | | CSID | 24722 | H bond acceptors | 6 | Rule of 5 violations | 0 | | Molecular weight | 360.401 | H bond donors | 0 | ACD/LogP | 1.84 | | Phase 25 °C | solid | Rotatable bonds | 0 | Predicted density | 1.11 g/cm3 | | SMILES | O1c3c(OCCOCCOc2ccccc2OCCOCC1)cccc3 | | STD InChIKey | YSSSPARMOAYJTE-UHFFFAOYAB | | Melting Points | | mp °C | source | |
|---|
| 162.00 | Alfa Aesar | | 163.00 | PHYSPROP |
|
|
| | | dibenzosuberone C15H12O3, 64 |
 | | Compound Data | | Melting point | 31.50 °C | 304.65 K | | CSID | 13927 | H bond acceptors | 1 | Rule of 5 violations | 0 | | Molecular weight | 208.2552 | H bond donors | 0 | ACD/LogP | 4.45 | | Phase 25 °C | solid | Rotatable bonds | 0 | Predicted density | 1.16 g/cm3 | | SMILES | O=C2c1c(cccc1)CCc3c2cccc3 | | STD InChIKey | BMVWCPGVLSILMU-UHFFFAOYAF | | Melting Points | | mp °C | source | |
|---|
| 33.00 | Alfa Aesar | | 30.00 | PHYSPROP |
|
|
| | | dibenzothiophene C12H8S3, 64 |
 | | Compound Data | | Melting point | 98.00 °C | 371.15 K | | CSID | 2915 | H bond acceptors | 0 | Rule of 5 violations | 0 | | Molecular weight | 184.2569 | H bond donors | 0 | ACD/LogP | 4.49 | | Phase 25 °C | solid | Rotatable bonds | 0 | Predicted density | 1.25 g/cm3 | | SMILES | c1ccc2c(c1)c3ccccc3s2 | | STD InChIKey | IYYZUPMFVPLQIF-UHFFFAOYAY | | Melting Points | | mp °C | source | |
|---|
| 99.00 | Alfa Aesar | | 97.00 | PHYSPROP |
|
|
| | | dibenzyl disulfide C14H14S23, 64 |
 | | Compound Data | | Melting point | 70.75 °C | 343.90 K | | CSID | 8662 | H bond acceptors | 0 | Rule of 5 violations | 1 | | Molecular weight | 246.391 | H bond donors | 0 | ACD/LogP | 5.35 | | Phase 25 °C | solid | Rotatable bonds | 5 | Predicted density | 1.17 g/cm3 | | SMILES | S(SCc1ccccc1)Cc2ccccc2 | | STD InChIKey | GVPWHKZIJBODOX-UHFFFAOYAF | | Melting Points | | mp °C | source | |
|---|
| 70.00 | Alfa Aesar | | 71.50 | PHYSPROP |
|
|
| | | dibenzyl ether C14H14O2, 3, 64 |
 | |
|
| | | dibenzyl phthalate C22H18O43, 64 |
 | | Compound Data | | Melting point | 42.50 °C | 315.65 K | | CSID | 191496 | H bond acceptors | 4 | Rule of 5 violations | 1 | | Molecular weight | 346.3759 | H bond donors | 0 | ACD/LogP | 5.18 | | Phase 25 °C | solid | Rotatable bonds | 8 | Predicted density | 1.21 g/cm3 | | SMILES | O=C(OCc1ccccc1)c3ccccc3C(=O)OCc2ccccc2 | | STD InChIKey | UCVPKAZCQPRWAY-UHFFFAOYAQ | | Melting Points | | mp °C | source | |
|---|
| 41.00 | Alfa Aesar | | 44.00 | PHYSPROP |
|
|
| | | dibenzyl succinate C18H18O43, 64 |
 | | Compound Data | | Melting point | 47.25 °C | 320.40 K | | CSID | 7370 | H bond acceptors | 4 | Rule of 5 violations | 0 | | Molecular weight | 298.3331 | H bond donors | 0 | ACD/LogP | 3.70 | | Phase 25 °C | solid | Rotatable bonds | 9 | Predicted density | 1.17 g/cm3 | | SMILES | O=C(OCc1ccccc1)CCC(=O)OCc2ccccc2 | | STD InChIKey | ODBOBZHTGBGYCK-UHFFFAOYAQ | | Melting Points | | mp °C | source | |
|---|
| 45.00 | Alfa Aesar | | 49.50 | PHYSPROP |
|
|
| | | dibenzyl sulfide C14H14S3, 64 |
 | | Compound Data | | Melting point | 49.25 °C | 322.40 K | | CSID | 10407 | H bond acceptors | 0 | Rule of 5 violations | 0 | | Molecular weight | 214.326 | H bond donors | 0 | ACD/LogP | 4.19 | | Phase 25 °C | solid | Rotatable bonds | 4 | Predicted density | 1.09 g/cm3 | | SMILES | S(Cc1ccccc1)Cc2ccccc2 | | STD InChIKey | LUFPJJNWMYZRQE-UHFFFAOYAV | | Melting Points | | mp °C | source | |
|---|
| 49.00 | Alfa Aesar | | 49.50 | PHYSPROP |
|
|
| | | dibenzyl sulfoxide C14H14OS48, 64 |
 | | Compound Data | | Melting point | 133.50 °C | 406.65 K | | CSID | 11618 | H bond acceptors | 1 | Rule of 5 violations | 0 | | Molecular weight | 230.3254 | H bond donors | 0 | ACD/LogP | 1.99 | | Phase 25 °C | solid | Rotatable bonds | 4 | Predicted density | 1.20 g/cm3 | | SMILES | O=S(Cc1ccccc1)Cc2ccccc2 | | STD InChIKey | HTMQZWFSTJVJEQ-UHFFFAOYAR | | Melting Points | | mp °C | source | |
|---|
| 133.00 | Karthikeyan M.; Glen R.C.; Bender A. General melting point p... | | 134.00 | PHYSPROP |
|
|
| | | dibromochloromethane CHBr2Cl2, 3, 64 |
 | |
|
| | | dibromomethane CH2Br23, 31, 61, 64 |
 | |
|
| | | dibutyl ether C8H18O2, 3, 61, 64 |
 | |
|
| | | dibutyl sulfide C8H18S3, 61, 64 |
 | | Compound Data | | Melting point | -79.90 °C | 193.25 K | | CSID | 10536 | H bond acceptors | 0 | Rule of 5 violations | 0 | | Molecular weight | 146.2935 | H bond donors | 0 | ACD/LogP | 4.08 | | Phase 25 °C | liquid/gas | Rotatable bonds | 6 | Predicted density | 0.84 g/cm3 | | SMILES | S(CCCC)CCCC | | STD InChIKey | HTIRHQRTDBPHNZ-UHFFFAOYAZ | | Melting Points | | mp °C | source | |
|---|
| -80.00 | Alfa Aesar | | -80.00 | Oxford University MSDS | | -79.70 | PHYSPROP |
|
|
| | | dibutyl sulfone C8H18O2S3, 64 |
 | | Compound Data | | Melting point | 44.50 °C | 317.65 K | | CSID | 62236 | H bond acceptors | 2 | Rule of 5 violations | 0 | | Molecular weight | 178.2923 | H bond donors | 0 | ACD/LogP | 2.00 | | Phase 25 °C | solid | Rotatable bonds | 6 | Predicted density | 0.98 g/cm3 | | SMILES | O=S(=O)(CCCC)CCCC | | STD InChIKey | AIDFJGKWTOULTC-UHFFFAOYAR | | Melting Points | | mp °C | source | |
|---|
| 44.00 | Alfa Aesar | | 45.00 | PHYSPROP |
|
|
| | | dibutylamine C8H19N3, 31, 61, 64 |
 | |
|
| | | dichlorodiethylsilane C4H10Cl2Si3, 64 |
 | | Compound Data | | Melting point | -96.75 °C | 176.40 K | | CSID | 14830 | H bond acceptors | 0 | Rule of 5 violations | 0 | | Molecular weight | 157.1137 | H bond donors | 0 | ACD/LogP | 4.25 | | Phase 25 °C | liquid/gas | Rotatable bonds | 2 | Predicted density | 1.03 g/cm3 | | SMILES | Cl[Si](Cl)(CC)CC | | STD InChIKey | BYLOHCRAPOSXLY-UHFFFAOYAW | | Melting Points | | mp °C | source | |
|---|
| -97.00 | Alfa Aesar | | -96.50 | PHYSPROP |
|
|
| | | dichloromethane CH2Cl23, 31, 61, 64 |
 | |
|
| | | dicofol C14H9Cl5O61, 64 |
 | | Compound Data | | Melting point | 78.00 °C | 351.15 K | | CSID | 7970 | H bond acceptors | 1 | Rule of 5 violations | 1 | | Molecular weight | 370.4857 | H bond donors | 1 | ACD/LogP | 5.74 | | Phase 25 °C | solid | Rotatable bonds | 3 | Predicted density | 1.53 g/cm3 | | SMILES | Clc1ccc(cc1)C(O)(c2ccc(Cl)cc2)C(Cl)(Cl)Cl | | STD InChIKey | UOAMTSKGCBMZTC-UHFFFAOYAZ | | Melting Points | | mp °C | source | |
|---|
| 78.50 | Oxford University MSDS | | 77.50 | PHYSPROP |
|
|
| | | dicumyl peroxide C18H22O261, 64 |
 | | Compound Data | | Melting point | 40.30 °C | 313.45 K | | CSID | 6389 | H bond acceptors | 2 | Rule of 5 violations | 1 | | Molecular weight | 270.3661 | H bond donors | 0 | ACD/LogP | 5.71 | | Phase 25 °C | solid | Rotatable bonds | 5 | Predicted density | 1.03 g/cm3 | | SMILES | O(OC(c1ccccc1)(C)C)C(c2ccccc2)(C)C | | STD InChIKey | XMNIXWIUMCBBBL-UHFFFAOYAA | | Melting Points | | mp °C | source | |
|---|
| 40.00 | Oxford University MSDS | | 40.60 | PHYSPROP |
|
|
| | | dicyandiamide C2H4N43, 61, 64 |
 | | Compound Data | | Melting point | 209.67 °C | 482.82 K | | CSID | 9611 | H bond acceptors | 4 | Rule of 5 violations | 0 | | Molecular weight | 84.08 | H bond donors | 4 | ACD/LogP | -1.15 | | Phase 25 °C | solid | Rotatable bonds | 0 | Predicted density | 1.42 g/cm3 | | SMILES | N#C\N=C(/N)N | | STD InChIKey | QGBSISYHAICWAH-UHFFFAOYAY | | Melting Points | | mp °C | source | |
|---|
| 210.00 | Alfa Aesar | | 208.00 | Oxford University MSDS | | 211.00 | PHYSPROP |
|
|
| | | dicyclohexylamine C12H23N2, 3, 61, 64 |
 | |
|
| | | diethoxymethane C5H12O23, 64 |
 | | Compound Data | | Melting point | -66.25 °C | 206.90 K | | CSID | 9630 | H bond acceptors | 2 | Rule of 5 violations | 0 | | Molecular weight | 104.1476 | H bond donors | 0 | ACD/LogP | 0.80 | | Phase 25 °C | liquid/gas | Rotatable bonds | 4 | Predicted density | 0.84 g/cm3 | | SMILES | O(CC)COCC | | STD InChIKey | KLKFAASOGCDTDT-UHFFFAOYAH | | Melting Points | | mp °C | source | |
|---|
| -66.00 | Alfa Aesar | | -66.50 | PHYSPROP |
|
|
| | | diethyl acetamidomalonate C9H15NO53, 64 |
 | | Compound Data | | Melting point | 97.15 °C | 370.30 K | | CSID | 13422 | H bond acceptors | 6 | Rule of 5 violations | 0 | | Molecular weight | 217.2191 | H bond donors | 1 | ACD/LogP | 0.36 | | Phase 25 °C | solid | Rotatable bonds | 7 | Predicted density | 1.14 g/cm3 | | SMILES | O=C(NC(C(=O)OCC)C(=O)OCC)C | | STD InChIKey | ISOLMABRZPQKOV-UHFFFAOYAP | | Melting Points | | mp °C | source | |
|---|
| 98.00 | Alfa Aesar | | 96.30 | PHYSPROP |
|
|
| | | diethyl acetylenedicarboxylate C8H10O43, 64 |
 | | Compound Data | | Melting point | 1.75 °C | 274.90 K | | CSID | 63002 | H bond acceptors | 4 | Rule of 5 violations | 0 | | Molecular weight | 170.1626 | H bond donors | 0 | ACD/LogP | 2.06 | | Phase 25 °C | liquid/gas | Rotatable bonds | 5 | Predicted density | 1.13 g/cm3 | | SMILES | CCOC(=O)C#CC(=O)OCC | | STD InChIKey | STRNXFOUBFLVIN-UHFFFAOYAZ | | Melting Points | | mp °C | source | |
|---|
| 2.00 | Alfa Aesar | | 1.50 | PHYSPROP |
|
|
| | | diethyl adipate C10H18O42, 3, 64 |
 | |
|
| | | diethyl benzylidenemalonate C14H16O43, 64 |
 | | Compound Data | | Melting point | 31.00 °C | 304.15 K | | CSID | 85490 | H bond acceptors | 4 | Rule of 5 violations | 0 | | Molecular weight | 248.2744 | H bond donors | 0 | ACD/LogP | 3.10 | | Phase 25 °C | solid | Rotatable bonds | 7 | Predicted density | 1.13 g/cm3 | | SMILES | O=C(OCC)C(/C(=O)OCC)=C\c1ccccc1 | | STD InChIKey | VUWPIBNKJSEYIN-UHFFFAOYAT | | Melting Points | | mp °C | source | |
|---|
| 30.00 | Alfa Aesar | | 32.00 | PHYSPROP |
|
|
| | | diethyl disulfide C4H10S23, 64 |
 | | Compound Data | | Melting point | -101.75 °C | 171.40 K | | CSID | 7786 | H bond acceptors | 0 | Rule of 5 violations | 0 | | Molecular weight | 122.2522 | H bond donors | 0 | ACD/LogP | 2.83 | | Phase 25 °C | liquid/gas | Rotatable bonds | 3 | Predicted density | 1.00 g/cm3 | | SMILES | S(SCC)CC | | STD InChIKey | CETBSQOFQKLHHZ-UHFFFAOYAU | | Melting Points | | mp °C | source | |
|---|
| -102.00 | Alfa Aesar | | -101.50 | PHYSPROP |
|
|
| | | diethyl ether C4H10O3, 4, 61, 64 |
 | |
|
| | | diethyl formamidomalonate C8H13NO53, 64 |
 | | Compound Data | | Melting point | 50.75 °C | 323.90 K | | CSID | 72806 | H bond acceptors | 6 | Rule of 5 violations | 0 | | Molecular weight | 203.1925 | H bond donors | 1 | ACD/LogP | 1.05 | | Phase 25 °C | solid | Rotatable bonds | 7 | Predicted density | 1.17 g/cm3 | | SMILES | O=C(OCC)C(C(=O)OCC)NC=O | | STD InChIKey | PFLHGSJLYNJIOF-UHFFFAOYAQ | | Melting Points | | mp °C | source | |
|---|
| 53.00 | Alfa Aesar | | 48.50 | PHYSPROP |
|
|
| | | diethyl maleate C8H12O42, 3, 61, 64 |
 | |
|
| | | diethyl maleate C8H18O53, 32, 61, 64 |
 | | Compound Data | | Melting point | -5.60 °C | 267.55 K | | CSID | 7908 | H bond acceptors | 5 | Rule of 5 violations | 0 | | Molecular weight | 194.2255 | H bond donors | 2 | ACD/LogP | -2.23 | | Phase 25 °C | liquid/gas | Rotatable bonds | 12 | Predicted density | 1.11 g/cm3 | | SMILES | OCCOCCOCCOCCO | | STD InChIKey | UWHCKJMYHZGTIT-UHFFFAOYAB | | Melting Points | | mp °C | source | |
|---|
| -4.00 | Alfa Aesar | | -6.20 | DrugBank | | -6.00 | Oxford University MSDS | | -6.20 | PHYSPROP |
|
|
| | | diethyl oxalate C6H10O42, 3, 61, 64 |
 | |
|
| | | diethyl phenylmalonate C13H16O42, 3, 64 |
 | |
|
| | | diethyl sebacate C14H26O42, 64 |
 | | Compound Data | | Melting point | 3.50 °C | 276.65 K | | CSID | 7758 | H bond acceptors | 4 | Rule of 5 violations | 0 | | Molecular weight | 258.3538 | H bond donors | 0 | ACD/LogP | 3.85 | | Phase 25 °C | liquid/gas | Rotatable bonds | 13 | Predicted density | 0.97 g/cm3 | | SMILES | O=C(OCC)CCCCCCCCC(=O)OCC | | STD InChIKey | ONKUXPIBXRRIDU-UHFFFAOYAF | | Melting Points | | mp °C | source | |
|---|
| 2.00 | Aldrich Chemical Company; Aldrich Catalog-Handbook of Fine C... | | 5.00 | PHYSPROP |
|
|
| | | diethyl succinate C8H14O42, 3, 64 |
 | |
|
| | | diethyl sulfate C4H10O4S3, 61, 64 |
 | | Compound Data | | Melting point | -24.33 °C | 248.82 K | | CSID | 5931 | H bond acceptors | 4 | Rule of 5 violations | 0 | | Molecular weight | 154.1848 | H bond donors | 0 | ACD/LogP | 1.14 | | Phase 25 °C | liquid/gas | Rotatable bonds | 4 | Predicted density | 1.20 g/cm3 | | SMILES | O=S(=O)(OCC)OCC | | STD InChIKey | DENRZWYUOJLTMF-UHFFFAOYAR | | Melting Points | | mp °C | source | |
|---|
| -25.00 | Alfa Aesar | | -24.00 | Oxford University MSDS | | -24.00 | PHYSPROP |
|
|
| | | diethyl sulfide C4H10S3, 4, 64 |
 | |
|
| | | diethyl terephthalate C12H14O43, 64 |
 | | Compound Data | | Melting point | 44.50 °C | 317.65 K | | CSID | 11972 | H bond acceptors | 4 | Rule of 5 violations | 0 | | Molecular weight | 222.2372 | H bond donors | 0 | ACD/LogP | 3.54 | | Phase 25 °C | solid | Rotatable bonds | 6 | Predicted density | 1.12 g/cm3 | | SMILES | O=C(OCC)c1ccc(C(=O)OCC)cc1 | | STD InChIKey | ONIHPYYWNBVMID-UHFFFAOYAS | | Melting Points | | mp °C | source | |
|---|
| 45.00 | Alfa Aesar | | 44.00 | PHYSPROP |
|
|
| | | diethylene glycol C4H10O33, 64 |
 | | Compound Data | | Melting point | -10.20 °C | 262.95 K | | CSID | 13835180 | H bond acceptors | 3 | Rule of 5 violations | 0 | | Molecular weight | 106.1204 | H bond donors | 2 | ACD/LogP | 0.00 | | Phase 25 °C | liquid/gas | Rotatable bonds | 6 | Predicted density | 1.11 g/cm3 | | SMILES | C(COCCO)O | | STD InChIKey | MTHSVFCYNBDYFN-UHFFFAOYAK | | Melting Points | | mp °C | source | |
|---|
| -10.00 | Alfa Aesar | | -10.40 | PHYSPROP |
|
|
| | | diethylenetriamine C4H13N33, 61, 64 |
 | | Compound Data | | Melting point | -38.00 °C | 235.15 K | | CSID | 13835401 | H bond acceptors | 3 | Rule of 5 violations | 1 | | Molecular weight | 103.1661 | H bond donors | 5 | ACD/LogP | 0.00 | | Phase 25 °C | liquid/gas | Rotatable bonds | 6 | Predicted density | 0.93 g/cm3 | | SMILES | C(CNCCN)N | | STD InChIKey | RPNUMPOLZDHAAY-UHFFFAOYAH | | Melting Points | | mp °C | source | |
|---|
| -40.00 | Alfa Aesar | | -35.00 | Oxford University MSDS | | -39.00 | PHYSPROP |
|
|
| | | diethylsilane C4H12Si3, 64 |
 | | Compound Data | | Melting point | -133.15 °C | 140.00 K | | CSID | 61632 | H bond acceptors | 0 | Rule of 5 violations | NA | | Molecular weight | 88.2236 | H bond donors | 0 | ACD/LogP | 0.00 | | Phase 25 °C | liquid/gas | Rotatable bonds | 2 | Predicted density | 0.00 g/cm3 | | SMILES | CC[SiH2]CC | | STD InChIKey | UCXUKTLCVSGCNR-UHFFFAOYAD | | Melting Points | | mp °C | source | |
|---|
| -132.00 | Alfa Aesar | | -134.30 | PHYSPROP |
|
|
| | | diethylsulfone C4H10O2S3, 64 |
 | | Compound Data | | Melting point | 72.75 °C | 345.90 K | | CSID | 62226 | H bond acceptors | 2 | Rule of 5 violations | 0 | | Molecular weight | 122.186 | H bond donors | 0 | ACD/LogP | -0.13 | | Phase 25 °C | solid | Rotatable bonds | 2 | Predicted density | 1.06 g/cm3 | | SMILES | O=S(=O)(CC)CC | | STD InChIKey | MBDUIEKYVPVZJH-UHFFFAOYAH | | Melting Points | | mp °C | source | |
|---|
| 72.00 | Alfa Aesar | | 73.50 | PHYSPROP |
|
|
| | | diflunisal C13H8F2O332, 35, 44, 56, 64 |
 | |
|
| | | diglycolic acid C4H6O53, 64 |
 | | Compound Data | | Melting point | 145.50 °C | 418.65 K | | CSID | 7797 | H bond acceptors | 5 | Rule of 5 violations | 0 | | Molecular weight | 134.0874 | H bond donors | 2 | ACD/LogP | -2.09 | | Phase 25 °C | solid | Rotatable bonds | 4 | Predicted density | 1.49 g/cm3 | | SMILES | O=C(O)COCC(=O)O | | STD InChIKey | QEVGZEDELICMKH-UHFFFAOYAA | | Melting Points | | mp °C | source | |
|---|
| 143.00 | Alfa Aesar | | 148.00 | PHYSPROP |
|
|
| | | diglyme C6H14O32, 3, 64 |
 | |
|
| | | dihydrobenzofuran C8H8O3, 64 |
 | | Compound Data | | Melting point | -21.25 °C | 251.90 K | | CSID | 21106522 | H bond acceptors | 1 | Rule of 5 violations | 0 | | Molecular weight | 120.1485 | H bond donors | 0 | ACD/LogP | 2.14 | | Phase 25 °C | liquid/gas | Rotatable bonds | 0 | Predicted density | 1.10 g/cm3 | | SMILES | c1cccc2OCCc12 | | STD InChIKey | HBEDSQVIWPRPAY-UHFFFAOYAI | | Melting Points | | mp °C | source | |
|---|
| -21.00 | Alfa Aesar | | -21.50 | PHYSPROP |
|
|
| | | diiodomethane CH2I23, 31, 61, 64 |
 | |
|
| | | diisobutylamine C8H19N3, 64 |
 | | Compound Data | | Melting point | -75.25 °C | 197.90 K | | CSID | 7794 | H bond acceptors | 1 | Rule of 5 violations | 0 | | Molecular weight | 129.2432 | H bond donors | 1 | ACD/LogP | 2.39 | | Phase 25 °C | liquid/gas | Rotatable bonds | 4 | Predicted density | 0.76 g/cm3 | | SMILES | N(CC(C)C)CC(C)C | | STD InChIKey | NJBCRXCAPCODGX-UHFFFAOYAJ | | Melting Points | | mp °C | source | |
|---|
| -77.00 | Alfa Aesar | | -73.50 | PHYSPROP |
|
|
| | | diisopropyl ether C6H14O4, 64 |
 | | Compound Data | | Melting point | -86.40 °C | 186.75 K | | CSID | 7626 | H bond acceptors | 1 | Rule of 5 violations | 0 | | Molecular weight | 102.1748 | H bond donors | 0 | ACD/LogP | 1.68 | | Phase 25 °C | liquid/gas | Rotatable bonds | 2 | Predicted density | 0.76 g/cm3 | | SMILES | O(C(C)C)C(C)C | | STD InChIKey | ZAFNJMIOTHYJRJ-UHFFFAOYAC | | Melting Points | | mp °C | source | |
|---|
| -86.00 | American Petroleum Institute. Research Project 44; Selected ... | | -86.80 | PHYSPROP |
|
|
| | | diisopropylethylamine C8H19N3, 61 |
 | | Compound Data | | Melting point | -48.00 °C | 225.15 K | | CSID | 73565 | H bond acceptors | 1 | Rule of 5 violations | 0 | | Molecular weight | 129.2432 | H bond donors | 0 | ACD/LogP | 2.35 | | Phase 25 °C | liquid/gas | Rotatable bonds | 3 | Predicted density | 0.77 g/cm3 | | SMILES | N(C(C)C)(C(C)C)CC | | STD InChIKey | JGFZNNIVVJXRND-UHFFFAOYAV | | Melting Points | | mp °C | source | |
|---|
| -46.00 | Alfa Aesar | | -50.00 | Oxford University MSDS |
|
|
| | | dimethoate C5H12NO3PS261, 64 |
 | | Compound Data | | Melting point | 51.75 °C | 324.90 K | | CSID | 2973 | H bond acceptors | 4 | Rule of 5 violations | 0 | | Molecular weight | 229.2574 | H bond donors | 1 | ACD/LogP | 0.48 | | Phase 25 °C | solid | Rotatable bonds | 5 | Predicted density | 1.30 g/cm3 | | SMILES | O=C(NC)CSP(=S)(OC)OC | | STD InChIKey | MCWXGJITAZMZEV-UHFFFAOYAB | | Melting Points | | mp °C | source | |
|---|
| 51.50 | Oxford University MSDS | | 52.00 | PHYSPROP |
|
|
| | | dimethoxymethane C3H8O22, 3, 61, 64 |
 | |
|
| | | dimethyl 1,10-decanedicarboxylate C14H26O43, 64 |
 | | Compound Data | | Melting point | 30.95 °C | 304.10 K | | CSID | 67007 | H bond acceptors | 4 | Rule of 5 violations | 0 | | Molecular weight | 258.3538 | H bond donors | 0 | ACD/LogP | 3.85 | | Phase 25 °C | solid | Rotatable bonds | 13 | Predicted density | 0.97 g/cm3 | | SMILES | O=C(OC)CCCCCCCCCCC(=O)OC | | STD InChIKey | IZMOTZDBVPMOFE-UHFFFAOYAP | | Melting Points | | mp °C | source | |
|---|
| 30.00 | Alfa Aesar | | 31.90 | PHYSPROP |
|
|
| | | dimethyl adipate C8H14O42, 3, 61, 64 |
 | |
|
| | | dimethyl carbonate C3H6O32, 3, 61, 64 |
 | |
|
| | | dimethyl ether C2H6O61, 64 |
 | | Compound Data | | Melting point | -139.75 °C | 133.40 K | | CSID | 7956 | H bond acceptors | 1 | Rule of 5 violations | 0 | | Molecular weight | 46.0684 | H bond donors | 0 | ACD/LogP | 0.02 | | Phase 25 °C | liquid/gas | Rotatable bonds | 0 | Predicted density | 0.68 g/cm3 | | SMILES | COC | | STD InChIKey | LCGLNKUTAGEVQW-UHFFFAOYAU | | Melting Points | | mp °C | source | |
|---|
| -138.00 | Oxford University MSDS | | -141.50 | PHYSPROP |
|
|
| | | dimethyl isophthalate C10H10O43, 64 |
 | | Compound Data | | Melting point | 68.25 °C | 341.40 K | | CSID | 14360 | H bond acceptors | 4 | Rule of 5 violations | 0 | | Molecular weight | 194.184 | H bond donors | 0 | ACD/LogP | 2.45 | | Phase 25 °C | solid | Rotatable bonds | 4 | Predicted density | 1.18 g/cm3 | | SMILES | O=C(OC)c1cccc(C(=O)OC)c1 | | STD InChIKey | VNGOYPQMJFJDLV-UHFFFAOYAW | | Melting Points | | mp °C | source | |
|---|
| 69.00 | Alfa Aesar | | 67.50 | PHYSPROP |
|
|
| | | dimethyl itaconate C7H10O43, 64 |
 | | Compound Data | | Melting point | 37.00 °C | 310.15 K | | CSID | 62453 | H bond acceptors | 4 | Rule of 5 violations | 0 | | Molecular weight | 158.1519 | H bond donors | 0 | ACD/LogP | 0.62 | | Phase 25 °C | solid | Rotatable bonds | 5 | Predicted density | 1.08 g/cm3 | | SMILES | COC(=O)CC(=C)C(=O)OC | | STD InChIKey | ZWWQRMFIZFPUAA-UHFFFAOYAN | | Melting Points | | mp °C | source | |
|---|
| 36.00 | Alfa Aesar | | 38.00 | PHYSPROP |
|
|
| | | dimethyl malonate C5H8O42, 3, 61, 64 |
 | |
|
| | | dimethyl oxalate C4H6O42, 3, 61, 64 |
 | |
|
| | | dimethyl parathion C8H10NO5PS61, 64 |
 | | Compound Data | | Melting point | 35.75 °C | 308.90 K | | CSID | 3987 | H bond acceptors | 6 | Rule of 5 violations | 0 | | Molecular weight | 263.2075 | H bond donors | 0 | ACD/LogP | 2.78 | | Phase 25 °C | solid | Rotatable bonds | 5 | Predicted density | 1.41 g/cm3 | | SMILES | S=P(Oc1ccc(cc1)[N+]([O-])=O)(OC)OC | | STD InChIKey | RLBIQVVOMOPOHC-UHFFFAOYAW | | Melting Points | | mp °C | source | |
|---|
| 36.00 | Oxford University MSDS | | 35.50 | PHYSPROP |
|
|
| | | dimethyl phthalate C10H10O42, 3, 61, 64 |
 | |
|
| | | dimethyl succinate C6H10O42, 3, 61, 64 |
 | |
|
| | | dimethyl sulfate C2H6O4S61, 64 |
 | | Compound Data | | Melting point | -29.50 °C | 243.65 K | | CSID | 6252 | H bond acceptors | 4 | Rule of 5 violations | 0 | | Molecular weight | 126.1316 | H bond donors | 0 | ACD/LogP | 0.12 | | Phase 25 °C | liquid/gas | Rotatable bonds | 2 | Predicted density | 1.32 g/cm3 | | SMILES | COS(=O)(=O)OC | | STD InChIKey | VAYGXNSJCAHWJZ-UHFFFAOYAK | | Melting Points | | mp °C | source | |
|---|
| -32.00 | Oxford University MSDS | | -27.00 | PHYSPROP |
|
|
| | | dimethyl sulfone C2H6O2S3, 61, 64 |
 | | Compound Data | | Melting point | 109.33 °C | 382.48 K | | CSID | 5978 | H bond acceptors | 2 | Rule of 5 violations | 0 | | Molecular weight | 94.1328 | H bond donors | 0 | ACD/LogP | -1.19 | | Phase 25 °C | solid | Rotatable bonds | 0 | Predicted density | 1.14 g/cm3 | | SMILES | O=S(=O)(C)C | | STD InChIKey | HHVIBTZHLRERCL-UHFFFAOYAG | | Melting Points | | mp °C | source | |
|---|
| 110.00 | Alfa Aesar | | 109.00 | Oxford University MSDS | | 109.00 | PHYSPROP |
|
|
| | | dimethyl sulfoxide C2H6OS2, 3, 32, 61, 64 |
 | |
|
| | | dimethyl terephthalate C10H10O42, 3, 61, 64 |
 | |
|
| | | dimethyl tetrachloroterephthalate C10H6Cl4O43, 64 |
 | | Compound Data | | Melting point | 156.00 °C | 429.15 K | | CSID | 2839 | H bond acceptors | 4 | Rule of 5 violations | 0 | | Molecular weight | 331.9642 | H bond donors | 0 | ACD/LogP | 3.48 | | Phase 25 °C | solid | Rotatable bonds | 4 | Predicted density | 1.56 g/cm3 | | SMILES | Clc1c(C(=O)OC)c(Cl)c(Cl)c(C(=O)OC)c1Cl | | STD InChIKey | NPOJQCVWMSKXDN-UHFFFAOYAS | | Melting Points | | mp °C | source | |
|---|
| 157.00 | Alfa Aesar | | 155.00 | PHYSPROP |
|
|
| | | dimethyl-POPOP C26H20N2O23, 61 |
 | | Compound Data | | Melting point | 233.00 °C | 506.15 K | | CSID | 68961 | H bond acceptors | 4 | Rule of 5 violations | 1 | | Molecular weight | 392.4492 | H bond donors | 0 | ACD/LogP | 7.37 | | Phase 25 °C | solid | Rotatable bonds | 4 | Predicted density | 1.17 g/cm3 | | SMILES | n1c(c(oc1c4ccc(c2nc(c(o2)c3ccccc3)C)cc4)c5ccccc5)C | | STD InChIKey | VLDFXDUAENINOO-UHFFFAOYAN | | Melting Points | | mp °C | source | |
|---|
| 234.00 | Alfa Aesar | | 232.00 | Oxford University MSDS |
|
|
| | | dimethylamine C2H7N31, 61, 64 |
 | |
|
| | | diphenic acid C14H10O43, 64 |
 | | Compound Data | | Melting point | 231.25 °C | 504.40 K | | CSID | 9795 | H bond acceptors | 4 | Rule of 5 violations | 0 | | Molecular weight | 242.2268 | H bond donors | 2 | ACD/LogP | 1.74 | | Phase 25 °C | solid | Rotatable bonds | 3 | Predicted density | 1.35 g/cm3 | | SMILES | c1ccc(c(c1)c2ccccc2C(=O)O)C(=O)O | | STD InChIKey | GWZCCUDJHOGOSO-UHFFFAOYAZ | | Melting Points | | mp °C | source | |
|---|
| 229.00 | Alfa Aesar | | 233.50 | PHYSPROP |
|
|
| | | diphenolic acid C17H18O43, 64 |
 | | Compound Data | | Melting point | 172.25 °C | 445.40 K | | CSID | 60518 | H bond acceptors | 4 | Rule of 5 violations | 0 | | Molecular weight | 286.3224 | H bond donors | 3 | ACD/LogP | 2.89 | | Phase 25 °C | solid | Rotatable bonds | 7 | Predicted density | 1.26 g/cm3 | | SMILES | O=C(O)CCC(c1ccc(O)cc1)(c2ccc(O)cc2)C | | STD InChIKey | VKOUCJUTMGHNOR-UHFFFAOYAX | | Melting Points | | mp °C | source | |
|---|
| 173.00 | Alfa Aesar | | 171.50 | PHYSPROP |
|
|
| | | diphenyl carbonate C13H10O33, 61, 64 |
 | | Compound Data | | Melting point | 80.33 °C | 353.48 K | | CSID | 7315 | H bond acceptors | 3 | Rule of 5 violations | 0 | | Molecular weight | 214.2167 | H bond donors | 0 | ACD/LogP | 3.28 | | Phase 25 °C | solid | Rotatable bonds | 4 | Predicted density | 1.20 g/cm3 | | SMILES | O=C(Oc1ccccc1)Oc2ccccc2 | | STD InChIKey | ROORDVPLFPIABK-UHFFFAOYAY | | Melting Points | | mp °C | source | |
|---|
| 79.00 | Alfa Aesar | | 79.00 | Oxford University MSDS | | 83.00 | PHYSPROP |
|
|
| | | diphenyl disulfide C12H10S23, 64 |
 | | Compound Data | | Melting point | 61.00 °C | 334.15 K | | CSID | 12861 | H bond acceptors | 0 | Rule of 5 violations | 0 | | Molecular weight | 218.3378 | H bond donors | 0 | ACD/LogP | 4.41 | | Phase 25 °C | solid | Rotatable bonds | 3 | Predicted density | 1.22 g/cm3 | | SMILES | c1ccc(cc1)SSc2ccccc2 | | STD InChIKey | GUUVPOWQJOLRAS-UHFFFAOYAY | | Melting Points | | mp °C | source | |
|---|
| 60.00 | Alfa Aesar | | 62.00 | PHYSPROP |
|
|
| | | diphenyl ether C12H10O2, 3, 61, 64 |
 | |
|
| | | diphenyl phosphoric acid C12H11O4P3, 64 |
 | | Compound Data | | Melting point | 66.75 °C | 339.90 K | | CSID | 12722 | H bond acceptors | 4 | Rule of 5 violations | 0 | | Molecular weight | 250.1871 | H bond donors | 1 | ACD/LogP | 1.34 | | Phase 25 °C | solid | Rotatable bonds | 4 | Predicted density | 1.34 g/cm3 | | SMILES | O=P(Oc1ccccc1)(Oc2ccccc2)O | | STD InChIKey | ASMQGLCHMVWBQR-UHFFFAOYAM | | Melting Points | | mp °C | source | |
|---|
| 66.00 | Alfa Aesar | | 67.50 | PHYSPROP |
|
|
| | | diphenyl phthalate C20H14O43, 64 |
 | | Compound Data | | Melting point | 74.00 °C | 347.15 K | | CSID | 6520 | H bond acceptors | 4 | Rule of 5 violations | 0 | | Molecular weight | 318.3228 | H bond donors | 0 | ACD/LogP | 4.41 | | Phase 25 °C | solid | Rotatable bonds | 6 | Predicted density | 1.24 g/cm3 | | SMILES | O=C(Oc1ccccc1)c3ccccc3C(=O)Oc2ccccc2 | | STD InChIKey | DWNAQMUDCDVSLT-UHFFFAOYAG | | Melting Points | | mp °C | source | |
|---|
| 75.00 | Alfa Aesar | | 73.00 | PHYSPROP |
|
|
| | | diphenyl sulfone C12H10O2S3, 64 |
 | | Compound Data | | Melting point | 128.25 °C | 401.40 K | | CSID | 29117 | H bond acceptors | 2 | Rule of 5 violations | 0 | | Molecular weight | 218.2716 | H bond donors | 0 | ACD/LogP | 2.40 | | Phase 25 °C | solid | Rotatable bonds | 2 | Predicted density | 1.23 g/cm3 | | SMILES | O=S(=O)(c1ccccc1)c2ccccc2 | | STD InChIKey | KZTYYGOKRVBIMI-UHFFFAOYAU | | Melting Points | | mp °C | source | |
|---|
| 128.00 | Alfa Aesar | | 128.50 | PHYSPROP |
|
|
| | | diphenyl sulfoxide C12H10OS2, 3, 64 |
 | |
|
| | | diphenylacetic acid C14H12O23, 35, 48, 64 |
 | |
|
| | | diphenylacetonitrile C14H11N3, 64 |
 | | Compound Data | | Melting point | 74.15 °C | 347.30 K | | CSID | 6576 | H bond acceptors | 1 | Rule of 5 violations | 0 | | Molecular weight | 193.2438 | H bond donors | 0 | ACD/LogP | 3.30 | | Phase 25 °C | solid | Rotatable bonds | 2 | Predicted density | 1.08 g/cm3 | | SMILES | N#CC(c1ccccc1)c2ccccc2 | | STD InChIKey | NEBPTMCRLHKPOB-UHFFFAOYAI | | Melting Points | | mp °C | source | |
|---|
| 74.00 | Alfa Aesar | | 74.30 | PHYSPROP |
|
|
| | | diphenylacetyl chloride C14H11ClO3, 64 |
 | | Compound Data | | Melting point | 54.75 °C | 327.90 K | | CSID | 67212 | H bond acceptors | 1 | Rule of 5 violations | 0 | | Molecular weight | 230.6895 | H bond donors | 0 | ACD/LogP | 3.96 | | Phase 25 °C | solid | Rotatable bonds | 3 | Predicted density | 1.19 g/cm3 | | SMILES | O=C(Cl)C(c1ccccc1)c2ccccc2 | | STD InChIKey | MSYLETHDEIJMAF-UHFFFAOYAP | | Melting Points | | mp °C | source | |
|---|
| 53.00 | Alfa Aesar | | 56.50 | PHYSPROP |
|
|
| | | diphenylacetylene C14H102, 3, 48, 61, 64 |
 | |
|
| | | diphenylamine C12H11N3, 61, 64, 70 |
 | |
|
| | | diphenylcarbamyl chloride C13H10ClNO3, 64 |
 | | Compound Data | | Melting point | 83.50 °C | 356.65 K | | CSID | 59164 | H bond acceptors | 2 | Rule of 5 violations | 0 | | Molecular weight | 231.6776 | H bond donors | 0 | ACD/LogP | 3.75 | | Phase 25 °C | solid | Rotatable bonds | 2 | Predicted density | 1.27 g/cm3 | | SMILES | O=C(Cl)N(c1ccccc1)c2ccccc2 | | STD InChIKey | XNBKKRFABABBPM-UHFFFAOYAY | | Melting Points | | mp °C | source | |
|---|
| 84.00 | Alfa Aesar | | 83.00 | PHYSPROP |
|
|
| | | diphenylmethanol C13H12O2, 3, 61, 64 |
 | |
|
| | | diphenylphosphinic acid C12H11O2P3, 64 |
 | | Compound Data | | Melting point | 194.50 °C | 467.65 K | | CSID | 14810 | H bond acceptors | 2 | Rule of 5 violations | 0 | | Molecular weight | 218.1883 | H bond donors | 1 | ACD/LogP | 1.61 | | Phase 25 °C | solid | Rotatable bonds | 2 | Predicted density | 1.25 g/cm3 | | SMILES | O=P(O)(c1ccccc1)c2ccccc2 | | STD InChIKey | BEQVQKJCLJBTKZ-UHFFFAOYAV | | Melting Points | | mp °C | source | |
|---|
| 195.00 | Alfa Aesar | | 194.00 | PHYSPROP |
|
|
| | | disulfiram C10H20N2S43, 44, 61, 64 |
 | |
|
| | | dithiocyanomethane C3H2N2S23, 61 |
 | | Compound Data | | Melting point | 105.50 °C | 378.65 K | | CSID | 21349 | H bond acceptors | 2 | Rule of 5 violations | 0 | | Molecular weight | 130.1914 | H bond donors | 0 | ACD/LogP | 0.80 | | Phase 25 °C | solid | Rotatable bonds | 2 | Predicted density | 1.40 g/cm3 | | SMILES | N#CSCSC#N | | STD InChIKey | JWZXKXIUSSIAMR-UHFFFAOYAO | | Melting Points | | mp °C | source | |
|---|
| 105.00 | Alfa Aesar | | 106.00 | Oxford University MSDS |
|
|
| | | dithranol C14H10O33, 61, 64 |
 | | Compound Data | | Melting point | 179.67 °C | 452.82 K | | CSID | 2117 | H bond acceptors | 3 | Rule of 5 violations | 0 | | Molecular weight | 226.2274 | H bond donors | 2 | ACD/LogP | 4.16 | | Phase 25 °C | solid | Rotatable bonds | 2 | Predicted density | 1.42 g/cm3 | | SMILES | O=C2c1c(O)cccc1Cc3c2c(O)ccc3 | | STD InChIKey | NUZWLKWWNNJHPT-UHFFFAOYAS | | Melting Points | | mp °C | source | |
|---|
| 179.00 | Alfa Aesar | | 181.00 | Oxford University MSDS | | 179.00 | PHYSPROP |
|
|
| | | diuron C9H10Cl2N2O3, 44, 64, 70 |
 | |
|
| | | docosane C22H463, 61, 64 |
 | | Compound Data | | Melting point | 43.80 °C | 316.95 K | | CSID | 11899 | H bond acceptors | 0 | Rule of 5 violations | 1 | | Molecular weight | 310.6006 | H bond donors | 0 | ACD/LogP | 12.45 | | Phase 25 °C | solid | Rotatable bonds | 19 | Predicted density | 0.79 g/cm3 | | SMILES | C(CCCCCCCCCCCCCCCCCC)CCC | | STD InChIKey | HOWGUJZVBDQJKV-UHFFFAOYAZ | | Melting Points | | mp °C | source | |
|---|
| 45.00 | Alfa Aesar | | 42.00 | Oxford University MSDS | | 44.40 | PHYSPROP |
|
|
| | | docosanoic acid C22H44O23, 61, 64 |
 | | Compound Data | | Melting point | 77.67 °C | 350.82 K | | CSID | 7923 | H bond acceptors | 2 | Rule of 5 violations | 1 | | Molecular weight | 340.5836 | H bond donors | 1 | ACD/LogP | 10.34 | | Phase 25 °C | solid | Rotatable bonds | 20 | Predicted density | 0.88 g/cm3 | | SMILES | O=C(O)CCCCCCCCCCCCCCCCCCCCC | | STD InChIKey | UKMSUNONTOPOIO-UHFFFAOYAN | | Melting Points | | mp °C | source | |
|---|
| 76.00 | Alfa Aesar | | 76.00 | Oxford University MSDS | | 81.00 | PHYSPROP |
|
|
| | | dodecane C12H263, 4, 32, 61, 64 |
 | |
|
| | | dodecanedioic acid C12H22O43, 61, 64 |
 | | Compound Data | | Melting point | 128.67 °C | 401.82 K | | CSID | 12213 | H bond acceptors | 4 | Rule of 5 violations | 0 | | Molecular weight | 230.3007 | H bond donors | 2 | ACD/LogP | 2.92 | | Phase 25 °C | solid | Rotatable bonds | 11 | Predicted density | 1.07 g/cm3 | | SMILES | O=C(O)CCCCCCCCCCC(=O)O | | STD InChIKey | TVIDDXQYHWJXFK-UHFFFAOYAC | | Melting Points | | mp °C | source | |
|---|
| 129.00 | Alfa Aesar | | 129.00 | Oxford University MSDS | | 128.00 | PHYSPROP |
|
|
| | | dodecyl dimethylamine N-oxide C14H31NO61, 64 |
 | | Compound Data | | Melting point | 131.50 °C | 404.65 K | | CSID | 14688 | H bond acceptors | 2 | Rule of 5 violations | 0 | | Molecular weight | 229.402 | H bond donors | 0 | ACD/LogP | 3.27 | | Phase 25 °C | solid | Rotatable bonds | 11 | Predicted density | 0.00 g/cm3 | | SMILES | [O-][N+](CCCCCCCCCCCC)(C)C | | STD InChIKey | SYELZBGXAIXKHU-UHFFFAOYAJ | | Melting Points | | mp °C | source | |
|---|
| 132.50 | Oxford University MSDS | | 130.50 | PHYSPROP |
|
|
| | | dodecyl gallate C19H30O53, 64 |
 | | Compound Data | | Melting point | 96.75 °C | 369.90 K | | CSID | 13777 | H bond acceptors | 5 | Rule of 5 violations | 1 | | Molecular weight | 338.4385 | H bond donors | 3 | ACD/LogP | 7.38 | | Phase 25 °C | solid | Rotatable bonds | 16 | Predicted density | 1.11 g/cm3 | | SMILES | O=C(OCCCCCCCCCCCC)c1cc(O)c(O)c(O)c1 | | STD InChIKey | RPWFJAMTCNSJKK-UHFFFAOYAC | | Melting Points | | mp °C | source | |
|---|
| 97.00 | Alfa Aesar | | 96.50 | PHYSPROP |
|
|
| | | domperidone C22H24ClN5O232, 61, 64 |
 | | Compound Data | | Melting point | 240.83 °C | 513.98 K | | CSID | 3039 | H bond acceptors | 7 | Rule of 5 violations | 0 | | Molecular weight | 425.9113 | H bond donors | 2 | ACD/LogP | 4.50 | | Phase 25 °C | solid | Rotatable bonds | 5 | Predicted density | 1.34 g/cm3 | | SMILES | Clc1cc2c(cc1)N(C(=O)N2)C5CCN(CCCN4c3ccccc3NC4=O)CC5 | | STD InChIKey | FGXWKSZFVQUSTL-UHFFFAOYAW | | Melting Points | | mp °C | source | |
|---|
| 242.50 | DrugBank | | 237.50 | Oxford University MSDS | | 242.50 | PHYSPROP |
|
|
| | | dotriacontane C32H663, 64 |
 | | Compound Data | | Melting point | 69.85 °C | 343.00 K | | CSID | 10542 | H bond acceptors | 0 | Rule of 5 violations | 1 | | Molecular weight | 450.8664 | H bond donors | 0 | ACD/LogP | 17.76 | | Phase 25 °C | solid | Rotatable bonds | 29 | Predicted density | 0.81 g/cm3 | | SMILES | C(CCCCCCCCCCCCCCCCCCCCCC)CCCCCCCCC | | STD InChIKey | QHMGJGNTMQDRQA-UHFFFAOYAV | | Melting Points | | mp °C | source | |
|---|
| 70.00 | Alfa Aesar | | 69.70 | PHYSPROP |
|
|
| | | duotal C15H14O53, 64 |
 | | Compound Data | | Melting point | 88.00 °C | 361.15 K | | CSID | 10633 | H bond acceptors | 5 | Rule of 5 violations | 0 | | Molecular weight | 274.2687 | H bond donors | 0 | ACD/LogP | 2.41 | | Phase 25 °C | solid | Rotatable bonds | 6 | Predicted density | 1.21 g/cm3 | | SMILES | O=C(Oc1ccccc1OC)Oc2ccccc2OC | | STD InChIKey | ORUJFMPWKPVXLZ-UHFFFAOYAQ | | Melting Points | | mp °C | source | |
|---|
| 87.00 | Alfa Aesar | | 89.00 | PHYSPROP |
|
|
| | | epichlorohydrin C3H5ClO3, 61, 64, 64, 78 |
 | | Compound Data | | Melting point | -57.10 °C | 216.05 K | | CSID | 13837112 | H bond acceptors | 1 | Rule of 5 violations | 0 | | Molecular weight | 92.5242 | H bond donors | 0 | ACD/LogP | 0.45 | | Phase 25 °C | liquid/gas | Rotatable bonds | 1 | Predicted density | 1.21 g/cm3 | | SMILES | ClCC1CO1 | | STD InChIKey | BRLQWZUYTZBJKN-UHFFFAOYAY | | Melting Points | | mp °C | source | |
|---|
| -57.00 | Alfa Aesar | | -57.20 | PHYSPROP | | -57.10 | WDTrade | | Values not used in calculating the average melting point | | -26.00 | Oxford University MSDS1 | | -26.00 | PHYSPROP2 | | 1. unlikely to be higher mp than bromo analog at -40C JCB | | 2. unlikely to be higher mp than bromo analog at -40C JCB |
|
|
| | | erythrocentaurin C10H8O39, 48, 64 |
 | |
|
| | | ethane C2H614, 25, 40, 61, 64, 73, 83 |
 | |
|
| | | ethanethiol C2H6S3, 61, 64 |
 | | Compound Data | | Melting point | -147.93 °C | 125.22 K | | CSID | 6103 | H bond acceptors | 0 | Rule of 5 violations | 0 | | Molecular weight | 62.134 | H bond donors | 0 | ACD/LogP | 1.44 | | Phase 25 °C | liquid/gas | Rotatable bonds | 1 | Predicted density | 0.82 g/cm3 | | SMILES | CCS | | STD InChIKey | DNJIEGIFACGWOD-UHFFFAOYAW | | Melting Points | | mp °C | source | |
|---|
| -148.00 | Alfa Aesar | | -148.00 | Oxford University MSDS | | -147.80 | PHYSPROP |
|
|
| | | ethanol C2H6O4, 28, 32, 56, 61, 61, 64, 72, 81 |
 | |
|
| | | ethofenprox C25H28O361, 64 |
 | | Compound Data | | Melting point | 36.50 °C | 309.65 K | | CSID | 64377 | H bond acceptors | 3 | Rule of 5 violations | 1 | | Molecular weight | 376.488 | H bond donors | 0 | ACD/LogP | 7.34 | | Phase 25 °C | solid | Rotatable bonds | 9 | Predicted density | 1.07 g/cm3 | | SMILES | O(c1ccccc1)c2cc(ccc2)COCC(c3ccc(OCC)cc3)(C)C | | STD InChIKey | YREQHYQNNWYQCJ-UHFFFAOYAW | | Melting Points | | mp °C | source | |
|---|
| 36.00 | Oxford University MSDS | | 37.00 | PHYSPROP |
|
|
| | | ethoxyethene C4H8O3, 61, 64 |
 | | Compound Data | | Melting point | -115.27 °C | 157.88 K | | CSID | 7732 | H bond acceptors | 1 | Rule of 5 violations | 0 | | Molecular weight | 72.1057 | H bond donors | 0 | ACD/LogP | 1.04 | | Phase 25 °C | liquid/gas | Rotatable bonds | 2 | Predicted density | 0.75 g/cm3 | | SMILES | O(\C=C)CC | | STD InChIKey | FJKIXWOMBXYWOQ-UHFFFAOYAE | | Melting Points | | mp °C | source | |
|---|
| -115.00 | Alfa Aesar | | -115.00 | Oxford University MSDS | | -115.80 | PHYSPROP |
|
|
| | | ethoxymethylenemalononitrile C6H6N2O3, 64 |
 | | Compound Data | | Melting point | 65.50 °C | 338.65 K | | CSID | 60497 | H bond acceptors | 3 | Rule of 5 violations | 0 | | Molecular weight | 122.1246 | H bond donors | 0 | ACD/LogP | 0.31 | | Phase 25 °C | solid | Rotatable bonds | 2 | Predicted density | 1.07 g/cm3 | | SMILES | N#C/C(C#N)=C\OCC | | STD InChIKey | OEICGMPRFOJHKO-UHFFFAOYAG | | Melting Points | | mp °C | source | |
|---|
| 65.00 | Alfa Aesar | | 66.00 | PHYSPROP |
|
|
| | | ethyl 2-aminobenzoate C9H11NO22, 3, 61, 64 |
 | |
|
| | | ethyl 2-cyanoacrylate C6H7NO261, 64 |
 | | Compound Data | | Melting point | -22.25 °C | 250.90 K | | CSID | 73564 | H bond acceptors | 3 | Rule of 5 violations | 0 | | Molecular weight | 125.1253 | H bond donors | 0 | ACD/LogP | 0.23 | | Phase 25 °C | liquid/gas | Rotatable bonds | 3 | Predicted density | 1.05 g/cm3 | | SMILES | N#C/C(=C)C(=O)OCC | | STD InChIKey | FGBJXOREULPLGL-UHFFFAOYAG | | Melting Points | | mp °C | source | |
|---|
| -22.00 | Oxford University MSDS | | -22.50 | PHYSPROP |
|
|
| | | ethyl 2-methylthiazole-4-carboxylate C7H9NO2S3, 48 |
 | | Compound Data | | Melting point | 56.00 °C | 329.15 K | | CSID | 258907 | H bond acceptors | 3 | Rule of 5 violations | 0 | | Molecular weight | 171.2169 | H bond donors | 0 | ACD/LogP | 1.44 | | Phase 25 °C | solid | Rotatable bonds | 3 | Predicted density | 1.20 g/cm3 | | SMILES | CCOC(=O)c1csc(n1)C | | STD InChIKey | QWWPUBQHZFHZSF-UHFFFAOYAZ | | Melting Points | | mp °C | source | |
|---|
| 55.00 | Alfa Aesar | | 57.00 | Karthikeyan M.; Glen R.C.; Bender A. General melting point p... |
|
|
| | | ethyl 2-nitrobenzoate C9H9NO43, 64 |
 | | Compound Data | | Melting point | 29.00 °C | 302.15 K | | CSID | 62340 | H bond acceptors | 5 | Rule of 5 violations | 0 | | Molecular weight | 195.1721 | H bond donors | 0 | ACD/LogP | 2.19 | | Phase 25 °C | solid | Rotatable bonds | 4 | Predicted density | 1.25 g/cm3 | | SMILES | O=[N+]([O-])c1ccccc1C(=O)OCC | | STD InChIKey | CPNMAYYYYSWTIV-UHFFFAOYAJ | | Melting Points | | mp °C | source | |
|---|
| 28.00 | Alfa Aesar | | 30.00 | PHYSPROP |
|
|
| | | ethyl 3-aminopyrazole-4-carboxylate C6H9N3O23, 48 |
 | | Compound Data | | Melting point | 104.50 °C | 377.65 K | | CSID | 73512 | H bond acceptors | 5 | Rule of 5 violations | 0 | | Molecular weight | 155.1546 | H bond donors | 3 | ACD/LogP | 0.67 | | Phase 25 °C | solid | Rotatable bonds | 4 | Predicted density | 1.32 g/cm3 | | SMILES | O=C(OCC)c1cnnc1N | | STD InChIKey | YPXGHKWOJXQLQU-UHFFFAOYAP | | Melting Points | | mp °C | source | |
|---|
| 106.00 | Alfa Aesar | | 103.00 | Karthikeyan M.; Glen R.C.; Bender A. General melting point p... |
|
|
| | | ethyl 3-methylpyrazole-5-carboxylate C7H10N2O23, 48, 48 |
 | |
|
| | | ethyl 3-nitrobenzoate C9H9NO43, 64 |
 | | Compound Data | | Melting point | 44.50 °C | 317.65 K | | CSID | 21106111 | H bond acceptors | 5 | Rule of 5 violations | 0 | | Molecular weight | 195.1721 | H bond donors | 0 | ACD/LogP | 2.35 | | Phase 25 °C | solid | Rotatable bonds | 4 | Predicted density | 1.25 g/cm3 | | SMILES | O=[N+]([O-])c1cc(ccc1)C(=O)OCC | | STD InChIKey | MKBIJCPQTPFQKQ-UHFFFAOYAR | | Melting Points | | mp °C | source | |
|---|
| 42.00 | Alfa Aesar | | 47.00 | PHYSPROP |
|
|
| | | ethyl 3,4-dimethoxybenzoate C11H14O43, 64 |
 | | Compound Data | | Melting point | 43.75 °C | 316.90 K | | CSID | 21171999 | H bond acceptors | 4 | Rule of 5 violations | 0 | | Molecular weight | 210.2265 | H bond donors | 0 | ACD/LogP | 2.59 | | Phase 25 °C | solid | Rotatable bonds | 5 | Predicted density | 1.09 g/cm3 | | SMILES | COc1cc(ccc1OC)C(=O)OCC | | STD InChIKey | AYYNUGSDPRDVCH-UHFFFAOYAS | | Melting Points | | mp °C | source | |
|---|
| 44.00 | Alfa Aesar | | 43.50 | PHYSPROP |
|
|
| | | ethyl 3,5-dinitrobenzoate C9H8N2O63, 64 |
 | | Compound Data | | Melting point | 93.00 °C | 366.15 K | | CSID | 62468 | H bond acceptors | 8 | Rule of 5 violations | 0 | | Molecular weight | 240.1696 | H bond donors | 0 | ACD/LogP | 1.91 | | Phase 25 °C | solid | Rotatable bonds | 5 | Predicted density | 1.43 g/cm3 | | SMILES | O=[N+]([O-])c1cc(cc([N+]([O-])=O)c1)C(=O)OCC | | STD InChIKey | IBQREHJPMPCXQA-UHFFFAOYAK | | Melting Points | | mp °C | source | |
|---|
| 92.00 | Alfa Aesar | | 94.00 | PHYSPROP |
|
|
| | | ethyl 4-(dimethylamino)benzoate C11H15NO23, 61 |
 | | Compound Data | | Melting point | 63.75 °C | 336.90 K | | CSID | 23472 | H bond acceptors | 3 | Rule of 5 violations | 0 | | Molecular weight | 193.2423 | H bond donors | 0 | ACD/LogP | 3.14 | | Phase 25 °C | solid | Rotatable bonds | 4 | Predicted density | 1.06 g/cm3 | | SMILES | O=C(OCC)c1ccc(N(C)C)cc1 | | STD InChIKey | FZUGPQWGEGAKET-UHFFFAOYAL | | Melting Points | | mp °C | source | |
|---|
| 64.00 | Alfa Aesar | | 63.50 | Oxford University MSDS |
|
|
| | | ethyl 4-hydroxybenzoate C9H10O33, 44, 61, 64 |
 | |
|
| | | ethyl 4-methoxybenzoate C10H12O33, 7, 64 |
 | |
|
| | | ethyl 4-nitrobenzoate C9H9NO42, 3, 64 |
 | |
|
| | | ethyl 5-nitro-2-furoate C7H7NO53, 48 |
 | | Compound Data | | Melting point | 100.50 °C | 373.65 K | | CSID | 63522 | H bond acceptors | 6 | Rule of 5 violations | 0 | | Molecular weight | 185.1342 | H bond donors | 0 | ACD/LogP | 0.81 | | Phase 25 °C | solid | Rotatable bonds | 4 | Predicted density | 1.34 g/cm3 | | SMILES | O=C(OCC)c1oc([N+](=O)[O-])cc1 | | STD InChIKey | JMNXLAQKIHVFIC-UHFFFAOYAA | | Melting Points | | mp °C | source | |
|---|
| 100.00 | Alfa Aesar | | 101.00 | Karthikeyan M.; Glen R.C.; Bender A. General melting point p... |
|
|
| | | ethyl acetate C4H8O22, 3, 61, 64 |
 | |
|
| | | ethyl acetoacetate C6H10O32, 3, 61, 64 |
 | |
|
| | | ethyl acrylate C5H8O22, 3, 61, 64 |
 | |
|
| | | ethyl benzilate C16H16O33, 64 |
 | | Compound Data | | Melting point | 32.00 °C | 305.15 K | | CSID | 86894 | H bond acceptors | 3 | Rule of 5 violations | 0 | | Molecular weight | 256.2964 | H bond donors | 1 | ACD/LogP | 3.54 | | Phase 25 °C | solid | Rotatable bonds | 6 | Predicted density | 1.16 g/cm3 | | SMILES | O=C(OCC)C(O)(c1ccccc1)c2ccccc2 | | STD InChIKey | AIPVNQQMYPWQSX-UHFFFAOYAG | | Melting Points | | mp °C | source | |
|---|
| 30.00 | Alfa Aesar | | 34.00 | PHYSPROP |
|
|
| | | ethyl bis(4-chlorophenyl)(hydroxy)acetate C16H14Cl2O361, 64 |
 | | Compound Data | | Melting point | 36.50 °C | 309.65 K | | CSID | 10085 | H bond acceptors | 3 | Rule of 5 violations | 0 | | Molecular weight | 325.1866 | H bond donors | 1 | ACD/LogP | 4.73 | | Phase 25 °C | solid | Rotatable bonds | 6 | Predicted density | 1.33 g/cm3 | | SMILES | Clc1ccc(cc1)C(O)(c2ccc(Cl)cc2)C(=O)OCC | | STD InChIKey | RAPBNVDSDCTNRC-UHFFFAOYAH | | Melting Points | | mp °C | source | |
|---|
| 36.00 | Oxford University MSDS | | 37.00 | PHYSPROP |
|
|
| | | ethyl butyrate C6H12O22, 3, 61, 64 |
 | |
|
| | | ethyl chloroacetate C4H7ClO23, 61, 64 |
 | | Compound Data | | Melting point | -24.33 °C | 248.82 K | | CSID | 7465 | H bond acceptors | 2 | Rule of 5 violations | 0 | | Molecular weight | 122.5502 | H bond donors | 0 | ACD/LogP | 0.94 | | Phase 25 °C | liquid/gas | Rotatable bonds | 3 | Predicted density | 1.12 g/cm3 | | SMILES | ClCC(=O)OCC | | STD InChIKey | VEUUMBGHMNQHGO-UHFFFAOYAS | | Melting Points | | mp °C | source | |
|---|
| -26.00 | Alfa Aesar | | -26.00 | Oxford University MSDS | | -21.00 | PHYSPROP |
|
|
| | | ethyl chloroformate C3H5ClO23, 64 |
 | | Compound Data | | Melting point | -80.80 °C | 192.35 K | | CSID | 10465 | H bond acceptors | 2 | Rule of 5 violations | 0 | | Molecular weight | 108.5236 | H bond donors | 0 | ACD/LogP | 1.44 | | Phase 25 °C | liquid/gas | Rotatable bonds | 2 | Predicted density | 1.17 g/cm3 | | SMILES | ClC(=O)OCC | | STD InChIKey | RIFGWPKJUGCATF-UHFFFAOYAX | | Melting Points | | mp °C | source | |
|---|
| -81.00 | Alfa Aesar | | -80.60 | PHYSPROP |
|
|
| | | ethyl cyanoacetate C5H7NO22, 3, 64 |
 | |
|
| | | ethyl formate C3H6O22, 3, 61, 64 |
 | |
|
| | | ethyl furoate C7H8O33, 64 |
 | | Compound Data | | Melting point | 34.25 °C | 307.40 K | | CSID | 11485 | H bond acceptors | 3 | Rule of 5 violations | 0 | | Molecular weight | 140.1366 | H bond donors | 0 | ACD/LogP | 1.52 | | Phase 25 °C | solid | Rotatable bonds | 3 | Predicted density | 1.11 g/cm3 | | SMILES | O=C(OCC)c1occc1 | | STD InChIKey | NHXSTXWKZVAVOQ-UHFFFAOYAN | | Melting Points | | mp °C | source | |
|---|
| 34.00 | Alfa Aesar | | 34.50 | PHYSPROP |
|
|
| | | ethyl heptanoate C9H18O23, 7, 64 |
 | |
|
| | | ethyl indole-2-carboxylate C11H11NO23, 64 |
 | | Compound Data | | Melting point | 123.75 °C | 396.90 K | | CSID | 65903 | H bond acceptors | 3 | Rule of 5 violations | 0 | | Molecular weight | 189.2105 | H bond donors | 1 | ACD/LogP | 3.10 | | Phase 25 °C | solid | Rotatable bonds | 3 | Predicted density | 1.21 g/cm3 | | SMILES | O=C(OCC)c2cc1ccccc1n2 | | STD InChIKey | QQXQAEWRSVZPJM-UHFFFAOYAR | | Melting Points | | mp °C | source | |
|---|
| 124.00 | Alfa Aesar | | 123.50 | PHYSPROP |
|
|
| | | ethyl indole-3-acetate C12H13NO23, 64 |
 | | Compound Data | | Melting point | 43.75 °C | 316.90 K | | CSID | 12523 | H bond acceptors | 3 | Rule of 5 violations | 0 | | Molecular weight | 203.2371 | H bond donors | 1 | ACD/LogP | 2.42 | | Phase 25 °C | solid | Rotatable bonds | 4 | Predicted density | 1.19 g/cm3 | | SMILES | O=C(OCC)Cc2c1ccccc1nc2 | | STD InChIKey | HUDBDWIQSIGUDI-UHFFFAOYAQ | | Melting Points | | mp °C | source | |
|---|
| 43.00 | Alfa Aesar | | 44.50 | PHYSPROP |
|
|
| | | ethyl isobutyrate C6H12O23, 64 |
 | | Compound Data | | Melting point | -88.10 °C | 185.05 K | | CSID | 7065 | H bond acceptors | 2 | Rule of 5 violations | 0 | | Molecular weight | 116.1583 | H bond donors | 0 | ACD/LogP | 1.59 | | Phase 25 °C | liquid/gas | Rotatable bonds | 3 | Predicted density | 0.88 g/cm3 | | SMILES | O=C(OCC)C(C)C | | STD InChIKey | WDAXFOBOLVPGLV-UHFFFAOYAG | | Melting Points | | mp °C | source | |
|---|
| -88.00 | Alfa Aesar | | -88.20 | PHYSPROP |
|
|
| | | ethyl isovalerate C7H14O22, 3, 64 |
 | |
|
| | | ethyl methyl sulfide C3H8S3, 4, 64 |
 | |
|
| | | ethyl nicotinate C8H9NO23, 64 |
 | | Compound Data | | Melting point | 8.75 °C | 281.90 K | | CSID | 62402 | H bond acceptors | 3 | Rule of 5 violations | 0 | | Molecular weight | 151.1626 | H bond donors | 0 | ACD/LogP | 1.41 | | Phase 25 °C | liquid/gas | Rotatable bonds | 3 | Predicted density | 1.10 g/cm3 | | SMILES | O=C(OCC)c1cccnc1 | | STD InChIKey | XBLVHTDFJBKJLG-UHFFFAOYAV | | Melting Points | | mp °C | source | |
|---|
| 9.00 | Alfa Aesar | | 8.50 | PHYSPROP |
|
|
| | | ethyl octanoate C10H20O22, 3, 64 |
 | |
|
| | | ethyl oxanilate C10H11NO33, 64 |
 | | Compound Data | | Melting point | 66.25 °C | 339.40 K | | CSID | 66460 | H bond acceptors | 4 | Rule of 5 violations | 0 | | Molecular weight | 193.1992 | H bond donors | 1 | ACD/LogP | 1.48 | | Phase 25 °C | solid | Rotatable bonds | 4 | Predicted density | 1.22 g/cm3 | | SMILES | O=C(Nc1ccccc1)C(=O)OCC | | STD InChIKey | YDGAUBHNAKCSKF-UHFFFAOYAA | | Melting Points | | mp °C | source | |
|---|
| 67.00 | Alfa Aesar | | 65.50 | PHYSPROP |
|
|
| | | ethyl p-hydroxybenzoate C9H10O370, 72 |
 | | Compound Data | | Melting point | 115.75 °C | 388.90 K | | CSID | 8127 | H bond acceptors | 3 | Rule of 5 violations | 0 | | Molecular weight | 166.1739 | H bond donors | 1 | ACD/LogP | 2.40 | | Phase 25 °C | solid | Rotatable bonds | 4 | Predicted density | 1.17 g/cm3 | | SMILES | O=C(OCC)c1ccc(O)cc1 | | STD InChIKey | NUVBSKCKDOMJSU-UHFFFAOYSA-N | | Melting Points | | mp °C | source | |
|---|
| 116.00 | Sepassi K; Yalkowsky SH. AAPS PharmSciTech 7(1) E1-E8 (2006) | | 115.50 | Sigma-Aldrich |
|
|
| | | ethyl p-toluenesulfonate C9H12O3S2, 3, 64 |
 | |
|
| | | ethyl phenyl ether C8H10O2, 3, 64 |
 | |
|
| | | ethyl phenylacetate C10H12O23, 64 |
 | | Compound Data | | Melting point | -29.20 °C | 243.95 K | | CSID | 13885245 | H bond acceptors | 2 | Rule of 5 violations | 0 | | Molecular weight | 164.2011 | H bond donors | 0 | ACD/LogP | 2.50 | | Phase 25 °C | liquid/gas | Rotatable bonds | 4 | Predicted density | 1.03 g/cm3 | | SMILES | O=C(Cc1ccccc1)OCC | | STD InChIKey | DULCUDSUACXJJC-UHFFFAOYAN | | Melting Points | | mp °C | source | |
|---|
| -29.00 | Alfa Aesar | | -29.40 | PHYSPROP |
|
|
| | | ethyl picolinate C8H9NO23, 64 |
 | | Compound Data | | Melting point | 1.50 °C | 274.65 K | | CSID | 16377 | H bond acceptors | 3 | Rule of 5 violations | 0 | | Molecular weight | 151.1626 | H bond donors | 0 | ACD/LogP | 1.03 | | Phase 25 °C | liquid/gas | Rotatable bonds | 3 | Predicted density | 1.10 g/cm3 | | SMILES | O=C(OCC)c1ncccc1 | | STD InChIKey | FQYYIPZPELSLDK-UHFFFAOYAQ | | Melting Points | | mp °C | source | |
|---|
| 2.00 | Alfa Aesar | | 1.00 | PHYSPROP |
|
|
| | | ethyl pivalate C7H14O23, 64 |
 | | Compound Data | | Melting point | -89.75 °C | 183.40 K | | CSID | 18688 | H bond acceptors | 2 | Rule of 5 violations | 0 | | Molecular weight | 130.1849 | H bond donors | 0 | ACD/LogP | 1.94 | | Phase 25 °C | liquid/gas | Rotatable bonds | 3 | Predicted density | 0.88 g/cm3 | | SMILES | O=C(OCC)C(C)(C)C | | STD InChIKey | HHEIMYAXCOIQCJ-UHFFFAOYAH | | Melting Points | | mp °C | source | |
|---|
| -90.00 | Alfa Aesar | | -89.50 | PHYSPROP |
|
|
| | | ethyl propionate C5H10O22, 3, 64 |
 | |
|
| | | ethyl propyl ether C5H12O4, 64 |
 | | Compound Data | | Melting point | -127.25 °C | 145.90 K | | CSID | 11835 | H bond acceptors | 1 | Rule of 5 violations | 0 | | Molecular weight | 88.1482 | H bond donors | 0 | ACD/LogP | 1.51 | | Phase 25 °C | liquid/gas | Rotatable bonds | 3 | Predicted density | 0.75 g/cm3 | | SMILES | O(CC)CCC | | STD InChIKey | NVJUHMXYKCUMQA-UHFFFAOYAW | | Melting Points | | mp °C | source | |
|---|
| -127.00 | American Petroleum Institute. Research Project 44; Selected ... | | -127.50 | PHYSPROP |
|
|
| | | ethyl stearate C20H40O23, 64 |
 | | Compound Data | | Melting point | 34.00 °C | 307.15 K | | CSID | 7830 | H bond acceptors | 2 | Rule of 5 violations | 1 | | Molecular weight | 312.5304 | H bond donors | 0 | ACD/LogP | 9.21 | | Phase 25 °C | solid | Rotatable bonds | 18 | Predicted density | 0.86 g/cm3 | | SMILES | O=C(OCC)CCCCCCCCCCCCCCCCC | | STD InChIKey | MVLVMROFTAUDAG-UHFFFAOYAC | | Melting Points | | mp °C | source | |
|---|
| 35.00 | Alfa Aesar | | 33.00 | PHYSPROP |
|
|
| | | ethyl tetradecanoate C16H32O23, 64 |
 | | Compound Data | | Melting point | 12.15 °C | 285.30 K | | CSID | 29023 | H bond acceptors | 2 | Rule of 5 violations | 1 | | Molecular weight | 256.4241 | H bond donors | 0 | ACD/LogP | 7.08 | | Phase 25 °C | liquid/gas | Rotatable bonds | 14 | Predicted density | 0.86 g/cm3 | | SMILES | O=C(OCC)CCCCCCCCCCCCC | | STD InChIKey | MMKRHZKQPFCLLS-UHFFFAOYAA | | Melting Points | | mp °C | source | |
|---|
| 12.00 | Alfa Aesar | | 12.30 | PHYSPROP |
|
|
| | | ethyl valerate C7H14O23, 64 |
 | | Compound Data | | Melting point | -91.10 °C | 182.05 K | | CSID | 10420 | H bond acceptors | 2 | Rule of 5 violations | 0 | | Molecular weight | 130.1849 | H bond donors | 0 | ACD/LogP | 2.30 | | Phase 25 °C | liquid/gas | Rotatable bonds | 5 | Predicted density | 0.88 g/cm3 | | SMILES | O=C(OCC)CCCC | | STD InChIKey | ICMAFTSLXCXHRK-UHFFFAOYAC | | Melting Points | | mp °C | source | |
|---|
| -91.00 | Alfa Aesar | | -91.20 | PHYSPROP |
|
|
| | | ethylamine C2H7N61, 64 |
 | | Compound Data | | Melting point | -81.10 °C | 192.05 K | | CSID | 6101 | H bond acceptors | 1 | Rule of 5 violations | 0 | | Molecular weight | 45.0837 | H bond donors | 2 | ACD/LogP | -0.13 | | Phase 25 °C | liquid/gas | Rotatable bonds | 1 | Predicted density | 0.69 g/cm3 | | SMILES | NCC | | STD InChIKey | QUSNBJAOOMFDIB-UHFFFAOYAL | | Melting Points | | mp °C | source | |
|---|
| -81.00 | Oxford University MSDS | | -81.20 | PHYSPROP |
|
|
| | | ethylbenzene C8H103, 4, 32, 64 |
 | |
|
| | | ethylcyclobutane C6H124, 64 |
 | | Compound Data | | Melting point | -142.95 °C | 130.20 K | | CSID | 221079 | H bond acceptors | 0 | Rule of 5 violations | 0 | | Molecular weight | 84.1595 | H bond donors | 0 | ACD/LogP | 3.28 | | Phase 25 °C | liquid/gas | Rotatable bonds | 1 | Predicted density | 0.78 g/cm3 | | SMILES | CCC1CCC1 | | STD InChIKey | NEZRFXZYPAIZAD-UHFFFAOYAY | | Melting Points | | mp °C | source | |
|---|
| -143.00 | American Petroleum Institute. Research Project 44; Selected ... | | -142.90 | PHYSPROP |
|
|
| | | ethylcyclohexane C8H164, 64 |
 | | Compound Data | | Melting point | -111.15 °C | 162.00 K | | CSID | 14751 | H bond acceptors | 0 | Rule of 5 violations | 0 | | Molecular weight | 112.2126 | H bond donors | 0 | ACD/LogP | 4.41 | | Phase 25 °C | liquid/gas | Rotatable bonds | 1 | Predicted density | 0.78 g/cm3 | | SMILES | CCC1CCCCC1 | | STD InChIKey | IIEWJVIFRVWJOD-UHFFFAOYAU | | Melting Points | | mp °C | source | |
|---|
| -111.00 | American Petroleum Institute. Research Project 44; Selected ... | | -111.30 | PHYSPROP |
|
|
| | | ethylcyclopentane C7H144, 64 |
 | | Compound Data | | Melting point | -138.20 °C | 134.95 K | | CSID | 14686 | H bond acceptors | 0 | Rule of 5 violations | 0 | | Molecular weight | 98.1861 | H bond donors | 0 | ACD/LogP | 3.85 | | Phase 25 °C | liquid/gas | Rotatable bonds | 1 | Predicted density | 0.78 g/cm3 | | SMILES | CCC1CCCC1 | | STD InChIKey | IFTRQJLVEBNKJK-UHFFFAOYAM | | Melting Points | | mp °C | source | |
|---|
| -138.00 | American Petroleum Institute. Research Project 44; Selected ... | | -138.40 | PHYSPROP |
|
|
| | | ethylcyclopropane C5H104, 64 |
 | | Compound Data | | Melting point | -149.10 °C | 124.05 K | | CSID | 64095 | H bond acceptors | 0 | Rule of 5 violations | 0 | | Molecular weight | 70.1329 | H bond donors | 0 | ACD/LogP | 2.72 | | Phase 25 °C | liquid/gas | Rotatable bonds | 1 | Predicted density | 0.77 g/cm3 | | SMILES | CCC1CC1 | | STD InChIKey | FOTXAJDDGPYIFU-UHFFFAOYAR | | Melting Points | | mp °C | source | |
|---|
| -149.00 | American Petroleum Institute. Research Project 44; Selected ... | | -149.20 | PHYSPROP |
|
|
| | | ethylene C2H460, 61, 64, 73 |
 | |
|
| | | ethylene oxide C2H4O61, 64 |
 | | Compound Data | | Melting point | -111.35 °C | 161.80 K | | CSID | 6114 | H bond acceptors | 1 | Rule of 5 violations | 0 | | Molecular weight | 44.0526 | H bond donors | 0 | ACD/LogP | 0.00 | | Phase 25 °C | liquid/gas | Rotatable bonds | 0 | Predicted density | 0.99 g/cm3 | | SMILES | C1CO1 | | STD InChIKey | IAYPIBMASNFSPL-UHFFFAOYAX | | Melting Points | | mp °C | source | |
|---|
| -111.00 | Oxford University MSDS | | -111.70 | PHYSPROP |
|
|
| | | ethylenediamine C2H8N23, 61, 64 |
 | | Compound Data | | Melting point | 9.87 °C | 283.02 K | | CSID | 13835550 | H bond acceptors | 2 | Rule of 5 violations | 0 | | Molecular weight | 60.0983 | H bond donors | 4 | ACD/LogP | 0.00 | | Phase 25 °C | liquid/gas | Rotatable bonds | 3 | Predicted density | 0.87 g/cm3 | | SMILES | C(CN)N | | STD InChIKey | PIICEJLVQHRZGT-UHFFFAOYAH | | Melting Points | | mp °C | source | |
|---|
| 10.00 | Alfa Aesar | | 8.50 | Oxford University MSDS | | 11.10 | PHYSPROP |
|
|
| | | ethylidenecyclopentane C7H123, 64 |
 | | Compound Data | | Melting point | -129.75 °C | 143.40 K | | CSID | 67620 | H bond acceptors | 0 | Rule of 5 violations | 0 | | Molecular weight | 96.1702 | H bond donors | 0 | ACD/LogP | 3.44 | | Phase 25 °C | liquid/gas | Rotatable bonds | 0 | Predicted density | 0.91 g/cm3 | | SMILES | C(=C1/CCCC1)\C | | STD InChIKey | VONKRKBGTZDZNV-UHFFFAOYAN | | Melting Points | | mp °C | source | |
|---|
| -130.00 | Alfa Aesar | | -129.50 | PHYSPROP |
|
|
| | | ethylmalonic acid C5H8O43, 64 |
 | | Compound Data | | Melting point | 113.50 °C | 386.65 K | | CSID | 11263 | H bond acceptors | 4 | Rule of 5 violations | 0 | | Molecular weight | 132.1146 | H bond donors | 2 | ACD/LogP | 0.32 | | Phase 25 °C | solid | Rotatable bonds | 3 | Predicted density | 1.31 g/cm3 | | SMILES | O=C(O)C(C(=O)O)CC | | STD InChIKey | UKFXDFUAPNAMPJ-UHFFFAOYAZ | | Melting Points | | mp °C | source | |
|---|
| 113.00 | Alfa Aesar | | 114.00 | PHYSPROP |
|
|
| | | ethylphosphonic acid C2H7O3P3, 61 |
 | | Compound Data | | Melting point | 60.75 °C | 333.90 K | | CSID | 177126 | H bond acceptors | 3 | Rule of 5 violations | 0 | | Molecular weight | 110.0489 | H bond donors | 2 | ACD/LogP | -1.49 | | Phase 25 °C | solid | Rotatable bonds | 1 | Predicted density | 1.36 g/cm3 | | SMILES | O=P(O)(O)CC | | STD InChIKey | GATNOFPXSDHULC-UHFFFAOYAH | | Melting Points | | mp °C | source | |
|---|
| 60.00 | Alfa Aesar | | 61.50 | Oxford University MSDS |
|
|
| | | eugenol C10H12O23, 61, 64 |
 | | Compound Data | | Melting point | -9.37 °C | 263.78 K | | CSID | 13876103 | H bond acceptors | 2 | Rule of 5 violations | 0 | | Molecular weight | 164.2011 | H bond donors | 1 | ACD/LogP | 2.20 | | Phase 25 °C | liquid/gas | Rotatable bonds | 4 | Predicted density | 1.05 g/cm3 | | SMILES | Oc1ccc(cc1OC)CC=C | | STD InChIKey | RRAFCDWBNXTKKO-UHFFFAOYAJ | | Melting Points | | mp °C | source | |
|---|
| -10.00 | Alfa Aesar | | -9.00 | Oxford University MSDS | | -9.10 | PHYSPROP |
|
|
| | | famotidine C8H15N7O2S39, 32, 44, 64 |
 | |
|
| | | febantel C20H22N4O6S9, 48, 64 |
 | |
|
| | | felbamate C11H14N2O49, 32, 48, 64 |
 | |
|
| | | fenac C8H5Cl3O261, 64 |
 | | Compound Data | | Melting point | 158.50 °C | 431.65 K | | CSID | 6546 | H bond acceptors | 2 | Rule of 5 violations | 0 | | Molecular weight | 239.4831 | H bond donors | 1 | ACD/LogP | 3.10 | | Phase 25 °C | solid | Rotatable bonds | 2 | Predicted density | 1.57 g/cm3 | | SMILES | Clc1c(c(Cl)ccc1Cl)CC(=O)O | | STD InChIKey | QZXCCPZJCKEPSA-UHFFFAOYAP | | Melting Points | | mp °C | source | |
|---|
| 156.00 | Oxford University MSDS | | 161.00 | PHYSPROP |
|
|
| | | fenamic acid C13H11NO23, 64 |
 | | Compound Data | | Melting point | 185.25 °C | 458.40 K | | CSID | 4233 | H bond acceptors | 3 | Rule of 5 violations | 0 | | Molecular weight | 213.2319 | H bond donors | 2 | ACD/LogP | 4.41 | | Phase 25 °C | solid | Rotatable bonds | 3 | Predicted density | 1.27 g/cm3 | | SMILES | O=C(O)c2ccccc2Nc1ccccc1 | | STD InChIKey | ZWJINEZUASEZBH-UHFFFAOYAQ | | Melting Points | | mp °C | source | |
|---|
| 187.00 | Alfa Aesar | | 183.50 | PHYSPROP |
|
|
| | | fenbufen C16H14O344, 64 |
 | | Compound Data | | Melting point | 186.05 °C | 459.20 K | | CSID | 3218 | H bond acceptors | 3 | Rule of 5 violations | 0 | | Molecular weight | 254.2806 | H bond donors | 1 | ACD/LogP | 3.13 | | Phase 25 °C | solid | Rotatable bonds | 5 | Predicted density | 1.19 g/cm3 | | SMILES | O=C(O)CCC(=O)c2ccc(c1ccccc1)cc2 | | STD InChIKey | ZPAKPRAICRBAOD-UHFFFAOYAO | | Melting Points | | mp °C | source | |
|---|
| 186.10 | Hughes LD; Palmer DS; Nigsch F and Mitchell JBO. 2008 Why ar... | | 186.00 | PHYSPROP |
|
|
| | | fenoxycarb C17H19NO444, 64, 64 |
 | |
|
| | | fentanyl C22H28N2O9, 48, 64 |
 | |
|
| | | fenthion C10H15O3PS261, 64 |
 | | Compound Data | | Melting point | 7.25 °C | 280.40 K | | CSID | 3229 | H bond acceptors | 3 | Rule of 5 violations | 0 | | Molecular weight | 278.3281 | H bond donors | 0 | ACD/LogP | 3.21 | | Phase 25 °C | liquid/gas | Rotatable bonds | 5 | Predicted density | 1.25 g/cm3 | | SMILES | S=P(OC)(OC)Oc1ccc(SC)c(c1)C | | STD InChIKey | PNVJTZOFSHSLTO-UHFFFAOYAH | | Melting Points | | mp °C | source | |
|---|
| 7.00 | Oxford University MSDS | | 7.50 | PHYSPROP |
|
|
| | | fenuron C9H12N2O64, 70, 70 |
 | |
|
| | | flavone C15H10O23, 64 |
 | | Compound Data | | Melting point | 98.50 °C | 371.65 K | | CSID | 10230 | H bond acceptors | 2 | Rule of 5 violations | 0 | | Molecular weight | 222.2387 | H bond donors | 0 | ACD/LogP | 3.56 | | Phase 25 °C | solid | Rotatable bonds | 1 | Predicted density | 1.24 g/cm3 | | SMILES | O=C\1c3c(O/C(=C/1)c2ccccc2)cccc3 | | STD InChIKey | VHBFFQKBGNRLFZ-UHFFFAOYAG | | Melting Points | | mp °C | source | |
|---|
| 97.00 | Alfa Aesar | | 100.00 | PHYSPROP |
|
|
| | | fludioxonil C12H6F2N2O244, 64 |
 | | Compound Data | | Melting point | 199.60 °C | 472.75 K | | CSID | 77916 | H bond acceptors | 4 | Rule of 5 violations | 0 | | Molecular weight | 248.185 | H bond donors | 1 | ACD/LogP | 3.62 | | Phase 25 °C | solid | Rotatable bonds | 1 | Predicted density | 1.55 g/cm3 | | SMILES | N#Cc3cncc3c1cccc2OC(F)(F)Oc12 | | STD InChIKey | MUJOIMFVNIBMKC-UHFFFAOYAI | | Melting Points | | mp °C | source | |
|---|
| 199.40 | Hughes LD; Palmer DS; Nigsch F and Mitchell JBO. 2008 Why ar... | | 199.80 | PHYSPROP |
|
|
| | | fluometuron C10H11F3N2O44, 64 |
 | | Compound Data | | Melting point | 163.75 °C | 436.90 K | | CSID | 15702 | H bond acceptors | 3 | Rule of 5 violations | 0 | | Molecular weight | 232.2023 | H bond donors | 1 | ACD/LogP | 2.36 | | Phase 25 °C | solid | Rotatable bonds | 1 | Predicted density | 1.29 g/cm3 | | SMILES | O=C(Nc1cc(ccc1)C(F)(F)F)N(C)C | | STD InChIKey | RZILCCPWPBTYDO-UHFFFAOYAP | | Melting Points | | mp °C | source | |
|---|
| 163.50 | Hughes LD; Palmer DS; Nigsch F and Mitchell JBO. 2008 Why ar... | | 164.00 | PHYSPROP |
|
|
| | | fluoranthene C16H1061, 64, 70 |
 | |
|
| | | fluorene C13H102, 3, 44, 48, 61, 64, 70 |
 | |
|
| | | fluorescein C20H12O53, 32 |
 | | Compound Data | | Melting point | 317.50 °C | 590.65 K | | CSID | 15968 | H bond acceptors | 5 | Rule of 5 violations | 0 | | Molecular weight | 332.3063 | H bond donors | 2 | ACD/LogP | 2.68 | | Phase 25 °C | solid | Rotatable bonds | 2 | Predicted density | 1.60 g/cm3 | | SMILES | c1ccc2c(c1)C(=O)OC23c4ccc(cc4Oc5c3ccc(c5)O)O | | STD InChIKey | GNBHRKFJIUUOQI-UHFFFAOYAZ | | Melting Points | | mp °C | source | |
|---|
| 320.00 | Alfa Aesar | | 315.00 | DrugBank |
|
|
| | | fluorobenzene C6H5F3, 61, 64 |
 | | Compound Data | | Melting point | -41.40 °C | 231.75 K | | CSID | 9614 | H bond acceptors | 0 | Rule of 5 violations | 0 | | Molecular weight | 96.1023 | H bond donors | 0 | ACD/LogP | 2.27 | | Phase 25 °C | liquid/gas | Rotatable bonds | 0 | Predicted density | 1.03 g/cm3 | | SMILES | Fc1ccccc1 | | STD InChIKey | PYLWMHQQBFSUBP-UHFFFAOYAM | | Melting Points | | mp °C | source | |
|---|
| -42.00 | Alfa Aesar | | -40.00 | Oxford University MSDS | | -42.20 | PHYSPROP |
|
|
| | | fluoroform CHF361, 64 |
 | | Compound Data | | Melting point | -157.55 °C | 115.60 K | | CSID | 21106179 | H bond acceptors | 0 | Rule of 5 violations | 0 | | Molecular weight | 70.0138 | H bond donors | 0 | ACD/LogP | 0.48 | | Phase 25 °C | liquid/gas | Rotatable bonds | 0 | Predicted density | 1.13 g/cm3 | | SMILES | FC(F)F | | STD InChIKey | XPDWGBQVDMORPB-UHFFFAOYAM | | Melting Points | | mp °C | source | |
|---|
| -160.00 | Oxford University MSDS | | -155.10 | PHYSPROP |
|
|
| | | fluoromethane CH3F28, 49, 61, 64 |
 | | Compound Data | | Melting point | -142.32 °C | 130.83 K | | CSID | 11148 | H bond acceptors | 0 | Rule of 5 violations | 0 | | Molecular weight | 34.0329 | H bond donors | 0 | ACD/LogP | 0.51 | | Phase 25 °C | liquid/gas | Rotatable bonds | 0 | Predicted density | 0.67 g/cm3 | | SMILES | FC | | STD InChIKey | NBVXSUQYWXRMNV-UHFFFAOYAF | | Melting Points | | mp °C | source | |
|---|
| -143.30 | CRC Handbook of Chemistry and Physics | | -141.85 | KDB | | -141.80 | PHYSPROP | | Values not used in calculating the average melting point | | -115.00 | Oxford University MSDS1 | | 1. clearly out of range and analog trend JCB |
|
|
| | | flupirtine C15H17FN4O29, 48, 64 |
 | |
|
| | | formamide CH3NO3, 61, 64 |
 | | Compound Data | | Melting point | 2.18 °C | 275.33 K | | CSID | 693 | H bond acceptors | 2 | Rule of 5 violations | 0 | | Molecular weight | 45.0406 | H bond donors | 2 | ACD/LogP | -1.51 | | Phase 25 °C | liquid/gas | Rotatable bonds | 0 | Predicted density | 0.98 g/cm3 | | SMILES | O=CN | | STD InChIKey | ZHNUHDYFZUAESO-UHFFFAOYAQ | | Melting Points | | mp °C | source | |
|---|
| 2.00 | Alfa Aesar | | 2.00 | Oxford University MSDS | | 2.55 | PHYSPROP |
|
|
| | | formic acid CH2O23, 35, 51, 64 |
 | |
|
| | | formic acid hydrazide CH4N2O3, 64 |
 | | Compound Data | | Melting point | 56.00 °C | 329.15 K | | CSID | 11728 | H bond acceptors | 3 | Rule of 5 violations | 0 | | Molecular weight | 60.0553 | H bond donors | 3 | ACD/LogP | -2.05 | | Phase 25 °C | solid | Rotatable bonds | 1 | Predicted density | 1.09 g/cm3 | | SMILES | O=CNN | | STD InChIKey | XZBIXDPGRMLSTC-UHFFFAOYAQ | | Melting Points | | mp °C | source | |
|---|
| 57.00 | Alfa Aesar | | 55.00 | PHYSPROP |
|
|
| | | fragivil C17H14O39, 48, 64 |
 | |
|
| | | fthalide C8H2Cl4O248, 64 |
 | | Compound Data | | Melting point | 208.75 °C | 481.90 K | | CSID | 31144 | H bond acceptors | 2 | Rule of 5 violations | 0 | | Molecular weight | 271.9123 | H bond donors | 0 | ACD/LogP | 2.73 | | Phase 25 °C | solid | Rotatable bonds | 0 | Predicted density | 1.77 g/cm3 | | SMILES | O=C1OCc2c1c(Cl)c(Cl)c(Cl)c2Cl | | STD InChIKey | NMWKWBPNKPGATC-UHFFFAOYAH | | Melting Points | | mp °C | source | |
|---|
| 208.00 | Karthikeyan M.; Glen R.C.; Bender A. General melting point p... | | 209.50 | PHYSPROP |
|
|
| | | furan C4H4O3, 61, 64 |
 | | Compound Data | | Melting point | -85.40 °C | 187.75 K | | CSID | 7738 | H bond acceptors | 1 | Rule of 5 violations | 0 | | Molecular weight | 68.074 | H bond donors | 0 | ACD/LogP | 1.74 | | Phase 25 °C | liquid/gas | Rotatable bonds | 0 | Predicted density | 0.94 g/cm3 | | SMILES | c1ccoc1 | | STD InChIKey | YLQBMQCUIZJEEH-UHFFFAOYAC | | Melting Points | | mp °C | source | |
|---|
| -85.00 | Alfa Aesar | | -85.60 | Oxford University MSDS | | -85.60 | PHYSPROP |
|
|
| | | furosemide C12H11ClN2O5S16, 26, 29, 32, 33, 35, 44, 64, 71, 72, 72 |
 | |
|
| | | gemfibrozil C15H22O39, 48, 64 |
 | |
|
| | | genistein C15H10O53, 32 |
 | | Compound Data | | Melting point | 300.75 °C | 573.90 K | | CSID | 4444448 | H bond acceptors | 5 | Rule of 5 violations | 0 | | Molecular weight | 270.2369 | H bond donors | 3 | ACD/LogP | 2.96 | | Phase 25 °C | solid | Rotatable bonds | 4 | Predicted density | 1.55 g/cm3 | | SMILES | Oc1ccc(cc1)C\3=C\Oc2cc(O)cc(O)c2C/3=O | | STD InChIKey | TZBJGXHYKVUXJN-UHFFFAOYAH | | Melting Points | | mp °C | source | |
|---|
| 300.00 | Alfa Aesar | | 301.50 | DrugBank |
|
|
| | | glutaric acid C5H8O43, 61, 64 |
 | | Compound Data | | Melting point | 97.10 °C | 370.25 K | | CSID | 723 | H bond acceptors | 4 | Rule of 5 violations | 0 | | Molecular weight | 132.1146 | H bond donors | 2 | ACD/LogP | 0.00 | | Phase 25 °C | solid | Rotatable bonds | 4 | Predicted density | 1.32 g/cm3 | | SMILES | C(CC(=O)O)CC(=O)O | | STD InChIKey | JFCQEDHGNNZCLN-UHFFFAOYAU | | Melting Points | | mp °C | source | |
|---|
| 97.00 | Alfa Aesar | | 96.50 | Oxford University MSDS | | 97.80 | PHYSPROP |
|
|
| | | glyburide C23H28ClN3O5S3, 9, 32, 64 |
 | |
|
| | | glycerol C3H8O33, 61, 64 |
 | | Compound Data | | Melting point | 18.00 °C | 291.15 K | | CSID | 733 | H bond acceptors | 3 | Rule of 5 violations | 0 | | Molecular weight | 92.0938 | H bond donors | 3 | ACD/LogP | 0.00 | | Phase 25 °C | liquid/gas | Rotatable bonds | 5 | Predicted density | 1.30 g/cm3 | | SMILES | C(C(CO)O)O | | STD InChIKey | PEDCQBHIVMGVHV-UHFFFAOYAF | | Melting Points | | mp °C | source | |
|---|
| 18.00 | Alfa Aesar | | 17.80 | Oxford University MSDS | | 18.20 | PHYSPROP |
|
|
| | | glycerol tripalmitate C51H98O63, 64 |
 | | Compound Data | | Melting point | 64.25 °C | 337.40 K | | CSID | 10674 | H bond acceptors | 6 | Rule of 5 violations | 2 | | Molecular weight | 807.3202 | H bond donors | 0 | ACD/LogP | 22.08 | | Phase 25 °C | solid | Rotatable bonds | 50 | Predicted density | 0.92 g/cm3 | | SMILES | O=C(OCC(OC(=O)CCCCCCCCCCCCCCC)COC(=O)CCCCCCCCCCCCCCC)CCCCCCCCCCCCCCC | | STD InChIKey | PVNIQBQSYATKKL-UHFFFAOYAV | | Melting Points | | mp °C | source | |
|---|
| 62.00 | Alfa Aesar | | 66.50 | PHYSPROP |
|
|
| | | glycolic acid C2H4O33, 61, 64 |
 | | Compound Data | | Melting point | 78.83 °C | 351.98 K | | CSID | 737 | H bond acceptors | 3 | Rule of 5 violations | 0 | | Molecular weight | 76.0514 | H bond donors | 2 | ACD/LogP | 0.00 | | Phase 25 °C | solid | Rotatable bonds | 2 | Predicted density | 1.42 g/cm3 | | SMILES | C(C(=O)O)O | | STD InChIKey | AEMRFAOFKBGASW-UHFFFAOYAR | | Melting Points | | mp °C | source | |
|---|
| 77.00 | Alfa Aesar | | 80.00 | Oxford University MSDS | | 79.50 | PHYSPROP |
|
|
| | | glycolophenone C8H8O22, 3, 17, 59, 64 |
 | | Compound Data | | Melting point | 5.17 °C | 278.32 K | | CSID | 61765 | H bond acceptors | 2 | Rule of 5 violations | 0 | | Molecular weight | 136.1479 | H bond donors | 1 | ACD/LogP | 0.44 | | Phase 25 °C | liquid/gas | Rotatable bonds | 3 | Predicted density | 1.15 g/cm3 | | SMILES | O=C(c1ccccc1)CO | | STD InChIKey | ZWVHTXAYIKBMEE-UHFFFAOYAZ | | Melting Points | | mp °C | source | |
|---|
| 6.00 | Aldrich Chemical Company; Aldrich Catalog-Handbook of Fine C... | | 4.50 | Alfa Aesar | | 5.00 | ChemBlink | | Values not used in calculating the average melting point | | 28.00 | NIST Web Book1 | | 90.00 | PHYSPROP2 | | 1. clearly out of range JCB | | 2. clearly out of range JCB |
|
|
| | | glymidine C13H15N3O4S9, 64 |
 | | Compound Data | | Melting point | 152.50 °C | 425.65 K | | CSID | 9190 | H bond acceptors | 7 | Rule of 5 violations | 0 | | Molecular weight | 309.3409 | H bond donors | 1 | ACD/LogP | 1.05 | | Phase 25 °C | solid | Rotatable bonds | 5 | Predicted density | 1.35 g/cm3 | | SMILES | O=S(=O)(Nc1ncc(OCCOC)cn1)c2ccccc2 | | STD InChIKey | QFWPJPIVLCBXFJ-UHFFFAOYAT | | Melting Points | | mp °C | source | |
|---|
| 152.00 | Bergstrom C. A. S.; Norinder U.; Luthman K.; Artursson P. Mo... | | 153.00 | PHYSPROP |
|
|
| | | guaiacol C7H8O22, 3, 61, 64 |
 | |
|
| | | halazepam C17H12ClF3N2O9, 48, 64 |
 | |
|
| | | haloperidol C21H23ClFNO29, 32, 35, 44, 48, 64 |
 | |
|
| | | henicosane C21H443, 61, 64 |
 | | Compound Data | | Melting point | 40.17 °C | 313.32 K | | CSID | 11897 | H bond acceptors | 0 | Rule of 5 violations | 1 | | Molecular weight | 296.5741 | H bond donors | 0 | ACD/LogP | 11.91 | | Phase 25 °C | solid | Rotatable bonds | 18 | Predicted density | 0.79 g/cm3 | | SMILES | C(CCCCCCCCCCCCCCCCCC)CC | | STD InChIKey | FNAZRRHPUDJQCJ-UHFFFAOYAL | | Melting Points | | mp °C | source | |
|---|
| 41.00 | Alfa Aesar | | 39.00 | Oxford University MSDS | | 40.50 | PHYSPROP |
|
|
| | | heptabarbital C13H18N2O39, 32, 44, 48, 64 |
 | |
|
| | | heptacosane C27H563, 64 |
 | | Compound Data | | Melting point | 59.25 °C | 332.40 K | | CSID | 11146 | H bond acceptors | 0 | Rule of 5 violations | 1 | | Molecular weight | 380.7335 | H bond donors | 0 | ACD/LogP | 15.10 | | Phase 25 °C | solid | Rotatable bonds | 24 | Predicted density | 0.80 g/cm3 | | SMILES | C(CCCCCCCCCCCCCCCCCCCCC)CCCCC | | STD InChIKey | BJQWYEJQWHSSCJ-UHFFFAOYAK | | Melting Points | | mp °C | source | |
|---|
| 59.00 | Alfa Aesar | | 59.50 | PHYSPROP |
|
|
| | | heptadecane C17H363, 4, 61, 64 |
 | |
|
| | | heptadecanoic acid C17H34O23, 61, 64 |
 | | Compound Data | | Melting point | 60.77 °C | 333.92 K | | CSID | 10033 | H bond acceptors | 2 | Rule of 5 violations | 1 | | Molecular weight | 270.4507 | H bond donors | 1 | ACD/LogP | 7.68 | | Phase 25 °C | solid | Rotatable bonds | 15 | Predicted density | 0.89 g/cm3 | | SMILES | O=C(O)CCCCCCCCCCCCCCCC | | STD InChIKey | KEMQGTRYUADPNZ-UHFFFAOYAT | | Melting Points | | mp °C | source | |
|---|
| 61.00 | Alfa Aesar | | 60.00 | Oxford University MSDS | | 61.30 | PHYSPROP |
|
|
| | | heptafluorobutyric acid C4HF7O23, 64 |
 | | Compound Data | | Melting point | -17.75 °C | 255.40 K | | CSID | 9394 | H bond acceptors | 2 | Rule of 5 violations | 0 | | Molecular weight | 214.0384 | H bond donors | 1 | ACD/LogP | 3.93 | | Phase 25 °C | liquid/gas | Rotatable bonds | 2 | Predicted density | 1.68 g/cm3 | | SMILES | FC(F)(C(F)(F)C(=O)O)C(F)(F)F | | STD InChIKey | YPJUNDFVDDCYIH-UHFFFAOYAI | | Melting Points | | mp °C | source | |
|---|
| -18.00 | Alfa Aesar | | -17.50 | PHYSPROP |
|
|
| | | heptanal C7H14O3, 4, 61, 64 |
 | |
|
| | | heptane C7H163, 4, 59, 61, 64 |
 | |
|
| | | heptanenitrile C7H13N3, 31 |
 | | Compound Data | | Melting point | -63.50 °C | 209.65 K | | CSID | 11866 | H bond acceptors | 1 | Rule of 5 violations | 0 | | Molecular weight | 111.1848 | H bond donors | 0 | ACD/LogP | 2.21 | | Phase 25 °C | liquid/gas | Rotatable bonds | 4 | Predicted density | 0.81 g/cm3 | | SMILES | N#CCCCCCC | | STD InChIKey | SDAXRHHPNYTELL-UHFFFAOYAT | | Melting Points | | mp °C | source | |
|---|
| -64.00 | Alfa Aesar | | -63.00 | Dreisbach R. R. Physical Properties of Chemical Compounds; V... |
|
|
| | | heptanoic acid C7H14O23, 4, 61, 64 |
 | |
|
| | | heptanoyl chloride C7H13ClO3, 64 |
 | | Compound Data | | Melting point | -83.90 °C | 189.25 K | | CSID | 16383 | H bond acceptors | 1 | Rule of 5 violations | 0 | | Molecular weight | 148.6305 | H bond donors | 0 | ACD/LogP | 3.11 | | Phase 25 °C | liquid/gas | Rotatable bonds | 5 | Predicted density | 0.97 g/cm3 | | SMILES | ClC(=O)CCCCCC | | STD InChIKey | UCVODTZQZHMTPN-UHFFFAOYAG | | Melting Points | | mp °C | source | |
|---|
| -84.00 | Alfa Aesar | | -83.80 | PHYSPROP |
|
|
| | | heptylcyclohexane C13H264, 64 |
 | | Compound Data | | Melting point | -30.50 °C | 242.65 K | | CSID | 20521 | H bond acceptors | 0 | Rule of 5 violations | 1 | | Molecular weight | 182.3455 | H bond donors | 0 | ACD/LogP | 7.07 | | Phase 25 °C | liquid/gas | Rotatable bonds | 6 | Predicted density | 0.80 g/cm3 | | SMILES | C(CCC1CCCCC1)CCCC | | STD InChIKey | MSTLSCNJAHAQNU-UHFFFAOYAB | | Melting Points | | mp °C | source | |
|---|
| -31.00 | American Petroleum Institute. Research Project 44; Selected ... | | -30.00 | PHYSPROP |
|
|
| | | hexabromobenzene C6Br661, 64 |
 | | Compound Data | | Melting point | 326.50 °C | 599.65 K | | CSID | 6639 | H bond acceptors | 0 | Rule of 5 violations | 2 | | Molecular weight | 551.4882 | H bond donors | 0 | ACD/LogP | 5.85 | | Phase 25 °C | solid | Rotatable bonds | 0 | Predicted density | 2.96 g/cm3 | | SMILES | Brc1c(Br)c(Br)c(Br)c(Br)c1Br | | STD InChIKey | CAYGQBVSOZLICD-UHFFFAOYAA | | Melting Points | | mp °C | source | |
|---|
| 327.00 | Oxford University MSDS | | 326.00 | PHYSPROP |
|
|
| | | hexachlorobenzene C6Cl644, 61, 64, 70, 70 |
 | |
|
| | | hexachlorophene C13H6Cl6O261, 64 |
 | | Compound Data | | Melting point | 165.25 °C | 438.40 K | | CSID | 3472 | H bond acceptors | 2 | Rule of 5 violations | 1 | | Molecular weight | 406.9035 | H bond donors | 2 | ACD/LogP | 7.20 | | Phase 25 °C | solid | Rotatable bonds | 4 | Predicted density | 1.71 g/cm3 | | SMILES | Clc1c(c(O)c(Cl)cc1Cl)Cc2c(O)c(Cl)cc(Cl)c2Cl | | STD InChIKey | ACGUYXCXAPNIKK-UHFFFAOYAL | | Melting Points | | mp °C | source | |
|---|
| 164.00 | Oxford University MSDS | | 166.50 | PHYSPROP |
|
|
| | | hexachloropropene C3Cl63, 64 |
 | | Compound Data | | Melting point | -72.95 °C | 200.20 K | | CSID | 15113 | H bond acceptors | 0 | Rule of 5 violations | 1 | | Molecular weight | 248.7501 | H bond donors | 0 | ACD/LogP | 6.08 | | Phase 25 °C | liquid/gas | Rotatable bonds | 0 | Predicted density | 1.78 g/cm3 | | SMILES | Cl/C(Cl)=C(/Cl)C(Cl)(Cl)Cl | | STD InChIKey | VFDYKPARTDCDCU-UHFFFAOYAH | | Melting Points | | mp °C | source | |
|---|
| -73.00 | Alfa Aesar | | -72.90 | PHYSPROP |
|
|
| | | hexacosane C26H543, 64 |
 | | Compound Data | | Melting point | 56.70 °C | 329.85 K | | CSID | 11901 | H bond acceptors | 0 | Rule of 5 violations | 1 | | Molecular weight | 366.707 | H bond donors | 0 | ACD/LogP | 14.57 | | Phase 25 °C | solid | Rotatable bonds | 23 | Predicted density | 0.80 g/cm3 | | SMILES | C(CCCCCCCCCCCCCCCCCCCC)CCCCC | | STD InChIKey | HMSWAIKSFDFLKN-UHFFFAOYAN | | Melting Points | | mp °C | source | |
|---|
| 57.00 | Alfa Aesar | | 56.40 | PHYSPROP |
|
|
| | | hexadecane C16H343, 4, 61, 64 |
 | |
|
| | | hexafluoroacetone C3F6O61, 64, 64 |
 | | Compound Data | | Melting point | -127.00 °C | 146.15 K | | CSID | 13846015 | H bond acceptors | 1 | Rule of 5 violations | 0 | | Molecular weight | 166.0219 | H bond donors | 0 | ACD/LogP | 1.89 | | Phase 25 °C | liquid/gas | Rotatable bonds | 0 | Predicted density | 1.54 g/cm3 | | SMILES | FC(F)(F)C(=O)C(F)(F)F | | STD InChIKey | VBZWSGALLODQNC-UHFFFAOYAI | | Melting Points | | mp °C | source | |
|---|
| -129.00 | Oxford University MSDS | | -125.00 | PHYSPROP | | Values not used in calculating the average melting point | | 19.50 | PHYSPROP1 | | 1. hydrate JCB |
|
|
| | | hexafluorobenzene C6F63, 61, 64 |
 | | Compound Data | | Melting point | 4.73 °C | 277.88 K | | CSID | 13836549 | H bond acceptors | 0 | Rule of 5 violations | 0 | | Molecular weight | 186.0546 | H bond donors | 0 | ACD/LogP | 2.42 | | Phase 25 °C | liquid/gas | Rotatable bonds | 0 | Predicted density | 1.62 g/cm3 | | SMILES | Fc1c(F)c(F)c(F)c(F)c1F | | STD InChIKey | ZQBFAOFFOQMSGJ-UHFFFAOYAJ | | Melting Points | | mp °C | source | |
|---|
| 5.00 | Alfa Aesar | | 3.90 | Oxford University MSDS | | 5.30 | PHYSPROP |
|
|
| | | hexafluoroethane C2F661, 64 |
 | | Compound Data | | Melting point | -100.35 °C | 172.80 K | | CSID | 6191 | H bond acceptors | 0 | Rule of 5 violations | 0 | | Molecular weight | 138.0118 | H bond donors | 0 | ACD/LogP | 2.00 | | Phase 25 °C | liquid/gas | Rotatable bonds | 0 | Predicted density | 1.46 g/cm3 | | SMILES | FC(F)(F)C(F)(F)F | | STD InChIKey | WMIYKQLTONQJES-UHFFFAOYAP | | Melting Points | | mp °C | source | |
|---|
| -100.00 | Oxford University MSDS | | -100.70 | PHYSPROP |
|
|
| | | hexamethylbenzene C12H182, 3, 64, 70 |
 | |
|
| | | hexamethylcyclotrisiloxane C6H18O3Si33, 61, 64 |
 | | Compound Data | | Melting point | 63.17 °C | 336.32 K | | CSID | 10452 | H bond acceptors | 3 | Rule of 5 violations | NA | | Molecular weight | 222.4618 | H bond donors | 0 | ACD/LogP | 0.00 | | Phase 25 °C | solid | Rotatable bonds | 0 | Predicted density | 0.94 g/cm3 | | SMILES | O1[Si](O[Si](O[Si]1(C)C)(C)C)(C)C | | STD InChIKey | HTDJPCNNEPUOOQ-UHFFFAOYAR | | Melting Points | | mp °C | source | |
|---|
| 65.00 | Alfa Aesar | | 60.00 | Oxford University MSDS | | 64.50 | PHYSPROP |
|
|
| | | hexamethyldisilane C6H18Si23, 64 |
 | | Compound Data | | Melting point | 12.75 °C | 285.90 K | | CSID | 66675 | H bond acceptors | 0 | Rule of 5 violations | 0 | | Molecular weight | 146.3781 | H bond donors | 0 | ACD/LogP | 2.50 | | Phase 25 °C | liquid/gas | Rotatable bonds | 1 | Predicted density | 0.73 g/cm3 | | SMILES | C[Si](C)(C)[Si](C)(C)C | | STD InChIKey | NEXSMEBSBIABKL-UHFFFAOYAV | | Melting Points | | mp °C | source | |
|---|
| 12.00 | Alfa Aesar | | 13.50 | PHYSPROP |
|
|
| | | hexan-2-one C6H12O3, 4, 61, 64 |
 | |
|
| | | hexane C6H143, 4, 32, 59, 61, 64 |
 | |
|
| | | hexane-2,5-dione C6H10O22, 3, 61, 64 |
 | |
|
| | | hexanoic acid C6H12O23, 4, 10, 35, 61, 64 |
 | |
|
| | | hexanoic anhydride C12H22O33, 64 |
 | | Compound Data | | Melting point | -40.50 °C | 232.65 K | | CSID | 67479 | H bond acceptors | 3 | Rule of 5 violations | 0 | | Molecular weight | 214.3013 | H bond donors | 0 | ACD/LogP | 3.77 | | Phase 25 °C | liquid/gas | Rotatable bonds | 10 | Predicted density | 0.94 g/cm3 | | SMILES | O=C(OC(=O)CCCCC)CCCCC | | STD InChIKey | PKHMTIRCAFTBDS-UHFFFAOYAZ | | Melting Points | | mp °C | source | |
|---|
| -40.00 | Alfa Aesar | | -41.00 | PHYSPROP |
|
|
| | | hexatriacontane C36H743, 64 |
 | | Compound Data | | Melting point | 76.25 °C | 349.40 K | | CSID | 11906 | H bond acceptors | 0 | Rule of 5 violations | 2 | | Molecular weight | 506.9728 | H bond donors | 0 | ACD/LogP | 19.88 | | Phase 25 °C | solid | Rotatable bonds | 33 | Predicted density | 0.81 g/cm3 | | SMILES | C(CCCCCCCCCCCCCCCCCCCCCC)CCCCCCCCCCCCC | | STD InChIKey | YDLYQMBWCWFRAI-UHFFFAOYAY | | Melting Points | | mp °C | source | |
|---|
| 76.00 | Alfa Aesar | | 76.50 | PHYSPROP |
|
|
| | | hexyl acetate C8H16O22, 3, 64 |
 | |
|
| | | hexyl formate C7H14O23, 64 |
 | | Compound Data | | Melting point | -62.80 °C | 210.35 K | | CSID | 55123 | H bond acceptors | 2 | Rule of 5 violations | 0 | | Molecular weight | 130.1849 | H bond donors | 0 | ACD/LogP | 2.42 | | Phase 25 °C | liquid/gas | Rotatable bonds | 6 | Predicted density | 0.88 g/cm3 | | SMILES | O=COCCCCCC | | STD InChIKey | OUGPMNMLWKSBRI-UHFFFAOYAA | | Melting Points | | mp °C | source | |
|---|
| -63.00 | Alfa Aesar | | -62.60 | PHYSPROP |
|
|
| | | homophthalic anhydride C9H6O33, 48 |
 | | Compound Data | | Melting point | 142.50 °C | 415.65 K | | CSID | 12274 | H bond acceptors | 3 | Rule of 5 violations | 0 | | Molecular weight | 162.1421 | H bond donors | 0 | ACD/LogP | 0.41 | | Phase 25 °C | solid | Rotatable bonds | 0 | Predicted density | 1.35 g/cm3 | | SMILES | O=C1OC(=O)Cc2ccccc12 | | STD InChIKey | AKHSBAVQPIRVAG-UHFFFAOYAF | | Melting Points | | mp °C | source | |
|---|
| 142.00 | Alfa Aesar | | 143.00 | Karthikeyan M.; Glen R.C.; Bender A. General melting point p... |
|
|
| | | homovanillic acid C9H10O43, 64 |
 | | Compound Data | | Melting point | 143.25 °C | 416.40 K | | CSID | 1675 | H bond acceptors | 4 | Rule of 5 violations | 0 | | Molecular weight | 182.1733 | H bond donors | 2 | ACD/LogP | 0.47 | | Phase 25 °C | solid | Rotatable bonds | 4 | Predicted density | 1.31 g/cm3 | | SMILES | O=C(O)Cc1cc(OC)c(O)cc1 | | STD InChIKey | QRMZSPFSDQBLIX-UHFFFAOYAZ | | Melting Points | | mp °C | source | |
|---|
| 143.00 | Alfa Aesar | | 143.50 | PHYSPROP |
|
|
| | | homoveratrol C9H12O23, 64 |
 | | Compound Data | | Melting point | 25.50 °C | 298.65 K | | CSID | 61434 | H bond acceptors | 2 | Rule of 5 violations | 0 | | Molecular weight | 152.1904 | H bond donors | 0 | ACD/LogP | 2.18 | | Phase 25 °C | solid | Rotatable bonds | 2 | Predicted density | 0.99 g/cm3 | | SMILES | Cc1ccc(c(c1)OC)OC | | STD InChIKey | GYPMBQZAVBFUIZ-UHFFFAOYAG | | Melting Points | | mp °C | source | |
|---|
| 27.00 | Alfa Aesar | | 24.00 | PHYSPROP |
|
|
| | | hycanthone C20H24N2O2S9, 48, 64 |
 | |
|
| | | hydantoin C3H4N2O23, 48, 64 |
 | |
|
| | | hydroflumethiazide C8H8F3N3O4S29, 32, 44, 64 |
 | |
|
| | | hydroquinone C6H6O22, 3, 35, 64 |
 | |
|
| | | hydroxydiphenylacetic acid C14H12O33, 35, 48, 59, 59, 61, 64 |
 | |
|
| | | hydroxyurea CH4N2O232, 64 |
 | | Compound Data | | Melting point | 142.50 °C | 415.65 K | | CSID | 3530 | H bond acceptors | 4 | Rule of 5 violations | 0 | | Molecular weight | 76.0547 | H bond donors | 4 | ACD/LogP | -1.80 | | Phase 25 °C | solid | Rotatable bonds | 1 | Predicted density | 1.46 g/cm3 | | SMILES | O=C(N)NO | | STD InChIKey | VSNHCAURESNICA-UHFFFAOYAY | | Melting Points | | mp °C | source | |
|---|
| 144.00 | DrugBank | | 141.00 | PHYSPROP |
|
|
| | | icosane C20H423, 4, 61, 64 |
 | |
|
| | | icosanoic acid C20H40O23, 61, 64 |
 | | Compound Data | | Melting point | 75.13 °C | 348.28 K | | CSID | 10035 | H bond acceptors | 2 | Rule of 5 violations | 1 | | Molecular weight | 312.5304 | H bond donors | 1 | ACD/LogP | 9.28 | | Phase 25 °C | solid | Rotatable bonds | 18 | Predicted density | 0.88 g/cm3 | | SMILES | O=C(O)CCCCCCCCCCCCCCCCCCC | | STD InChIKey | VKOBVWXKNCXXDE-UHFFFAOYAB | | Melting Points | | mp °C | source | |
|---|
| 75.00 | Alfa Aesar | | 75.00 | Oxford University MSDS | | 75.40 | PHYSPROP |
|
|
| | | imidacloprid C9H10ClN5O2Oxford University MSDS, 64 |
 | | Compound Data | | Melting point | 142.05 °C | 415.20 K | | CSID | 77934 | H bond acceptors | 7 | Rule of 5 violations | 0 | | Molecular weight | 255.661 | H bond donors | 1 | ACD/LogP | -0.43 | | Phase 25 °C | solid | Rotatable bonds | 2 | Predicted density | 1.59 g/cm3 | | SMILES | [O-][N+](=O)NC/1=N/CCN\1Cc2cnc(Cl)cc2 | | STD InChIKey | YWTYJOPNNQFBPC-UHFFFAOYAZ | | Melting Points | | mp °C | source | |
|---|
| 140.10 | 5-dihydro-N-nitro-1H-imidazol-2-amine.html | | 144.00 | PHYSPROP |
|
|
| | | imidazole C3H4N23, 61, 64 |
 | | Compound Data | | Melting point | 90.17 °C | 363.32 K | | CSID | 773 | H bond acceptors | 2 | Rule of 5 violations | 0 | | Molecular weight | 68.0773 | H bond donors | 1 | ACD/LogP | 0.00 | | Phase 25 °C | solid | Rotatable bonds | 0 | Predicted density | 1.12 g/cm3 | | SMILES | c1cnc[nH]1 | | STD InChIKey | RAXXELZNTBOGNW-UHFFFAOYAS | | Melting Points | | mp °C | source | |
|---|
| 90.00 | Alfa Aesar | | 90.00 | Oxford University MSDS | | 90.50 | PHYSPROP |
|
|
| | | iminodibenzyl C14H13N3, 64 |
 | | Compound Data | | Melting point | 106.75 °C | 379.90 K | | CSID | 9886 | H bond acceptors | 1 | Rule of 5 violations | 0 | | Molecular weight | 195.2597 | H bond donors | 1 | ACD/LogP | 4.03 | | Phase 25 °C | solid | Rotatable bonds | 0 | Predicted density | 1.08 g/cm3 | | SMILES | c1cc3c(cc1)CCc2c(cccc2)N3 | | STD InChIKey | ZSMRRZONCYIFNB-UHFFFAOYAX | | Melting Points | | mp °C | source | |
|---|
| 107.00 | Alfa Aesar | | 106.50 | PHYSPROP |
|
|
| | | indane C9H103, 64 |
 | | Compound Data | | Melting point | -51.20 °C | 221.95 K | | CSID | 9903 | H bond acceptors | 0 | Rule of 5 violations | 0 | | Molecular weight | 118.1757 | H bond donors | 0 | ACD/LogP | 3.21 | | Phase 25 °C | liquid/gas | Rotatable bonds | 0 | Predicted density | 1.00 g/cm3 | | SMILES | c1ccc2c(c1)CCC2 | | STD InChIKey | PQNFLJBBNBOBRQ-UHFFFAOYAW | | Melting Points | | mp °C | source | |
|---|
| -51.00 | Alfa Aesar | | -51.40 | PHYSPROP |
|
|
| | | indene C9H83, 64 |
 | | Compound Data | | Melting point | -1.90 °C | 271.25 K | | CSID | 6949 | H bond acceptors | 0 | Rule of 5 violations | 0 | | Molecular weight | 116.1598 | H bond donors | 0 | ACD/LogP | 3.04 | | Phase 25 °C | liquid/gas | Rotatable bonds | 0 | Predicted density | 1.04 g/cm3 | | SMILES | c1ccc2c(c1)CC=C2 | | STD InChIKey | YBYIRNPNPLQARY-UHFFFAOYAJ | | Melting Points | | mp °C | source | |
|---|
| -2.00 | Alfa Aesar | | -1.80 | PHYSPROP |
|
|
| | | indole C8H7N3, 61, 64 |
 | | Compound Data | | Melting point | 52.17 °C | 325.32 K | | CSID | 776 | H bond acceptors | 1 | Rule of 5 violations | 0 | | Molecular weight | 117.1479 | H bond donors | 1 | ACD/LogP | 2.59 | | Phase 25 °C | solid | Rotatable bonds | 0 | Predicted density | 1.15 g/cm3 | | SMILES | c1ccc2c(c1)cc[nH]2 | | STD InChIKey | SIKJAQJRHWYJAI-UHFFFAOYAI | | Melting Points | | mp °C | source | |
|---|
| 52.00 | Alfa Aesar | | 52.00 | Oxford University MSDS | | 52.50 | PHYSPROP |
|
|
| | | indole-3-butyric acid C12H13NO23, 32, 64 |
 | | Compound Data | | Melting point | 124.00 °C | 397.15 K | | CSID | 8298 | H bond acceptors | 3 | Rule of 5 violations | 0 | | Molecular weight | 203.2371 | H bond donors | 2 | ACD/LogP | 2.34 | | Phase 25 °C | solid | Rotatable bonds | 4 | Predicted density | 1.25 g/cm3 | | SMILES | O=C(O)CCCc2c1ccccc1nc2 | | STD InChIKey | JTEDVYBZBROSJT-UHFFFAOYAT | | Melting Points | | mp °C | source | |
|---|
| 123.00 | Alfa Aesar | | 124.50 | DrugBank | | 124.50 | PHYSPROP |
|
|
| | | indole-3-carbonitrile C9H6N23, 64 |
 | | Compound Data | | Melting point | 180.25 °C | 453.40 K | | CSID | 200562 | H bond acceptors | 2 | Rule of 5 violations | 0 | | Molecular weight | 142.1573 | H bond donors | 1 | ACD/LogP | 2.32 | | Phase 25 °C | solid | Rotatable bonds | 0 | Predicted density | 1.24 g/cm3 | | SMILES | N#Cc2c1ccccc1nc2 | | STD InChIKey | CHIFTAQVXHNVRW-UHFFFAOYAG | | Melting Points | | mp °C | source | |
|---|
| 180.00 | Alfa Aesar | | 180.50 | PHYSPROP |
|
|
| | | indole-3-carboxaldehyde C9H7NO3, 64 |
 | | Compound Data | | Melting point | 196.75 °C | 469.90 K | | CSID | 9838 | H bond acceptors | 2 | Rule of 5 violations | 0 | | Molecular weight | 145.158 | H bond donors | 1 | ACD/LogP | 1.68 | | Phase 25 °C | solid | Rotatable bonds | 1 | Predicted density | 1.28 g/cm3 | | SMILES | c1ccc2c(c1)c(c[nH]2)C=O | | STD InChIKey | OLNJUISKUQQNIM-UHFFFAOYAL | | Melting Points | | mp °C | source | |
|---|
| 197.00 | Alfa Aesar | | 196.50 | PHYSPROP |
|
|
| | | indole-3-methanol C9H9NO3, 64 |
 | | Compound Data | | Melting point | 97.75 °C | 370.90 K | | CSID | 3581 | H bond acceptors | 2 | Rule of 5 violations | 0 | | Molecular weight | 147.1739 | H bond donors | 2 | ACD/LogP | 0.96 | | Phase 25 °C | solid | Rotatable bonds | 2 | Predicted density | 1.27 g/cm3 | | SMILES | OCc2c1ccccc1nc2 | | STD InChIKey | IVYPNXXAYMYVSP-UHFFFAOYAO | | Melting Points | | mp °C | source | |
|---|
| 98.00 | Alfa Aesar | | 97.50 | PHYSPROP |
|
|
| | | indole-3-propionic acid C11H11NO23, 64 |
 | | Compound Data | | Melting point | 134.25 °C | 407.40 K | | CSID | 3613 | H bond acceptors | 3 | Rule of 5 violations | 0 | | Molecular weight | 189.2105 | H bond donors | 2 | ACD/LogP | 1.76 | | Phase 25 °C | solid | Rotatable bonds | 3 | Predicted density | 1.30 g/cm3 | | SMILES | O=C(O)CCc2c1ccccc1nc2 | | STD InChIKey | GOLXRNDWAUTYKT-UHFFFAOYAW | | Melting Points | | mp °C | source | |
|---|
| 134.00 | Alfa Aesar | | 134.50 | PHYSPROP |
|
|
| | | indomethacin C19H16ClNO43, 32, 44, 64 |
 | |
|
| | | iodoacetic acid C2H3IO23, 61, 64 |
 | | Compound Data | | Melting point | 81.50 °C | 354.65 K | | CSID | 5050 | H bond acceptors | 2 | Rule of 5 violations | 0 | | Molecular weight | 185.9485 | H bond donors | 1 | ACD/LogP | 0.79 | | Phase 25 °C | solid | Rotatable bonds | 1 | Predicted density | 2.48 g/cm3 | | SMILES | C(C(=O)O)I | | STD InChIKey | JDNTWHVOXJZDSN-UHFFFAOYAA | | Melting Points | | mp °C | source | |
|---|
| 81.00 | Alfa Aesar | | 81.00 | Oxford University MSDS | | 82.50 | PHYSPROP |
|
|
| | | iodobenzene C6H5I3, 31, 64 |
 | |
|
| | | iodoethane C2H5I3, 31, 61, 64 |
 | |
|
| | | iodoform CHI33, 61, 64 |
 | | Compound Data | | Melting point | 120.83 °C | 393.98 K | | CSID | 6134 | H bond acceptors | 0 | Rule of 5 violations | 0 | | Molecular weight | 393.7321 | H bond donors | 0 | ACD/LogP | 3.51 | | Phase 25 °C | solid | Rotatable bonds | 0 | Predicted density | 3.86 g/cm3 | | SMILES | IC(I)I | | STD InChIKey | OKJPEAGHQZHRQV-UHFFFAOYAY | | Melting Points | | mp °C | source | |
|---|
| 122.00 | Alfa Aesar | | 121.50 | Oxford University MSDS | | 119.00 | PHYSPROP |
|
|
| | | iodomethane CH3I3, 31, 61, 64 |
 | |
|
| | | irbesartan C25H28N6O9, 32, 48 |
 | |
|
| | | isatin C8H5NO232, 61 |
 | | Compound Data | | Melting point | 201.50 °C | 474.65 K | | CSID | 6787 | H bond acceptors | 3 | Rule of 5 violations | 0 | | Molecular weight | 147.1308 | H bond donors | 1 | ACD/LogP | 0.56 | | Phase 25 °C | solid | Rotatable bonds | 0 | Predicted density | 1.37 g/cm3 | | SMILES | O=C2c1ccccc1NC2=O | | STD InChIKey | JXDYKVIHCLTXOP-UHFFFAOYAS | | Melting Points | | mp °C | source | |
|---|
| 203.00 | DrugBank | | 200.00 | Oxford University MSDS |
|
|
| | | iso-butylcyclopentane C9H184, 64 |
 | | Compound Data | | Melting point | -115.10 °C | 158.05 K | | CSID | 69826 | H bond acceptors | 0 | Rule of 5 violations | 0 | | Molecular weight | 126.2392 | H bond donors | 0 | ACD/LogP | 4.72 | | Phase 25 °C | liquid/gas | Rotatable bonds | 2 | Predicted density | 0.79 g/cm3 | | SMILES | CC(C)CC1CCCC1 | | STD InChIKey | DPUYDFJBHDYVQM-UHFFFAOYAS | | Melting Points | | mp °C | source | |
|---|
| -115.00 | American Petroleum Institute. Research Project 44; Selected ... | | -115.20 | PHYSPROP |
|
|
| | | isoamyl formate C6H12O27, 64 |
 | | Compound Data | | Melting point | -93.25 °C | 179.90 K | | CSID | 7761 | H bond acceptors | 2 | Rule of 5 violations | 0 | | Molecular weight | 116.1583 | H bond donors | 0 | ACD/LogP | 1.71 | | Phase 25 °C | liquid/gas | Rotatable bonds | 4 | Predicted density | 0.88 g/cm3 | | SMILES | O=COCCC(C)C | | STD InChIKey | XKYICAQFSCFURC-UHFFFAOYAX | | Melting Points | | mp °C | source | |
|---|
| -93.00 | Beilstein F. K.; Beilsteins Handbuch der Organischen Chemie.... | | -93.50 | PHYSPROP |
|
|
| | | isobutene C4H861, 64 |
 | | Compound Data | | Melting point | -140.20 °C | 132.95 K | | CSID | 7957 | H bond acceptors | 0 | Rule of 5 violations | 0 | | Molecular weight | 56.1063 | H bond donors | 0 | ACD/LogP | 2.25 | | Phase 25 °C | liquid/gas | Rotatable bonds | 0 | Predicted density | 0.63 g/cm3 | | SMILES | CC(=C)C | | STD InChIKey | VQTUBCCKSQIDNK-UHFFFAOYAW | | Melting Points | | mp °C | source | |
|---|
| -140.00 | Oxford University MSDS | | -140.40 | PHYSPROP |
|
|
| | | isobutyl acetate C6H12O23, 64 |
 | | Compound Data | | Melting point | -98.90 °C | 174.25 K | | CSID | 7747 | H bond acceptors | 2 | Rule of 5 violations | 0 | | Molecular weight | 116.1583 | H bond donors | 0 | ACD/LogP | 1.59 | | Phase 25 °C | liquid/gas | Rotatable bonds | 3 | Predicted density | 0.88 g/cm3 | | SMILES | O=C(OCC(C)C)C | | STD InChIKey | GJRQTCIYDGXPES-UHFFFAOYAF | | Melting Points | | mp °C | source | |
|---|
| -99.00 | Alfa Aesar | | -98.80 | PHYSPROP |
|
|
| | | isobutyl isobutyrate C8H16O23, 7, 64 |
 | |
|
| | | isobutylamine C4H11N3, 31, 64 |
 | |
|
| | | isobutyraldehyde C4H8O3, 4, 61, 64 |
 | |
|
| | | isobutyramide C4H9NO2, 3, 64 |
 | |
|
| | | isobutyric acid C4H8O23, 4, 32, 64 |
 | |
|
| | | isobutyric anhydride C8H14O33, 64 |
 | | Compound Data | | Melting point | -54.75 °C | 218.40 K | | CSID | 7069 | H bond acceptors | 3 | Rule of 5 violations | 0 | | Molecular weight | 158.195 | H bond donors | 0 | ACD/LogP | 1.27 | | Phase 25 °C | liquid/gas | Rotatable bonds | 4 | Predicted density | 0.98 g/cm3 | | SMILES | O=C(OC(=O)C(C)C)C(C)C | | STD InChIKey | LSACYLWPPQLVSM-UHFFFAOYAZ | | Melting Points | | mp °C | source | |
|---|
| -56.00 | Alfa Aesar | | -53.50 | PHYSPROP |
|
|
| | | isobutyronitrile C4H7N2, 3, 61, 64 |
 | |
|
| | | isocyanuric acid triallyl ester C12H15N3O361, 64 |
 | | Compound Data | | Melting point | 22.25 °C | 295.40 K | | CSID | 13329 | H bond acceptors | 6 | Rule of 5 violations | 0 | | Molecular weight | 249.2658 | H bond donors | 0 | ACD/LogP | -0.43 | | Phase 25 °C | liquid/gas | Rotatable bonds | 6 | Predicted density | 1.15 g/cm3 | | SMILES | O=C1N(C(=O)N(C(=O)N1C\C=C)C\C=C)C\C=C | | STD InChIKey | KOMNUTZXSVSERR-UHFFFAOYAI | | Melting Points | | mp °C | source | |
|---|
| 24.00 | Oxford University MSDS | | 20.50 | PHYSPROP |
|
|
| | | isoniazid C6H7N3O3, 9, 32, 35, 44, 48, 61, 64 |
 | |
|
| | | isonicotinamide C6H6N2O3, 64 |
 | | Compound Data | | Melting point | 156.50 °C | 429.65 K | | CSID | 14346 | H bond acceptors | 3 | Rule of 5 violations | 0 | | Molecular weight | 122.1246 | H bond donors | 2 | ACD/LogP | -0.28 | | Phase 25 °C | solid | Rotatable bonds | 1 | Predicted density | 1.20 g/cm3 | | SMILES | O=C(N)c1ccncc1 | | STD InChIKey | VFQXVTODMYMSMJ-UHFFFAOYAE | | Melting Points | | mp °C | source | |
|---|
| 157.00 | Alfa Aesar | | 156.00 | PHYSPROP |
|
|
| | | isonicotinic acid N-oxide C6H5NO33, 64 |
 | | Compound Data | | Melting point | 270.25 °C | 543.40 K | | CSID | 24341 | H bond acceptors | 4 | Rule of 5 violations | 0 | | Molecular weight | 139.1088 | H bond donors | 1 | ACD/LogP | -1.52 | | Phase 25 °C | solid | Rotatable bonds | 1 | Predicted density | 1.34 g/cm3 | | SMILES | [O-][n+]1ccc(C(=O)O)cc1 | | STD InChIKey | QCWTWMJMLSKQCJ-UHFFFAOYAL | | Melting Points | | mp °C | source | |
|---|
| 270.00 | Alfa Aesar | | 270.50 | PHYSPROP |
|
|
| | | isopentyl butyrate C9H18O23, 64 |
 | | Compound Data | | Melting point | -73.10 °C | 200.05 K | | CSID | 7507 | H bond acceptors | 2 | Rule of 5 violations | 0 | | Molecular weight | 158.238 | H bond donors | 0 | ACD/LogP | 3.18 | | Phase 25 °C | liquid/gas | Rotatable bonds | 6 | Predicted density | 0.87 g/cm3 | | SMILES | O=C(OCCC(C)C)CCC | | STD InChIKey | PQLMXFQTAMDXIZ-UHFFFAOYAT | | Melting Points | | mp °C | source | |
|---|
| -73.00 | Alfa Aesar | | -73.20 | PHYSPROP |
|
|
| | | isophorone C9H14O3, 61, 64 |
 | | Compound Data | | Melting point | -8.03 °C | 265.12 K | | CSID | 6296 | H bond acceptors | 1 | Rule of 5 violations | 0 | | Molecular weight | 138.2069 | H bond donors | 0 | ACD/LogP | 2.07 | | Phase 25 °C | liquid/gas | Rotatable bonds | 0 | Predicted density | 0.91 g/cm3 | | SMILES | O=C1\C=C(/CC(C)(C)C1)C | | STD InChIKey | HJOVHMDZYOCNQW-UHFFFAOYAC | | Melting Points | | mp °C | source | |
|---|
| -8.00 | Alfa Aesar | | -8.00 | Oxford University MSDS | | -8.10 | PHYSPROP |
|
|
| | | isophthalaldehyde C8H6O22, 47, 47, 64 |
 | |
|
| | | isophthalic acid C8H6O42, 48, 64 |
 | |
|
| | | isophthaloyl dichloride C8H4Cl2O23, 64 |
 | | Compound Data | | Melting point | 43.75 °C | 316.90 K | | CSID | 7171 | H bond acceptors | 2 | Rule of 5 violations | 0 | | Molecular weight | 203.0222 | H bond donors | 0 | ACD/LogP | 2.48 | | Phase 25 °C | solid | Rotatable bonds | 2 | Predicted density | 1.43 g/cm3 | | SMILES | O=C(Cl)c1cccc(C(Cl)=O)c1 | | STD InChIKey | FDQSRULYDNDXQB-UHFFFAOYAQ | | Melting Points | | mp °C | source | |
|---|
| 44.00 | Alfa Aesar | | 43.50 | PHYSPROP |
|
|
| | | isoprene C5H83, 4, 64 |
 | |
|
| | | isopropenyl acetate C5H8O23, 64 |
 | | Compound Data | | Melting point | -92.95 °C | 180.20 K | | CSID | 7628 | H bond acceptors | 2 | Rule of 5 violations | 0 | | Molecular weight | 100.1158 | H bond donors | 0 | ACD/LogP | 1.28 | | Phase 25 °C | liquid/gas | Rotatable bonds | 2 | Predicted density | 0.91 g/cm3 | | SMILES | O=C(O/C(=C)C)C | | STD InChIKey | HETCEOQFVDFGSY-UHFFFAOYAT | | Melting Points | | mp °C | source | |
|---|
| -93.00 | Alfa Aesar | | -92.90 | PHYSPROP |
|
|
| | | isopropyl acetate C5H10O23, 64 |
 | | Compound Data | | Melting point | -73.20 °C | 199.95 K | | CSID | 7627 | H bond acceptors | 2 | Rule of 5 violations | 0 | | Molecular weight | 102.1317 | H bond donors | 0 | ACD/LogP | 1.06 | | Phase 25 °C | liquid/gas | Rotatable bonds | 2 | Predicted density | 0.89 g/cm3 | | SMILES | O=C(OC(C)C)C | | STD InChIKey | JMMWKPVZQRWMSS-UHFFFAOYAA | | Melting Points | | mp °C | source | |
|---|
| -73.00 | Alfa Aesar | | -73.40 | PHYSPROP |
|
|
| | | isopropyl acetoacetate C7H12O33, 64 |
 | | Compound Data | | Melting point | -27.15 °C | 246.00 K | | CSID | 21171506 | H bond acceptors | 3 | Rule of 5 violations | 0 | | Molecular weight | 144.1684 | H bond donors | 0 | ACD/LogP | 1.06 | | Phase 25 °C | liquid/gas | Rotatable bonds | 4 | Predicted density | 0.99 g/cm3 | | SMILES | CC(C)OC(=O)CC(=O)C | | STD InChIKey | GVIIRWAJDFKJMJ-UHFFFAOYAG | | Melting Points | | mp °C | source | |
|---|
| -27.00 | Alfa Aesar | | -27.30 | PHYSPROP |
|
|
| | | isopropyl N-phenylcarbamate C10H13NO23, 64 |
 | | Compound Data | | Melting point | 87.65 °C | 360.80 K | | CSID | 23083 | H bond acceptors | 3 | Rule of 5 violations | 0 | | Molecular weight | 179.2157 | H bond donors | 1 | ACD/LogP | 2.65 | | Phase 25 °C | solid | Rotatable bonds | 3 | Predicted density | 1.10 g/cm3 | | SMILES | O=C(OC(C)C)Nc1ccccc1 | | STD InChIKey | VXPLXMJHHKHSOA-UHFFFAOYAY | | Melting Points | | mp °C | source | |
|---|
| 88.00 | Alfa Aesar | | 87.30 | PHYSPROP |
|
|
| | | isopropyl palmitate C19H38O23, 64 |
 | | Compound Data | | Melting point | 12.75 °C | 285.90 K | | CSID | 8567 | H bond acceptors | 2 | Rule of 5 violations | 1 | | Molecular weight | 298.5038 | H bond donors | 0 | ACD/LogP | 8.49 | | Phase 25 °C | liquid/gas | Rotatable bonds | 16 | Predicted density | 0.86 g/cm3 | | SMILES | O=C(OC(C)C)CCCCCCCCCCCCCCC | | STD InChIKey | XUGNVMKQXJXZCD-UHFFFAOYAX | | Melting Points | | mp °C | source | |
|---|
| 12.00 | Alfa Aesar | | 13.50 | PHYSPROP |
|
|
| | | isopropylacetylene C5H84, 64 |
 | | Compound Data | | Melting point | -89.85 °C | 183.30 K | | CSID | 62241 | H bond acceptors | 0 | Rule of 5 violations | 0 | | Molecular weight | 68.117 | H bond donors | 0 | ACD/LogP | 1.88 | | Phase 25 °C | liquid/gas | Rotatable bonds | 0 | Predicted density | 0.71 g/cm3 | | SMILES | C#CC(C)C | | STD InChIKey | USCSRAJGJYMJFZ-UHFFFAOYAZ | | Melting Points | | mp °C | source | |
|---|
| -90.00 | American Petroleum Institute. Research Project 44; Selected ... | | -89.70 | PHYSPROP |
|
|
| | | isopropylcyclopentane C8H164, 64 |
 | | Compound Data | | Melting point | -111.20 °C | 161.95 K | | CSID | 18604 | H bond acceptors | 0 | Rule of 5 violations | 0 | | Molecular weight | 112.2126 | H bond donors | 0 | ACD/LogP | 4.19 | | Phase 25 °C | liquid/gas | Rotatable bonds | 1 | Predicted density | 0.80 g/cm3 | | SMILES | CC(C)C1CCCC1 | | STD InChIKey | TVSBRLGQVHJIKT-UHFFFAOYAE | | Melting Points | | mp °C | source | |
|---|
| -111.00 | American Petroleum Institute. Research Project 44; Selected ... | | -111.40 | PHYSPROP |
|
|
| | | isopropylcyclopropane C6H124, 64 |
 | | Compound Data | | Melting point | -112.95 °C | 160.20 K | | CSID | 121640 | H bond acceptors | 0 | Rule of 5 violations | 0 | | Molecular weight | 84.1595 | H bond donors | 0 | ACD/LogP | 3.06 | | Phase 25 °C | liquid/gas | Rotatable bonds | 1 | Predicted density | 0.80 g/cm3 | | SMILES | CC(C)C1CC1 | | STD InChIKey | HPBROFGYTXOJIO-UHFFFAOYAX | | Melting Points | | mp °C | source | |
|---|
| -113.00 | American Petroleum Institute. Research Project 44; Selected ... | | -112.90 | PHYSPROP |
|
|
| | | isoquinoline C9H7N3, 64 |
 | | Compound Data | | Melting point | 26.23 °C | 299.38 K | | CSID | 8098 | H bond acceptors | 1 | Rule of 5 violations | 0 | | Molecular weight | 129.1586 | H bond donors | 0 | ACD/LogP | 2.02 | | Phase 25 °C | solid | Rotatable bonds | 0 | Predicted density | 1.11 g/cm3 | | SMILES | c1ccc2cnccc2c1 | | STD InChIKey | AWJUIBRHMBBTKR-UHFFFAOYAX | | Melting Points | | mp °C | source | |
|---|
| 26.00 | Alfa Aesar | | 26.47 | PHYSPROP |
|
|
| | | isothiocyanatomethane C2H3NS3, 61, 64 |
 | | Compound Data | | Melting point | 34.33 °C | 307.48 K | | CSID | 10694 | H bond acceptors | 1 | Rule of 5 violations | 0 | | Molecular weight | 73.1169 | H bond donors | 0 | ACD/LogP | 0.94 | | Phase 25 °C | solid | Rotatable bonds | 0 | Predicted density | 0.95 g/cm3 | | SMILES | S=C=N/C | | STD InChIKey | LGDSHSYDSCRFAB-UHFFFAOYAS | | Melting Points | | mp °C | source | |
|---|
| 32.00 | Alfa Aesar | | 35.00 | Oxford University MSDS | | 36.00 | PHYSPROP |
|
|
| | | isovaleramide C5H11NO3, 64 |
 | | Compound Data | | Melting point | 136.50 °C | 409.65 K | | CSID | 10467 | H bond acceptors | 2 | Rule of 5 violations | 0 | | Molecular weight | 101.1469 | H bond donors | 2 | ACD/LogP | 0.18 | | Phase 25 °C | solid | Rotatable bonds | 2 | Predicted density | 0.90 g/cm3 | | SMILES | O=C(N)CC(C)C | | STD InChIKey | SANOUVWGPVYVAV-UHFFFAOYAT | | Melting Points | | mp °C | source | |
|---|
| 136.00 | Alfa Aesar | | 137.00 | PHYSPROP |
|
|
| | | isovaleric acid C5H10O23, 4, 35, 64 |
 | |
|
| | | julolidine C12H15N3, 64 |
 | | Compound Data | | Melting point | 37.50 °C | 310.65 K | | CSID | 61383 | H bond acceptors | 1 | Rule of 5 violations | 0 | | Molecular weight | 173.2542 | H bond donors | 0 | ACD/LogP | 3.26 | | Phase 25 °C | solid | Rotatable bonds | 0 | Predicted density | 1.10 g/cm3 | | SMILES | c13c2c(ccc1)CCCN2CCC3 | | STD InChIKey | DZFWNZJKBJOGFQ-UHFFFAOYAM | | Melting Points | | mp °C | source | |
|---|
| 35.00 | Alfa Aesar | | 40.00 | PHYSPROP |
|
|
| | | ketobemidone C15H21NO29, 48, 64 |
 | |
|
| | | kojic acid C6H6O43, 32, 64 |
 | | Compound Data | | Melting point | 153.67 °C | 426.82 K | | CSID | 3708 | H bond acceptors | 4 | Rule of 5 violations | 0 | | Molecular weight | 142.1094 | H bond donors | 2 | ACD/LogP | -0.64 | | Phase 25 °C | solid | Rotatable bonds | 3 | Predicted density | 1.54 g/cm3 | | SMILES | O=C1/C=C(\O/C=C1/O)CO | | STD InChIKey | BEJNERDRQOWKJM-UHFFFAOYAO | | Melting Points | | mp °C | source | |
|---|
| 154.00 | Alfa Aesar | | 153.50 | DrugBank | | 153.50 | PHYSPROP |
|
|
| | | lauric acid C12H24O23, 32, 61, 64 |
 | | Compound Data | | Melting point | 43.85 °C | 317.00 K | | CSID | 3756 | H bond acceptors | 2 | Rule of 5 violations | 1 | | Molecular weight | 200.3178 | H bond donors | 1 | ACD/LogP | 5.03 | | Phase 25 °C | solid | Rotatable bonds | 10 | Predicted density | 0.91 g/cm3 | | SMILES | O=C(O)CCCCCCCCCCC | | STD InChIKey | POULHZVOKOAJMA-UHFFFAOYAP | | Melting Points | | mp °C | source | |
|---|
| 44.00 | Alfa Aesar | | 43.20 | DrugBank | | 45.00 | Oxford University MSDS | | 43.20 | PHYSPROP |
|
|
| | | leflunomide C12H9F3N2O232, 64 |
 | | Compound Data | | Melting point | 166.00 °C | 439.15 K | | CSID | 3762 | H bond acceptors | 4 | Rule of 5 violations | 0 | | Molecular weight | 270.2073 | H bond donors | 1 | ACD/LogP | 1.95 | | Phase 25 °C | solid | Rotatable bonds | 2 | Predicted density | 1.39 g/cm3 | | SMILES | O=C(Nc1ccc(cc1)C(F)(F)F)c2c(onc2)C | | STD InChIKey | VHOGYURTWQBHIL-UHFFFAOYAS | | Melting Points | | mp °C | source | |
|---|
| 165.50 | DrugBank | | 166.50 | PHYSPROP |
|
|
| | | lepidine C10H9N3, 64 |
 | | Compound Data | | Melting point | 9.75 °C | 282.90 K | | CSID | 13854818 | H bond acceptors | 1 | Rule of 5 violations | 0 | | Molecular weight | 143.1852 | H bond donors | 0 | ACD/LogP | 2.54 | | Phase 25 °C | liquid/gas | Rotatable bonds | 0 | Predicted density | 1.08 g/cm3 | | SMILES | Cc1ccnc2ccccc12 | | STD InChIKey | MUDSDYNRBDKLGK-UHFFFAOYAO | | Melting Points | | mp °C | source | |
|---|
| 10.00 | Alfa Aesar | | 9.50 | PHYSPROP |
|
|
| | | letrozole C17H11N59, 32, 48, 64 |
 | |
|
| | | levulinic acid C5H8O33, 32, 64 |
 | | Compound Data | | Melting point | 31.67 °C | 304.82 K | | CSID | 11091 | H bond acceptors | 3 | Rule of 5 violations | 0 | | Molecular weight | 116.1152 | H bond donors | 1 | ACD/LogP | 0.00 | | Phase 25 °C | solid | Rotatable bonds | 3 | Predicted density | 1.13 g/cm3 | | SMILES | CC(=O)CCC(=O)O | | STD InChIKey | JOOXCMJARBKPKM-UHFFFAOYAR | | Melting Points | | mp °C | source | |
|---|
| 29.00 | Alfa Aesar | | 33.00 | DrugBank | | 33.00 | PHYSPROP |
|
|
| | | linuron C9H10Cl2N2O244, 64 |
 | | Compound Data | | Melting point | 93.25 °C | 366.40 K | | CSID | 9130 | H bond acceptors | 4 | Rule of 5 violations | 0 | | Molecular weight | 249.0939 | H bond donors | 1 | ACD/LogP | 3.20 | | Phase 25 °C | solid | Rotatable bonds | 2 | Predicted density | 1.41 g/cm3 | | SMILES | Clc1ccc(NC(=O)N(OC)C)cc1Cl | | STD InChIKey | XKJMBINCVNINCA-UHFFFAOYAQ | | Melting Points | | mp °C | source | |
|---|
| 93.50 | Hughes LD; Palmer DS; Nigsch F and Mitchell JBO. 2008 Why ar... | | 93.00 | PHYSPROP |
|
|
| | | locula C8H10N2O3S3, 32, 44, 61, 64 |
 | |
|
| | | lumazine C6H4N4O23, 64 |
 | | Compound Data | | Melting point | 348.25 °C | 621.40 K | | CSID | 9832 | H bond acceptors | 6 | Rule of 5 violations | 0 | | Molecular weight | 164.1216 | H bond donors | 2 | ACD/LogP | 0.00 | | Phase 25 °C | solid | Rotatable bonds | 0 | Predicted density | 1.52 g/cm3 | | SMILES | c1cnc2c(n1)c(=O)[nH]c(=O)[nH]2 | | STD InChIKey | UYEUUXMDVNYCAM-UHFFFAOYAF | | Melting Points | | mp °C | source | |
|---|
| 348.00 | Alfa Aesar | | 348.50 | PHYSPROP |
|
|
| | | maleic anhydride C4H2O33, 61, 64 |
 | | Compound Data | | Melting point | 53.27 °C | 326.42 K | | CSID | 7635 | H bond acceptors | 3 | Rule of 5 violations | 0 | | Molecular weight | 98.0569 | H bond donors | 0 | ACD/LogP | 0.00 | | Phase 25 °C | solid | Rotatable bonds | 0 | Predicted density | 1.49 g/cm3 | | SMILES | C1=CC(=O)OC1=O | | STD InChIKey | FPYJFEHAWHCUMM-UHFFFAOYAP | | Melting Points | | mp °C | source | |
|---|
| 54.00 | Alfa Aesar | | 53.00 | Oxford University MSDS | | 52.80 | PHYSPROP |
|
|
| | | maleimide C4H3NO23, 64 |
 | | Compound Data | | Melting point | 93.00 °C | 366.15 K | | CSID | 10471 | H bond acceptors | 3 | Rule of 5 violations | 0 | | Molecular weight | 97.0721 | H bond donors | 1 | ACD/LogP | 0.00 | | Phase 25 °C | solid | Rotatable bonds | 0 | Predicted density | 1.37 g/cm3 | | SMILES | C1=CC(=O)NC1=O | | STD InChIKey | PEEHTFAAVSWFBL-UHFFFAOYAL | | Melting Points | | mp °C | source | |
|---|
| 92.00 | Alfa Aesar | | 94.00 | PHYSPROP |
|
|
| | | malononitrile C3H2N22, 3, 64 |
 | |
|
| | | maltol C6H6O33, 64 |
 | | Compound Data | | Melting point | 162.25 °C | 435.40 K | | CSID | 8066 | H bond acceptors | 3 | Rule of 5 violations | 0 | | Molecular weight | 126.11 | H bond donors | 1 | ACD/LogP | 0.07 | | Phase 25 °C | solid | Rotatable bonds | 1 | Predicted density | 1.35 g/cm3 | | SMILES | Cc1c(c(=O)cco1)O | | STD InChIKey | XPCTZQVDEJYUGT-UHFFFAOYAH | | Melting Points | | mp °C | source | |
|---|
| 163.00 | Alfa Aesar | | 161.50 | PHYSPROP |
|
|
| | | maprotiline C20H23N9, 48, 64 |
 | |
|
| | | mebrofenin C15H19BrN2O53, 64 |
 | | Compound Data | | Melting point | 196.50 °C | 469.65 K | | CSID | 48922 | H bond acceptors | 7 | Rule of 5 violations | 0 | | Molecular weight | 387.2258 | H bond donors | 3 | ACD/LogP | 3.09 | | Phase 25 °C | solid | Rotatable bonds | 7 | Predicted density | 1.55 g/cm3 | | SMILES | Brc1c(c(c(cc1C)C)NC(=O)CN(CC(=O)O)CC(=O)O)C | | STD InChIKey | MHPZZZZLAQGTHT-UHFFFAOYAH | | Melting Points | | mp °C | source | |
|---|
| 194.00 | Alfa Aesar | | 199.00 | PHYSPROP |
|
|
| | | mecloqualone C15H11ClN2O9, 48, 64 |
 | |
|
| | | medronic acid CH6O6P23, 64 |
 | | Compound Data | | Melting point | 201.25 °C | 474.40 K | | CSID | 15308 | H bond acceptors | 6 | Rule of 5 violations | 0 | | Molecular weight | 176.0023 | H bond donors | 4 | ACD/LogP | -4.12 | | Phase 25 °C | solid | Rotatable bonds | 2 | Predicted density | 2.11 g/cm3 | | SMILES | O=P(O)(O)CP(=O)(O)O | | STD InChIKey | MBKDYNNUVRNNRF-UHFFFAOYAP | | Melting Points | | mp °C | source | |
|---|
| 203.00 | Alfa Aesar | | 199.50 | PHYSPROP |
|
|
| | | Meldrum's acid C6H8O43, 48, 64 |
 | |
|
| | | menadione C11H8O23, 32, 61, 64 |
 | | Compound Data | | Melting point | 104.25 °C | 377.40 K | | CSID | 3915 | H bond acceptors | 2 | Rule of 5 violations | 0 | | Molecular weight | 172.18 | H bond donors | 0 | ACD/LogP | 2.38 | | Phase 25 °C | solid | Rotatable bonds | 0 | Predicted density | 1.23 g/cm3 | | SMILES | O=C\2c1c(cccc1)C(=O)/C(=C/2)C | | STD InChIKey | MJVAVZPDRWSRRC-UHFFFAOYAY | | Melting Points | | mp °C | source | |
|---|
| 106.00 | Alfa Aesar | | 102.00 | DrugBank | | 102.00 | Oxford University MSDS | | 107.00 | PHYSPROP |
|
|
| | | mercaptosuccinic acid C4H6O4S3, 64 |
 | | Compound Data | | Melting point | 150.50 °C | 423.65 K | | CSID | 6032 | H bond acceptors | 4 | Rule of 5 violations | 0 | | Molecular weight | 150.153 | H bond donors | 2 | ACD/LogP | 0.00 | | Phase 25 °C | solid | Rotatable bonds | 4 | Predicted density | 1.53 g/cm3 | | SMILES | C(C(C(=O)O)S)C(=O)O | | STD InChIKey | NJRXVEJTAYWCQJ-UHFFFAOYAP | | Melting Points | | mp °C | source | |
|---|
| 152.00 | Alfa Aesar | | 149.00 | PHYSPROP |
|
|
| | | mesitylacetic acid C11H14O23, 47 |
 | | Compound Data | | Melting point | 168.43 °C | 441.57 K | | CSID | 70500 | H bond acceptors | 2 | Rule of 5 violations | 0 | | Molecular weight | 178.2277 | H bond donors | 1 | ACD/LogP | 2.88 | | Phase 25 °C | solid | Rotatable bonds | 2 | Predicted density | 1.07 g/cm3 | | SMILES | O=C(O)Cc1c(cc(cc1C)C)C | | STD InChIKey | CQWMQAKKAHTCSC-UHFFFAOYAD | | Melting Points | | mp °C | source | |
|---|
| 169.00 | Alfa Aesar | | 167.85 | IUCr |
|
|
| | | mesitylene C9H123, 4, 61, 64 |
 | |
|
| | | mesitylene-2-sulfonyl chloride C9H11ClO2S3, 64 |
 | | Compound Data | | Melting point | 55.50 °C | 328.65 K | | CSID | 12504 | H bond acceptors | 2 | Rule of 5 violations | 0 | | Molecular weight | 218.7004 | H bond donors | 0 | ACD/LogP | 3.37 | | Phase 25 °C | solid | Rotatable bonds | 1 | Predicted density | 1.25 g/cm3 | | SMILES | O=S(Cl)(=O)c1c(cc(cc1C)C)C | | STD InChIKey | PVJZBZSCGJAWNG-UHFFFAOYAR | | Melting Points | | mp °C | source | |
|---|
| 55.00 | Alfa Aesar | | 56.00 | PHYSPROP |
|
|
| | | methacrylonitrile C4H5N2, 64 |
 | | Compound Data | | Melting point | -35.90 °C | 237.25 K | | CSID | 29101 | H bond acceptors | 1 | Rule of 5 violations | 0 | | Molecular weight | 67.0892 | H bond donors | 0 | ACD/LogP | 0.74 | | Phase 25 °C | liquid/gas | Rotatable bonds | 0 | Predicted density | 0.81 g/cm3 | | SMILES | N#C\C(=C)C | | STD InChIKey | GYCMBHHDWRMZGG-UHFFFAOYAX | | Melting Points | | mp °C | source | |
|---|
| -36.00 | Aldrich Chemical Company; Aldrich Catalog-Handbook of Fine C... | | -35.80 | PHYSPROP |
|
|
| | | methallatal C10H14N2O2S9, 48, 64 |
 | |
|
| | | methane CH459, 61, 64, 73 |
 | |
|
| | | methanethiol CH4S61, 64 |
 | | Compound Data | | Melting point | -122.00 °C | 151.15 K | | CSID | 855 | H bond acceptors | 0 | Rule of 5 violations | 0 | | Molecular weight | 48.1075 | H bond donors | 0 | ACD/LogP | 0.72 | | Phase 25 °C | liquid/gas | Rotatable bonds | 0 | Predicted density | 0.81 g/cm3 | | SMILES | SC | | STD InChIKey | LSDPWZHWYPCBBB-UHFFFAOYAW | | Melting Points | | mp °C | source | |
|---|
| -121.00 | Oxford University MSDS | | -123.00 | PHYSPROP |
|
|
| | | methanol CH4O3, 3, 4, 19, 28, 61, 61, 64, 72 |
 | |
|
| | | methimazole C4H6N2S3, 28, 32, 56, 64, 72, 81, 84 |
 | |
|
| | | methimazole C8H8O3, 8, 28, 31, 39, 61, 61, 64, 84 |
 | |
|
| | | methimazole C12H103, 44, 61, 64, 70 |
 | |
|
| | | methoxyacetic acid C3H6O33, 35, 64 |
 | | Compound Data | | Melting point | 7.80 °C | 280.95 K | | CSID | 11750 | H bond acceptors | 3 | Rule of 5 violations | 0 | | Molecular weight | 90.0779 | H bond donors | 1 | ACD/LogP | -0.96 | | Phase 25 °C | liquid/gas | Rotatable bonds | 2 | Predicted density | 1.14 g/cm3 | | SMILES | O=C(O)COC | | STD InChIKey | RMIODHQZRUFFFF-UHFFFAOYAC | | Melting Points | | mp °C | source | |
|---|
| 8.00 | Alfa Aesar | | 7.70 | EPISuite-ChemSpider | | 7.70 | PHYSPROP |
|
|
| | | methoxyflurane C3H4Cl2F2O3, 32, 61, 64 |
 | | Compound Data | | Melting point | -35.25 °C | 237.90 K | | CSID | 3973 | H bond acceptors | 1 | Rule of 5 violations | 0 | | Molecular weight | 164.9661 | H bond donors | 0 | ACD/LogP | 1.66 | | Phase 25 °C | liquid/gas | Rotatable bonds | 2 | Predicted density | 1.39 g/cm3 | | SMILES | ClC(Cl)C(F)(F)OC | | STD InChIKey | RFKMCNOHBTXSMU-UHFFFAOYAI | | Melting Points | | mp °C | source | |
|---|
| -36.00 | Alfa Aesar | | -35.00 | DrugBank | | -35.00 | Oxford University MSDS | | -35.00 | PHYSPROP |
|
|
| | | methyl 2-amino-5-chlorobenzoate C8H8ClNO23, 64 |
 | | Compound Data | | Melting point | 68.00 °C | 341.15 K | | CSID | 71213 | H bond acceptors | 3 | Rule of 5 violations | 0 | | Molecular weight | 185.6076 | H bond donors | 2 | ACD/LogP | 2.92 | | Phase 25 °C | solid | Rotatable bonds | 3 | Predicted density | 1.31 g/cm3 | | SMILES | Clc1cc(C(=O)OC)c(N)cc1 | | STD InChIKey | IGHVUURTQGBABT-UHFFFAOYAW | | Melting Points | | mp °C | source | |
|---|
| 69.00 | Alfa Aesar | | 67.00 | PHYSPROP |
|
|
| | | methyl 2-aminobenzoate C8H9NO22, 3, 61, 64 |
 | |
|
| | | methyl 2,4-dihydroxybenzoate C8H8O43, 64 |
 | | Compound Data | | Melting point | 118.75 °C | 391.90 K | | CSID | 15663 | H bond acceptors | 4 | Rule of 5 violations | 0 | | Molecular weight | 168.1467 | H bond donors | 2 | ACD/LogP | 1.92 | | Phase 25 °C | solid | Rotatable bonds | 4 | Predicted density | 1.35 g/cm3 | | SMILES | O=C(OC)c1ccc(O)cc1O | | STD InChIKey | IIFCLXHRIYTHPV-UHFFFAOYAU | | Melting Points | | mp °C | source | |
|---|
| 118.00 | Alfa Aesar | | 119.50 | PHYSPROP |
|
|
| | | methyl 2,5-dichlorobenzoate C8H6Cl2O23, 64 |
 | | Compound Data | | Melting point | 38.75 °C | 311.90 K | | CSID | 16951 | H bond acceptors | 2 | Rule of 5 violations | 0 | | Molecular weight | 205.038 | H bond donors | 0 | ACD/LogP | 3.06 | | Phase 25 °C | solid | Rotatable bonds | 2 | Predicted density | 1.35 g/cm3 | | SMILES | O=C(OC)c1cc(Cl)ccc1Cl | | STD InChIKey | SPJQBGGHUDNAIC-UHFFFAOYAB | | Melting Points | | mp °C | source | |
|---|
| 39.00 | Alfa Aesar | | 38.50 | PHYSPROP |
|
|
| | | methyl 3-bromobenzoate C8H7BrO23, 7, 64 |
 | |
|
| | | methyl 3-hydroxy-2-naphthoate C12H10O33, 64 |
 | | Compound Data | | Melting point | 74.25 °C | 347.40 K | | CSID | 63350 | H bond acceptors | 3 | Rule of 5 violations | 0 | | Molecular weight | 202.206 | H bond donors | 1 | ACD/LogP | 3.46 | | Phase 25 °C | solid | Rotatable bonds | 3 | Predicted density | 1.26 g/cm3 | | SMILES | O=C(OC)c2cc1c(cccc1)cc2O | | STD InChIKey | YVVBECLPRBAATK-UHFFFAOYAT | | Melting Points | | mp °C | source | |
|---|
| 73.00 | Alfa Aesar | | 75.50 | PHYSPROP |
|
|
| | | methyl 3-hydroxybenzoate C8H8O32, 3, 64 |
 | |
|
| | | methyl 3-nitrobenzoate C8H7IO27, 64 |
 | | Compound Data | | Melting point | 54.25 °C | 327.40 K | | CSID | 62471 | H bond acceptors | 2 | Rule of 5 violations | 0 | | Molecular weight | 262.0444 | H bond donors | 0 | ACD/LogP | 3.31 | | Phase 25 °C | solid | Rotatable bonds | 2 | Predicted density | 1.75 g/cm3 | | SMILES | O=C(OC)c1cc(I)ccc1 | | STD InChIKey | NPXOIGSBRLCOSD-UHFFFAOYAY | | Melting Points | | mp °C | source | |
|---|
| 54.00 | Beilstein F. K.; Beilsteins Handbuch der Organischen Chemie.... | | 54.50 | PHYSPROP |
|
|
| | | methyl 3,4-dimethoxybenzoate C10H12O42, 3, 64 |
 | |
|
| | | methyl 3,4,5-trimethoxybenzoate C11H14O52, 3, 48, 64 |
 | |
|
| | | methyl 3,5-dimethoxybenzoate C10H12O42, 3 |
 | | Compound Data | | Melting point | 42.50 °C | 315.65 K | | CSID | 21159597 | H bond acceptors | 4 | Rule of 5 violations | 0 | | Molecular weight | 196.1999 | H bond donors | 0 | ACD/LogP | 1.85 | | Phase 25 °C | solid | Rotatable bonds | 4 | Predicted density | 1.12 g/cm3 | | SMILES | COc1cc(cc(OC)c1)C(=O)OC | | STD InChIKey | YXUIOVUOFQKWDM-UHFFFAOYAR | | Melting Points | | mp °C | source | |
|---|
| 43.00 | Aldrich Chemical Company; Aldrich Catalog-Handbook of Fine C... | | 42.00 | Alfa Aesar |
|
|
| | | methyl 4-aminobenzoate C8H9NO23, 64, 70, 72 |
 | |
|
| | | methyl 4-bromobenzoate C8H7BrO23, 7, 64 |
 | |
|
| | | methyl 4-chloro-3-nitrobenzoate C8H6ClNO43, 64 |
 | | Compound Data | | Melting point | 81.50 °C | 354.65 K | | CSID | 642951 | H bond acceptors | 5 | Rule of 5 violations | 0 | | Molecular weight | 215.5905 | H bond donors | 0 | ACD/LogP | 2.18 | | Phase 25 °C | solid | Rotatable bonds | 3 | Predicted density | 1.43 g/cm3 | | SMILES | O=[N+]([O-])c1cc(ccc1Cl)C(=O)OC | | STD InChIKey | XRTKWPWDSUNLHS-UHFFFAOYAD | | Melting Points | | mp °C | source | |
|---|
| 80.00 | Alfa Aesar | | 83.00 | PHYSPROP |
|
|
| | | methyl 4-chlorobenzoate C8H7ClO22, 3, 64 |
 | |
|
| | | methyl 4-cyanobenzoate C9H7NO23, 7, 48 |
 | |
|
| | | methyl 4-formylbenzoate C9H8O32, 3, 61 |
 | |
|
| | | methyl 4-iodobenzoate C8H7IO23, 7, 64 |
 | |
|
| | | methyl 4-methoxybenzoate C9H10O32, 3, 64 |
 | |
|
| | | methyl 4-methylbenzoate C9H10O22, 3, 64 |
 | |
|
| | | methyl 4-nitrobenzoate C8H7NO42, 3, 64 |
 | |
|
| | | methyl 5-chloro-2-hydroxybenzoate C8H7ClO33, 64 |
 | | Compound Data | | Melting point | 48.00 °C | 321.15 K | | CSID | 70085 | H bond acceptors | 3 | Rule of 5 violations | 0 | | Molecular weight | 186.5924 | H bond donors | 1 | ACD/LogP | 3.24 | | Phase 25 °C | solid | Rotatable bonds | 3 | Predicted density | 1.35 g/cm3 | | SMILES | Clc1cc(C(=O)OC)c(O)cc1 | | STD InChIKey | KJWHRMZKJXOWFC-UHFFFAOYAE | | Melting Points | | mp °C | source | |
|---|
| 46.00 | Alfa Aesar | | 50.00 | PHYSPROP |
|
|
| | | methyl 5-chloro-2-nitrobenzoate C8H6ClNO43, 64 |
 | | Compound Data | | Melting point | 48.75 °C | 321.90 K | | CSID | 149513 | H bond acceptors | 5 | Rule of 5 violations | 0 | | Molecular weight | 215.5905 | H bond donors | 0 | ACD/LogP | 2.37 | | Phase 25 °C | solid | Rotatable bonds | 3 | Predicted density | 1.43 g/cm3 | | SMILES | O=[N+]([O-])c1c(cc(Cl)cc1)C(=O)OC | | STD InChIKey | JGBJHRKCUKTQOE-UHFFFAOYAV | | Melting Points | | mp °C | source | |
|---|
| 49.00 | Alfa Aesar | | 48.50 | PHYSPROP |
|
|
| | | methyl acetylsalicylate C10H10O47, 64 |
 | | Compound Data | | Melting point | 51.75 °C | 324.90 K | | CSID | 61759 | H bond acceptors | 4 | Rule of 5 violations | 0 | | Molecular weight | 194.184 | H bond donors | 0 | ACD/LogP | 1.47 | | Phase 25 °C | solid | Rotatable bonds | 4 | Predicted density | 1.18 g/cm3 | | SMILES | O=C(Oc1ccccc1C(=O)OC)C | | STD InChIKey | ONWPLBKWMAUFGZ-UHFFFAOYAR | | Melting Points | | mp °C | source | |
|---|
| 52.00 | Beilstein F. K.; Beilsteins Handbuch der Organischen Chemie.... | | 51.50 | PHYSPROP |
|
|
| | | methyl acrylate C4H6O22, 3, 61, 64 |
 | |
|
| | | methyl benzilate C15H14O33, 64 |
 | | Compound Data | | Melting point | 75.40 °C | 348.55 K | | CSID | 59546 | H bond acceptors | 3 | Rule of 5 violations | 0 | | Molecular weight | 242.2699 | H bond donors | 1 | ACD/LogP | 3.01 | | Phase 25 °C | solid | Rotatable bonds | 5 | Predicted density | 1.19 g/cm3 | | SMILES | O=C(OC)C(O)(c1ccccc1)c2ccccc2 | | STD InChIKey | LJFIHTFNTGQZJL-UHFFFAOYAO | | Melting Points | | mp °C | source | |
|---|
| 75.00 | Alfa Aesar | | 75.80 | PHYSPROP |
|
|
| | | methyl benzoate C8H8O23, 31, 61, 64 |
 | |
|
| | | methyl carbamate C2H5NO23, 64 |
 | | Compound Data | | Melting point | 54.50 °C | 327.65 K | | CSID | 11229 | H bond acceptors | 3 | Rule of 5 violations | 0 | | Molecular weight | 75.0666 | H bond donors | 2 | ACD/LogP | -0.68 | | Phase 25 °C | solid | Rotatable bonds | 1 | Predicted density | 1.09 g/cm3 | | SMILES | O=C(OC)N | | STD InChIKey | GTCAXTIRRLKXRU-UHFFFAOYAJ | | Melting Points | | mp °C | source | |
|---|
| 55.00 | Alfa Aesar | | 54.00 | PHYSPROP |
|
|
| | | methyl carbazate C2H6N2O23, 48, 64 |
 | |
|
| | | methyl chloroacetate C3H5ClO23, 64 |
 | | Compound Data | | Melting point | -32.05 °C | 241.10 K | | CSID | 13872667 | H bond acceptors | 2 | Rule of 5 violations | 0 | | Molecular weight | 108.5236 | H bond donors | 0 | ACD/LogP | 0.41 | | Phase 25 °C | liquid/gas | Rotatable bonds | 2 | Predicted density | 1.17 g/cm3 | | SMILES | ClCC(=O)OC | | STD InChIKey | QABLOFMHHSOFRJ-UHFFFAOYAJ | | Melting Points | | mp °C | source | |
|---|
| -32.00 | Alfa Aesar | | -32.10 | PHYSPROP |
|
|
| | | methyl dichloroacetate C3H4Cl2O23, 64 |
 | | Compound Data | | Melting point | -51.95 °C | 221.20 K | | CSID | 8013 | H bond acceptors | 2 | Rule of 5 violations | 0 | | Molecular weight | 142.9687 | H bond donors | 0 | ACD/LogP | 0.99 | | Phase 25 °C | liquid/gas | Rotatable bonds | 2 | Predicted density | 1.36 g/cm3 | | SMILES | ClC(Cl)C(=O)OC | | STD InChIKey | HKMLRUAPIDAGIE-UHFFFAOYAG | | Melting Points | | mp °C | source | |
|---|
| -52.00 | Alfa Aesar | | -51.90 | PHYSPROP |
|
|
| | | methyl dodecanoate C13H26O23, 64 |
 | | Compound Data | | Melting point | 5.10 °C | 278.25 K | | CSID | 7847 | H bond acceptors | 2 | Rule of 5 violations | 1 | | Molecular weight | 214.3443 | H bond donors | 0 | ACD/LogP | 5.49 | | Phase 25 °C | liquid/gas | Rotatable bonds | 11 | Predicted density | 0.87 g/cm3 | | SMILES | O=C(OC)CCCCCCCCCCC | | STD InChIKey | UQDUPQYQJKYHQI-UHFFFAOYAP | | Melting Points | | mp °C | source | |
|---|
| 5.00 | Alfa Aesar | | 5.20 | PHYSPROP |
|
|
| | | methyl formate C2H4O22, 3, 61, 64 |
 | |
|
| | | methyl hydroquinone C7H8O23, 61, 64 |
 | | Compound Data | | Melting point | 128.67 °C | 401.82 K | | CSID | 6983 | H bond acceptors | 2 | Rule of 5 violations | 0 | | Molecular weight | 124.1372 | H bond donors | 2 | ACD/LogP | 1.10 | | Phase 25 °C | solid | Rotatable bonds | 2 | Predicted density | 1.21 g/cm3 | | SMILES | Oc1ccc(O)c(c1)C | | STD InChIKey | CNHDIAIOKMXOLK-UHFFFAOYAG | | Melting Points | | mp °C | source | |
|---|
| 129.00 | Alfa Aesar | | 129.00 | Oxford University MSDS | | 128.00 | PHYSPROP |
|
|
| | | methyl indole-3-carboxylate C10H9NO23, 64 |
 | | Compound Data | | Melting point | 150.75 °C | 423.90 K | | CSID | 512092 | H bond acceptors | 3 | Rule of 5 violations | 0 | | Molecular weight | 175.184 | H bond donors | 1 | ACD/LogP | 2.54 | | Phase 25 °C | solid | Rotatable bonds | 2 | Predicted density | 1.25 g/cm3 | | SMILES | COC(=O)c2cnc1ccccc12 | | STD InChIKey | QXAUTQFAWKKNLM-UHFFFAOYAU | | Melting Points | | mp °C | source | |
|---|
| 151.00 | Alfa Aesar | | 150.50 | PHYSPROP |
|
|
| | | methyl isobutyrate C5H10O23, 64 |
 | | Compound Data | | Melting point | -84.85 °C | 188.30 K | | CSID | 10571 | H bond acceptors | 2 | Rule of 5 violations | 0 | | Molecular weight | 102.1317 | H bond donors | 0 | ACD/LogP | 1.06 | | Phase 25 °C | liquid/gas | Rotatable bonds | 2 | Predicted density | 0.89 g/cm3 | | SMILES | O=C(OC)C(C)C | | STD InChIKey | BHIWKHZACMWKOJ-UHFFFAOYAO | | Melting Points | | mp °C | source | |
|---|
| -85.00 | Alfa Aesar | | -84.70 | PHYSPROP |
|
|
| | | methyl isopropyl sulfide C4H10S4, 64 |
 | | Compound Data | | Melting point | -101.75 °C | 171.40 K | | CSID | 14512 | H bond acceptors | 0 | Rule of 5 violations | 0 | | Molecular weight | 90.1872 | H bond donors | 0 | ACD/LogP | 1.77 | | Phase 25 °C | liquid/gas | Rotatable bonds | 1 | Predicted density | 0.83 g/cm3 | | SMILES | S(C(C)C)C | | STD InChIKey | ROSSIHMZZJOVOU-UHFFFAOYAD | | Melting Points | | mp °C | source | |
|---|
| -102.00 | American Petroleum Institute. Research Project 44; Selected ... | | -101.50 | PHYSPROP |
|
|
| | | methyl methacrylate C5H8O22, 3, 61, 64 |
 | |
|
| | | methyl N-methylanthranilate C9H11NO23, 64 |
 | | Compound Data | | Melting point | 18.50 °C | 291.65 K | | CSID | 21108245 | H bond acceptors | 3 | Rule of 5 violations | 0 | | Molecular weight | 165.1891 | H bond donors | 1 | ACD/LogP | 2.69 | | Phase 25 °C | liquid/gas | Rotatable bonds | 3 | Predicted density | 1.12 g/cm3 | | SMILES | CNc1ccccc1C(=O)OC | | STD InChIKey | GVOWHGSUZUUUDR-UHFFFAOYAS | | Melting Points | | mp °C | source | |
|---|
| 18.00 | Alfa Aesar | | 19.00 | PHYSPROP |
|
|
| | | methyl nicotinate C7H7NO23, 64 |
 | | Compound Data | | Melting point | 42.25 °C | 315.40 K | | CSID | 21111785 | H bond acceptors | 3 | Rule of 5 violations | 0 | | Molecular weight | 137.136 | H bond donors | 0 | ACD/LogP | 0.88 | | Phase 25 °C | solid | Rotatable bonds | 2 | Predicted density | 1.14 g/cm3 | | SMILES | O=C(OC)c1cccnc1 | | STD InChIKey | YNBADRVTZLEFNH-UHFFFAOYAU | | Melting Points | | mp °C | source | |
|---|
| 42.00 | Alfa Aesar | | 42.50 | PHYSPROP |
|
|
| | | methyl palmitate C17H34O23, 64 |
 | | Compound Data | | Melting point | 30.50 °C | 303.65 K | | CSID | 7889 | H bond acceptors | 2 | Rule of 5 violations | 1 | | Molecular weight | 270.4507 | H bond donors | 0 | ACD/LogP | 7.62 | | Phase 25 °C | solid | Rotatable bonds | 15 | Predicted density | 0.86 g/cm3 | | SMILES | O=C(OC)CCCCCCCCCCCCCCC | | STD InChIKey | FLIACVVOZYBSBS-UHFFFAOYAK | | Melting Points | | mp °C | source | |
|---|
| 31.00 | Alfa Aesar | | 30.00 | PHYSPROP |
|
|
| | | methyl phenyl sulfone C7H8O2S3, 64 |
 | | Compound Data | | Melting point | 86.50 °C | 359.65 K | | CSID | 17347 | H bond acceptors | 2 | Rule of 5 violations | 0 | | Molecular weight | 156.2022 | H bond donors | 0 | ACD/LogP | 0.50 | | Phase 25 °C | solid | Rotatable bonds | 1 | Predicted density | 1.19 g/cm3 | | SMILES | O=S(=O)(c1ccccc1)C | | STD InChIKey | JCDWETOKTFWTHA-UHFFFAOYAQ | | Melting Points | | mp °C | source | |
|---|
| 87.00 | Alfa Aesar | | 86.00 | PHYSPROP |
|
|
| | | methyl phenylsulfonylacetate C9H10O4S3, 64 |
 | | Compound Data | | Melting point | 32.50 °C | 305.65 K | | CSID | 483123 | H bond acceptors | 4 | Rule of 5 violations | 0 | | Molecular weight | 214.2383 | H bond donors | 0 | ACD/LogP | 0.70 | | Phase 25 °C | solid | Rotatable bonds | 4 | Predicted density | 1.28 g/cm3 | | SMILES | COC(=O)CS(=O)(=O)c1ccccc1 | | STD InChIKey | NLEAIFBNKPYTGN-UHFFFAOYAT | | Melting Points | | mp °C | source | |
|---|
| 30.00 | Alfa Aesar | | 35.00 | PHYSPROP |
|
|
| | | methyl propionate C4H8O22, 3, 61, 64 |
 | |
|
| | | methyl salicylate C8H8O32, 3, 61, 64 |
 | |
|
| | | methyl stearate C19H38O23, 64 |
 | | Compound Data | | Melting point | 39.55 °C | 312.70 K | | CSID | 7909 | H bond acceptors | 2 | Rule of 5 violations | 1 | | Molecular weight | 298.5038 | H bond donors | 0 | ACD/LogP | 8.68 | | Phase 25 °C | solid | Rotatable bonds | 17 | Predicted density | 0.86 g/cm3 | | SMILES | O=C(OC)CCCCCCCCCCCCCCCCC | | STD InChIKey | HPEUJPJOZXNMSJ-UHFFFAOYAE | | Melting Points | | mp °C | source | |
|---|
| 40.00 | Alfa Aesar | | 39.10 | PHYSPROP |
|
|
| | | methyl succinate C5H8O461, 64 |
 | | Compound Data | | Melting point | 57.75 °C | 330.90 K | | CSID | 69896 | H bond acceptors | 4 | Rule of 5 violations | 0 | | Molecular weight | 132.1146 | H bond donors | 1 | ACD/LogP | -0.21 | | Phase 25 °C | solid | Rotatable bonds | 4 | Predicted density | 1.21 g/cm3 | | SMILES | O=C(O)CCC(=O)OC | | STD InChIKey | JDRMYOQETPMYQX-UHFFFAOYAV | | Melting Points | | mp °C | source | |
|---|
| 57.50 | Oxford University MSDS | | 58.00 | PHYSPROP |
|
|
| | | methyl t-butyl ether C5H12O3, 4, 61, 64 |
 | |
|
| | | methyl terephthalate C9H8O42, 64 |
 | | Compound Data | | Melting point | 221.50 °C | 494.65 K | | CSID | 14760 | H bond acceptors | 4 | Rule of 5 violations | 0 | | Molecular weight | 180.1574 | H bond donors | 1 | ACD/LogP | 2.30 | | Phase 25 °C | solid | Rotatable bonds | 3 | Predicted density | 1.29 g/cm3 | | SMILES | O=C(OC)c1ccc(C(=O)O)cc1 | | STD InChIKey | REIDAMBAPLIATC-UHFFFAOYAP | | Melting Points | | mp °C | source | |
|---|
| 221.00 | Aldrich Chemical Company; Aldrich Catalog-Handbook of Fine C... | | 222.00 | PHYSPROP |
|
|
| | | methyl tetradecanoate C15H30O23, 64 |
 | | Compound Data | | Melting point | 18.50 °C | 291.65 K | | CSID | 29024 | H bond acceptors | 2 | Rule of 5 violations | 1 | | Molecular weight | 242.3975 | H bond donors | 0 | ACD/LogP | 6.55 | | Phase 25 °C | liquid/gas | Rotatable bonds | 13 | Predicted density | 0.87 g/cm3 | | SMILES | O=C(OC)CCCCCCCCCCCCC | | STD InChIKey | ZAZKJZBWRNNLDS-UHFFFAOYAX | | Melting Points | | mp °C | source | |
|---|
| 18.00 | Alfa Aesar | | 19.00 | PHYSPROP |
|
|
| | | methyl trichloroacetate C3H3Cl3O23, 64 |
 | | Compound Data | | Melting point | -17.75 °C | 255.40 K | | CSID | 11246 | H bond acceptors | 2 | Rule of 5 violations | 0 | | Molecular weight | 177.4137 | H bond donors | 0 | ACD/LogP | 2.11 | | Phase 25 °C | liquid/gas | Rotatable bonds | 1 | Predicted density | 1.53 g/cm3 | | SMILES | ClC(Cl)(Cl)C(=O)OC | | STD InChIKey | VHFUHRXYRYWELT-UHFFFAOYAW | | Melting Points | | mp °C | source | |
|---|
| -18.00 | Alfa Aesar | | -17.50 | PHYSPROP |
|
|
| | | methylamine CH5N61, 64 |
 | | Compound Data | | Melting point | -93.20 °C | 179.95 K | | CSID | 6089 | H bond acceptors | 1 | Rule of 5 violations | 0 | | Molecular weight | 31.0571 | H bond donors | 2 | ACD/LogP | -0.66 | | Phase 25 °C | liquid/gas | Rotatable bonds | 0 | Predicted density | 0.64 g/cm3 | | SMILES | NC | | STD InChIKey | BAVYZALUXZFZLV-UHFFFAOYAN | | Melting Points | | mp °C | source | |
|---|
| -93.00 | Oxford University MSDS | | -93.40 | PHYSPROP |
|
|
| | | methylcyclohexane C7H143, 4, 61, 64 |
 | |
|
| | | methylcyclopentane C6H123, 4, 64 |
 | |
|
| | | methylparaben C8H8O32, 3, 35, 44, 61, 64, 70 |
 | |
|
| | | methylphosphonic acid CH5O3P3, 61, 64 |
 | | Compound Data | | Melting point | 106.50 °C | 379.65 K | | CSID | 13220 | H bond acceptors | 3 | Rule of 5 violations | 0 | | Molecular weight | 96.0224 | H bond donors | 2 | ACD/LogP | -2.02 | | Phase 25 °C | solid | Rotatable bonds | 0 | Predicted density | 1.50 g/cm3 | | SMILES | O=P(O)(O)C | | STD InChIKey | YACKEPLHDIMKIO-UHFFFAOYAB | | Melting Points | | mp °C | source | |
|---|
| 105.00 | Alfa Aesar | | 106.00 | Oxford University MSDS | | 108.50 | PHYSPROP |
|
|
| | | methylphosphonic dichloride CH3Cl2OP61, 64 |
 | | Compound Data | | Melting point | 35.50 °C | 308.65 K | | CSID | 12150 | H bond acceptors | 1 | Rule of 5 violations | 0 | | Molecular weight | 132.9137 | H bond donors | 0 | ACD/LogP | 0.26 | | Phase 25 °C | solid | Rotatable bonds | 0 | Predicted density | 1.45 g/cm3 | | SMILES | ClP(Cl)(=O)C | | STD InChIKey | SCLFRABIDYGTAZ-UHFFFAOYAS | | Melting Points | | mp °C | source | |
|---|
| 35.00 | Oxford University MSDS | | 36.00 | PHYSPROP |
|
|
| | | methyltriacetoxysilane C7H12O6Si3, 64 |
 | | Compound Data | | Melting point | 41.75 °C | 314.90 K | | CSID | 70319 | H bond acceptors | 6 | Rule of 5 violations | 0 | | Molecular weight | 220.2521 | H bond donors | 0 | ACD/LogP | 1.37 | | Phase 25 °C | solid | Rotatable bonds | 6 | Predicted density | 1.16 g/cm3 | | SMILES | O=C(O[Si](OC(=O)C)(OC(=O)C)C)C | | STD InChIKey | TVJPBVNWVPUZBM-UHFFFAOYAG | | Melting Points | | mp °C | source | |
|---|
| 43.00 | Alfa Aesar | | 40.50 | PHYSPROP |
|
|
| | | methyltriphenylsilane C19H18Si3, 64 |
 | | Compound Data | | Melting point | 68.25 °C | 341.40 K | | CSID | 455964 | H bond acceptors | 0 | Rule of 5 violations | 1 | | Molecular weight | 274.4317 | H bond donors | 0 | ACD/LogP | 6.42 | | Phase 25 °C | solid | Rotatable bonds | 3 | Predicted density | 1.04 g/cm3 | | SMILES | c1(ccccc1)[Si](c2ccccc2)(c3ccccc3)C | | STD InChIKey | GIGVICQLYWGMGW-UHFFFAOYAN | | Melting Points | | mp °C | source | |
|---|
| 67.00 | Alfa Aesar | | 69.50 | PHYSPROP |
|
|
| | | metoclopramide C14H22ClN3O29, 32, 44, 48, 64 |
 | |
|
| | | metopimazine C22H27N3O3S29, 64 |
 | | Compound Data | | Melting point | 170.25 °C | 443.40 K | | CSID | 24584 | H bond acceptors | 6 | Rule of 5 violations | 0 | | Molecular weight | 445.5981 | H bond donors | 2 | ACD/LogP | 2.87 | | Phase 25 °C | solid | Rotatable bonds | 6 | Predicted density | 1.29 g/cm3 | | SMILES | O=S(=O)(c2cc1N(c3c(Sc1cc2)cccc3)CCCN4CCC(C(=O)N)CC4)C | | STD InChIKey | BQDBKDMTIJBJLA-UHFFFAOYAM | | Melting Points | | mp °C | source | |
|---|
| 170.00 | Bergstrom C. A. S.; Norinder U.; Luthman K.; Artursson P. Mo... | | 170.50 | PHYSPROP |
|
|
| | | metoxuran C10H13ClN2O264, 70 |
 | | Compound Data | | Melting point | 126.75 °C | 399.90 K | | CSID | 27749 | H bond acceptors | 4 | Rule of 5 violations | 0 | | Molecular weight | 228.6754 | H bond donors | 1 | ACD/LogP | 1.80 | | Phase 25 °C | solid | Rotatable bonds | 2 | Predicted density | 1.25 g/cm3 | | SMILES | Clc1cc(ccc1OC)NC(=O)N(C)C | | STD InChIKey | DSRNRYQBBJQVCW-UHFFFAOYAL | | Melting Points | | mp °C | source | |
|---|
| 126.50 | PHYSPROP | | 127.00 | Sepassi K; Yalkowsky SH. AAPS PharmSciTech 7(1) E1-E8 (2006) |
|
|
| | | metronidazole C6H9N3O332, 44, 61, 70 |
 | |
|
| | | Michler's ketone C17H20N2O3, 64 |
 | | Compound Data | | Melting point | 177.00 °C | 450.15 K | | CSID | 6764 | H bond acceptors | 3 | Rule of 5 violations | 0 | | Molecular weight | 268.3535 | H bond donors | 0 | ACD/LogP | 3.87 | | Phase 25 °C | solid | Rotatable bonds | 4 | Predicted density | 1.10 g/cm3 | | SMILES | O=C(c1ccc(N(C)C)cc1)c2ccc(N(C)C)cc2 | | STD InChIKey | VVBLNCFGVYUYGU-UHFFFAOYAE | | Melting Points | | mp °C | source | |
|---|
| 175.00 | Alfa Aesar | | 179.00 | PHYSPROP |
|
|
| | | moricizine C22H25N3O4S9, 32, 48, 64 |
 | |
|
| | | morphazinamide C10H14N4O29, 64 |
 | | Compound Data | | Melting point | 118.75 °C | 391.90 K | | CSID | 63555 | H bond acceptors | 6 | Rule of 5 violations | 0 | | Molecular weight | 222.2438 | H bond donors | 1 | ACD/LogP | -1.07 | | Phase 25 °C | solid | Rotatable bonds | 3 | Predicted density | 1.23 g/cm3 | | SMILES | O=C(NCN1CCOCC1)c2nccnc2 | | STD InChIKey | GVTLAVKAVSKBKK-UHFFFAOYAT | | Melting Points | | mp °C | source | |
|---|
| 119.00 | Bergstrom C. A. S.; Norinder U.; Luthman K.; Artursson P. Mo... | | 118.50 | PHYSPROP |
|
|
| | | morpholine C4H9NO3, 61, 64 |
 | | Compound Data | | Melting point | -4.93 °C | 268.22 K | | CSID | 13837537 | H bond acceptors | 2 | Rule of 5 violations | 0 | | Molecular weight | 87.1204 | H bond donors | 1 | ACD/LogP | 0.00 | | Phase 25 °C | liquid/gas | Rotatable bonds | 0 | Predicted density | 0.93 g/cm3 | | SMILES | C1CNCCO1 | | STD InChIKey | YNAVUWVOSKDBBP-UHFFFAOYAU | | Melting Points | | mp °C | source | |
|---|
| -5.00 | Alfa Aesar | | -5.00 | Oxford University MSDS | | -4.80 | PHYSPROP |
|
|
| | | moxaverine C20H21NO29, 48, 64 |
 | |
|
| | | MPTP C12H15N61, 64 |
 | | Compound Data | | Melting point | 39.25 °C | 312.40 K | | CSID | 1346 | H bond acceptors | 1 | Rule of 5 violations | 0 | | Molecular weight | 173.2542 | H bond donors | 0 | ACD/LogP | 2.28 | | Phase 25 °C | solid | Rotatable bonds | 1 | Predicted density | 1.00 g/cm3 | | SMILES | c2c(/C1=C/CN(C)CC1)cccc2 | | STD InChIKey | PLRACCBDVIHHLZ-UHFFFAOYAV | | Melting Points | | mp °C | source | |
|---|
| 38.50 | Oxford University MSDS | | 40.00 | PHYSPROP |
|
|
| | | myristamide C14H29NO3, 64 |
 | | Compound Data | | Melting point | 105.00 °C | 378.15 K | | CSID | 62698 | H bond acceptors | 2 | Rule of 5 violations | 1 | | Molecular weight | 227.3862 | H bond donors | 2 | ACD/LogP | 5.14 | | Phase 25 °C | solid | Rotatable bonds | 12 | Predicted density | 0.87 g/cm3 | | SMILES | O=C(N)CCCCCCCCCCCCC | | STD InChIKey | QEALYLRSRQDCRA-UHFFFAOYAT | | Melting Points | | mp °C | source | |
|---|
| 106.00 | Alfa Aesar | | 104.00 | PHYSPROP |
|
|
| | | myristic acid C14H28O23, 61, 64 |
 | | Compound Data | | Melting point | 54.67 °C | 327.82 K | | CSID | 10539 | H bond acceptors | 2 | Rule of 5 violations | 1 | | Molecular weight | 228.3709 | H bond donors | 1 | ACD/LogP | 5.79 | | Phase 25 °C | solid | Rotatable bonds | 12 | Predicted density | 0.90 g/cm3 | | SMILES | CCCCCCCCCCCCCC(=O)O | | STD InChIKey | TUNFSRHWOTWDNC-UHFFFAOYAZ | | Melting Points | | mp °C | source | |
|---|
| 55.00 | Alfa Aesar | | 55.10 | Oxford University MSDS | | 53.90 | PHYSPROP |
|
|
| | | N-(2-bromoethyl)phthalimide C10H8BrNO23, 64 |
 | | Compound Data | | Melting point | 82.25 °C | 355.40 K | | CSID | 10848 | H bond acceptors | 3 | Rule of 5 violations | 0 | | Molecular weight | 254.08 | H bond donors | 0 | ACD/LogP | 2.53 | | Phase 25 °C | solid | Rotatable bonds | 2 | Predicted density | 1.66 g/cm3 | | SMILES | O=C2c1ccccc1C(=O)N2CCBr | | STD InChIKey | CHZXTOCAICMPQR-UHFFFAOYAF | | Melting Points | | mp °C | source | |
|---|
| 82.00 | Alfa Aesar | | 82.50 | PHYSPROP |
|
|
| | | N-(2-fluorenyl)acetamide C15H13NO61, 64 |
 | | Compound Data | | Melting point | 193.50 °C | 466.65 K | | CSID | 5686 | H bond acceptors | 2 | Rule of 5 violations | 0 | | Molecular weight | 223.2698 | H bond donors | 1 | ACD/LogP | 3.03 | | Phase 25 °C | solid | Rotatable bonds | 1 | Predicted density | 1.23 g/cm3 | | SMILES | O=C(Nc3ccc2c1ccccc1Cc2c3)C | | STD InChIKey | CZIHNRWJTSTCEX-UHFFFAOYAF | | Melting Points | | mp °C | source | |
|---|
| 194.00 | Oxford University MSDS | | 193.00 | PHYSPROP |
|
|
| | | N-(2-hydroxyphenyl)acetamide C8H9NO22, 3, 61, 64 |
 | |
|
| | | n-(2-nitrophenyl)acetamide C8H8N2O33, 64 |
 | | Compound Data | | Melting point | 93.00 °C | 366.15 K | | CSID | 10619 | H bond acceptors | 5 | Rule of 5 violations | 0 | | Molecular weight | 180.1607 | H bond donors | 1 | ACD/LogP | 1.00 | | Phase 25 °C | solid | Rotatable bonds | 2 | Predicted density | 1.34 g/cm3 | | SMILES | O=C(Nc1ccccc1[N+]([O-])=O)C | | STD InChIKey | BUNFNRVLMKHKIT-UHFFFAOYAY | | Melting Points | | mp °C | source | |
|---|
| 92.00 | Alfa Aesar | | 94.00 | PHYSPROP |
|
|
| | | N-(3-bromopropyl)phthalimide C11H10BrNO23, 64 |
 | | Compound Data | | Melting point | 74.50 °C | 347.65 K | | CSID | 20311 | H bond acceptors | 3 | Rule of 5 violations | 0 | | Molecular weight | 268.1066 | H bond donors | 0 | ACD/LogP | 2.85 | | Phase 25 °C | solid | Rotatable bonds | 3 | Predicted density | 1.58 g/cm3 | | SMILES | O=C2c1ccccc1C(=O)N2CCCBr | | STD InChIKey | VKJCJJYNVIYVQR-UHFFFAOYAX | | Melting Points | | mp °C | source | |
|---|
| 74.00 | Alfa Aesar | | 75.00 | PHYSPROP |
|
|
| | | N-(3-fluorophenyl)acetamide C8H8FNO3, 64 |
 | | Compound Data | | Melting point | 85.50 °C | 358.65 K | | CSID | 9218 | H bond acceptors | 2 | Rule of 5 violations | 0 | | Molecular weight | 153.1536 | H bond donors | 1 | ACD/LogP | 1.61 | | Phase 25 °C | solid | Rotatable bonds | 1 | Predicted density | 1.21 g/cm3 | | SMILES | O=C(Nc1cccc(F)c1)C | | STD InChIKey | AQLLDCFUQXGLHM-UHFFFAOYAE | | Melting Points | | mp °C | source | |
|---|
| 88.00 | Alfa Aesar | | 83.00 | PHYSPROP |
|
|
| | | N-(3-methylphenyl)acetamide C9H11NO61, 64 |
 | | Compound Data | | Melting point | 65.25 °C | 338.40 K | | CSID | 11332993 | H bond acceptors | 2 | Rule of 5 violations | 0 | | Molecular weight | 149.1897 | H bond donors | 1 | ACD/LogP | 1.54 | | Phase 25 °C | solid | Rotatable bonds | 1 | Predicted density | 1.07 g/cm3 | | SMILES | Cc1cccc(NC(C)=O)c1 | | STD InChIKey | ALMHSXDYCFOZQD-UHFFFAOYAI | | Melting Points | | mp °C | source | |
|---|
| 65.00 | Oxford University MSDS | | 65.50 | PHYSPROP |
|
|
| | | N-(4-bromophenyl)acetamide C8H8BrNO2, 3, 64 |
 | |
|
| | | N-(4-fluorophenyl)acetanilide C8H8FNO3, 64 |
 | | Compound Data | | Melting point | 153.00 °C | 426.15 K | | CSID | 9225 | H bond acceptors | 2 | Rule of 5 violations | 0 | | Molecular weight | 153.1536 | H bond donors | 1 | ACD/LogP | 1.47 | | Phase 25 °C | solid | Rotatable bonds | 1 | Predicted density | 1.21 g/cm3 | | SMILES | O=C(Nc1ccc(F)cc1)C | | STD InChIKey | JHEFOJNPLXSWNZ-UHFFFAOYAX | | Melting Points | | mp °C | source | |
|---|
| 152.00 | Alfa Aesar | | 154.00 | PHYSPROP |
|
|
| | | N-(4-methylphenyl)acetamide C9H11NO3, 64 |
 | | Compound Data | | Melting point | 150.50 °C | 423.65 K | | CSID | 10243171 | H bond acceptors | 2 | Rule of 5 violations | 0 | | Molecular weight | 149.1897 | H bond donors | 1 | ACD/LogP | 1.54 | | Phase 25 °C | solid | Rotatable bonds | 1 | Predicted density | 1.07 g/cm3 | | SMILES | Cc1ccc(NC(C)=O)cc1 | | STD InChIKey | YICAMJWHIUMFDI-UHFFFAOYAN | | Melting Points | | mp °C | source | |
|---|
| 149.00 | Alfa Aesar | | 152.00 | PHYSPROP |
|
|
| | | N-(methylcarbamoyl)acetamid C4H8N2O248, 64 |
 | | Compound Data | | Melting point | 179.25 °C | 452.40 K | | CSID | 62546 | H bond acceptors | 4 | Rule of 5 violations | 0 | | Molecular weight | 116.1185 | H bond donors | 2 | ACD/LogP | -0.62 | | Phase 25 °C | solid | Rotatable bonds | 0 | Predicted density | 1.09 g/cm3 | | SMILES | O=C(NC(=O)NC)C | | STD InChIKey | XRVHSOXXNQTWAW-UHFFFAOYAT | | Melting Points | | mp °C | source | |
|---|
| 178.00 | Karthikeyan M.; Glen R.C.; Bender A. General melting point p... | | 180.50 | PHYSPROP |
|
|
| | | N-acetylglycinamide C4H8N2O23, 64 |
 | | Compound Data | | Melting point | 139.75 °C | 412.90 K | | CSID | 68309 | H bond acceptors | 4 | Rule of 5 violations | 0 | | Molecular weight | 116.1185 | H bond donors | 3 | ACD/LogP | -2.35 | | Phase 25 °C | solid | Rotatable bonds | 2 | Predicted density | 1.15 g/cm3 | | SMILES | O=C(NC(=O)CN)C | | STD InChIKey | UUBCNZXOFCAIOX-UHFFFAOYAB | | Melting Points | | mp °C | source | |
|---|
| 138.00 | Alfa Aesar | | 141.50 | PHYSPROP |
|
|
| | | N-acetylhydrazobenzene C8H10N2O3, 64 |
 | | Compound Data | | Melting point | 129.75 °C | 402.90 K | | CSID | 7951 | H bond acceptors | 3 | Rule of 5 violations | 0 | | Molecular weight | 150.1778 | H bond donors | 2 | ACD/LogP | 0.84 | | Phase 25 °C | solid | Rotatable bonds | 2 | Predicted density | 1.14 g/cm3 | | SMILES | O=C(NNc1ccccc1)C | | STD InChIKey | UICBCXONCUFSOI-UHFFFAOYAT | | Melting Points | | mp °C | source | |
|---|
| 130.00 | Alfa Aesar | | 129.50 | PHYSPROP |
|
|
| | | N-acetylimidazole C5H6N2O3, 64 |
 | | Compound Data | | Melting point | 101.50 °C | 374.65 K | | CSID | 16257 | H bond acceptors | 3 | Rule of 5 violations | 0 | | Molecular weight | 110.1139 | H bond donors | 0 | ACD/LogP | -0.34 | | Phase 25 °C | solid | Rotatable bonds | 0 | Predicted density | 1.14 g/cm3 | | SMILES | O=C(n1ccnc1)C | | STD InChIKey | VIHYIVKEECZGOU-UHFFFAOYAL | | Melting Points | | mp °C | source | |
|---|
| 101.00 | Alfa Aesar | | 102.00 | PHYSPROP |
|
|
| | | N-acetylmorpholine C6H11NO23, 64 |
 | | Compound Data | | Melting point | 12.25 °C | 285.40 K | | CSID | 14787 | H bond acceptors | 3 | Rule of 5 violations | 0 | | Molecular weight | 129.157 | H bond donors | 0 | ACD/LogP | -0.32 | | Phase 25 °C | liquid/gas | Rotatable bonds | 0 | Predicted density | 1.08 g/cm3 | | SMILES | O=C(N1CCOCC1)C | | STD InChIKey | KYWXRBNOYGGPIZ-UHFFFAOYAL | | Melting Points | | mp °C | source | |
|---|
| 10.00 | Alfa Aesar | | 14.50 | PHYSPROP |
|
|
| | | N-benzylbenzamide C14H13NO3, 48 |
 | | Compound Data | | Melting point | 105.50 °C | 378.65 K | | CSID | 66512 | H bond acceptors | 2 | Rule of 5 violations | 0 | | Molecular weight | 211.2591 | H bond donors | 1 | ACD/LogP | 2.95 | | Phase 25 °C | solid | Rotatable bonds | 3 | Predicted density | 1.11 g/cm3 | | SMILES | O=C(NCc1ccccc1)c2ccccc2 | | STD InChIKey | LKQUCICFTHBFAL-UHFFFAOYAQ | | Melting Points | | mp °C | source | |
|---|
| 106.00 | Alfa Aesar | | 105.00 | Karthikeyan M.; Glen R.C.; Bender A. General melting point p... |
|
|
| | | n-bromoacetamide C2H4BrNO3, 64 |
 | | Compound Data | | Melting point | 103.75 °C | 376.90 K | | CSID | 4200 | H bond acceptors | 2 | Rule of 5 violations | 0 | | Molecular weight | 137.9633 | H bond donors | 1 | ACD/LogP | 0.44 | | Phase 25 °C | solid | Rotatable bonds | 0 | Predicted density | 1.71 g/cm3 | | SMILES | BrNC(=O)C | | STD InChIKey | VBTQNRFWXBXZQR-UHFFFAOYAA | | Melting Points | | mp °C | source | |
|---|
| 104.00 | Alfa Aesar | | 103.50 | PHYSPROP |
|
|
| | | n-butylbenzene C10H143, 4, 32, 61, 64 |
 | |
|
| | | N-butylurea C5H12N2O3, 64 |
 | | Compound Data | | Melting point | 96.00 °C | 369.15 K | | CSID | 11107 | H bond acceptors | 3 | Rule of 5 violations | 0 | | Molecular weight | 116.1616 | H bond donors | 3 | ACD/LogP | 0.37 | | Phase 25 °C | solid | Rotatable bonds | 3 | Predicted density | 0.96 g/cm3 | | SMILES | O=C(N)NCCCC | | STD InChIKey | CNWSQCLBDWYLAN-UHFFFAOYAX | | Melting Points | | mp °C | source | |
|---|
| 95.00 | Alfa Aesar | | 97.00 | PHYSPROP |
|
|
| | | N-chlorosuccinimide C4H4ClNO23, 64 |
 | | Compound Data | | Melting point | 149.00 °C | 422.15 K | | CSID | 29129 | H bond acceptors | 3 | Rule of 5 violations | 0 | | Molecular weight | 133.5331 | H bond donors | 0 | ACD/LogP | -0.87 | | Phase 25 °C | solid | Rotatable bonds | 0 | Predicted density | 1.50 g/cm3 | | SMILES | O=C1N(Cl)C(=O)CC1 | | STD InChIKey | JRNVZBWKYDBUCA-UHFFFAOYAN | | Melting Points | | mp °C | source | |
|---|
| 148.00 | Alfa Aesar | | 150.00 | PHYSPROP |
|
|
| | | N-cyclohexyl-4-methylbenzenesulfonamide C13H19NO2S3, 61 |
 | | Compound Data | | Melting point | 86.25 °C | 359.40 K | | CSID | 6381 | H bond acceptors | 3 | Rule of 5 violations | 0 | | Molecular weight | 253.3605 | H bond donors | 1 | ACD/LogP | 3.49 | | Phase 25 °C | solid | Rotatable bonds | 2 | Predicted density | 1.18 g/cm3 | | SMILES | O=S(=O)(NC1CCCCC1)c2ccc(cc2)C | | STD InChIKey | DKYVVNLWACXMDW-UHFFFAOYAU | | Melting Points | | mp °C | source | |
|---|
| 88.00 | Alfa Aesar | | 84.50 | Oxford University MSDS |
|
|
| | | N-cyclohexylaniline C12H17N3, 64 |
 | | Compound Data | | Melting point | 15.50 °C | 288.65 K | | CSID | 67145 | H bond acceptors | 1 | Rule of 5 violations | 0 | | Molecular weight | 175.2701 | H bond donors | 1 | ACD/LogP | 3.65 | | Phase 25 °C | liquid/gas | Rotatable bonds | 2 | Predicted density | 1.02 g/cm3 | | SMILES | c2c(NC1CCCCC1)cccc2 | | STD InChIKey | TXTHKGMZDDTZFD-UHFFFAOYAU | | Melting Points | | mp °C | source | |
|---|
| 15.00 | Alfa Aesar | | 16.00 | PHYSPROP |
|
|
| | | N-ethyl-4-nitroaniline C8H10N2O261, 64 |
 | | Compound Data | | Melting point | 96.50 °C | 369.65 K | | CSID | 18227 | H bond acceptors | 4 | Rule of 5 violations | 0 | | Molecular weight | 166.1772 | H bond donors | 1 | ACD/LogP | 2.57 | | Phase 25 °C | solid | Rotatable bonds | 3 | Predicted density | 1.21 g/cm3 | | SMILES | [O-][N+](=O)c1ccc(NCC)cc1 | | STD InChIKey | XBNNLAWQCMDISJ-UHFFFAOYAU | | Melting Points | | mp °C | source | |
|---|
| 96.00 | Oxford University MSDS | | 97.00 | PHYSPROP |
|
|
| | | N-ethylaniline C8H11N2, 3, 61, 64 |
 | |
|
| | | N-ethylmaleimide C6H7NO23, 61, 64 |
 | | Compound Data | | Melting point | 44.83 °C | 317.98 K | | CSID | 4209 | H bond acceptors | 3 | Rule of 5 violations | 0 | | Molecular weight | 125.1253 | H bond donors | 0 | ACD/LogP | 0.68 | | Phase 25 °C | solid | Rotatable bonds | 1 | Predicted density | 1.21 g/cm3 | | SMILES | O=C1\C=C/C(=O)N1CC | | STD InChIKey | HDFGOPSGAURCEO-UHFFFAOYAE | | Melting Points | | mp °C | source | |
|---|
| 45.00 | Alfa Aesar | | 44.00 | Oxford University MSDS | | 45.50 | PHYSPROP |
|
|
| | | N-ethylphthalimide C10H9NO23, 64 |
 | | Compound Data | | Melting point | 77.50 °C | 350.65 K | | CSID | 19862 | H bond acceptors | 3 | Rule of 5 violations | 0 | | Molecular weight | 175.184 | H bond donors | 0 | ACD/LogP | 2.09 | | Phase 25 °C | solid | Rotatable bonds | 1 | Predicted density | 1.25 g/cm3 | | SMILES | O=C2c1ccccc1C(=O)N2CC | | STD InChIKey | JZDSOQSUCWVBMV-UHFFFAOYAZ | | Melting Points | | mp °C | source | |
|---|
| 76.00 | Alfa Aesar | | 79.00 | PHYSPROP |
|
|
| | | N-formylmorpholine C5H9NO23, 64 |
 | | Compound Data | | Melting point | 21.50 °C | 294.65 K | | CSID | 19231 | H bond acceptors | 3 | Rule of 5 violations | 0 | | Molecular weight | 115.1305 | H bond donors | 0 | ACD/LogP | -1.30 | | Phase 25 °C | liquid/gas | Rotatable bonds | 0 | Predicted density | 1.21 g/cm3 | | SMILES | O=CN1CCOCC1 | | STD InChIKey | LCEDQNDDFOCWGG-UHFFFAOYAJ | | Melting Points | | mp °C | source | |
|---|
| 22.00 | Alfa Aesar | | 21.00 | PHYSPROP |
|
|
| | | N-hydroxysuccinimide C4H5NO33, 61 |
 | | Compound Data | | Melting point | 96.75 °C | 369.90 K | | CSID | 72416 | H bond acceptors | 4 | Rule of 5 violations | 0 | | Molecular weight | 115.0874 | H bond donors | 1 | ACD/LogP | -2.00 | | Phase 25 °C | solid | Rotatable bonds | 1 | Predicted density | 1.65 g/cm3 | | SMILES | O=C1N(O)C(=O)CC1 | | STD InChIKey | NQTADLQHYWFPDB-UHFFFAOYAM | | Melting Points | | mp °C | source | |
|---|
| 97.00 | Alfa Aesar | | 96.50 | Oxford University MSDS |
|
|
| | | N-isopropyl-N'-phenyl-p-phenylenediamine C15H18N23, 64 |
 | | Compound Data | | Melting point | 75.50 °C | 348.65 K | | CSID | 7292 | H bond acceptors | 2 | Rule of 5 violations | 0 | | Molecular weight | 226.3168 | H bond donors | 2 | ACD/LogP | 2.83 | | Phase 25 °C | solid | Rotatable bonds | 4 | Predicted density | 1.09 g/cm3 | | SMILES | N(c1ccc(cc1)Nc2ccccc2)C(C)C | | STD InChIKey | OUBMGJOQLXMSNT-UHFFFAOYAN | | Melting Points | | mp °C | source | |
|---|
| 77.00 | Alfa Aesar | | 74.00 | PHYSPROP |
|
|
| | | N-methyl-2-nitroaniline C7H8N2O23, 64 |
 | | Compound Data | | Melting point | 36.50 °C | 309.65 K | | CSID | 62372 | H bond acceptors | 4 | Rule of 5 violations | 0 | | Molecular weight | 152.1506 | H bond donors | 1 | ACD/LogP | 2.18 | | Phase 25 °C | solid | Rotatable bonds | 2 | Predicted density | 1.26 g/cm3 | | SMILES | [O-][N+](=O)c1ccccc1NC | | STD InChIKey | KFBOUJZFFJDYTA-UHFFFAOYAI | | Melting Points | | mp °C | source | |
|---|
| 35.00 | Alfa Aesar | | 38.00 | PHYSPROP |
|
|
| | | N-methyl-4-nitroaniline C7H8N2O23, 61, 64 |
 | | Compound Data | | Melting point | 152.33 °C | 425.48 K | | CSID | 7203 | H bond acceptors | 4 | Rule of 5 violations | 0 | | Molecular weight | 152.1506 | H bond donors | 1 | ACD/LogP | 2.04 | | Phase 25 °C | solid | Rotatable bonds | 2 | Predicted density | 1.26 g/cm3 | | SMILES | [O-][N+](=O)c1ccc(NC)cc1 | | STD InChIKey | XIFJZJPMHNUGRA-UHFFFAOYAM | | Melting Points | | mp °C | source | |
|---|
| 153.00 | Alfa Aesar | | 152.00 | Oxford University MSDS | | 152.00 | PHYSPROP |
|
|
| | | N-methylacetamide C3H7NO3, 61, 64 |
 | | Compound Data | | Melting point | 27.33 °C | 300.48 K | | CSID | 6334 | H bond acceptors | 2 | Rule of 5 violations | 0 | | Molecular weight | 73.0938 | H bond donors | 1 | ACD/LogP | -1.05 | | Phase 25 °C | solid | Rotatable bonds | 0 | Predicted density | 0.87 g/cm3 | | SMILES | O=C(NC)C | | STD InChIKey | OHLUUHNLEMFGTQ-UHFFFAOYAK | | Melting Points | | mp °C | source | |
|---|
| 27.00 | Alfa Aesar | | 27.00 | Oxford University MSDS | | 28.00 | PHYSPROP |
|
|
| | | N-methylbenzamide C8H9NO3, 64 |
 | | Compound Data | | Melting point | 80.50 °C | 353.65 K | | CSID | 11460 | H bond acceptors | 2 | Rule of 5 violations | 0 | | Molecular weight | 135.1632 | H bond donors | 1 | ACD/LogP | 0.86 | | Phase 25 °C | solid | Rotatable bonds | 1 | Predicted density | 1.04 g/cm3 | | SMILES | O=C(NC)c1ccccc1 | | STD InChIKey | NCCHARWOCKOHIH-UHFFFAOYAK | | Melting Points | | mp °C | source | |
|---|
| 79.00 | Alfa Aesar | | 82.00 | PHYSPROP |
|
|
| | | N-methylformanilide C8H9NO3, 64 |
 | | Compound Data | | Melting point | 12.75 °C | 285.90 K | | CSID | 60103 | H bond acceptors | 2 | Rule of 5 violations | 0 | | Molecular weight | 135.1632 | H bond donors | 0 | ACD/LogP | 1.09 | | Phase 25 °C | liquid/gas | Rotatable bonds | 1 | Predicted density | 1.08 g/cm3 | | SMILES | O=CN(c1ccccc1)C | | STD InChIKey | JIKUXBYRTXDNIY-UHFFFAOYAF | | Melting Points | | mp °C | source | |
|---|
| 11.00 | Alfa Aesar | | 14.50 | PHYSPROP |
|
|
| | | N-methylsuccinimide C5H7NO23, 64 |
 | | Compound Data | | Melting point | 68.50 °C | 341.65 K | | CSID | 63882 | H bond acceptors | 3 | Rule of 5 violations | 0 | | Molecular weight | 113.1146 | H bond donors | 0 | ACD/LogP | -0.95 | | Phase 25 °C | solid | Rotatable bonds | 0 | Predicted density | 1.22 g/cm3 | | SMILES | O=C1N(C(=O)CC1)C | | STD InChIKey | KYEACNNYFNZCST-UHFFFAOYAZ | | Melting Points | | mp °C | source | |
|---|
| 66.00 | Alfa Aesar | | 71.00 | PHYSPROP |
|
|
| | | n-octane C8H183, 4, 32, 59, 64 |
 | |
|
| | | N-p-tolyl-benzamide C14H13NO48, 64 |
 | | Compound Data | | Melting point | 157.00 °C | 430.15 K | | CSID | 10274392 | H bond acceptors | 2 | Rule of 5 violations | 0 | | Molecular weight | 211.2591 | H bond donors | 1 | ACD/LogP | 3.35 | | Phase 25 °C | solid | Rotatable bonds | 2 | Predicted density | 1.15 g/cm3 | | SMILES | Cc1ccc(cc1)NC(=O)c2ccccc2 | | STD InChIKey | YUIHXKGKVSVIEL-UHFFFAOYAA | | Melting Points | | mp °C | source | |
|---|
| 156.00 | Karthikeyan M.; Glen R.C.; Bender A. General melting point p... | | 158.00 | PHYSPROP |
|
|
| | | n-pentylcyclohexane C11H223, 4, 64 |
 | |
|
| | | N-phenyl-1-naphthaleneamine C16H13N61, 64 |
 | | Compound Data | | Melting point | 61.50 °C | 334.65 K | | CSID | 6746 | H bond acceptors | 1 | Rule of 5 violations | 0 | | Molecular weight | 219.2811 | H bond donors | 1 | ACD/LogP | 4.20 | | Phase 25 °C | solid | Rotatable bonds | 2 | Predicted density | 1.16 g/cm3 | | SMILES | c3c(Nc1ccccc1)c2ccccc2cc3 | | STD InChIKey | XQVWYOYUZDUNRW-UHFFFAOYAN | | Melting Points | | mp °C | source | |
|---|
| 61.00 | Oxford University MSDS | | 62.00 | PHYSPROP |
|
|
| | | N-phenylformamide C7H7NO3, 61, 64 |
 | | Compound Data | | Melting point | 46.67 °C | 319.82 K | | CSID | 7388 | H bond acceptors | 2 | Rule of 5 violations | 0 | | Molecular weight | 121.1366 | H bond donors | 1 | ACD/LogP | 1.15 | | Phase 25 °C | solid | Rotatable bonds | 1 | Predicted density | 1.14 g/cm3 | | SMILES | O=CNc1ccccc1 | | STD InChIKey | DYDNPESBYVVLBO-UHFFFAOYAU | | Melting Points | | mp °C | source | |
|---|
| 47.00 | Alfa Aesar | | 47.00 | Oxford University MSDS | | 46.00 | PHYSPROP |
|
|
| | | N-phenylglycine ethyl ester C10H13NO23, 64 |
 | | Compound Data | | Melting point | 57.50 °C | 330.65 K | | CSID | 21159611 | H bond acceptors | 3 | Rule of 5 violations | 0 | | Molecular weight | 179.2157 | H bond donors | 1 | ACD/LogP | 1.79 | | Phase 25 °C | solid | Rotatable bonds | 5 | Predicted density | 1.11 g/cm3 | | SMILES | CCOC(=O)CNc1ccccc1 | | STD InChIKey | MLSGRWDEDYJNER-UHFFFAOYAC | | Melting Points | | mp °C | source | |
|---|
| 57.00 | Alfa Aesar | | 58.00 | PHYSPROP |
|
|
| | | N-phenylmaleimide C10H7NO23, 64 |
 | | Compound Data | | Melting point | 89.75 °C | 362.90 K | | CSID | 13073 | H bond acceptors | 3 | Rule of 5 violations | 0 | | Molecular weight | 173.1681 | H bond donors | 0 | ACD/LogP | 1.15 | | Phase 25 °C | solid | Rotatable bonds | 1 | Predicted density | 1.33 g/cm3 | | SMILES | c1ccc(cc1)N2C(=O)C=CC2=O | | STD InChIKey | HIDBROSJWZYGSZ-UHFFFAOYAO | | Melting Points | | mp °C | source | |
|---|
| 89.00 | Alfa Aesar | | 90.50 | PHYSPROP |
|
|
| | | N-phenylpyrrole C10H9N3, 64 |
 | | Compound Data | | Melting point | 60.50 °C | 333.65 K | | CSID | 11970 | H bond acceptors | 1 | Rule of 5 violations | 0 | | Molecular weight | 143.1852 | H bond donors | 0 | ACD/LogP | 3.08 | | Phase 25 °C | solid | Rotatable bonds | 1 | Predicted density | 0.97 g/cm3 | | SMILES | c1ccc(cc1)n2cccc2 | | STD InChIKey | GEZGAZKEOUKLBR-UHFFFAOYAM | | Melting Points | | mp °C | source | |
|---|
| 59.00 | Alfa Aesar | | 62.00 | PHYSPROP |
|
|
| | | n-propyl formate C4H8O23, 64 |
 | | Compound Data | | Melting point | -92.95 °C | 180.20 K | | CSID | 7782 | H bond acceptors | 2 | Rule of 5 violations | 0 | | Molecular weight | 88.1051 | H bond donors | 0 | ACD/LogP | 0.83 | | Phase 25 °C | liquid/gas | Rotatable bonds | 3 | Predicted density | 0.90 g/cm3 | | SMILES | O=COCCC | | STD InChIKey | KFNNIILCVOLYIR-UHFFFAOYAC | | Melting Points | | mp °C | source | |
|---|
| -93.00 | Alfa Aesar | | -92.90 | PHYSPROP |
|
|
| | | n-propyl propionate C6H12O23, 64 |
 | | Compound Data | | Melting point | -75.95 °C | 197.20 K | | CSID | 7515 | H bond acceptors | 2 | Rule of 5 violations | 0 | | Molecular weight | 116.1583 | H bond donors | 0 | ACD/LogP | 1.77 | | Phase 25 °C | liquid/gas | Rotatable bonds | 4 | Predicted density | 0.89 g/cm3 | | SMILES | O=C(OCCC)CC | | STD InChIKey | MCSINKKTEDDPNK-UHFFFAOYAX | | Melting Points | | mp °C | source | |
|---|
| -76.00 | Alfa Aesar | | -75.90 | PHYSPROP |
|
|
| | | N-t-butylacrylamide C7H13NO3, 64 |
 | | Compound Data | | Melting point | 128.75 °C | 401.90 K | | CSID | 7589 | H bond acceptors | 2 | Rule of 5 violations | 0 | | Molecular weight | 127.1842 | H bond donors | 1 | ACD/LogP | 0.55 | | Phase 25 °C | solid | Rotatable bonds | 2 | Predicted density | 0.88 g/cm3 | | SMILES | O=C(\C=C)NC(C)(C)C | | STD InChIKey | XFHJDMUEHUHAJW-UHFFFAOYAL | | Melting Points | | mp °C | source | |
|---|
| 129.00 | Alfa Aesar | | 128.50 | PHYSPROP |
|
|
| | | N-vinylcarbazole C14H11N61, 64 |
 | | Compound Data | | Melting point | 64.00 °C | 337.15 K | | CSID | 14414 | H bond acceptors | 1 | Rule of 5 violations | 0 | | Molecular weight | 193.2438 | H bond donors | 0 | ACD/LogP | 4.61 | | Phase 25 °C | solid | Rotatable bonds | 1 | Predicted density | 1.05 g/cm3 | | SMILES | c1cccc3c1c2c(cccc2)n3\C=C | | STD InChIKey | KKFHAJHLJHVUDM-UHFFFAOYAO | | Melting Points | | mp °C | source | |
|---|
| 63.00 | Oxford University MSDS | | 65.00 | PHYSPROP |
|
|
| | | N,2,6-trichloroquinoneimine C6H2Cl3NO61, 64 |
 | | Compound Data | | Melting point | 66.50 °C | 339.65 K | | CSID | 7275 | H bond acceptors | 2 | Rule of 5 violations | 0 | | Molecular weight | 210.4452 | H bond donors | 0 | ACD/LogP | 1.64 | | Phase 25 °C | solid | Rotatable bonds | 0 | Predicted density | 1.61 g/cm3 | | SMILES | Cl\C1=CC(=N\Cl)/C=C(/Cl)C1=O | | STD InChIKey | YHUMTHWQGWPJOQ-UHFFFAOYAO | | Melting Points | | mp °C | source | |
|---|
| 67.00 | Oxford University MSDS | | 66.00 | PHYSPROP |
|
|
| | | N,N-dibenzylaniline C20H19N3, 64 |
 | | Compound Data | | Melting point | 69.50 °C | 342.65 K | | CSID | 60047 | H bond acceptors | 1 | Rule of 5 violations | 1 | | Molecular weight | 273.3716 | H bond donors | 0 | ACD/LogP | 6.06 | | Phase 25 °C | solid | Rotatable bonds | 5 | Predicted density | 1.10 g/cm3 | | SMILES | c1(ccccc1)CN(c2ccccc2)Cc3ccccc3 | | STD InChIKey | ISGXOWLMGOPVPB-UHFFFAOYAN | | Melting Points | | mp °C | source | |
|---|
| 70.00 | Alfa Aesar | | 69.00 | PHYSPROP |
|
|
| | | N,N-diethylaniline C10H15N2, 3, 61, 64 |
 | |
|
| | | N,N-dimethyl-2,2-diphenylacetamide C16H17NO61, 64 |
 | | Compound Data | | Melting point | 134.25 °C | 407.40 K | | CSID | 13133 | H bond acceptors | 2 | Rule of 5 violations | 0 | | Molecular weight | 239.3123 | H bond donors | 0 | ACD/LogP | 2.63 | | Phase 25 °C | solid | Rotatable bonds | 3 | Predicted density | 1.07 g/cm3 | | SMILES | O=C(N(C)C)C(c1ccccc1)c2ccccc2 | | STD InChIKey | QAHFOPIILNICLA-UHFFFAOYAX | | Melting Points | | mp °C | source | |
|---|
| 133.50 | Oxford University MSDS | | 135.00 | PHYSPROP |
|
|
| | | N,N-dimethyl-3-nitroaniline C8H10N2O23, 64 |
 | | Compound Data | | Melting point | 59.75 °C | 332.90 K | | CSID | 21168823 | H bond acceptors | 4 | Rule of 5 violations | 0 | | Molecular weight | 166.1772 | H bond donors | 0 | ACD/LogP | 2.74 | | Phase 25 °C | solid | Rotatable bonds | 2 | Predicted density | 1.19 g/cm3 | | SMILES | CN(C)c1cccc(c1)[N+]([O-])=O | | STD InChIKey | CJDICMLSLYHRPT-UHFFFAOYAB | | Melting Points | | mp °C | source | |
|---|
| 59.00 | Alfa Aesar | | 60.50 | PHYSPROP |
|
|
| | | N,N-dimethyl-4-nitroaniline C8H10N2O23, 64 |
 | | Compound Data | | Melting point | 164.50 °C | 437.65 K | | CSID | 7210 | H bond acceptors | 4 | Rule of 5 violations | 0 | | Molecular weight | 166.1772 | H bond donors | 0 | ACD/LogP | 2.61 | | Phase 25 °C | solid | Rotatable bonds | 2 | Predicted density | 1.19 g/cm3 | | SMILES | [O-][N+](=O)c1ccc(N(C)C)cc1 | | STD InChIKey | QJAIOCKFIORVFU-UHFFFAOYAA | | Melting Points | | mp °C | source | |
|---|
| 165.00 | Alfa Aesar | | 164.00 | PHYSPROP |
|
|
| | | N,N-dimethylaniline C8H11N2, 3, 61, 64 |
 | |
|
| | | N,N-dimethyldodecylamine C14H31N3, 64 |
 | | Compound Data | | Melting point | -17.50 °C | 255.65 K | | CSID | 7876 | H bond acceptors | 1 | Rule of 5 violations | 1 | | Molecular weight | 213.4026 | H bond donors | 0 | ACD/LogP | 5.91 | | Phase 25 °C | liquid/gas | Rotatable bonds | 11 | Predicted density | 0.80 g/cm3 | | SMILES | N(CCCCCCCCCCCC)(C)C | | STD InChIKey | YWFWDNVOPHGWMX-UHFFFAOYAY | | Melting Points | | mp °C | source | |
|---|
| -20.00 | Alfa Aesar | | -15.00 | PHYSPROP |
|
|
| | | N,N-dimethylformamide C3H7NO2, 3, 32, 61, 64 |
 | |
|
| | | N,N-dimethylglycine C4H9NO23, 32, 64 |
 | | Compound Data | | Melting point | 184.00 °C | 457.15 K | | CSID | 653 | H bond acceptors | 3 | Rule of 5 violations | 0 | | Molecular weight | 103.1198 | H bond donors | 1 | ACD/LogP | -0.30 | | Phase 25 °C | solid | Rotatable bonds | 2 | Predicted density | 1.07 g/cm3 | | SMILES | O=C(O)CN(C)C | | STD InChIKey | FFDGPVCHZBVARC-UHFFFAOYAX | | Melting Points | | mp °C | source | |
|---|
| 181.00 | Alfa Aesar | | 185.50 | DrugBank | | 185.50 | PHYSPROP |
|
|
| | | N,N-dimethylurea C3H8N2O3, 64 |
 | | Compound Data | | Melting point | 181.75 °C | 454.90 K | | CSID | 11244 | H bond acceptors | 3 | Rule of 5 violations | 0 | | Molecular weight | 88.1084 | H bond donors | 2 | ACD/LogP | -1.28 | | Phase 25 °C | solid | Rotatable bonds | 0 | Predicted density | 1.02 g/cm3 | | SMILES | O=C(N)N(C)C | | STD InChIKey | YBBLOADPFWKNGS-UHFFFAOYAG | | Melting Points | | mp °C | source | |
|---|
| 180.00 | Alfa Aesar | | 183.50 | PHYSPROP |
|
|
| | | N,N,N',N'-tetramethyl-p-phenylenediamine C10H16N23, 64 |
 | | Compound Data | | Melting point | 50.50 °C | 323.65 K | | CSID | 21106585 | H bond acceptors | 2 | Rule of 5 violations | 0 | | Molecular weight | 164.2474 | H bond donors | 0 | ACD/LogP | 2.08 | | Phase 25 °C | solid | Rotatable bonds | 2 | Predicted density | 0.99 g/cm3 | | SMILES | CN(C)c1ccc(cc1)N(C)C | | STD InChIKey | CJAOGUFAAWZWNI-UHFFFAOYAJ | | Melting Points | | mp °C | source | |
|---|
| 50.00 | Alfa Aesar | | 51.00 | PHYSPROP |
|
|
| | | N,N'-dibenzylethylenediamine C16H20N23, 64 |
 | | Compound Data | | Melting point | 25.00 °C | 298.15 K | | CSID | 8463 | H bond acceptors | 2 | Rule of 5 violations | 0 | | Molecular weight | 240.3434 | H bond donors | 2 | ACD/LogP | 2.86 | | Phase 25 °C | liquid/gas | Rotatable bonds | 7 | Predicted density | 1.03 g/cm3 | | SMILES | N(CCNCc1ccccc1)Cc2ccccc2 | | STD InChIKey | JUHORIMYRDESRB-UHFFFAOYAS | | Melting Points | | mp °C | source | |
|---|
| 24.00 | Alfa Aesar | | 26.00 | PHYSPROP |
|
|
| | | N,N'-dibutylthiourea C9H20N2S3, 64 |
 | | Compound Data | | Melting point | 65.00 °C | 338.15 K | | CSID | 2005824 | H bond acceptors | 2 | Rule of 5 violations | 0 | | Molecular weight | 188.3335 | H bond donors | 2 | ACD/LogP | 2.84 | | Phase 25 °C | solid | Rotatable bonds | 6 | Predicted density | 0.94 g/cm3 | | SMILES | S=C(NCCCC)NCCCC | | STD InChIKey | KFFQABQEJATQAT-UHFFFAOYAB | | Melting Points | | mp °C | source | |
|---|
| 66.00 | Alfa Aesar | | 64.00 | PHYSPROP |
|
|
| | | N,N'-diethyloxamide C6H12N2O23, 64 |
 | | Compound Data | | Melting point | 177.50 °C | 450.65 K | | CSID | 62423 | H bond acceptors | 4 | Rule of 5 violations | 0 | | Molecular weight | 144.1717 | H bond donors | 2 | ACD/LogP | -0.23 | | Phase 25 °C | solid | Rotatable bonds | 3 | Predicted density | 1.03 g/cm3 | | SMILES | O=C(NCC)C(=O)NCC | | STD InChIKey | FFYAVOJIYAAUNX-UHFFFAOYAN | | Melting Points | | mp °C | source | |
|---|
| 180.00 | Alfa Aesar | | 175.00 | PHYSPROP |
|
|
| | | N,N'-diethylthiourea C5H12N2S3, 64 |
 | | Compound Data | | Melting point | 77.50 °C | 350.65 K | | CSID | 2016737 | H bond acceptors | 2 | Rule of 5 violations | 0 | | Molecular weight | 132.2272 | H bond donors | 2 | ACD/LogP | 0.72 | | Phase 25 °C | solid | Rotatable bonds | 2 | Predicted density | 0.99 g/cm3 | | SMILES | S=C(NCC)NCC | | STD InChIKey | FLVIGYVXZHLUHP-UHFFFAOYAN | | Melting Points | | mp °C | source | |
|---|
| 77.00 | Alfa Aesar | | 78.00 | PHYSPROP |
|
|
| | | N,N'-diethylurea C5H12N2O3, 64 |
 | | Compound Data | | Melting point | 111.25 °C | 384.40 K | | CSID | 11694 | H bond acceptors | 3 | Rule of 5 violations | 0 | | Molecular weight | 116.1616 | H bond donors | 2 | ACD/LogP | 0.05 | | Phase 25 °C | solid | Rotatable bonds | 2 | Predicted density | 0.92 g/cm3 | | SMILES | O=C(NCC)NCC | | STD InChIKey | ZWAVGZYKJNOTPX-UHFFFAOYAT | | Melting Points | | mp °C | source | |
|---|
| 110.00 | Alfa Aesar | | 112.50 | PHYSPROP |
|
|
| | | N,N'-diphenyl-p-phenylenediamine C18H16N23, 64 |
 | | Compound Data | | Melting point | 145.50 °C | 418.65 K | | CSID | 6080 | H bond acceptors | 2 | Rule of 5 violations | 0 | | Molecular weight | 260.333 | H bond donors | 2 | ACD/LogP | 4.54 | | Phase 25 °C | solid | Rotatable bonds | 4 | Predicted density | 1.18 g/cm3 | | SMILES | c1ccc(cc1)Nc2ccc(cc2)Nc3ccccc3 | | STD InChIKey | UTGQNNCQYDRXCH-UHFFFAOYAQ | | Melting Points | | mp °C | source | |
|---|
| 147.00 | Alfa Aesar | | 144.00 | PHYSPROP |
|
|
| | | N,N'-diphenylbenzidine C24H20N23, 64 |
 | | Compound Data | | Melting point | 247.50 °C | 520.65 K | | CSID | 61577 | H bond acceptors | 2 | Rule of 5 violations | 1 | | Molecular weight | 336.429 | H bond donors | 2 | ACD/LogP | 6.34 | | Phase 25 °C | solid | Rotatable bonds | 5 | Predicted density | 1.17 g/cm3 | | SMILES | c4c(Nc1ccc(cc1)c3ccc(Nc2ccccc2)cc3)cccc4 | | STD InChIKey | FDRNXKXKFNHNCA-UHFFFAOYAV | | Melting Points | | mp °C | source | |
|---|
| 248.00 | Alfa Aesar | | 247.00 | PHYSPROP |
|
|
| | | nalidixic acid C12H12N2O33, 32, 44, 61, 64 |
 | |
|
| | | naphthalene-1-carbonitrile C11H7N3, 64 |
 | | Compound Data | | Melting point | 36.75 °C | 309.90 K | | CSID | 6585 | H bond acceptors | 1 | Rule of 5 violations | 0 | | Molecular weight | 153.18 | H bond donors | 0 | ACD/LogP | 2.89 | | Phase 25 °C | solid | Rotatable bonds | 0 | Predicted density | 1.13 g/cm3 | | SMILES | N#Cc2cccc1ccccc12 | | STD InChIKey | YJMNOKOLADGBKA-UHFFFAOYAU | | Melting Points | | mp °C | source | |
|---|
| 36.00 | Alfa Aesar | | 37.50 | PHYSPROP |
|
|
| | | naphthalic anhydride C12H6O33, 64 |
 | | Compound Data | | Melting point | 270.50 °C | 543.65 K | | CSID | 6438 | H bond acceptors | 3 | Rule of 5 violations | 0 | | Molecular weight | 198.1742 | H bond donors | 0 | ACD/LogP | 1.75 | | Phase 25 °C | solid | Rotatable bonds | 0 | Predicted density | 1.45 g/cm3 | | SMILES | O=C3OC(=O)c2cccc1cccc3c12 | | STD InChIKey | GRSMWKLPSNHDHA-UHFFFAOYAM | | Melting Points | | mp °C | source | |
|---|
| 271.00 | Alfa Aesar | | 270.00 | PHYSPROP |
|
|
| | | neopentyl alcohol C5H12O3, 4, 64 |
 | |
|
| | | neopentyl glycol C5H12O22, 3, 61, 64 |
 | |
|
| | | nialamide C16H18N4O232, 64 |
 | | Compound Data | | Melting point | 151.30 °C | 424.45 K | | CSID | 4317 | H bond acceptors | 6 | Rule of 5 violations | 0 | | Molecular weight | 298.3397 | H bond donors | 3 | ACD/LogP | 0.32 | | Phase 25 °C | solid | Rotatable bonds | 7 | Predicted density | 1.20 g/cm3 | | SMILES | O=C(NNCCC(=O)NCc1ccccc1)c2ccncc2 | | STD InChIKey | NOIIUHRQUVNIDD-UHFFFAOYAU | | Melting Points | | mp °C | source | |
|---|
| 151.60 | DrugBank | | 151.00 | PHYSPROP |
|
|
| | | nicotinamide C6H6N2O3, 32, 44, 61, 64 |
 | |
|
| | | nicotinic acid C6H5NO23, 32, 35, 44, 61, 64 |
 | |
|
| | | nicotinyl alcohol C6H7NO3, 64 |
 | | Compound Data | | Melting point | -6.75 °C | 266.40 K | | CSID | 7229 | H bond acceptors | 2 | Rule of 5 violations | 0 | | Molecular weight | 109.1259 | H bond donors | 1 | ACD/LogP | -0.46 | | Phase 25 °C | liquid/gas | Rotatable bonds | 2 | Predicted density | 1.13 g/cm3 | | SMILES | OCc1cccnc1 | | STD InChIKey | MVQVNTPHUGQQHK-UHFFFAOYAK | | Melting Points | | mp °C | source | |
|---|
| -7.00 | Alfa Aesar | | -6.50 | PHYSPROP |
|
|
| | | nitrobenzene C6H5NO22, 3, 61, 64 |
 | |
|
| | | nitroethane C2H5NO23, 64 |
 | | Compound Data | | Melting point | -89.25 °C | 183.90 K | | CSID | 6338 | H bond acceptors | 3 | Rule of 5 violations | 0 | | Molecular weight | 75.07 | H bond donors | 0 | ACD/LogP | 0.34 | | Phase 25 °C | liquid/gas | Rotatable bonds | 1 | Predicted density | 1.01 g/cm3 | | SMILES | CC[N+](=O)[O-] | | STD InChIKey | MCSAJNNLRCFZED-UHFFFAOYAB | | Melting Points | | mp °C | source | |
|---|
| -89.00 | Alfa Aesar | | -89.50 | PHYSPROP |
|
|
| | | nitrofen C12H7Cl2NO33, 61, 64 |
 | | Compound Data | | Melting point | 70.17 °C | 343.32 K | | CSID | 15010 | H bond acceptors | 4 | Rule of 5 violations | 0 | | Molecular weight | 284.0949 | H bond donors | 0 | ACD/LogP | 4.92 | | Phase 25 °C | solid | Rotatable bonds | 3 | Predicted density | 1.45 g/cm3 | | SMILES | Clc2cc(Cl)ccc2Oc1ccc([N+]([O-])=O)cc1 | | STD InChIKey | XITQUSLLOSKDTB-UHFFFAOYAU | | Melting Points | | mp °C | source | |
|---|
| 70.00 | Alfa Aesar | | 70.50 | Oxford University MSDS | | 70.00 | PHYSPROP |
|
|
| | | nitromethane CH3NO23, 61, 64 |
 | | Compound Data | | Melting point | -28.83 °C | 244.32 K | | CSID | 6135 | H bond acceptors | 3 | Rule of 5 violations | 0 | | Molecular weight | 61.04 | H bond donors | 0 | ACD/LogP | 0.00 | | Phase 25 °C | liquid/gas | Rotatable bonds | 0 | Predicted density | 1.05 g/cm3 | | SMILES | C[N+](=O)[O-] | | STD InChIKey | LYGJENNIWJXYER-UHFFFAOYAW | | Melting Points | | mp °C | source | |
|---|
| -29.00 | Alfa Aesar | | -29.00 | Oxford University MSDS | | -28.50 | PHYSPROP |
|
|
| | | nitrosobenzene C6H5NO61, 64 |
 | | Compound Data | | Melting point | 66.75 °C | 339.90 K | | CSID | 10989 | H bond acceptors | 2 | Rule of 5 violations | 0 | | Molecular weight | 107.11 | H bond donors | 0 | ACD/LogP | 2.01 | | Phase 25 °C | solid | Rotatable bonds | 1 | Predicted density | 1.04 g/cm3 | | SMILES | O=Nc1ccccc1 | | STD InChIKey | NLRKCXQQSUWLCH-UHFFFAOYAR | | Melting Points | | mp °C | source | |
|---|
| 65.00 | Oxford University MSDS | | 68.50 | PHYSPROP |
|
|
| | | nonacosane C29H6061, 64 |
 | | Compound Data | | Melting point | 64.85 °C | 338.00 K | | CSID | 11903 | H bond acceptors | 0 | Rule of 5 violations | 1 | | Molecular weight | 408.7867 | H bond donors | 0 | ACD/LogP | 16.16 | | Phase 25 °C | solid | Rotatable bonds | 26 | Predicted density | 0.81 g/cm3 | | SMILES | C(CCCCCCCCCCCCCCCCCCCCCC)CCCCCC | | STD InChIKey | IGGUPRCHHJZPBS-UHFFFAOYAH | | Melting Points | | mp °C | source | |
|---|
| 66.00 | Oxford University MSDS | | 63.70 | PHYSPROP |
|
|
| | | nonadecane C19H403, 4, 61, 64 |
 | |
|
| | | nonadecanoic acid C19H38O261, 64 |
 | | Compound Data | | Melting point | 69.20 °C | 342.35 K | | CSID | 12071 | H bond acceptors | 2 | Rule of 5 violations | 1 | | Molecular weight | 298.5038 | H bond donors | 1 | ACD/LogP | 8.75 | | Phase 25 °C | solid | Rotatable bonds | 17 | Predicted density | 0.89 g/cm3 | | SMILES | O=C(O)CCCCCCCCCCCCCCCCCC | | STD InChIKey | ISYWECDDZWTKFF-UHFFFAOYAR | | Melting Points | | mp °C | source | |
|---|
| 69.00 | Oxford University MSDS | | 69.40 | PHYSPROP |
|
|
| | | nonadecanone C19H38O3, 64 |
 | | Compound Data | | Melting point | 56.00 °C | 329.15 K | | CSID | 62631 | H bond acceptors | 1 | Rule of 5 violations | 1 | | Molecular weight | 282.5044 | H bond donors | 0 | ACD/LogP | 8.34 | | Phase 25 °C | solid | Rotatable bonds | 16 | Predicted density | 0.83 g/cm3 | | SMILES | O=C(CCCCCCCCCCCCCCCCC)C | | STD InChIKey | IEDKVDCIEARIIU-UHFFFAOYAV | | Melting Points | | mp °C | source | |
|---|
| 55.00 | Alfa Aesar | | 57.00 | PHYSPROP |
|
|
| | | nonane C9H203, 4, 61, 64 |
 | |
|
| | | nonanoic acid C9H18O23, 4, 64 |
 | |
|
| | | nonanoyl chloride C9H17ClO3, 64 |
 | | Compound Data | | Melting point | -60.75 °C | 212.40 K | | CSID | 63017 | H bond acceptors | 1 | Rule of 5 violations | 0 | | Molecular weight | 176.6837 | H bond donors | 0 | ACD/LogP | 4.18 | | Phase 25 °C | liquid/gas | Rotatable bonds | 7 | Predicted density | 0.95 g/cm3 | | SMILES | ClC(=O)CCCCCCCC | | STD InChIKey | NTQYXUJLILNTFH-UHFFFAOYAD | | Melting Points | | mp °C | source | |
|---|
| -61.00 | Alfa Aesar | | -60.50 | PHYSPROP |
|
|
| | | octacosane C28H583, 64 |
 | | Compound Data | | Melting point | 63.25 °C | 336.40 K | | CSID | 11902 | H bond acceptors | 0 | Rule of 5 violations | 1 | | Molecular weight | 394.7601 | H bond donors | 0 | ACD/LogP | 15.63 | | Phase 25 °C | solid | Rotatable bonds | 25 | Predicted density | 0.80 g/cm3 | | SMILES | C(CCCCCCCCCCCCCCCCCCCCC)CCCCCC | | STD InChIKey | ZYURHZPYMFLWSH-UHFFFAOYAH | | Melting Points | | mp °C | source | |
|---|
| 62.00 | Alfa Aesar | | 64.50 | PHYSPROP |
|
|
| | | octadecafluorooctane C8F1861, 64 |
 | | Compound Data | | Melting point | -24.10 °C | 249.05 K | | CSID | 9018 | H bond acceptors | 0 | Rule of 5 violations | 1 | | Molecular weight | 438.0569 | H bond donors | 0 | ACD/LogP | 7.43 | | Phase 25 °C | liquid/gas | Rotatable bonds | 5 | Predicted density | 1.69 g/cm3 | | SMILES | FC(F)(C(F)(F)C(F)(F)F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F | | STD InChIKey | YVBBRRALBYAZBM-UHFFFAOYAG | | Melting Points | | mp °C | source | |
|---|
| -25.00 | Oxford University MSDS | | -23.20 | PHYSPROP |
|
|
| | | octadecane C18H383, 4, 64 |
 | |
|
| | | octafluoronaphthalene C10F83, 64 |
 | | Compound Data | | Melting point | 87.25 °C | 360.40 K | | CSID | 60886 | H bond acceptors | 0 | Rule of 5 violations | 0 | | Molecular weight | 272.0942 | H bond donors | 0 | ACD/LogP | 3.61 | | Phase 25 °C | solid | Rotatable bonds | 0 | Predicted density | 1.73 g/cm3 | | SMILES | Fc2c1c(F)c(F)c(F)c(F)c1c(F)c(F)c2F | | STD InChIKey | JDCMOHAFGDQQJX-UHFFFAOYAI | | Melting Points | | mp °C | source | |
|---|
| 87.00 | Alfa Aesar | | 87.50 | PHYSPROP |
|
|
| | | octafluorotoluene C7F83, 64 |
 | | Compound Data | | Melting point | -65.80 °C | 207.35 K | | CSID | 9522 | H bond acceptors | 0 | Rule of 5 violations | 0 | | Molecular weight | 236.0621 | H bond donors | 0 | ACD/LogP | 2.81 | | Phase 25 °C | liquid/gas | Rotatable bonds | 0 | Predicted density | 1.64 g/cm3 | | SMILES | Fc1c(c(F)c(F)c(F)c1F)C(F)(F)F | | STD InChIKey | USPWUOFNOTUBAD-UHFFFAOYAB | | Melting Points | | mp °C | source | |
|---|
| -66.00 | Alfa Aesar | | -65.60 | PHYSPROP |
|
|
| | | octamethylcyclotetrasilazane C8H28N4Si43, 64 |
 | | Compound Data | | Melting point | 96.75 °C | 369.90 K | | CSID | 59489 | H bond acceptors | 4 | Rule of 5 violations | NA | | Molecular weight | 292.6767 | H bond donors | 4 | ACD/LogP | 0.00 | | Phase 25 °C | solid | Rotatable bonds | 0 | Predicted density | 0.92 g/cm3 | | SMILES | N1[Si](N[Si](N[Si](N[Si]1(C)C)(C)C)(C)C)(C)C | | STD InChIKey | FIADVASZMLCQIF-UHFFFAOYAF | | Melting Points | | mp °C | source | |
|---|
| 96.00 | Alfa Aesar | | 97.50 | PHYSPROP |
|
|
| | | octamethylcyclotetrasiloxane C8H24O4Si43, 61, 64 |
 | | Compound Data | | Melting point | 17.67 °C | 290.82 K | | CSID | 10696 | H bond acceptors | 4 | Rule of 5 violations | NA | | Molecular weight | 296.6158 | H bond donors | 0 | ACD/LogP | 0.00 | | Phase 25 °C | liquid/gas | Rotatable bonds | 0 | Predicted density | 0.95 g/cm3 | | SMILES | O1[Si](O[Si](O[Si](O[Si]1(C)C)(C)C)(C)C)(C)C | | STD InChIKey | HMMGMWAXVFQUOA-UHFFFAOYAZ | | Melting Points | | mp °C | source | |
|---|
| 18.00 | Alfa Aesar | | 17.50 | Oxford University MSDS | | 17.50 | PHYSPROP |
|
|
| | | octanenitrile C8H15N3, 31, 64 |
 | |
|
| | | octanoic acid C8H16O23, 4, 12, 32, 35, 64 |
 | |
|
| | | octaphenylcyclotetrasiloxane C48H40O4Si4 |
 | | Compound Data | | Melting point | 0.00 °C | 273.15 K | | CSID | 61642 | H bond acceptors | 4 | Rule of 5 violations | NA | | Molecular weight | 793.1708 | H bond donors | 0 | ACD/LogP | 0.00 | | Phase 25 °C | liquid/gas | Rotatable bonds | 8 | Predicted density | 1.22 g/cm3 | | SMILES | O1[Si](O[Si](O[Si](O[Si]1(c2ccccc2)c3ccccc3)(c4ccccc4)c5ccccc5)(c6ccccc6)c7ccccc7)(c8ccccc8)c9ccccc9 | | STD InChIKey | VSIKJPJINIDELZ-UHFFFAOYAJ | | Melting Points |
|
|
| | | octyl cyanide C9H17N31, 64 |
 | | Compound Data | | Melting point | -34.10 °C | 239.05 K | | CSID | 15846 | H bond acceptors | 1 | Rule of 5 violations | 0 | | Molecular weight | 139.238 | H bond donors | 0 | ACD/LogP | 3.27 | | Phase 25 °C | liquid/gas | Rotatable bonds | 6 | Predicted density | 0.82 g/cm3 | | SMILES | N#CCCCCCCCC | | STD InChIKey | PLZZPPHAMDJOSR-UHFFFAOYAV | | Melting Points | | mp °C | source | |
|---|
| -34.00 | Dreisbach R. R. Physical Properties of Chemical Compounds; V... | | -34.20 | PHYSPROP |
|
|
| | | octyl gallate C15H22O53, 64 |
 | | Compound Data | | Melting point | 100.75 °C | 373.90 K | | CSID | 55194 | H bond acceptors | 5 | Rule of 5 violations | 1 | | Molecular weight | 282.3322 | H bond donors | 3 | ACD/LogP | 5.26 | | Phase 25 °C | solid | Rotatable bonds | 12 | Predicted density | 1.19 g/cm3 | | SMILES | O=C(OCCCCCCCC)c1cc(O)c(O)c(O)c1 | | STD InChIKey | NRPKURNSADTHLJ-UHFFFAOYAL | | Melting Points | | mp °C | source | |
|---|
| 99.00 | Alfa Aesar | | 102.50 | PHYSPROP |
|
|
| | | omeprazole C17H19N3O3S9, 32, 32, 44, 48, 64 |
 | |
|
| | | opianic acid C10H10O53, 64 |
 | | Compound Data | | Melting point | 148.50 °C | 421.65 K | | CSID | 61517 | H bond acceptors | 5 | Rule of 5 violations | 0 | | Molecular weight | 210.1834 | H bond donors | 1 | ACD/LogP | 0.63 | | Phase 25 °C | solid | Rotatable bonds | 4 | Predicted density | 1.30 g/cm3 | | SMILES | O=Cc1ccc(OC)c(OC)c1C(=O)O | | STD InChIKey | HVXXOIGTXJOVON-UHFFFAOYAS | | Melting Points | | mp °C | source | |
|---|
| 147.00 | Alfa Aesar | | 150.00 | PHYSPROP |
|
|
| | | opianyl C10H10O448, 64 |
 | | Compound Data | | Melting point | 101.75 °C | 374.90 K | | CSID | 61717 | H bond acceptors | 4 | Rule of 5 violations | 0 | | Molecular weight | 194.184 | H bond donors | 0 | ACD/LogP | 0.63 | | Phase 25 °C | solid | Rotatable bonds | 2 | Predicted density | 1.26 g/cm3 | | SMILES | O=C1OCc2ccc(OC)c(OC)c12 | | STD InChIKey | ORFFGRQMMWVHIB-UHFFFAOYAA | | Melting Points | | mp °C | source | |
|---|
| 101.00 | Karthikeyan M.; Glen R.C.; Bender A. General melting point p... | | 102.50 | PHYSPROP |
|
|
| | | orinase C12H18N2O3S3, 32, 61, 64 |
 | | Compound Data | | Melting point | 128.62 °C | 401.77 K | | CSID | 5304 | H bond acceptors | 5 | Rule of 5 violations | 0 | | Molecular weight | 270.3479 | H bond donors | 2 | ACD/LogP | 2.34 | | Phase 25 °C | solid | Rotatable bonds | 4 | Predicted density | 1.18 g/cm3 | | SMILES | O=S(=O)(c1ccc(cc1)C)NC(=O)NCCCC | | STD InChIKey | JLRGJRBPOGGCBT-UHFFFAOYAI | | Melting Points | | mp °C | source | |
|---|
| 129.00 | Alfa Aesar | | 128.50 | DrugBank | | 128.50 | Oxford University MSDS | | 128.50 | PHYSPROP |
|
|
| | | oxacyclohexadecan-2-one C15H28O23, 64 |
 | | Compound Data | | Melting point | 33.50 °C | 306.65 K | | CSID | 205386 | H bond acceptors | 2 | Rule of 5 violations | 1 | | Molecular weight | 240.3816 | H bond donors | 0 | ACD/LogP | 5.44 | | Phase 25 °C | solid | Rotatable bonds | 0 | Predicted density | 0.89 g/cm3 | | SMILES | O=C1OCCCCCCCCCCCCCC1 | | STD InChIKey | FKUPPRZPSYCDRS-UHFFFAOYAJ | | Melting Points | | mp °C | source | |
|---|
| 35.00 | Alfa Aesar | | 32.00 | PHYSPROP |
|
|
| | | oxanthrene C12H8O261, 64 |
 | | Compound Data | | Melting point | 122.25 °C | 395.40 K | | CSID | 8861 | H bond acceptors | 2 | Rule of 5 violations | 0 | | Molecular weight | 184.1907 | H bond donors | 0 | ACD/LogP | 4.38 | | Phase 25 °C | solid | Rotatable bonds | 0 | Predicted density | 1.24 g/cm3 | | SMILES | O1c3c(Oc2c1cccc2)cccc3 | | STD InChIKey | NFBOHOGPQUYFRF-UHFFFAOYAJ | | Melting Points | | mp °C | source | |
|---|
| 122.50 | Oxford University MSDS | | 122.00 | PHYSPROP |
|
|
| | | oxaprozin C18H15NO39, 32, 64 |
 | | Compound Data | | Melting point | 160.08 °C | 433.23 K | | CSID | 4453 | H bond acceptors | 4 | Rule of 5 violations | 0 | | Molecular weight | 293.3166 | H bond donors | 1 | ACD/LogP | 3.89 | | Phase 25 °C | solid | Rotatable bonds | 5 | Predicted density | 1.22 g/cm3 | | SMILES | O=C(O)CCc1nc(c(o1)c2ccccc2)c3ccccc3 | | STD InChIKey | OFPXSFXSNFPTHF-UHFFFAOYAC | | Melting Points | | mp °C | source | |
|---|
| 161.00 | Bergstrom C. A. S.; Norinder U.; Luthman K.; Artursson P. Mo... | | 158.50 | DrugBank | | 160.75 | PHYSPROP |
|
|
| | | oxindole C8H7NO3, 64 |
 | | Compound Data | | Melting point | 127.00 °C | 400.15 K | | CSID | 284794 | H bond acceptors | 2 | Rule of 5 violations | 0 | | Molecular weight | 133.1473 | H bond donors | 1 | ACD/LogP | 1.15 | | Phase 25 °C | solid | Rotatable bonds | 0 | Predicted density | 1.20 g/cm3 | | SMILES | c1ccc2c(c1)CC(=O)N2 | | STD InChIKey | JYGFTBXVXVMTGB-UHFFFAOYAF | | Melting Points | | mp °C | source | |
|---|
| 126.00 | Alfa Aesar | | 128.00 | PHYSPROP |
|
|
| | | p-cyanoaniline C7H6N22, 3, 64 |
 | |
|
| | | p-diisopropenylbenzene C12H142, 64 |
 | | Compound Data | | Melting point | 64.75 °C | 337.90 K | | CSID | 66759 | H bond acceptors | 0 | Rule of 5 violations | 0 | | Molecular weight | 158.2396 | H bond donors | 0 | ACD/LogP | 4.29 | | Phase 25 °C | solid | Rotatable bonds | 2 | Predicted density | 0.87 g/cm3 | | SMILES | C(/c1ccc(\C(=C)C)cc1)(=C)C | | STD InChIKey | ZENYUPUKNXGVDY-UHFFFAOYAU | | Melting Points | | mp °C | source | |
|---|
| 66.00 | Aldrich Chemical Company; Aldrich Catalog-Handbook of Fine C... | | 63.50 | PHYSPROP |
|
|
| | | p-iodobromobenzene C6H4BrI2, 3, 64 |
 | |
|
| | | p-nitroacetophenone C8H7NO32, 3, 64 |
 | |
|
| | | p-toluenesulfonamide C7H9NO2S2, 3, 64 |
 | |
|
| | | p-toluidine C7H9N3, 31, 61, 64, 64 |
 | |
|
| | | palmitic acid C16H32O23, 61, 64 |
 | | Compound Data | | Melting point | 61.77 °C | 334.92 K | | CSID | 960 | H bond acceptors | 2 | Rule of 5 violations | 1 | | Molecular weight | 256.4241 | H bond donors | 1 | ACD/LogP | 6.81 | | Phase 25 °C | solid | Rotatable bonds | 14 | Predicted density | 0.89 g/cm3 | | SMILES | CCCCCCCCCCCCCCCC(=O)O | | STD InChIKey | IPCSVZSSVZVIGE-UHFFFAOYAJ | | Melting Points | | mp °C | source | |
|---|
| 61.00 | Alfa Aesar | | 62.50 | Oxford University MSDS | | 61.80 | PHYSPROP |
|
|
| | | palmitoyl chloride C16H31ClO3, 64 |
 | | Compound Data | | Melting point | 11.50 °C | 284.65 K | | CSID | 7914 | H bond acceptors | 1 | Rule of 5 violations | 1 | | Molecular weight | 274.8697 | H bond donors | 0 | ACD/LogP | 7.90 | | Phase 25 °C | liquid/gas | Rotatable bonds | 14 | Predicted density | 0.91 g/cm3 | | SMILES | ClC(=O)CCCCCCCCCCCCCCC | | STD InChIKey | ARBOVOVUTSQWSS-UHFFFAOYAK | | Melting Points | | mp °C | source | |
|---|
| 11.00 | Alfa Aesar | | 12.00 | PHYSPROP |
|
|
| | | papaverine C20H21NO43, 64 |
 | | Compound Data | | Melting point | 147.25 °C | 420.40 K | | CSID | 4518 | H bond acceptors | 5 | Rule of 5 violations | 0 | | Molecular weight | 339.385 | H bond donors | 0 | ACD/LogP | 2.93 | | Phase 25 °C | solid | Rotatable bonds | 6 | Predicted density | 1.16 g/cm3 | | SMILES | COc1ccc(cc1OC)Cc2c3cc(c(cc3ccn2)OC)OC | | STD InChIKey | XQYZDYMELSJDRZ-UHFFFAOYAJ | | Melting Points | | mp °C | source | |
|---|
| 147.00 | Alfa Aesar | | 147.50 | PHYSPROP |
|
|
| | | pentabromophenol C6HBr5O3, 61, 64 |
 | | Compound Data | | Melting point | 228.50 °C | 501.65 K | | CSID | 11359 | H bond acceptors | 1 | Rule of 5 violations | 1 | | Molecular weight | 488.5915 | H bond donors | 1 | ACD/LogP | 6.10 | | Phase 25 °C | solid | Rotatable bonds | 1 | Predicted density | 2.89 g/cm3 | | SMILES | Brc1c(O)c(Br)c(Br)c(Br)c1Br | | STD InChIKey | SVHOVVJFOWGYJO-UHFFFAOYAU | | Melting Points | | mp °C | source | |
|---|
| 226.00 | Alfa Aesar | | 230.00 | Oxford University MSDS | | 229.50 | PHYSPROP |
|
|
| | | pentachloroaniline C6H2Cl5N3, 64 |
 | | Compound Data | | Melting point | 233.50 °C | 506.65 K | | CSID | 10243 | H bond acceptors | 1 | Rule of 5 violations | 0 | | Molecular weight | 265.3518 | H bond donors | 2 | ACD/LogP | 4.86 | | Phase 25 °C | solid | Rotatable bonds | 1 | Predicted density | 1.75 g/cm3 | | SMILES | Clc1c(c(Cl)c(Cl)c(Cl)c1Cl)N | | STD InChIKey | KHCZSJXTDDHLGJ-UHFFFAOYAH | | Melting Points | | mp °C | source | |
|---|
| 232.00 | Alfa Aesar | | 235.00 | PHYSPROP |
|
|
| | | pentachlorophenol C6HCl5O61, 64, 70, 72 |
 | |
|
| | | pentachloropyridine C5Cl5N3, 64 |
 | | Compound Data | | Melting point | 125.25 °C | 398.40 K | | CSID | 15724 | H bond acceptors | 1 | Rule of 5 violations | 0 | | Molecular weight | 251.3252 | H bond donors | 0 | ACD/LogP | 3.60 | | Phase 25 °C | solid | Rotatable bonds | 0 | Predicted density | 1.76 g/cm3 | | SMILES | Clc1c(Cl)c(Cl)nc(Cl)c1Cl | | STD InChIKey | DNDPLEAVNVOOQZ-UHFFFAOYAW | | Melting Points | | mp °C | source | |
|---|
| 125.00 | Alfa Aesar | | 125.50 | PHYSPROP |
|
|
| | | pentacosane C25H523, 64 |
 | | Compound Data | | Melting point | 53.50 °C | 326.65 K | | CSID | 11900 | H bond acceptors | 0 | Rule of 5 violations | 1 | | Molecular weight | 352.6804 | H bond donors | 0 | ACD/LogP | 14.04 | | Phase 25 °C | solid | Rotatable bonds | 22 | Predicted density | 0.80 g/cm3 | | SMILES | C(CCCCCCCCCCCCCCCCCCCC)CCCC | | STD InChIKey | YKNWIILGEFFOPE-UHFFFAOYAK | | Melting Points | | mp °C | source | |
|---|
| 53.00 | Alfa Aesar | | 54.00 | PHYSPROP |
|
|
| | | pentadecafluorooctanoic acid C8HF15O261, 64 |
 | | Compound Data | | Melting point | 54.90 °C | 328.05 K | | CSID | 9180 | H bond acceptors | 2 | Rule of 5 violations | 1 | | Molecular weight | 414.0684 | H bond donors | 1 | ACD/LogP | 7.75 | | Phase 25 °C | solid | Rotatable bonds | 6 | Predicted density | 1.75 g/cm3 | | SMILES | FC(F)(C(F)(F)C(=O)O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F | | STD InChIKey | SNGREZUHAYWORS-UHFFFAOYAQ | | Melting Points | | mp °C | source | |
|---|
| 55.50 | Oxford University MSDS | | 54.30 | PHYSPROP |
|
|
| | | pentadecane C15H323, 4, 61, 64 |
 | |
|
| | | pentadecanoic acid C15H30O23, 61, 64 |
 | | Compound Data | | Melting point | 52.43 °C | 325.58 K | | CSID | 13249 | H bond acceptors | 2 | Rule of 5 violations | 1 | | Molecular weight | 242.3975 | H bond donors | 1 | ACD/LogP | 6.62 | | Phase 25 °C | solid | Rotatable bonds | 13 | Predicted density | 0.90 g/cm3 | | SMILES | O=C(O)CCCCCCCCCCCCCC | | STD InChIKey | WQEPLUUGTLDZJY-UHFFFAOYAK | | Melting Points | | mp °C | source | |
|---|
| 53.00 | Alfa Aesar | | 52.00 | Oxford University MSDS | | 52.30 | PHYSPROP |
|
|
| | | pentafluoroanisole C7H3F5O3, 64 |
 | | Compound Data | | Melting point | -37.50 °C | 235.65 K | | CSID | 21171396 | H bond acceptors | 1 | Rule of 5 violations | 0 | | Molecular weight | 198.0901 | H bond donors | 0 | ACD/LogP | 2.39 | | Phase 25 °C | liquid/gas | Rotatable bonds | 1 | Predicted density | 1.47 g/cm3 | | SMILES | Fc1c(F)c(F)c(F)c(F)c1OC | | STD InChIKey | ZRQUIRABLIQJRI-UHFFFAOYAM | | Melting Points | | mp °C | source | |
|---|
| -38.00 | Alfa Aesar | | -37.00 | PHYSPROP |
|
|
| | | pentafluorobenzoic acid C7HF5O23, 64 |
 | | Compound Data | | Melting point | 101.50 °C | 374.65 K | | CSID | 11277 | H bond acceptors | 2 | Rule of 5 violations | 0 | | Molecular weight | 212.0737 | H bond donors | 1 | ACD/LogP | 2.46 | | Phase 25 °C | solid | Rotatable bonds | 1 | Predicted density | 1.72 g/cm3 | | SMILES | Fc1c(c(F)c(F)c(F)c1F)C(=O)O | | STD InChIKey | YZERDTREOUSUHF-UHFFFAOYAQ | | Melting Points | | mp °C | source | |
|---|
| 102.00 | Alfa Aesar | | 101.00 | PHYSPROP |
|
|
| | | pentafluorobenzonitrile C7F5N3, 64 |
 | | Compound Data | | Melting point | 2.20 °C | 275.35 K | | CSID | 63077 | H bond acceptors | 1 | Rule of 5 violations | 0 | | Molecular weight | 193.0736 | H bond donors | 0 | ACD/LogP | 0.95 | | Phase 25 °C | liquid/gas | Rotatable bonds | 0 | Predicted density | 1.55 g/cm3 | | SMILES | Fc1c(C#N)c(F)c(F)c(F)c1F | | STD InChIKey | YXWJGZQOGXGSSC-UHFFFAOYAJ | | Melting Points | | mp °C | source | |
|---|
| 2.00 | Alfa Aesar | | 2.40 | PHYSPROP |
|
|
| | | pentafluorophenol C6HF5O3, 61, 64 |
 | | Compound Data | | Melting point | 33.93 °C | 307.08 K | | CSID | 12499 | H bond acceptors | 1 | Rule of 5 violations | 0 | | Molecular weight | 184.0636 | H bond donors | 1 | ACD/LogP | 3.05 | | Phase 25 °C | solid | Rotatable bonds | 1 | Predicted density | 1.69 g/cm3 | | SMILES | Fc1c(F)c(F)c(F)c(O)c1F | | STD InChIKey | XBNGYFFABRKICK-UHFFFAOYAG | | Melting Points | | mp °C | source | |
|---|
| 34.00 | Alfa Aesar | | 35.00 | Oxford University MSDS | | 32.80 | PHYSPROP |
|
|
| | | pentafluorophenyl phenyl ketone C13H5F5O3, 61, 64 |
 | | Compound Data | | Melting point | 37.50 °C | 310.65 K | | CSID | 66396 | H bond acceptors | 1 | Rule of 5 violations | 0 | | Molecular weight | 272.1702 | H bond donors | 0 | ACD/LogP | 2.29 | | Phase 25 °C | solid | Rotatable bonds | 2 | Predicted density | 1.44 g/cm3 | | SMILES | Fc1c(c(F)c(F)c(F)c1F)C(=O)c2ccccc2 | | STD InChIKey | HCCPWBWOSASKLG-UHFFFAOYAF | | Melting Points | | mp °C | source | |
|---|
| 38.00 | Alfa Aesar | | 37.50 | Oxford University MSDS | | 37.00 | PHYSPROP |
|
|
| | | pentafluorophenylhydrazine C6H3F5N23, 64 |
 | | Compound Data | | Melting point | 75.50 °C | 348.65 K | | CSID | 12681 | H bond acceptors | 2 | Rule of 5 violations | 0 | | Molecular weight | 198.0934 | H bond donors | 3 | ACD/LogP | 2.52 | | Phase 25 °C | solid | Rotatable bonds | 2 | Predicted density | 1.69 g/cm3 | | SMILES | Fc1c(F)c(F)c(F)c(F)c1NN | | STD InChIKey | BYCUWCJUPSUFBX-UHFFFAOYAP | | Melting Points | | mp °C | source | |
|---|
| 76.00 | Alfa Aesar | | 75.00 | PHYSPROP |
|
|
| | | pentamethylbenzene C11H164, 64 |
 | | Compound Data | | Melting point | 54.25 °C | 327.40 K | | CSID | 12259 | H bond acceptors | 0 | Rule of 5 violations | 0 | | Molecular weight | 148.2447 | H bond donors | 0 | ACD/LogP | 4.52 | | Phase 25 °C | solid | Rotatable bonds | 0 | Predicted density | 0.87 g/cm3 | | SMILES | c1(c(cc(c(c1C)C)C)C)C | | STD InChIKey | BEZDDPMMPIDMGJ-UHFFFAOYAT | | Melting Points | | mp °C | source | |
|---|
| 54.00 | American Petroleum Institute. Research Project 44; Selected ... | | 54.50 | PHYSPROP |
|
|
| | | pentamethylbenzyl chloride C12H17Cl3, 48 |
 | | Compound Data | | Melting point | 82.50 °C | 355.65 K | | CSID | 61399 | H bond acceptors | 0 | Rule of 5 violations | 0 | | Molecular weight | 196.7164 | H bond donors | 0 | ACD/LogP | 4.79 | | Phase 25 °C | solid | Rotatable bonds | 1 | Predicted density | 0.99 g/cm3 | | SMILES | ClCc1c(c(c(c(c1C)C)C)C)C | | STD InChIKey | CXUAEBDTJFKMBV-UHFFFAOYAP | | Melting Points | | mp °C | source | |
|---|
| 83.00 | Alfa Aesar | | 82.00 | Karthikeyan M.; Glen R.C.; Bender A. General melting point p... |
|
|
| | | pentamethylenetetrazol C6H10N43, 61, 64 |
 | | Compound Data | | Melting point | 59.00 °C | 332.15 K | | CSID | 5704 | H bond acceptors | 4 | Rule of 5 violations | 0 | | Molecular weight | 138.1704 | H bond donors | 0 | ACD/LogP | 0.14 | | Phase 25 °C | solid | Rotatable bonds | 0 | Predicted density | 1.42 g/cm3 | | SMILES | n1nnc2n1CCCCC2 | | STD InChIKey | CWRVKFFCRWGWCS-UHFFFAOYAS | | Melting Points | | mp °C | source | |
|---|
| 60.00 | Alfa Aesar | | 57.50 | Oxford University MSDS | | 59.50 | PHYSPROP |
|
|
| | | pentane C5H123, 4, 15, 61, 64 |
 | |
|
| | | pentobarbital C11H18N2O332, 35, 44, 64 |
 | |
|
| | | pentyl butyrate C9H18O27, 64 |
 | | Compound Data | | Melting point | -73.10 °C | 200.05 K | | CSID | 10428 | H bond acceptors | 2 | Rule of 5 violations | 0 | | Molecular weight | 158.238 | H bond donors | 0 | ACD/LogP | 3.37 | | Phase 25 °C | liquid/gas | Rotatable bonds | 7 | Predicted density | 0.88 g/cm3 | | SMILES | O=C(OCCCCC)CCC | | STD InChIKey | CFNJLPHOBMVMNS-UHFFFAOYAQ | | Melting Points | | mp °C | source | |
|---|
| -73.00 | Beilstein F. K.; Beilsteins Handbuch der Organischen Chemie.... | | -73.20 | PHYSPROP |
|
|
| | | pentyl cyanide C6H11N31, 64 |
 | | Compound Data | | Melting point | -80.15 °C | 193.00 K | | CSID | 11846 | H bond acceptors | 1 | Rule of 5 violations | 0 | | Molecular weight | 97.1582 | H bond donors | 0 | ACD/LogP | 1.68 | | Phase 25 °C | liquid/gas | Rotatable bonds | 3 | Predicted density | 0.80 g/cm3 | | SMILES | N#CCCCCC | | STD InChIKey | AILKHAQXUAOOFU-UHFFFAOYAZ | | Melting Points | | mp °C | source | |
|---|
| -80.00 | Dreisbach R. R. Physical Properties of Chemical Compounds; V... | | -80.30 | PHYSPROP |
|
|
| | | peracetic acid C2H4O361, 64 |
 | | Compound Data | | Melting point | -0.05 °C | 273.10 K | | CSID | 6336 | H bond acceptors | 3 | Rule of 5 violations | 0 | | Molecular weight | 76.0514 | H bond donors | 1 | ACD/LogP | 0.00 | | Phase 25 °C | liquid/gas | Rotatable bonds | 2 | Predicted density | 1.22 g/cm3 | | SMILES | CC(=O)OO | | STD InChIKey | KFSLWBXXFJQRDL-UHFFFAOYAD | | Melting Points | | mp °C | source | |
|---|
| 0.10 | Oxford University MSDS | | -0.20 | PHYSPROP |
|
|
| | | perazine C20H25N3S44, 64 |
 | | Compound Data | | Melting point | 52.50 °C | 325.65 K | | CSID | 4582 | H bond acceptors | 3 | Rule of 5 violations | 0 | | Molecular weight | 339.4976 | H bond donors | 0 | ACD/LogP | 4.04 | | Phase 25 °C | solid | Rotatable bonds | 4 | Predicted density | 1.15 g/cm3 | | SMILES | S2c1ccccc1N(c3c2cccc3)CCCN4CCN(C)CC4 | | STD InChIKey | WEYVCQFUGFRXOM-UHFFFAOYAC | | Melting Points | | mp °C | source | |
|---|
| 53.00 | Hughes LD; Palmer DS; Nigsch F and Mitchell JBO. 2008 Why ar... | | 52.00 | PHYSPROP |
|
|
| | | perphenazine C21H26ClN3OS9, 44, 48, 64 |
 | |
|
| | | perylene C20H123, 44, 61, 64, 70 |
 | |
|
| | | phenacetin C10H13NO22, 3, 32, 35, 44, 61, 64, 70 |
 | |
|
| | | phenacyl bromide C8H7BrO3, 48, 64 |
 | |
|
| | | phenacyl chloride C8H7ClO3, 32, 61, 64 |
 | | Compound Data | | Melting point | 55.17 °C | 328.32 K | | CSID | 10303 | H bond acceptors | 1 | Rule of 5 violations | 0 | | Molecular weight | 154.5936 | H bond donors | 0 | ACD/LogP | 1.85 | | Phase 25 °C | solid | Rotatable bonds | 2 | Predicted density | 1.17 g/cm3 | | SMILES | O=C(c1ccccc1)CCl | | STD InChIKey | IMACFCSSMIZSPP-UHFFFAOYAN | | Melting Points | | mp °C | source | |
|---|
| 54.00 | Alfa Aesar | | 55.00 | Oxford University MSDS | | 56.50 | PHYSPROP | | Values not used in calculating the average melting point | | -93.40 | DrugBank1 | | 1. incorrect SMILES - mp for methylamine JCB |
|
|
| | | phenalenone C13H8O61, 64 |
 | | Compound Data | | Melting point | 154.25 °C | 427.40 K | | CSID | 10582 | H bond acceptors | 1 | Rule of 5 violations | 0 | | Molecular weight | 180.202 | H bond donors | 0 | ACD/LogP | 3.45 | | Phase 25 °C | solid | Rotatable bonds | 0 | Predicted density | 1.26 g/cm3 | | SMILES | O=C3/C=C\c2cccc1cccc3c12 | | STD InChIKey | WWBGWPHHLRSTFI-UHFFFAOYAL | | Melting Points | | mp °C | source | |
|---|
| 154.50 | Oxford University MSDS | | 154.00 | PHYSPROP |
|
|
| | | phenanthrene C14H103, 35, 44, 61, 64, 70, 70 |
 | |
|
| | | phenanthrene-9-carboxaldehyde C15H10O3, 72 |
 | | Compound Data | | Melting point | 101.75 °C | 374.90 K | | CSID | 70806 | H bond acceptors | 1 | Rule of 5 violations | 0 | | Molecular weight | 206.2393 | H bond donors | 0 | ACD/LogP | 4.10 | | Phase 25 °C | solid | Rotatable bonds | 1 | Predicted density | 1.22 g/cm3 | | SMILES | O=Cc2cc3c(c1c2cccc1)cccc3 | | STD InChIKey | QECIGCMPORCORE-UHFFFAOYAE | | Melting Points | | mp °C | source | |
|---|
| 102.00 | Alfa Aesar | | 101.50 | Sigma-Aldrich |
|
|
| | | phenanthrene-9,10-dione C14H8O23, 48, 61, 64 |
 | |
|
| | | phenanthrindene C15H1061, 64 |
 | | Compound Data | | Melting point | 115.00 °C | 388.15 K | | CSID | 8793 | H bond acceptors | 0 | Rule of 5 violations | 0 | | Molecular weight | 190.2399 | H bond donors | 0 | ACD/LogP | 4.54 | | Phase 25 °C | solid | Rotatable bonds | 0 | Predicted density | 1.26 g/cm3 | | SMILES | c23ccc1cccc4c1c2c(ccc3)C4 | | STD InChIKey | RKZDZWJDQTZDLD-UHFFFAOYAY | | Melting Points | | mp °C | source | |
|---|
| 116.00 | Oxford University MSDS | | 114.00 | PHYSPROP |
|
|
| | | phenanthroline C12H8N23, 32, 64 |
 | | Compound Data | | Melting point | 117.33 °C | 390.48 K | | CSID | 1278 | H bond acceptors | 2 | Rule of 5 violations | 0 | | Molecular weight | 180.2053 | H bond donors | 0 | ACD/LogP | 2.25 | | Phase 25 °C | solid | Rotatable bonds | 0 | Predicted density | 1.25 g/cm3 | | SMILES | c1cc2ccc3cccnc3c2nc1 | | STD InChIKey | DGEZNRSVGBDHLK-UHFFFAOYAW | | Melting Points | | mp °C | source | |
|---|
| 118.00 | Alfa Aesar | | 117.00 | DrugBank | | 117.00 | PHYSPROP |
|
|
| | | phencarbamide C19H24N2OS9, 48, 64 |
 | |
|
| | | phenidone C9H10N2O3, 61, 64 |
 | | Compound Data | | Melting point | 123.33 °C | 396.48 K | | CSID | 6823 | H bond acceptors | 3 | Rule of 5 violations | 0 | | Molecular weight | 162.1885 | H bond donors | 1 | ACD/LogP | 0.18 | | Phase 25 °C | solid | Rotatable bonds | 1 | Predicted density | 1.19 g/cm3 | | SMILES | O=C2NN(c1ccccc1)CC2 | | STD InChIKey | CMCWWLVWPDLCRM-UHFFFAOYAF | | Melting Points | | mp °C | source | |
|---|
| 122.00 | Alfa Aesar | | 122.00 | Oxford University MSDS | | 126.00 | PHYSPROP |
|
|
| | | phenindione C15H10O232, 64 |
 | | Compound Data | | Melting point | 149.75 °C | 422.90 K | | CSID | 4596 | H bond acceptors | 2 | Rule of 5 violations | 0 | | Molecular weight | 222.2387 | H bond donors | 0 | ACD/LogP | 3.30 | | Phase 25 °C | solid | Rotatable bonds | 1 | Predicted density | 1.26 g/cm3 | | SMILES | O=C2c1ccccc1C(=O)C2c3ccccc3 | | STD InChIKey | NFBAXHOPROOJAW-UHFFFAOYAZ | | Melting Points | | mp °C | source | |
|---|
| 149.50 | DrugBank | | 150.00 | PHYSPROP |
|
|
| | | phenobarbital C12H12N2O332, 35, 44, 64, 70 |
 | |
|
| | | phenocoll C10H14N2O29, 48, 64 |
 | |
|
| | | phenol C6H6O3, 31, 64, 70, 72 |
 | |
|
| | | phenolphthalein C20H14O43, 32, 44, 64 |
 | |
|
| | | phenothiazine C12H9NS3, 3, 28, 56, 64, 72, 72 |
 | |
|
| | | phenoxathiine C12H8OS3, 61 |
 | | Compound Data | | Melting point | 58.25 °C | 331.40 K | | CSID | 8862 | H bond acceptors | 1 | Rule of 5 violations | 0 | | Molecular weight | 200.2563 | H bond donors | 0 | ACD/LogP | 4.54 | | Phase 25 °C | solid | Rotatable bonds | 0 | Predicted density | 1.28 g/cm3 | | SMILES | O1c3c(Sc2c1cccc2)cccc3 | | STD InChIKey | GJSGGHOYGKMUPT-UHFFFAOYAV | | Melting Points | | mp °C | source | |
|---|
| 57.00 | Alfa Aesar | | 59.50 | Oxford University MSDS |
|
|
| | | phenoxyacetic acid C8H8O32, 3, 64 |
 | |
|
| | | phentolamine C17H19N3O32, 64 |
 | | Compound Data | | Melting point | 174.75 °C | 447.90 K | | CSID | 5571 | H bond acceptors | 4 | Rule of 5 violations | 0 | | Molecular weight | 281.3523 | H bond donors | 2 | ACD/LogP | 3.60 | | Phase 25 °C | solid | Rotatable bonds | 5 | Predicted density | 1.18 g/cm3 | | SMILES | Oc3cc(N(c1ccc(cc1)C)CC/2=N/CCN\2)ccc3 | | STD InChIKey | MRBDMNSDAVCSSF-UHFFFAOYAI | | Melting Points | | mp °C | source | |
|---|
| 174.50 | DrugBank | | 175.00 | PHYSPROP |
|
|
| | | phenyl benzoate C13H10O22, 3, 48, 64, 72 |
 | |
|
| | | phenyl carbamate C7H7NO23, 64 |
 | | Compound Data | | Melting point | 150.50 °C | 423.65 K | | CSID | 62532 | H bond acceptors | 3 | Rule of 5 violations | 0 | | Molecular weight | 137.136 | H bond donors | 2 | ACD/LogP | 1.08 | | Phase 25 °C | solid | Rotatable bonds | 2 | Predicted density | 1.20 g/cm3 | | SMILES | O=C(Oc1ccccc1)N | | STD InChIKey | BSCCSDNZEIHXOK-UHFFFAOYAJ | | Melting Points | | mp °C | source | |
|---|
| 151.00 | Alfa Aesar | | 150.00 | PHYSPROP |
|
|
| | | phenyl propyl ether C9H12O7, 64 |
 | | Compound Data | | Melting point | -27.50 °C | 245.65 K | | CSID | 11655 | H bond acceptors | 1 | Rule of 5 violations | 0 | | Molecular weight | 136.191 | H bond donors | 0 | ACD/LogP | 3.20 | | Phase 25 °C | liquid/gas | Rotatable bonds | 3 | Predicted density | 0.93 g/cm3 | | SMILES | O(c1ccccc1)CCC | | STD InChIKey | DSNYFFJTZPIKFZ-UHFFFAOYAJ | | Melting Points | | mp °C | source | |
|---|
| -28.00 | Beilstein F. K.; Beilsteins Handbuch der Organischen Chemie.... | | -27.00 | PHYSPROP |
|
|
| | | phenyl salicylate C13H10O33, 35, 64, 67, 72 |
 | | Compound Data | | Melting point | 42.40 °C | 315.55 K | | CSID | 8058 | H bond acceptors | 3 | Rule of 5 violations | 0 | | Molecular weight | 214.2167 | H bond donors | 1 | ACD/LogP | 3.55 | | Phase 25 °C | solid | Rotatable bonds | 4 | Predicted density | 1.25 g/cm3 | | SMILES | O=C(Oc1ccccc1)c2ccccc2O | | STD InChIKey | ZQBAKBUEJOMQEX-UHFFFAOYAI | | Melting Points | | mp °C | source | |
|---|
| 43.00 | Alfa Aesar | | 42.20 | RTC melting point standard | | 42.00 | Sigma-Aldrich | | Values not used in calculating the average melting point | | 130.50 | EPISuite-ChemSpider1 | | 130.50 | PHYSPROP2 | | 1. clearly out of range JCB | | 2. clearly out of range JCB |
|
|
| | | phenyl vinyl sulfone C8H8O2S3, 61 |
 | | Compound Data | | Melting point | 68.50 °C | 341.65 K | | CSID | 71964 | H bond acceptors | 2 | Rule of 5 violations | 0 | | Molecular weight | 168.2129 | H bond donors | 0 | ACD/LogP | 1.20 | | Phase 25 °C | solid | Rotatable bonds | 2 | Predicted density | 1.18 g/cm3 | | SMILES | O=S(=O)(\C=C)c1ccccc1 | | STD InChIKey | UJTPZISIAWDGFF-UHFFFAOYAS | | Melting Points | | mp °C | source | |
|---|
| 69.00 | Alfa Aesar | | 68.00 | Oxford University MSDS |
|
|
| | | phenylacetic acid C8H8O22, 3, 3, 35, 48, 59, 64, 72 |
 | |
|
| | | phenylacetylene C8H63, 64 |
 | | Compound Data | | Melting point | -44.90 °C | 228.25 K | | CSID | 10364 | H bond acceptors | 0 | Rule of 5 violations | 0 | | Molecular weight | 102.1332 | H bond donors | 0 | ACD/LogP | 2.70 | | Phase 25 °C | liquid/gas | Rotatable bonds | 0 | Predicted density | 0.95 g/cm3 | | SMILES | C#Cc1ccccc1 | | STD InChIKey | UEXCJVNBTNXOEH-UHFFFAOYAC | | Melting Points | | mp °C | source | |
|---|
| -45.00 | Alfa Aesar | | -44.80 | PHYSPROP |
|
|
| | | phenylboronic acid C6H7BO23, 64 |
 | | Compound Data | | Melting point | 218.00 °C | 491.15 K | | CSID | 60191 | H bond acceptors | 2 | Rule of 5 violations | 0 | | Molecular weight | 121.9296 | H bond donors | 2 | ACD/LogP | 1.24 | | Phase 25 °C | solid | Rotatable bonds | 3 | Predicted density | 1.14 g/cm3 | | SMILES | B(c1ccccc1)(O)O | | STD InChIKey | HXITXNWTGFUOAU-UHFFFAOYAQ | | Melting Points | | mp °C | source | |
|---|
| 217.00 | Alfa Aesar | | 219.00 | PHYSPROP |
|
|
| | | phenylbutazone C19H20N2O23, 32, 44, 64 |
 | |
|
| | | phenylhydrazine C6H8N23, 64 |
 | | Compound Data | | Melting point | 19.30 °C | 292.45 K | | CSID | 7235 | H bond acceptors | 2 | Rule of 5 violations | 0 | | Molecular weight | 108.1411 | H bond donors | 3 | ACD/LogP | 1.25 | | Phase 25 °C | liquid/gas | Rotatable bonds | 2 | Predicted density | 1.12 g/cm3 | | SMILES | NNc1ccccc1 | | STD InChIKey | HKOOXMFOFWEVGF-UHFFFAOYAN | | Melting Points | | mp °C | source | |
|---|
| 19.00 | Alfa Aesar | | 19.60 | PHYSPROP |
|
|
| | | phenylphosphonic acid C6H7O3P3, 64 |
 | | Compound Data | | Melting point | 162.75 °C | 435.90 K | | CSID | 14560 | H bond acceptors | 3 | Rule of 5 violations | 0 | | Molecular weight | 158.0917 | H bond donors | 2 | ACD/LogP | 0.54 | | Phase 25 °C | solid | Rotatable bonds | 1 | Predicted density | 1.42 g/cm3 | | SMILES | O=P(O)(O)c1ccccc1 | | STD InChIKey | QLZHNIAADXEJJP-UHFFFAOYAC | | Melting Points | | mp °C | source | |
|---|
| 161.00 | Alfa Aesar | | 164.50 | PHYSPROP |
|
|
| | | phenylpropiolic acid C9H6O23, 3 |
 | | Compound Data | | Melting point | 136.50 °C | 409.65 K | | CSID | 62682 | H bond acceptors | 2 | Rule of 5 violations | 0 | | Molecular weight | 146.1427 | H bond donors | 1 | ACD/LogP | 2.61 | | Phase 25 °C | solid | Rotatable bonds | 1 | Predicted density | 1.24 g/cm3 | | SMILES | O=C(C#Cc1ccccc1)O | | STD InChIKey | XNERWVPQCYSMLC-UHFFFAOYAX | | Melting Points | | mp °C | source | |
|---|
| 136.00 | Alfa Aesar | | 137.00 | Alfa Aesar |
|
|
| | | phenylthioacetic acid C8H8O2S3, 64 |
 | | Compound Data | | Melting point | 64.50 °C | 337.65 K | | CSID | 53706 | H bond acceptors | 2 | Rule of 5 violations | 0 | | Molecular weight | 168.2129 | H bond donors | 1 | ACD/LogP | 1.88 | | Phase 25 °C | solid | Rotatable bonds | 3 | Predicted density | 1.27 g/cm3 | | SMILES | O=C(O)CSc1ccccc1 | | STD InChIKey | MOTOSAGBNXXRRE-UHFFFAOYAI | | Melting Points | | mp °C | source | |
|---|
| 64.00 | Alfa Aesar | | 65.00 | PHYSPROP |
|
|
| | | phenylthiourea C7H8N2S61, 64 |
 | | Compound Data | | Melting point | 151.50 °C | 424.65 K | | CSID | 589165 | H bond acceptors | 2 | Rule of 5 violations | 0 | | Molecular weight | 152.2168 | H bond donors | 3 | ACD/LogP | 0.73 | | Phase 25 °C | solid | Rotatable bonds | 1 | Predicted density | 1.29 g/cm3 | | SMILES | S=C(Nc1ccccc1)N | | STD InChIKey | FULZLIGZKMKICU-UHFFFAOYAW | | Melting Points | | mp °C | source | |
|---|
| 149.00 | Oxford University MSDS | | 154.00 | PHYSPROP |
|
|
| | | phloroglucinol C6H6O33, 64 |
 | | Compound Data | | Melting point | 218.25 °C | 491.40 K | | CSID | 352 | H bond acceptors | 3 | Rule of 5 violations | 0 | | Molecular weight | 126.11 | H bond donors | 3 | ACD/LogP | 0.00 | | Phase 25 °C | solid | Rotatable bonds | 3 | Predicted density | 1.49 g/cm3 | | SMILES | c1c(cc(cc1O)O)O | | STD InChIKey | QCDYQQDYXPDABM-UHFFFAOYAF | | Melting Points | | mp °C | source | |
|---|
| 218.00 | Alfa Aesar | | 218.50 | PHYSPROP |
|
|
| | | phthalaldehyde C8H6O22, 61, 64 |
 | |
|
| | | phthalazine C8H6N23, 64 |
 | | Compound Data | | Melting point | 90.75 °C | 363.90 K | | CSID | 8852 | H bond acceptors | 2 | Rule of 5 violations | 0 | | Molecular weight | 130.1466 | H bond donors | 0 | ACD/LogP | 0.46 | | Phase 25 °C | solid | Rotatable bonds | 0 | Predicted density | 1.18 g/cm3 | | SMILES | n2ncc1ccccc1c2 | | STD InChIKey | LFSXCDWNBUNEEM-UHFFFAOYAE | | Melting Points | | mp °C | source | |
|---|
| 91.00 | Alfa Aesar | | 90.50 | PHYSPROP |
|
|
| | | phthalic anhydride C8H4O33, 64 |
 | | Compound Data | | Melting point | 131.40 °C | 404.55 K | | CSID | 6552 | H bond acceptors | 3 | Rule of 5 violations | 0 | | Molecular weight | 148.1156 | H bond donors | 0 | ACD/LogP | 1.60 | | Phase 25 °C | solid | Rotatable bonds | 0 | Predicted density | 1.44 g/cm3 | | SMILES | O=C1OC(=O)c2ccccc12 | | STD InChIKey | LGRFSURHDFAFJT-UHFFFAOYAZ | | Melting Points | | mp °C | source | |
|---|
| 132.00 | Alfa Aesar | | 130.80 | PHYSPROP |
|
|
| | | phthalide C8H6O23, 64 |
 | | Compound Data | | Melting point | 74.50 °C | 347.65 K | | CSID | 6621 | H bond acceptors | 2 | Rule of 5 violations | 0 | | Molecular weight | 134.132 | H bond donors | 0 | ACD/LogP | 0.99 | | Phase 25 °C | solid | Rotatable bonds | 0 | Predicted density | 1.26 g/cm3 | | SMILES | O=C1OCc2ccccc12 | | STD InChIKey | WNZQDUSMALZDQF-UHFFFAOYAW | | Melting Points | | mp °C | source | |
|---|
| 74.00 | Alfa Aesar | | 75.00 | PHYSPROP |
|
|
| | | phthalimide C8H5NO23, 64 |
 | | Compound Data | | Melting point | 236.00 °C | 509.15 K | | CSID | 6550 | H bond acceptors | 3 | Rule of 5 violations | 0 | | Molecular weight | 147.1308 | H bond donors | 1 | ACD/LogP | 1.15 | | Phase 25 °C | solid | Rotatable bonds | 0 | Predicted density | 1.37 g/cm3 | | SMILES | O=C2c1ccccc1C(=O)N2 | | STD InChIKey | XKJCHHZQLQNZHY-UHFFFAOYAS | | Melting Points | | mp °C | source | |
|---|
| 234.00 | Alfa Aesar | | 238.00 | PHYSPROP |
|
|
| | | phthaloyl chloride C8H4Cl2O23, 64 |
 | | Compound Data | | Melting point | 13.75 °C | 286.90 K | | CSID | 13865683 | H bond acceptors | 2 | Rule of 5 violations | 0 | | Molecular weight | 203.0222 | H bond donors | 0 | ACD/LogP | 1.65 | | Phase 25 °C | liquid/gas | Rotatable bonds | 2 | Predicted density | 1.43 g/cm3 | | SMILES | O=C(Cl)c1ccccc1C(Cl)=O | | STD InChIKey | FYXKZNLBZKRYSS-UHFFFAOYAB | | Melting Points | | mp °C | source | |
|---|
| 12.00 | Alfa Aesar | | 15.50 | PHYSPROP |
|
|
| | | picric acid C6H3N3O761, 64 |
 | | Compound Data | | Melting point | 122.25 °C | 395.40 K | | CSID | 6688 | H bond acceptors | 10 | Rule of 5 violations | 1 | | Molecular weight | 229.1039 | H bond donors | 1 | ACD/LogP | 1.84 | | Phase 25 °C | solid | Rotatable bonds | 4 | Predicted density | 1.86 g/cm3 | | SMILES | O=[N+]([O-])c1cc(cc([N+]([O-])=O)c1O)[N+]([O-])=O | | STD InChIKey | OXNIZHLAWKMVMX-UHFFFAOYAM | | Melting Points | | mp °C | source | |
|---|
| 122.00 | Oxford University MSDS | | 122.50 | PHYSPROP |
|
|
| | | pimelic acid C7H12O43, 32, 64 |
 | | Compound Data | | Melting point | 105.33 °C | 378.48 K | | CSID | 376 | H bond acceptors | 4 | Rule of 5 violations | 0 | | Molecular weight | 160.1678 | H bond donors | 2 | ACD/LogP | 0.27 | | Phase 25 °C | solid | Rotatable bonds | 6 | Predicted density | 1.20 g/cm3 | | SMILES | O=C(O)CCCCCC(=O)O | | STD InChIKey | WLJVNTCWHIRURA-UHFFFAOYAR | | Melting Points | | mp °C | source | |
|---|
| 104.00 | Alfa Aesar | | 106.00 | DrugBank | | 106.00 | PHYSPROP |
|
|
| | | pinacol C6H14O22, 3, 64 |
 | |
|
| | | pinacolone C6H12O3, 4, 61, 64 |
 | |
|
| | | piperazine C4H10N23, 32, 64 |
 | | Compound Data | | Melting point | 107.33 °C | 380.48 K | | CSID | 13835459 | H bond acceptors | 2 | Rule of 5 violations | 0 | | Molecular weight | 86.1356 | H bond donors | 2 | ACD/LogP | 0.00 | | Phase 25 °C | solid | Rotatable bonds | 0 | Predicted density | 0.87 g/cm3 | | SMILES | C1CNCCN1 | | STD InChIKey | GLUUGHFHXGJENI-UHFFFAOYAS | | Melting Points | | mp °C | source | |
|---|
| 110.00 | Alfa Aesar | | 106.00 | DrugBank | | 106.00 | PHYSPROP |
|
|
| | | piperidine C5H11N3, 64 |
 | | Compound Data | | Melting point | -9.00 °C | 264.15 K | | CSID | 7791 | H bond acceptors | 1 | Rule of 5 violations | 0 | | Molecular weight | 85.1475 | H bond donors | 1 | ACD/LogP | 0.61 | | Phase 25 °C | liquid/gas | Rotatable bonds | 0 | Predicted density | 0.83 g/cm3 | | SMILES | C1CCNCC1 | | STD InChIKey | NQRYJNQNLNOLGT-UHFFFAOYAY | | Melting Points | | mp °C | source | |
|---|
| -11.00 | Alfa Aesar | | -7.00 | PHYSPROP |
|
|
| | | piperidione C9H15NO29, 48, 64 |
 | |
|
| | | piperidone C5H9NO3, 64 |
 | | Compound Data | | Melting point | 38.25 °C | 311.40 K | | CSID | 12144 | H bond acceptors | 2 | Rule of 5 violations | 0 | | Molecular weight | 99.1311 | H bond donors | 1 | ACD/LogP | -0.89 | | Phase 25 °C | solid | Rotatable bonds | 0 | Predicted density | 1.00 g/cm3 | | SMILES | O=C1NCCCC1 | | STD InChIKey | XUWHAWMETYGRKB-UHFFFAOYAE | | Melting Points | | mp °C | source | |
|---|
| 37.00 | Alfa Aesar | | 39.50 | PHYSPROP |
|
|
| | | piperonal C8H6O33, 35, 64 |
 | | Compound Data | | Melting point | 36.67 °C | 309.82 K | | CSID | 13859497 | H bond acceptors | 3 | Rule of 5 violations | 0 | | Molecular weight | 150.1314 | H bond donors | 0 | ACD/LogP | 1.05 | | Phase 25 °C | solid | Rotatable bonds | 1 | Predicted density | 1.34 g/cm3 | | SMILES | c1cc2c(cc1C=O)OCO2 | | STD InChIKey | SATCULPHIDQDRE-UHFFFAOYAS | | Melting Points | | mp °C | source | |
|---|
| 36.00 | Alfa Aesar | | 37.00 | EPISuite-ChemSpider | | 37.00 | PHYSPROP |
|
|
| | | piperonol C8H8O33, 64 |
 | | Compound Data | | Melting point | 55.50 °C | 328.65 K | | CSID | 9900 | H bond acceptors | 3 | Rule of 5 violations | 0 | | Molecular weight | 152.1473 | H bond donors | 1 | ACD/LogP | 0.90 | | Phase 25 °C | solid | Rotatable bonds | 2 | Predicted density | 1.33 g/cm3 | | SMILES | O1c2ccc(cc2OC1)CO | | STD InChIKey | BHUIUXNAPJIDOG-UHFFFAOYAA | | Melting Points | | mp °C | source | |
|---|
| 53.00 | Alfa Aesar | | 58.00 | PHYSPROP |
|
|
| | | piperonylic acid C8H6O43, 64 |
 | | Compound Data | | Melting point | 231.00 °C | 504.15 K | | CSID | 6928 | H bond acceptors | 4 | Rule of 5 violations | 0 | | Molecular weight | 166.1308 | H bond donors | 1 | ACD/LogP | 2.01 | | Phase 25 °C | solid | Rotatable bonds | 1 | Predicted density | 1.47 g/cm3 | | SMILES | O=C(O)c1ccc2OCOc2c1 | | STD InChIKey | VDVJGIYXDVPQLP-UHFFFAOYAN | | Melting Points | | mp °C | source | |
|---|
| 233.00 | Alfa Aesar | | 229.00 | PHYSPROP |
|
|
| | | piperonylonitrile C8H5NO23, 48 |
 | | Compound Data | | Melting point | 93.50 °C | 366.65 K | | CSID | 70512 | H bond acceptors | 3 | Rule of 5 violations | 0 | | Molecular weight | 147.1308 | H bond donors | 0 | ACD/LogP | 1.88 | | Phase 25 °C | solid | Rotatable bonds | 0 | Predicted density | 1.34 g/cm3 | | SMILES | N#Cc1ccc2OCOc2c1 | | STD InChIKey | PKRWWZCDLJSJIF-UHFFFAOYAP | | Melting Points | | mp °C | source | |
|---|
| 93.00 | Alfa Aesar | | 94.00 | Karthikeyan M.; Glen R.C.; Bender A. General melting point p... |
|
|
| | | pipsyl chloride C6H4ClIO2S3, 64 |
 | | Compound Data | | Melting point | 83.50 °C | 356.65 K | | CSID | 7121 | H bond acceptors | 2 | Rule of 5 violations | 0 | | Molecular weight | 302.5172 | H bond donors | 0 | ACD/LogP | 3.28 | | Phase 25 °C | solid | Rotatable bonds | 1 | Predicted density | 2.04 g/cm3 | | SMILES | O=S(Cl)(=O)c1ccc(I)cc1 | | STD InChIKey | POXFXTSTVWDWIR-UHFFFAOYAO | | Melting Points | | mp °C | source | |
|---|
| 82.00 | Alfa Aesar | | 85.00 | PHYSPROP |
|
|
| | | piroxicam C15H13N3O4S9, 35, 44, 64 |
 | |
|
| | | pivalic acid C5H10O23, 4, 64 |
 | |
|
| | | pivalonitrile C5H9N3, 64 |
 | | Compound Data | | Melting point | 16.00 °C | 289.15 K | | CSID | 11909 | H bond acceptors | 1 | Rule of 5 violations | 0 | | Molecular weight | 83.1317 | H bond donors | 0 | ACD/LogP | 0.78 | | Phase 25 °C | liquid/gas | Rotatable bonds | 0 | Predicted density | 0.80 g/cm3 | | SMILES | N#CC(C)(C)C | | STD InChIKey | JAMNHZBIQDNHMM-UHFFFAOYAT | | Melting Points | | mp °C | source | |
|---|
| 17.00 | Alfa Aesar | | 15.00 | PHYSPROP |
|
|
| | | pridinol C20H25NO9, 48, 64 |
 | |
|
| | | primidone C12H14N2O29, 32, 44, 64 |
 | |
|
| | | probarbital C9H14N2O335, 44, 64 |
 | |
|
| | | probenecid C13H19NO4S3, 9, 32, 44, 61, 64 |
 | |
|
| | | profluralin C14H16F3N3O464, 70 |
 | | Compound Data | | Melting point | 32.15 °C | 305.30 K | | CSID | 30913 | H bond acceptors | 7 | Rule of 5 violations | 1 | | Molecular weight | 347.2897 | H bond donors | 0 | ACD/LogP | 5.25 | | Phase 25 °C | solid | Rotatable bonds | 7 | Predicted density | 1.41 g/cm3 | | SMILES | [O-][N+](=O)c2c(N(CCC)CC1CC1)c([N+]([O-])=O)cc(c2)C(F)(F)F | | STD InChIKey | ITVQAKZNYJEWKS-UHFFFAOYAO | | Melting Points | | mp °C | source | |
|---|
| 32.30 | PHYSPROP | | 32.00 | Sepassi K; Yalkowsky SH. AAPS PharmSciTech 7(1) E1-E8 (2006) |
|
|
| | | propallylonal C10H13BrN2O39, 48, 64 |
 | |
|
| | | propane C3H861, 64, 73 |
 | |
|
| | | propane sultone C3H6O3S3, 61, 64 |
 | | Compound Data | | Melting point | 31.83 °C | 304.98 K | | CSID | 13626 | H bond acceptors | 3 | Rule of 5 violations | 0 | | Molecular weight | 122.1429 | H bond donors | 0 | ACD/LogP | 0.00 | | Phase 25 °C | solid | Rotatable bonds | 0 | Predicted density | 1.42 g/cm3 | | SMILES | C1COS(=O)(=O)C1 | | STD InChIKey | FSSPGSAQUIYDCN-UHFFFAOYAH | | Melting Points | | mp °C | source | |
|---|
| 32.00 | Alfa Aesar | | 32.00 | Oxford University MSDS | | 31.50 | PHYSPROP |
|
|
| | | propene C3H660, 61, 64, 73 |
 | |
|
| | | propionaldehyde C3H6O3, 4, 61, 64 |
 | |
|
| | | propionamide C3H7NO3, 64 |
 | | Compound Data | | Melting point | 79.65 °C | 352.80 K | | CSID | 6330 | H bond acceptors | 2 | Rule of 5 violations | 0 | | Molecular weight | 73.0938 | H bond donors | 2 | ACD/LogP | -0.70 | | Phase 25 °C | solid | Rotatable bonds | 1 | Predicted density | 0.93 g/cm3 | | SMILES | O=C(N)CC | | STD InChIKey | QLNJFJADRCOGBJ-UHFFFAOYAE | | Melting Points | | mp °C | source | |
|---|
| 78.00 | Alfa Aesar | | 81.30 | PHYSPROP |
|
|
| | | propionic acid C3H6O23, 4, 35, 61, 64 |
 | |
|
| | | propiononitrile C3H5N2, 3, 31, 61, 64 |
 | |
|
| | | propiophenone C9H10O3, 31, 61, 64 |
 | |
|
| | | propoxur C11H15NO344, 64 |
 | | Compound Data | | Melting point | 90.75 °C | 363.90 K | | CSID | 4775 | H bond acceptors | 4 | Rule of 5 violations | 0 | | Molecular weight | 209.2417 | H bond donors | 1 | ACD/LogP | 1.60 | | Phase 25 °C | solid | Rotatable bonds | 4 | Predicted density | 1.08 g/cm3 | | SMILES | O=C(Oc1ccccc1OC(C)C)NC | | STD InChIKey | ISRUGXGCCGIOQO-UHFFFAOYAH | | Melting Points | | mp °C | source | |
|---|
| 91.50 | Hughes LD; Palmer DS; Nigsch F and Mitchell JBO. 2008 Why ar... | | 90.00 | PHYSPROP |
|
|
| | | propyl 4-aminobenzoate C10H13NO23, 64 |
 | | Compound Data | | Melting point | 74.50 °C | 347.65 K | | CSID | 6906 | H bond acceptors | 3 | Rule of 5 violations | 0 | | Molecular weight | 179.2157 | H bond donors | 2 | ACD/LogP | 2.48 | | Phase 25 °C | solid | Rotatable bonds | 5 | Predicted density | 1.10 g/cm3 | | SMILES | O=C(OCCC)c1ccc(N)cc1 | | STD InChIKey | NBFQYHKHPBMJJV-UHFFFAOYAX | | Melting Points | | mp °C | source | |
|---|
| 74.00 | Alfa Aesar | | 75.00 | PHYSPROP |
|
|
| | | propyl acetate C5H10O22, 3, 32, 61, 64 |
 | |
|
| | | propyl hexanoate C9H18O23, 64 |
 | | Compound Data | | Melting point | -68.85 °C | 204.30 K | | CSID | 11790 | H bond acceptors | 2 | Rule of 5 violations | 0 | | Molecular weight | 158.238 | H bond donors | 0 | ACD/LogP | 3.37 | | Phase 25 °C | liquid/gas | Rotatable bonds | 7 | Predicted density | 0.88 g/cm3 | | SMILES | O=C(OCCC)CCCCC | | STD InChIKey | HTUIWRWYYVBCFT-UHFFFAOYAY | | Melting Points | | mp °C | source | |
|---|
| -69.00 | Alfa Aesar | | -68.70 | PHYSPROP |
|
|
| | | propylbenzene C9H123, 4, 61, 64 |
 | |
|
| | | propylcyclohexane C9H184, 64 |
 | | Compound Data | | Melting point | -94.95 °C | 178.20 K | | CSID | 14752 | H bond acceptors | 0 | Rule of 5 violations | 0 | | Molecular weight | 126.2392 | H bond donors | 0 | ACD/LogP | 4.94 | | Phase 25 °C | liquid/gas | Rotatable bonds | 2 | Predicted density | 0.79 g/cm3 | | SMILES | CCCC1CCCCC1 | | STD InChIKey | DEDZSLCZHWTGOR-UHFFFAOYAV | | Melting Points | | mp °C | source | |
|---|
| -95.00 | American Petroleum Institute. Research Project 44; Selected ... | | -94.90 | PHYSPROP |
|
|
| | | propylcyclopentane C8H164, 64 |
 | | Compound Data | | Melting point | -117.15 °C | 156.00 K | | CSID | 15438 | H bond acceptors | 0 | Rule of 5 violations | 0 | | Molecular weight | 112.2126 | H bond donors | 0 | ACD/LogP | 4.38 | | Phase 25 °C | liquid/gas | Rotatable bonds | 2 | Predicted density | 0.79 g/cm3 | | SMILES | CCCC1CCCC1 | | STD InChIKey | KDIAMAVWIJYWHN-UHFFFAOYAU | | Melting Points | | mp °C | source | |
|---|
| -117.00 | American Petroleum Institute. Research Project 44; Selected ... | | -117.30 | PHYSPROP |
|
|
| | | propylene oxide C3H6O3, 61, 64 |
 | | Compound Data | | Melting point | -111.97 °C | 161.18 K | | CSID | 6138 | H bond acceptors | 1 | Rule of 5 violations | 0 | | Molecular weight | 58.0791 | H bond donors | 0 | ACD/LogP | 0.33 | | Phase 25 °C | liquid/gas | Rotatable bonds | 0 | Predicted density | 0.90 g/cm3 | | SMILES | CC1CO1 | | STD InChIKey | GOOHAUXETOMSMM-UHFFFAOYAI | | Melting Points | | mp °C | source | |
|---|
| -112.00 | Alfa Aesar | | -112.00 | Oxford University MSDS | | -111.90 | PHYSPROP |
|
|
| | | propylparaben C10H12O33, 28, 35, 44, 56, 61, 64, 70, 72, 72 |
 | |
|
| | | propylthiouracil C7H10N2OS32, 61, 64 |
 | | Compound Data | | Melting point | 219.67 °C | 492.82 K | | CSID | 571424 | H bond acceptors | 3 | Rule of 5 violations | 0 | | Molecular weight | 170.2321 | H bond donors | 2 | ACD/LogP | 1.37 | | Phase 25 °C | solid | Rotatable bonds | 2 | Predicted density | 1.24 g/cm3 | | SMILES | S=C1N/C(=C\C(=O)N1)CCC | | STD InChIKey | KNAHARQHSZJURB-UHFFFAOYAR | | Melting Points | | mp °C | source | |
|---|
| 219.00 | DrugBank | | 220.00 | Oxford University MSDS | | 220.00 | PHYSPROP |
|
|
| | | putrescine C4H12N23, 32, 61, 64 |
 | | Compound Data | | Melting point | 27.38 °C | 300.52 K | | CSID | 13837702 | H bond acceptors | 2 | Rule of 5 violations | 0 | | Molecular weight | 88.1515 | H bond donors | 4 | ACD/LogP | 0.00 | | Phase 25 °C | solid | Rotatable bonds | 5 | Predicted density | 0.86 g/cm3 | | SMILES | C(CCN)CN | | STD InChIKey | KIDHWZJUCRJVML-UHFFFAOYAX | | Melting Points | | mp °C | source | |
|---|
| 27.00 | Alfa Aesar | | 27.50 | DrugBank | | 27.50 | Oxford University MSDS | | 27.50 | PHYSPROP |
|
|
| | | pyrazinamide C5H5N3O9, 32, 44, 48, 64 |
 | |
|
| | | pyrazine C4H4N23, 61, 64 |
 | | Compound Data | | Melting point | 54.33 °C | 327.48 K | | CSID | 8904 | H bond acceptors | 2 | Rule of 5 violations | 0 | | Molecular weight | 80.088 | H bond donors | 0 | ACD/LogP | 0.00 | | Phase 25 °C | solid | Rotatable bonds | 0 | Predicted density | 1.05 g/cm3 | | SMILES | c1cnccn1 | | STD InChIKey | KYQCOXFCLRTKLS-UHFFFAOYAV | | Melting Points | | mp °C | source | |
|---|
| 53.00 | Alfa Aesar | | 55.00 | Oxford University MSDS | | 55.00 | PHYSPROP |
|
|
| | | pyridine C5H5N2, 3, 61, 64 |
 | |
|
| | | pyridine N-oxide C5H5NO3, 64 |
 | | Compound Data | | Melting point | 64.75 °C | 337.90 K | | CSID | 12229 | H bond acceptors | 2 | Rule of 5 violations | 0 | | Molecular weight | 95.0993 | H bond donors | 0 | ACD/LogP | 0.00 | | Phase 25 °C | solid | Rotatable bonds | 0 | Predicted density | 1.03 g/cm3 | | SMILES | c1cc[n+](cc1)[O-] | | STD InChIKey | ILVXOBCQQYKLDS-UHFFFAOYAZ | | Melting Points | | mp °C | source | |
|---|
| 64.00 | Alfa Aesar | | 65.50 | PHYSPROP |
|
|
| | | pyrimethamine C12H13ClN432, 61, 64 |
 | | Compound Data | | Melting point | 233.33 °C | 506.48 K | | CSID | 4819 | H bond acceptors | 4 | Rule of 5 violations | 0 | | Molecular weight | 248.7114 | H bond donors | 4 | ACD/LogP | 2.75 | | Phase 25 °C | solid | Rotatable bonds | 2 | Predicted density | 1.30 g/cm3 | | SMILES | Clc2ccc(c1c(nc(nc1CC)N)N)cc2 | | STD InChIKey | WKSAUQYGYAYLPV-UHFFFAOYAW | | Melting Points | | mp °C | source | |
|---|
| 233.50 | DrugBank | | 233.00 | Oxford University MSDS | | 233.50 | PHYSPROP |
|
|
| | | pyrimidine C4H4N23, 61, 64 |
 | | Compound Data | | Melting point | 21.33 °C | 294.48 K | | CSID | 8903 | H bond acceptors | 2 | Rule of 5 violations | 0 | | Molecular weight | 80.088 | H bond donors | 0 | ACD/LogP | 0.26 | | Phase 25 °C | liquid/gas | Rotatable bonds | 0 | Predicted density | 1.05 g/cm3 | | SMILES | c1cncnc1 | | STD InChIKey | CZPWVGJYEJSRLH-UHFFFAOYAT | | Melting Points | | mp °C | source | |
|---|
| 21.00 | Alfa Aesar | | 21.00 | Oxford University MSDS | | 22.00 | PHYSPROP |
|
|
| | | pyrithione C5H5NOS3, 61 |
 | | Compound Data | | Melting point | 70.75 °C | 343.90 K | | CSID | 10446934 | H bond acceptors | 2 | Rule of 5 violations | 0 | | Molecular weight | 127.1643 | H bond donors | 0 | ACD/LogP | 0.00 | | Phase 25 °C | solid | Rotatable bonds | 1 | Predicted density | 1.26 g/cm3 | | SMILES | [O-][n+]1ccccc1S | | STD InChIKey | FGVVTMRZYROCTH-UHFFFAOYAC | | Melting Points | | mp °C | source | |
|---|
| 71.00 | Alfa Aesar | | 70.50 | Oxford University MSDS |
|
|
| | | pyrogallol C6H6O32, 3, 61, 64 |
 | |
|
| | | pyrrole C4H5N61, 64 |
 | | Compound Data | | Melting point | -23.20 °C | 249.95 K | | CSID | 7736 | H bond acceptors | 1 | Rule of 5 violations | 0 | | Molecular weight | 67.0892 | H bond donors | 1 | ACD/LogP | 0.84 | | Phase 25 °C | liquid/gas | Rotatable bonds | 0 | Predicted density | 0.99 g/cm3 | | SMILES | c1cc[nH]c1 | | STD InChIKey | KAESVJOAVNADME-UHFFFAOYAK | | Melting Points | | mp °C | source | |
|---|
| -23.00 | Oxford University MSDS | | -23.40 | PHYSPROP |
|
|
| | | pyrrole-2-carboxaldehyde C5H5NO3, 64 |
 | | Compound Data | | Melting point | 44.75 °C | 317.90 K | | CSID | 13254 | H bond acceptors | 2 | Rule of 5 violations | 0 | | Molecular weight | 95.0993 | H bond donors | 1 | ACD/LogP | 0.64 | | Phase 25 °C | solid | Rotatable bonds | 1 | Predicted density | 1.20 g/cm3 | | SMILES | O=Cc1cccn1 | | STD InChIKey | ZSKGQVFRTSEPJT-UHFFFAOYAN | | Melting Points | | mp °C | source | |
|---|
| 43.00 | Alfa Aesar | | 46.50 | PHYSPROP |
|
|
| | | pyruvic acid C3H4O33, 3, 6, 28, 32, 61, 61, 64, 72 |
 | |
|
| | | quaterphenyl C24H183, 64 |
 | | Compound Data | | Melting point | 318.50 °C | 591.65 K | | CSID | 8353 | H bond acceptors | 0 | Rule of 5 violations | 1 | | Molecular weight | 306.3997 | H bond donors | 0 | ACD/LogP | 7.29 | | Phase 25 °C | solid | Rotatable bonds | 3 | Predicted density | 1.07 g/cm3 | | SMILES | c1cc(ccc1c2ccccc2)c3ccc(cc3)c4ccccc4 | | STD InChIKey | GPRIERYVMZVKTC-UHFFFAOYAG | | Melting Points | | mp °C | source | |
|---|
| 317.00 | Alfa Aesar | | 320.00 | PHYSPROP |
|
|
| | | quinaldic acid C10H7NO23, 32, 64 |
 | | Compound Data | | Melting point | 156.67 °C | 429.82 K | | CSID | 6857 | H bond acceptors | 3 | Rule of 5 violations | 0 | | Molecular weight | 173.1681 | H bond donors | 1 | ACD/LogP | 2.27 | | Phase 25 °C | solid | Rotatable bonds | 1 | Predicted density | 1.34 g/cm3 | | SMILES | c1ccc2c(c1)ccc(n2)C(=O)O | | STD InChIKey | LOAUVZALPPNFOQ-UHFFFAOYAV | | Melting Points | | mp °C | source | |
|---|
| 158.00 | Alfa Aesar | | 156.00 | DrugBank | | 156.00 | PHYSPROP |
|
|
| | | quinaldine C10H9N3, 64 |
 | | Compound Data | | Melting point | -1.75 °C | 271.40 K | | CSID | 13870160 | H bond acceptors | 1 | Rule of 5 violations | 0 | | Molecular weight | 143.1852 | H bond donors | 0 | ACD/LogP | 2.54 | | Phase 25 °C | liquid/gas | Rotatable bonds | 0 | Predicted density | 1.08 g/cm3 | | SMILES | Cc1ccc2ccccc2n1 | | STD InChIKey | SMUQFGGVLNAIOZ-UHFFFAOYAY | | Melting Points | | mp °C | source | |
|---|
| -2.00 | Alfa Aesar | | -1.50 | PHYSPROP |
|
|
| | | quinazoline C8H6N23, 64 |
 | | Compound Data | | Melting point | 47.50 °C | 320.65 K | | CSID | 8855 | H bond acceptors | 2 | Rule of 5 violations | 0 | | Molecular weight | 130.1466 | H bond donors | 0 | ACD/LogP | 1.00 | | Phase 25 °C | solid | Rotatable bonds | 0 | Predicted density | 1.18 g/cm3 | | SMILES | c1ccc2c(c1)cncn2 | | STD InChIKey | JWVCLYRUEFBMGU-UHFFFAOYAV | | Melting Points | | mp °C | source | |
|---|
| 47.00 | Alfa Aesar | | 48.00 | PHYSPROP |
|
|
| | | quinoline C9H7N3, 64 |
 | | Compound Data | | Melting point | -14.89 °C | 258.26 K | | CSID | 6780 | H bond acceptors | 1 | Rule of 5 violations | 0 | | Molecular weight | 129.1586 | H bond donors | 0 | ACD/LogP | 2.08 | | Phase 25 °C | liquid/gas | Rotatable bonds | 0 | Predicted density | 1.11 g/cm3 | | SMILES | n1cccc2ccccc12 | | STD InChIKey | SMWDFEZZVXVKRB-UHFFFAOYAU | | Melting Points | | mp °C | source | |
|---|
| -15.00 | Alfa Aesar | | -14.78 | PHYSPROP |
|
|
| | | quinoline-2-carboxaldehyde C10H7NO3, 64 |
 | | Compound Data | | Melting point | 69.50 °C | 342.65 K | | CSID | 71926 | H bond acceptors | 2 | Rule of 5 violations | 0 | | Molecular weight | 157.1687 | H bond donors | 0 | ACD/LogP | 2.14 | | Phase 25 °C | solid | Rotatable bonds | 1 | Predicted density | 1.22 g/cm3 | | SMILES | O=Cc1nc2ccccc2cc1 | | STD InChIKey | WPYJKGWLDJECQD-UHFFFAOYAZ | | Melting Points | | mp °C | source | |
|---|
| 68.00 | Alfa Aesar | | 71.00 | PHYSPROP |
|
|
| | | quinoline-4-carboxaldehyde C10H7NO3, 64 |
 | | Compound Data | | Melting point | 50.50 °C | 323.65 K | | CSID | 70450 | H bond acceptors | 2 | Rule of 5 violations | 0 | | Molecular weight | 157.1687 | H bond donors | 0 | ACD/LogP | 1.51 | | Phase 25 °C | solid | Rotatable bonds | 1 | Predicted density | 1.22 g/cm3 | | SMILES | O=Cc1c2ccccc2ncc1 | | STD InChIKey | MGCGJBXTNWUHQE-UHFFFAOYAT | | Melting Points | | mp °C | source | |
|---|
| 50.00 | Alfa Aesar | | 51.00 | PHYSPROP |
|
|
| | | quinolone C9H7NO3, 64 |
 | | Compound Data | | Melting point | 198.75 °C | 471.90 K | | CSID | 5816 | H bond acceptors | 2 | Rule of 5 violations | 0 | | Molecular weight | 145.158 | H bond donors | 1 | ACD/LogP | 1.26 | | Phase 25 °C | solid | Rotatable bonds | 0 | Predicted density | 1.19 g/cm3 | | SMILES | O=C2/C=C\c1c(cccc1)N2 | | STD InChIKey | LISFMEBWQUVKPJ-UHFFFAOYAF | | Melting Points | | mp °C | source | |
|---|
| 198.00 | Alfa Aesar | | 199.50 | PHYSPROP |
|
|
| | | quinoxaline C8H6N23, 64 |
 | | Compound Data | | Melting point | 29.00 °C | 302.15 K | | CSID | 21106470 | H bond acceptors | 2 | Rule of 5 violations | 0 | | Molecular weight | 130.1466 | H bond donors | 0 | ACD/LogP | 1.30 | | Phase 25 °C | solid | Rotatable bonds | 0 | Predicted density | 1.18 g/cm3 | | SMILES | c1cccc2nccnc12 | | STD InChIKey | XSCHRSMBECNVNS-UHFFFAOYAS | | Melting Points | | mp °C | source | |
|---|
| 30.00 | Alfa Aesar | | 28.00 | PHYSPROP |
|
|
| | | resorcinol C6H6O22, 3, 61, 64 |
 | |
|
| | | resorcinol monobenzoate C13H10O33, 64 |
 | | Compound Data | | Melting point | 133.00 °C | 406.15 K | | CSID | 8366 | H bond acceptors | 3 | Rule of 5 violations | 0 | | Molecular weight | 214.2167 | H bond donors | 1 | ACD/LogP | 3.03 | | Phase 25 °C | solid | Rotatable bonds | 4 | Predicted density | 1.25 g/cm3 | | SMILES | O=C(Oc1cccc(O)c1)c2ccccc2 | | STD InChIKey | GDESWOTWNNGOMW-UHFFFAOYAL | | Melting Points | | mp °C | source | |
|---|
| 132.00 | Alfa Aesar | | 134.00 | PHYSPROP |
|
|
| | | rhodanine C3H3NOS23, 64 |
 | | Compound Data | | Melting point | 169.50 °C | 442.65 K | | CSID | 1013337 | H bond acceptors | 2 | Rule of 5 violations | 0 | | Molecular weight | 133.192 | H bond donors | 1 | ACD/LogP | 0.06 | | Phase 25 °C | solid | Rotatable bonds | 0 | Predicted density | 1.59 g/cm3 | | SMILES | O=C1NC(=S)SC1 | | STD InChIKey | KIWUVOGUEXMXSV-UHFFFAOYAP | | Melting Points | | mp °C | source | |
|---|
| 169.00 | Alfa Aesar | | 170.00 | PHYSPROP |
|
|
| | | rothane C14H10Cl461, 64 |
 | | Compound Data | | Melting point | 109.25 °C | 382.40 K | | CSID | 6057 | H bond acceptors | 0 | Rule of 5 violations | 1 | | Molecular weight | 320.0412 | H bond donors | 0 | ACD/LogP | 5.39 | | Phase 25 °C | solid | Rotatable bonds | 3 | Predicted density | 1.37 g/cm3 | | SMILES | Clc1ccc(cc1)C(c2ccc(Cl)cc2)C(Cl)Cl | | STD InChIKey | AHJKRLASYNVKDZ-UHFFFAOYAJ | | Melting Points | | mp °C | source | |
|---|
| 109.00 | Oxford University MSDS | | 109.50 | PHYSPROP |
|
|
| | | saccharin C7H5NO3S3, 44 |
 | | Compound Data | | Melting point | 229.15 °C | 502.30 K | | CSID | 4959 | H bond acceptors | 4 | Rule of 5 violations | 0 | | Molecular weight | 183.1845 | H bond donors | 1 | ACD/LogP | 0.91 | | Phase 25 °C | solid | Rotatable bonds | 0 | Predicted density | 1.56 g/cm3 | | SMILES | O=C2c1ccccc1S(=O)(=O)N2 | | STD InChIKey | CVHZOJJKTDOEJC-UHFFFAOYAR | | Melting Points | | mp °C | source | |
|---|
| 229.00 | Alfa Aesar | | 229.30 | Hughes LD; Palmer DS; Nigsch F and Mitchell JBO. 2008 Why ar... |
|
|
| | | salicylacetic acid C9H8O53, 64 |
 | | Compound Data | | Melting point | 190.00 °C | 463.15 K | | CSID | 62668 | H bond acceptors | 5 | Rule of 5 violations | 0 | | Molecular weight | 196.1568 | H bond donors | 2 | ACD/LogP | 0.70 | | Phase 25 °C | solid | Rotatable bonds | 4 | Predicted density | 1.43 g/cm3 | | SMILES | O=C(O)c1ccccc1OCC(=O)O | | STD InChIKey | JLLXSRLEXBECPY-UHFFFAOYAI | | Melting Points | | mp °C | source | |
|---|
| 189.00 | Alfa Aesar | | 191.00 | PHYSPROP |
|
|
| | | salicylamide C7H7NO22, 3, 35, 44, 61, 64 |
 | |
|
| | | salicylic acid C7H6O32, 3, 9, 20, 21, 32, 35, 44, 48, 61, 61, 64, 70, 84 |
 | |
|
| | | salicylic alcohol C7H8O22, 3, 64 |
 | |
|
| | | salicylideneaniline C13H11NO64, 77 |
 | | Compound Data | | Melting point | 48.50 °C | 321.65 K | | CSID | 10237273 | H bond acceptors | 2 | Rule of 5 violations | 0 | | Molecular weight | 197.2325 | H bond donors | 1 | ACD/LogP | 3.09 | | Phase 25 °C | solid | Rotatable bonds | 3 | Predicted density | 1.06 g/cm3 | | SMILES | Oc2ccccc2/C=N/c1ccccc1 | | STD InChIKey | QIYHCQVVYSSDTI-GXDHUFHOBW | | Melting Points | | mp °C | source | |
|---|
| 49.50 | PHYSPROP | | 47.50 | UsefulChem EXP269 |
|
|
| | | sebacic acid C10H18O42, 3, 61, 64 |
 | |
|
| | | sebacoyl chloride C10H16Cl2O23, 64 |
 | | Compound Data | | Melting point | -3.75 °C | 269.40 K | | CSID | 59462 | H bond acceptors | 2 | Rule of 5 violations | 0 | | Molecular weight | 239.1388 | H bond donors | 0 | ACD/LogP | 3.35 | | Phase 25 °C | liquid/gas | Rotatable bonds | 9 | Predicted density | 1.14 g/cm3 | | SMILES | ClC(=O)CCCCCCCCC(Cl)=O | | STD InChIKey | WMPOZLHMGVKUEJ-UHFFFAOYAH | | Melting Points | | mp °C | source | |
|---|
| -5.00 | Alfa Aesar | | -2.50 | PHYSPROP |
|
|
| | | silvadene C10H10N4O2S3, 35, 44 |
 | |
|
| | | simazine C7H12ClN53, 64 |
 | | Compound Data | | Melting point | 227.00 °C | 500.15 K | | CSID | 5027 | H bond acceptors | 5 | Rule of 5 violations | 0 | | Molecular weight | 201.6567 | H bond donors | 2 | ACD/LogP | 2.28 | | Phase 25 °C | solid | Rotatable bonds | 2 | Predicted density | 1.32 g/cm3 | | SMILES | Clc1nc(nc(n1)NCC)NCC | | STD InChIKey | ODCWYMIRDDJXKW-UHFFFAOYAN | | Melting Points | | mp °C | source | |
|---|
| 228.00 | Alfa Aesar | | 226.00 | PHYSPROP |
|
|
| | | sowell C9H18N2O49, 32, 44, 48, 61, 64 |
 | |
|
| | | spermidine C7H19N33, 61, 64 |
 | | Compound Data | | Melting point | 23.75 °C | 296.90 K | | CSID | 1071 | H bond acceptors | 3 | Rule of 5 violations | 1 | | Molecular weight | 145.2459 | H bond donors | 5 | ACD/LogP | 0.00 | | Phase 25 °C | liquid/gas | Rotatable bonds | 9 | Predicted density | 0.91 g/cm3 | | SMILES | C(CCNCCCN)CN | | STD InChIKey | ATHGHQPFGPMSJY-UHFFFAOYAK | | Melting Points | | mp °C | source | |
|---|
| 24.00 | Alfa Aesar | | 23.50 | Oxford University MSDS | | Values not used in calculating the average melting point | | 258.00 | PHYSPROP1 | | 1. salt JCB |
|
|
| | | spermine C10H26N43, 32, 64, 64 |
 | | Compound Data | | Melting point | 28.67 °C | 301.82 K | | CSID | 1072 | H bond acceptors | 4 | Rule of 5 violations | 1 | | Molecular weight | 202.3402 | H bond donors | 6 | ACD/LogP | 0.00 | | Phase 25 °C | solid | Rotatable bonds | 13 | Predicted density | 0.93 g/cm3 | | SMILES | C(CCNCCCN)CNCCCN | | STD InChIKey | PFNFFQXMRSDOHW-UHFFFAOYAC | | Melting Points | | mp °C | source | |
|---|
| 29.00 | Alfa Aesar | | 28.00 | DrugBank | | 29.00 | PHYSPROP | | Values not used in calculating the average melting point | | 301.50 | PHYSPROP1 | | 1. salt JCB |
|
|
| | | spiperone C23H26FN3O29, 48, 64 |
 | |
|
| | | stearic acid C18H36O23, 61, 64 |
 | | Compound Data | | Melting point | 69.43 °C | 342.58 K | | CSID | 5091 | H bond acceptors | 2 | Rule of 5 violations | 1 | | Molecular weight | 284.4772 | H bond donors | 1 | ACD/LogP | 8.22 | | Phase 25 °C | solid | Rotatable bonds | 16 | Predicted density | 0.89 g/cm3 | | SMILES | O=C(O)CCCCCCCCCCCCCCCCC | | STD InChIKey | QIQXTHQIDYTFRH-UHFFFAOYAB | | Melting Points | | mp °C | source | |
|---|
| 71.00 | Alfa Aesar | | 68.00 | Oxford University MSDS | | 69.30 | PHYSPROP |
|
|
| | | stearone C35H70O3, 64 |
 | | Compound Data | | Melting point | 88.00 °C | 361.15 K | | CSID | 10009 | H bond acceptors | 1 | Rule of 5 violations | 2 | | Molecular weight | 506.9297 | H bond donors | 0 | ACD/LogP | 16.85 | | Phase 25 °C | solid | Rotatable bonds | 32 | Predicted density | 0.84 g/cm3 | | SMILES | O=C(CCCCCCCCCCCCCCCCC)CCCCCCCCCCCCCCCCC | | STD InChIKey | DMCJFWXGXUEHFD-UHFFFAOYAX | | Melting Points | | mp °C | source | |
|---|
| 87.00 | Alfa Aesar | | 89.00 | PHYSPROP |
|
|
| | | stearylamine C18H39N35, 61, 64 |
 | | Compound Data | | Melting point | 53.93 °C | 327.08 K | | CSID | 15016 | H bond acceptors | 1 | Rule of 5 violations | 1 | | Molecular weight | 269.509 | H bond donors | 2 | ACD/LogP | 8.19 | | Phase 25 °C | solid | Rotatable bonds | 17 | Predicted density | 0.82 g/cm3 | | SMILES | CCCCCCCCCCCCCCCCCCN | | STD InChIKey | REYJJPSVUYRZGE-UHFFFAOYAC | | Melting Points | | mp °C | source | |
|---|
| 52.90 | EPISuite-ChemSpider | | 56.00 | Oxford University MSDS | | 52.90 | PHYSPROP |
|
|
| | | suberic acid C8H14O42, 3, 61, 64 |
 | |
|
| | | succinic acid C4H6O42, 3, 32, 35, 61, 64 |
 | |
|
| | | succinic anhydride C4H4O33, 61, 64 |
 | | Compound Data | | Melting point | 119.50 °C | 392.65 K | | CSID | 7634 | H bond acceptors | 3 | Rule of 5 violations | 0 | | Molecular weight | 100.0728 | H bond donors | 0 | ACD/LogP | -1.30 | | Phase 25 °C | solid | Rotatable bonds | 0 | Predicted density | 1.38 g/cm3 | | SMILES | O=C1OC(=O)CC1 | | STD InChIKey | RINCXYDBBGOEEQ-UHFFFAOYAN | | Melting Points | | mp °C | source | |
|---|
| 120.00 | Alfa Aesar | | 119.50 | Oxford University MSDS | | 119.00 | PHYSPROP |
|
|
| | | succinimide C4H5NO23, 64 |
 | | Compound Data | | Melting point | 125.25 °C | 398.40 K | | CSID | 10955 | H bond acceptors | 3 | Rule of 5 violations | 0 | | Molecular weight | 99.088 | H bond donors | 1 | ACD/LogP | -1.18 | | Phase 25 °C | solid | Rotatable bonds | 0 | Predicted density | 1.27 g/cm3 | | SMILES | O=C1NC(=O)CC1 | | STD InChIKey | KZNICNPSHKQLFF-UHFFFAOYAV | | Melting Points | | mp °C | source | |
|---|
| 124.00 | Alfa Aesar | | 126.50 | PHYSPROP |
|
|
| | | succinonitrile C4H4N22, 3, 64 |
 | |
|
| | | succinyl chloride C4H4Cl2O23, 64 |
 | | Compound Data | | Melting point | 18.50 °C | 291.65 K | | CSID | 13867055 | H bond acceptors | 2 | Rule of 5 violations | 0 | | Molecular weight | 154.9794 | H bond donors | 0 | ACD/LogP | 1.01 | | Phase 25 °C | liquid/gas | Rotatable bonds | 3 | Predicted density | 1.39 g/cm3 | | SMILES | ClC(=O)CCC(Cl)=O | | STD InChIKey | IRXBNHGNHKNOJI-UHFFFAOYAK | | Melting Points | | mp °C | source | |
|---|
| 17.00 | Alfa Aesar | | 20.00 | PHYSPROP |
|
|
| | | sulfacytine C12H14N4O3S32, 64 |
 | | Compound Data | | Melting point | 166.88 °C | 440.02 K | | CSID | 5131 | H bond acceptors | 7 | Rule of 5 violations | 0 | | Molecular weight | 294.3296 | H bond donors | 3 | ACD/LogP | -0.49 | | Phase 25 °C | solid | Rotatable bonds | 3 | Predicted density | 1.45 g/cm3 | | SMILES | O=C1/N=C(\C=C/N1CC)NS(=O)(=O)c2ccc(N)cc2 | | STD InChIKey | SIBQAECNSSQUOD-UHFFFAOYAA | | Melting Points | | mp °C | source | |
|---|
| 166.50 | DrugBank | | 167.25 | PHYSPROP |
|
|
| | | sulfamerazine C11H12N4O2S3, 9, 32, 44, 63, 63, 64 |
 | |
|
| | | sulfamethoxazole C10H11N3O3S32, 35, 44, 64 |
 | |
|
| | | sulfapyridine C11H11N3O2S32, 61, 64 |
 | | Compound Data | | Melting point | 191.83 °C | 464.98 K | | CSID | 5145 | H bond acceptors | 5 | Rule of 5 violations | 0 | | Molecular weight | 249.2889 | H bond donors | 3 | ACD/LogP | 0.03 | | Phase 25 °C | solid | Rotatable bonds | 2 | Predicted density | 1.43 g/cm3 | | SMILES | O=S(=O)(Nc1ncccc1)c2ccc(N)cc2 | | STD InChIKey | GECHUMIMRBOMGK-UHFFFAOYAO | | Melting Points | | mp °C | source | |
|---|
| 192.00 | DrugBank | | 191.50 | Oxford University MSDS | | 192.00 | PHYSPROP |
|
|
| | | sulfolane C4H8O2S3, 64 |
 | | Compound Data | | Melting point | 27.30 °C | 300.45 K | | CSID | 29080 | H bond acceptors | 2 | Rule of 5 violations | 0 | | Molecular weight | 120.1701 | H bond donors | 0 | ACD/LogP | 0.00 | | Phase 25 °C | solid | Rotatable bonds | 0 | Predicted density | 1.26 g/cm3 | | SMILES | C1CCS(=O)(=O)C1 | | STD InChIKey | HXJUTPCZVOIRIF-UHFFFAOYAA | | Melting Points | | mp °C | source | |
|---|
| 27.00 | Alfa Aesar | | 27.60 | PHYSPROP |
|
|
| | | sulthiame C10H14N2O4S29, 64 |
 | | Compound Data | | Melting point | 180.50 °C | 453.65 K | | CSID | 5163 | H bond acceptors | 6 | Rule of 5 violations | 0 | | Molecular weight | 290.3592 | H bond donors | 2 | ACD/LogP | -0.43 | | Phase 25 °C | solid | Rotatable bonds | 2 | Predicted density | 1.47 g/cm3 | | SMILES | O=S2(=O)N(c1ccc(cc1)S(=O)(=O)N)CCCC2 | | STD InChIKey | HMHVCUVYZFYAJI-UHFFFAOYAA | | Melting Points | | mp °C | source | |
|---|
| 180.00 | Bergstrom C. A. S.; Norinder U.; Luthman K.; Artursson P. Mo... | | 181.00 | PHYSPROP |
|
|
| | | sumatriptan C14H21N3O2S9, 32, 64 |
 | | Compound Data | | Melting point | 169.67 °C | 442.82 K | | CSID | 5165 | H bond acceptors | 5 | Rule of 5 violations | 0 | | Molecular weight | 295.4004 | H bond donors | 2 | ACD/LogP | 0.67 | | Phase 25 °C | solid | Rotatable bonds | 5 | Predicted density | 1.24 g/cm3 | | SMILES | O=S(=O)(NC)Cc1cc2c(cc1)ncc2CCN(C)C | | STD InChIKey | KQKPFRSPSRPDEB-UHFFFAOYAF | | Melting Points | | mp °C | source | |
|---|
| 169.00 | Bergstrom C. A. S.; Norinder U.; Luthman K.; Artursson P. Mo... | | 170.00 | DrugBank | | 170.00 | PHYSPROP |
|
|
| | | syringaldehyde C9H10O43, 64 |
 | | Compound Data | | Melting point | 112.50 °C | 385.65 K | | CSID | 8333 | H bond acceptors | 4 | Rule of 5 violations | 0 | | Molecular weight | 182.1733 | H bond donors | 1 | ACD/LogP | 1.30 | | Phase 25 °C | solid | Rotatable bonds | 4 | Predicted density | 1.24 g/cm3 | | SMILES | COc1cc(cc(c1O)OC)C=O | | STD InChIKey | KCDXJAYRVLXPFO-UHFFFAOYAW | | Melting Points | | mp °C | source | |
|---|
| 112.00 | Alfa Aesar | | 113.00 | PHYSPROP |
|
|
| | | syringic acid C9H10O53, 61, 64 |
 | | Compound Data | | Melting point | 206.50 °C | 479.65 K | | CSID | 10289 | H bond acceptors | 5 | Rule of 5 violations | 0 | | Molecular weight | 198.1727 | H bond donors | 2 | ACD/LogP | 1.13 | | Phase 25 °C | solid | Rotatable bonds | 4 | Predicted density | 1.33 g/cm3 | | SMILES | O=C(O)c1cc(OC)c(O)c(OC)c1 | | STD InChIKey | JMSVCTWVEWCHDZ-UHFFFAOYAU | | Melting Points | | mp °C | source | |
|---|
| 207.00 | Alfa Aesar | | 205.00 | Oxford University MSDS | | 207.50 | PHYSPROP |
|
|
| | | syringol C8H10O32, 3, 64 |
 | |
|
| | | t-butanol C4H10O3, 4, 61, 64 |
 | |
|
| | | t-butyl benzenecarboperoxoate C11H14O33, 61, 64 |
 | | Compound Data | | Melting point | 7.67 °C | 280.82 K | | CSID | 11472 | H bond acceptors | 3 | Rule of 5 violations | 0 | | Molecular weight | 194.2271 | H bond donors | 0 | ACD/LogP | 3.33 | | Phase 25 °C | liquid/gas | Rotatable bonds | 4 | Predicted density | 1.06 g/cm3 | | SMILES | O=C(OOC(C)(C)C)c1ccccc1 | | STD InChIKey | GJBRNHKUVLOCEB-UHFFFAOYAT | | Melting Points | | mp °C | source | |
|---|
| 7.00 | Alfa Aesar | | 8.00 | Oxford University MSDS | | 8.00 | PHYSPROP |
|
|
| | | t-butyl bromide C4H9Br3, 31, 64 |
 | |
|
| | | t-butyl chloride C4H9Cl3, 31, 61, 64 |
 | |
|
| | | t-butyl hydroperoxide C4H10O261, 64 |
 | | Compound Data | | Melting point | -5.50 °C | 267.65 K | | CSID | 6170 | H bond acceptors | 2 | Rule of 5 violations | 0 | | Molecular weight | 90.121 | H bond donors | 1 | ACD/LogP | 1.23 | | Phase 25 °C | liquid/gas | Rotatable bonds | 2 | Predicted density | 0.92 g/cm3 | | SMILES | CC(C)(C)OO | | STD InChIKey | CIHOLLKRGTVIJN-UHFFFAOYAX | | Melting Points | | mp °C | source | |
|---|
| -3.00 | Oxford University MSDS | | -8.00 | PHYSPROP |
|
|
| | | t-butylacetylene C6H103, 4, 61, 64 |
 | |
|
| | | t-butylbenzene C10H143, 4, 61, 64 |
 | |
|
| | | t-butylcyclohexane C10H203, 64 |
 | | Compound Data | | Melting point | -41.10 °C | 232.05 K | | CSID | 17481 | H bond acceptors | 0 | Rule of 5 violations | 1 | | Molecular weight | 140.2658 | H bond donors | 0 | ACD/LogP | 5.11 | | Phase 25 °C | liquid/gas | Rotatable bonds | 1 | Predicted density | 0.81 g/cm3 | | SMILES | CC(C)(C)C1CCCCC1 | | STD InChIKey | XTVMZZBLCLWBPM-UHFFFAOYAR | | Melting Points | | mp °C | source | |
|---|
| -41.00 | Alfa Aesar | | -41.20 | PHYSPROP |
|
|
| | | t-butylisothiocyanate C5H9NS3, 64 |
 | | Compound Data | | Melting point | 10.25 °C | 283.40 K | | CSID | 11057 | H bond acceptors | 1 | Rule of 5 violations | 0 | | Molecular weight | 115.1967 | H bond donors | 0 | ACD/LogP | 2.17 | | Phase 25 °C | liquid/gas | Rotatable bonds | 1 | Predicted density | 0.89 g/cm3 | | SMILES | S=C=N/C(C)(C)C | | STD InChIKey | ZFWFRTVIIMTOLY-UHFFFAOYAZ | | Melting Points | | mp °C | source | |
|---|
| 10.00 | Alfa Aesar | | 10.50 | PHYSPROP |
|
|
| | | t-butylthiol C4H10S4, 64 |
 | | Compound Data | | Melting point | 0.25 °C | 273.40 K | | CSID | 6147 | H bond acceptors | 0 | Rule of 5 violations | 0 | | Molecular weight | 90.1872 | H bond donors | 0 | ACD/LogP | 1.95 | | Phase 25 °C | liquid/gas | Rotatable bonds | 1 | Predicted density | 0.83 g/cm3 | | SMILES | SC(C)(C)C | | STD InChIKey | WMXCDAVJEZZYLT-UHFFFAOYAT | | Melting Points | | mp °C | source | |
|---|
| 1.00 | American Petroleum Institute. Research Project 44; Selected ... | | -0.50 | PHYSPROP |
|
|
| | | taurolidine C7H16N4O4S29, 64 |
 | | Compound Data | | Melting point | 155.00 °C | 428.15 K | | CSID | 27486 | H bond acceptors | 8 | Rule of 5 violations | 0 | | Molecular weight | 284.3563 | H bond donors | 2 | ACD/LogP | -2.55 | | Phase 25 °C | solid | Rotatable bonds | 2 | Predicted density | 1.47 g/cm3 | | SMILES | O=S2(=O)NCN(CN1CCS(=O)(=O)NC1)CC2 | | STD InChIKey | AJKIRUJIDFJUKJ-UHFFFAOYAI | | Melting Points | | mp °C | source | |
|---|
| 154.00 | Bergstrom C. A. S.; Norinder U.; Luthman K.; Artursson P. Mo... | | 156.00 | PHYSPROP |
|
|
| | | terbutrex C10H19N5S61, 64, 70 |
 | |
|
| | | terephthalaldehyde C8H6O22, 2, 3, 64 |
 | |
|
| | | terephthalonitrile C8H4N22, 3, 61, 64 |
 | |
|
| | | terephthaloyl chloride C8H4Cl2O23, 64 |
 | | Compound Data | | Melting point | 82.25 °C | 355.40 K | | CSID | 7207 | H bond acceptors | 2 | Rule of 5 violations | 0 | | Molecular weight | 203.0222 | H bond donors | 0 | ACD/LogP | 2.63 | | Phase 25 °C | solid | Rotatable bonds | 2 | Predicted density | 1.43 g/cm3 | | SMILES | O=C(Cl)c1ccc(C(Cl)=O)cc1 | | STD InChIKey | LXEJRKJRKIFVNY-UHFFFAOYAY | | Melting Points | | mp °C | source | |
|---|
| 81.00 | Alfa Aesar | | 83.50 | PHYSPROP |
|
|
| | | terphenyl C18H143, 7, 64 |
 | |
|
| | | terphenyl C18H143, 7, 61, 64 |
 | |
|
| | | terpyridine C15H11N33, 64 |
 | | Compound Data | | Melting point | 90.50 °C | 363.65 K | | CSID | 64012 | H bond acceptors | 3 | Rule of 5 violations | 0 | | Molecular weight | 233.2679 | H bond donors | 0 | ACD/LogP | 2.18 | | Phase 25 °C | solid | Rotatable bonds | 2 | Predicted density | 1.17 g/cm3 | | SMILES | c1ccnc(c1)c2cccc(n2)c3ccccn3 | | STD InChIKey | DRGAZIDRYFYHIJ-UHFFFAOYAP | | Melting Points | | mp °C | source | |
|---|
| 91.00 | Alfa Aesar | | 90.00 | PHYSPROP |
|
|
| | | terthienyl C12H8S33, 64 |
 | | Compound Data | | Melting point | 92.75 °C | 365.90 K | | CSID | 58578 | H bond acceptors | 0 | Rule of 5 violations | 1 | | Molecular weight | 248.3869 | H bond donors | 0 | ACD/LogP | 5.56 | | Phase 25 °C | solid | Rotatable bonds | 2 | Predicted density | 1.32 g/cm3 | | SMILES | s1cccc1c2sc(cc2)c3sccc3 | | STD InChIKey | KXSFECAJUBPPFE-UHFFFAOYAI | | Melting Points | | mp °C | source | |
|---|
| 92.00 | Alfa Aesar | | 93.50 | PHYSPROP |
|
|
| | | tetrabromothiophene C4Br4S3, 64 |
 | | Compound Data | | Melting point | 116.25 °C | 389.40 K | | CSID | 69970 | H bond acceptors | 0 | Rule of 5 violations | 0 | | Molecular weight | 399.7238 | H bond donors | 0 | ACD/LogP | 4.51 | | Phase 25 °C | solid | Rotatable bonds | 0 | Predicted density | 2.78 g/cm3 | | SMILES | Brc1sc(Br)c(Br)c1Br | | STD InChIKey | AVPWUAFYDNQGNZ-UHFFFAOYAI | | Melting Points | | mp °C | source | |
|---|
| 115.00 | Alfa Aesar | | 117.50 | PHYSPROP |
|
|
| | | tetrachloroethylene C2Cl43, 64 |
 | | Compound Data | | Melting point | -22.15 °C | 251.00 K | | CSID | 13837281 | H bond acceptors | 0 | Rule of 5 violations | 0 | | Molecular weight | 165.8334 | H bond donors | 0 | ACD/LogP | 2.95 | | Phase 25 °C | liquid/gas | Rotatable bonds | 0 | Predicted density | 1.65 g/cm3 | | SMILES | Cl/C(Cl)=C(/Cl)Cl | | STD InChIKey | CYTYCFOTNPOANT-UHFFFAOYAO | | Melting Points | | mp °C | source | |
|---|
| -22.00 | Alfa Aesar | | -22.30 | PHYSPROP |
|
|
| | | tetrachloromethane CCl431, 56, 58, 61, 61, 64, 69, 81 |
 | |
|
| | | tetrachlorophthalic anhydride C8Cl4O33, 61, 64 |
 | | Compound Data | | Melting point | 255.33 °C | 528.48 K | | CSID | 8023 | H bond acceptors | 3 | Rule of 5 violations | 0 | | Molecular weight | 285.8958 | H bond donors | 0 | ACD/LogP | 3.56 | | Phase 25 °C | solid | Rotatable bonds | 0 | Predicted density | 1.90 g/cm3 | | SMILES | O=C1OC(=O)c2c1c(Cl)c(Cl)c(Cl)c2Cl | | STD InChIKey | AUHHYELHRWCWEZ-UHFFFAOYAF | | Melting Points | | mp °C | source | |
|---|
| 256.00 | Alfa Aesar | | 255.50 | Oxford University MSDS | | 254.50 | PHYSPROP |
|
|
| | | tetrachlorothiophene C4Cl4S3, 64 |
 | | Compound Data | | Melting point | 29.25 °C | 302.40 K | | CSID | 20971 | H bond acceptors | 0 | Rule of 5 violations | 0 | | Molecular weight | 221.9198 | H bond donors | 0 | ACD/LogP | 4.15 | | Phase 25 °C | solid | Rotatable bonds | 0 | Predicted density | 1.75 g/cm3 | | SMILES | Clc1sc(Cl)c(Cl)c1Cl | | STD InChIKey | WZXXZHONLFRKGG-UHFFFAOYAU | | Melting Points | | mp °C | source | |
|---|
| 28.00 | Alfa Aesar | | 30.50 | PHYSPROP |
|
|
| | | tetracontane C40H823, 64 |
 | | Compound Data | | Melting point | 81.50 °C | 354.65 K | | CSID | 18983 | H bond acceptors | 0 | Rule of 5 violations | 2 | | Molecular weight | 563.0791 | H bond donors | 0 | ACD/LogP | 22.01 | | Phase 25 °C | solid | Rotatable bonds | 37 | Predicted density | 0.82 g/cm3 | | SMILES | C(CCCCCCCCCCCCCCCCCCCCCC)CCCCCCCCCCCCCCCCC | | STD InChIKey | KUPLEGDPSCCPJI-UHFFFAOYAV | | Melting Points | | mp °C | source | |
|---|
| 81.00 | Alfa Aesar | | 82.00 | PHYSPROP |
|
|
| | | tetracosane C24H503, 64 |
 | | Compound Data | | Melting point | 52.50 °C | 325.65 K | | CSID | 12072 | H bond acceptors | 0 | Rule of 5 violations | 1 | | Molecular weight | 338.6538 | H bond donors | 0 | ACD/LogP | 13.51 | | Phase 25 °C | solid | Rotatable bonds | 21 | Predicted density | 0.80 g/cm3 | | SMILES | C(CCCCCCCCCCCCCCCCCCC)CCCC | | STD InChIKey | POOSGDOYLQNASK-UHFFFAOYAT | | Melting Points | | mp °C | source | |
|---|
| 51.00 | Alfa Aesar | | 54.00 | PHYSPROP |
|
|
| | | tetracyanoethylene C6N43, 64 |
 | | Compound Data | | Melting point | 198.50 °C | 471.65 K | | CSID | 12114 | H bond acceptors | 4 | Rule of 5 violations | 0 | | Molecular weight | 128.091 | H bond donors | 0 | ACD/LogP | 0.00 | | Phase 25 °C | solid | Rotatable bonds | 0 | Predicted density | 1.36 g/cm3 | | SMILES | C(#N)C(=C(C#N)C#N)C#N | | STD InChIKey | NLDYACGHTUPAQU-UHFFFAOYAN | | Melting Points | | mp °C | source | |
|---|
| 198.00 | Alfa Aesar | | 199.00 | PHYSPROP |
|
|
| | | tetradecane C14H303, 4, 61, 64 |
 | |
|
| | | tetradecyl aldehyde C14H28O2, 64 |
 | | Compound Data | | Melting point | 22.25 °C | 295.40 K | | CSID | 29031 | H bond acceptors | 1 | Rule of 5 violations | 1 | | Molecular weight | 212.3715 | H bond donors | 0 | ACD/LogP | 6.01 | | Phase 25 °C | liquid/gas | Rotatable bonds | 12 | Predicted density | 0.83 g/cm3 | | SMILES | CCCCCCCCCCCCCC=O | | STD InChIKey | UHUFTBALEZWWIH-UHFFFAOYAK | | Melting Points | | mp °C | source | |
|---|
| 24.00 | Aldrich Chemical Company; Aldrich Catalog-Handbook of Fine C... | | 20.50 | PHYSPROP |
|
|
| | | tetraethyl orthosilicate C8H20O4Si3, 61, 64 |
 | | Compound Data | | Melting point | -84.50 °C | 188.65 K | | CSID | 6270 | H bond acceptors | 4 | Rule of 5 violations | 0 | | Molecular weight | 208.3275 | H bond donors | 0 | ACD/LogP | 3.81 | | Phase 25 °C | liquid/gas | Rotatable bonds | 8 | Predicted density | 0.94 g/cm3 | | SMILES | CCO[Si](OCC)(OCC)OCC | | STD InChIKey | BOTDANWDWHJENH-UHFFFAOYAS | | Melting Points | | mp °C | source | |
|---|
| -85.00 | Alfa Aesar | | -86.00 | Oxford University MSDS | | -82.50 | PHYSPROP |
|
|
| | | tetraethylsilane C8H20Si3, 64 |
 | | Compound Data | | Melting point | -82.25 °C | 190.90 K | | CSID | 11919 | H bond acceptors | 0 | Rule of 5 violations | 0 | | Molecular weight | 144.3299 | H bond donors | 0 | ACD/LogP | 4.96 | | Phase 25 °C | liquid/gas | Rotatable bonds | 4 | Predicted density | 0.73 g/cm3 | | SMILES | CC[Si](CC)(CC)CC | | STD InChIKey | VCZQFJFZMMALHB-UHFFFAOYAY | | Melting Points | | mp °C | source | |
|---|
| -82.00 | Alfa Aesar | | -82.50 | PHYSPROP |
|
|
| | | tetrafluoromethane CF461, 64 |
 | | Compound Data | | Melting point | -183.80 °C | 89.35 K | | CSID | 6153 | H bond acceptors | 0 | Rule of 5 violations | 0 | | Molecular weight | 88.0043 | H bond donors | 0 | ACD/LogP | 1.24 | | Phase 25 °C | liquid/gas | Rotatable bonds | 0 | Predicted density | 1.31 g/cm3 | | SMILES | FC(F)(F)F | | STD InChIKey | TXEYQDLBPFQVAA-UHFFFAOYAJ | | Melting Points | | mp °C | source | |
|---|
| -184.00 | Oxford University MSDS | | -183.60 | PHYSPROP |
|
|
| | | tetrafluoroquinone C6F4O261, 64 |
 | | Compound Data | | Melting point | 181.50 °C | 454.65 K | | CSID | 61540 | H bond acceptors | 2 | Rule of 5 violations | 0 | | Molecular weight | 180.0566 | H bond donors | 0 | ACD/LogP | 0.34 | | Phase 25 °C | solid | Rotatable bonds | 0 | Predicted density | 1.62 g/cm3 | | SMILES | FC=1C(=O)C(\F)=C(\F)C(=O)C=1F | | STD InChIKey | JKLYZOGJWVAIQS-UHFFFAOYAA | | Melting Points | | mp °C | source | |
|---|
| 179.00 | Oxford University MSDS | | 184.00 | PHYSPROP |
|
|
| | | tetrafluorosuccinic acid C4H2F4O43, 64 |
 | | Compound Data | | Melting point | 117.00 °C | 390.15 K | | CSID | 61150 | H bond acceptors | 4 | Rule of 5 violations | 0 | | Molecular weight | 190.0499 | H bond donors | 2 | ACD/LogP | 3.35 | | Phase 25 °C | solid | Rotatable bonds | 3 | Predicted density | 1.80 g/cm3 | | SMILES | FC(F)(C(=O)O)C(F)(F)C(=O)O | | STD InChIKey | YUDUFRYTKFGQCL-UHFFFAOYAJ | | Melting Points | | mp °C | source | |
|---|
| 115.00 | Alfa Aesar | | 119.00 | PHYSPROP |
|
|
| | | tetrahydrocarbazole C12H13N3, 48, 64 |
 | |
|
| | | tetrahydrofuran C4H8O2, 3, 61, 64 |
 | |
|
| | | tetrahydropyran C5H10O3, 32, 64 |
 | | Compound Data | | Melting point | -46.33 °C | 226.82 K | | CSID | 8554 | H bond acceptors | 1 | Rule of 5 violations | 0 | | Molecular weight | 86.1323 | H bond donors | 0 | ACD/LogP | 0.89 | | Phase 25 °C | liquid/gas | Rotatable bonds | 0 | Predicted density | 0.88 g/cm3 | | SMILES | O1CCCCC1 | | STD InChIKey | DHXVGJBLRPWPCS-UHFFFAOYAV | | Melting Points | | mp °C | source | |
|---|
| -49.00 | Alfa Aesar | | -45.00 | DrugBank | | -45.00 | PHYSPROP |
|
|
| | | tetrahydrothiophene C4H8S3, 61, 64 |
 | | Compound Data | | Melting point | -96.03 °C | 177.12 K | | CSID | 1095 | H bond acceptors | 0 | Rule of 5 violations | 0 | | Molecular weight | 88.1713 | H bond donors | 0 | ACD/LogP | 1.34 | | Phase 25 °C | liquid/gas | Rotatable bonds | 0 | Predicted density | 1.00 g/cm3 | | SMILES | S1CCCC1 | | STD InChIKey | RAOIDOHSFRTOEL-UHFFFAOYAY | | Melting Points | | mp °C | source | |
|---|
| -96.00 | Alfa Aesar | | -96.00 | Oxford University MSDS | | -96.10 | PHYSPROP |
|
|
| | | tetralin C10H122, 3, 61, 64 |
 | |
|
| | | tetralone C10H10O3, 64 |
 | | Compound Data | | Melting point | 7.50 °C | 280.65 K | | CSID | 10273 | H bond acceptors | 1 | Rule of 5 violations | 0 | | Molecular weight | 146.1858 | H bond donors | 0 | ACD/LogP | 2.61 | | Phase 25 °C | liquid/gas | Rotatable bonds | 0 | Predicted density | 1.10 g/cm3 | | SMILES | O=C2c1c(cccc1)CCC2 | | STD InChIKey | XHLHPRDBBAGVEG-UHFFFAOYAD | | Melting Points | | mp °C | source | |
|---|
| 7.00 | Alfa Aesar | | 8.00 | PHYSPROP |
|
|
| | | tetramethylethylene C6H123, 4, 64 |
 | |
|
| | | tetramethylsilane C4H12Si3, 64 |
 | | Compound Data | | Melting point | -99.50 °C | 173.65 K | | CSID | 6156 | H bond acceptors | 0 | Rule of 5 violations | 0 | | Molecular weight | 88.2236 | H bond donors | 0 | ACD/LogP | 2.84 | | Phase 25 °C | liquid/gas | Rotatable bonds | 0 | Predicted density | 0.68 g/cm3 | | SMILES | C[Si](C)(C)C | | STD InChIKey | CZDYPVPMEAXLPK-UHFFFAOYAT | | Melting Points | | mp °C | source | |
|---|
| -100.00 | Alfa Aesar | | -99.00 | PHYSPROP |
|
|
| | | tetramethylurea C5H12N2O3, 64 |
 | | Compound Data | | Melting point | -1.10 °C | 272.05 K | | CSID | 11930 | H bond acceptors | 3 | Rule of 5 violations | 0 | | Molecular weight | 116.1616 | H bond donors | 0 | ACD/LogP | 0.19 | | Phase 25 °C | liquid/gas | Rotatable bonds | 0 | Predicted density | 0.95 g/cm3 | | SMILES | O=C(N(C)C)N(C)C | | STD InChIKey | AVQQQNCBBIEMEU-UHFFFAOYAZ | | Melting Points | | mp °C | source | |
|---|
| -1.00 | Alfa Aesar | | -1.20 | PHYSPROP |
|
|
| | | tetranitromethane CN4O861, 64 |
 | | Compound Data | | Melting point | 13.90 °C | 287.05 K | | CSID | 13842838 | H bond acceptors | 12 | Rule of 5 violations | 2 | | Molecular weight | 196.03 | H bond donors | 0 | ACD/LogP | 8.49 | | Phase 25 °C | liquid/gas | Rotatable bonds | 4 | Predicted density | 2.04 g/cm3 | | SMILES | C([N+](=O)[O-])([N+](=O)[O-])([N+](=O)[O-])[N+](=O)[O-] | | STD InChIKey | NYTOUQBROMCLBJ-UHFFFAOYAA | | Melting Points | | mp °C | source | |
|---|
| 14.00 | Oxford University MSDS | | 13.80 | PHYSPROP |
|
|
| | | tetraphenylethene C26H203, 64 |
 | | Compound Data | | Melting point | 224.50 °C | 497.65 K | | CSID | 62645 | H bond acceptors | 0 | Rule of 5 violations | 1 | | Molecular weight | 332.437 | H bond donors | 0 | ACD/LogP | 6.15 | | Phase 25 °C | solid | Rotatable bonds | 4 | Predicted density | 1.09 g/cm3 | | SMILES | c1ccc(cc1)C(=C(c2ccccc2)c3ccccc3)c4ccccc4 | | STD InChIKey | JLZUZNKTTIRERF-UHFFFAOYAF | | Melting Points | | mp °C | source | |
|---|
| 224.00 | Alfa Aesar | | 225.00 | PHYSPROP |
|
|
| | | tetraphenylmethane C25H203, 64 |
 | | Compound Data | | Melting point | 282.50 °C | 555.65 K | | CSID | 11917 | H bond acceptors | 0 | Rule of 5 violations | 1 | | Molecular weight | 320.4263 | H bond donors | 0 | ACD/LogP | 7.31 | | Phase 25 °C | solid | Rotatable bonds | 4 | Predicted density | 1.08 g/cm3 | | SMILES | c1c(cccc1)C(c2ccccc2)(c3ccccc3)c4ccccc4 | | STD InChIKey | PEQHIRFAKIASBK-UHFFFAOYAS | | Melting Points | | mp °C | source | |
|---|
| 283.00 | Alfa Aesar | | 282.00 | PHYSPROP |
|
|
| | | tetraphenylsilane C24H20Si3, 64 |
 | | Compound Data | | Melting point | 236.75 °C | 509.90 K | | CSID | 59493 | H bond acceptors | 0 | Rule of 5 violations | 1 | | Molecular weight | 336.5011 | H bond donors | 0 | ACD/LogP | 8.18 | | Phase 25 °C | solid | Rotatable bonds | 4 | Predicted density | 1.10 g/cm3 | | SMILES | c1c(cccc1)[Si](c2ccccc2)(c3ccccc3)c4ccccc4 | | STD InChIKey | JLAVCPKULITDHO-UHFFFAOYAV | | Melting Points | | mp °C | source | |
|---|
| 237.00 | Alfa Aesar | | 236.50 | PHYSPROP |
|
|
| | | tetratetracontane C44H903, 64 |
 | | Compound Data | | Melting point | 87.75 °C | 360.90 K | | CSID | 21965 | H bond acceptors | 0 | Rule of 5 violations | 2 | | Molecular weight | 619.1854 | H bond donors | 0 | ACD/LogP | 24.14 | | Phase 25 °C | solid | Rotatable bonds | 41 | Predicted density | 0.82 g/cm3 | | SMILES | C(CCCCCCCCCCCCCCCCCCCCCC)CCCCCCCCCCCCCCCCCCCCC | | STD InChIKey | KMXFZRSJMDYPPG-UHFFFAOYAJ | | Melting Points | | mp °C | source | |
|---|
| 88.00 | Alfa Aesar | | 87.50 | PHYSPROP |
|
|
| | | tetroxoprim C16H22N4O444, 64 |
 | | Compound Data | | Melting point | 154.25 °C | 427.40 K | | CSID | 58910 | H bond acceptors | 8 | Rule of 5 violations | 0 | | Molecular weight | 334.3703 | H bond donors | 4 | ACD/LogP | 0.46 | | Phase 25 °C | solid | Rotatable bonds | 8 | Predicted density | 1.23 g/cm3 | | SMILES | n1c(N)c(cnc1N)Cc2cc(OC)c(OCCOC)c(OC)c2 | | STD InChIKey | WSWJIZXMAUYHOE-UHFFFAOYAT | | Melting Points | | mp °C | source | |
|---|
| 154.50 | Hughes LD; Palmer DS; Nigsch F and Mitchell JBO. 2008 Why ar... | | 154.00 | PHYSPROP |
|
|
| | | thenaldine C17H22N2S9, 64 |
 | | Compound Data | | Melting point | 95.50 °C | 368.65 K | | CSID | 25957 | H bond acceptors | 2 | Rule of 5 violations | 0 | | Molecular weight | 286.435 | H bond donors | 0 | ACD/LogP | 4.28 | | Phase 25 °C | solid | Rotatable bonds | 4 | Predicted density | 1.14 g/cm3 | | SMILES | s1c(ccc1)CN(c2ccccc2)C3CCN(C)CC3 | | STD InChIKey | KLOHYVOVXOUKQI-UHFFFAOYAU | | Melting Points | | mp °C | source | |
|---|
| 95.00 | Bergstrom C. A. S.; Norinder U.; Luthman K.; Artursson P. Mo... | | 96.00 | PHYSPROP |
|
|
| | | theophylline C7H8N4O29, 32, 44, 48, 61, 64, 70 |
 | |
|
| | | theophylline-7-acetic acid C7H2F5NO3, 64 |
 | | Compound Data | | Melting point | 147.50 °C | 420.65 K | | CSID | 62751 | H bond acceptors | 2 | Rule of 5 violations | 0 | | Molecular weight | 211.0889 | H bond donors | 2 | ACD/LogP | 0.97 | | Phase 25 °C | solid | Rotatable bonds | 1 | Predicted density | 1.63 g/cm3 | | SMILES | Fc1c(c(F)c(F)c(F)c1F)C(=O)N | | STD InChIKey | WPWWHXPRJFDTTJ-UHFFFAOYAO | | Melting Points | | mp °C | source | |
|---|
| 148.00 | Alfa Aesar | | 147.00 | PHYSPROP |
|
|
| | | thexyl alcohol C6H14O4, 64 |
 | | Compound Data | | Melting point | -12.00 °C | 261.15 K | | CSID | 11180 | H bond acceptors | 1 | Rule of 5 violations | 0 | | Molecular weight | 102.1748 | H bond donors | 1 | ACD/LogP | 1.45 | | Phase 25 °C | liquid/gas | Rotatable bonds | 2 | Predicted density | 0.81 g/cm3 | | SMILES | CC(C)C(C)(C)O | | STD InChIKey | IKECULIHBUCAKR-UHFFFAOYAD | | Melting Points | | mp °C | source | |
|---|
| -10.00 | American Petroleum Institute. Research Project 44; Selected ... | | -14.00 | PHYSPROP |
|
|
| | | thiabendazole C10H7N3S32, 61, 64 |
 | | Compound Data | | Melting point | 303.00 °C | 576.15 K | | CSID | 5237 | H bond acceptors | 3 | Rule of 5 violations | 0 | | Molecular weight | 201.2477 | H bond donors | 1 | ACD/LogP | 2.47 | | Phase 25 °C | solid | Rotatable bonds | 1 | Predicted density | 1.41 g/cm3 | | SMILES | n2c1c(cccc1)nc2c3ncsc3 | | STD InChIKey | WJCNZQLZVWNLKY-UHFFFAOYAV | | Melting Points | | mp °C | source | |
|---|
| 300.00 | DrugBank | | 304.50 | Oxford University MSDS | | 304.50 | PHYSPROP |
|
|
| | | thiaxanthone C13H8OS3, 48, 61, 64 |
 | |
|
| | | thienone C9H6OS23, 64 |
 | | Compound Data | | Melting point | 89.50 °C | 362.65 K | | CSID | 62914 | H bond acceptors | 1 | Rule of 5 violations | 0 | | Molecular weight | 194.2733 | H bond donors | 0 | ACD/LogP | 2.54 | | Phase 25 °C | solid | Rotatable bonds | 2 | Predicted density | 1.33 g/cm3 | | SMILES | O=C(c1sccc1)c2sccc2 | | STD InChIKey | GUTQMBQKTSGBPQ-UHFFFAOYAO | | Melting Points | | mp °C | source | |
|---|
| 89.00 | Alfa Aesar | | 90.00 | PHYSPROP |
|
|
| | | thioacetamide C2H5NS3, 61, 64 |
 | | Compound Data | | Melting point | 114.17 °C | 387.32 K | | CSID | 2006126 | H bond acceptors | 1 | Rule of 5 violations | 0 | | Molecular weight | 75.1328 | H bond donors | 2 | ACD/LogP | -0.26 | | Phase 25 °C | solid | Rotatable bonds | 0 | Predicted density | 1.07 g/cm3 | | SMILES | S=C(N)C | | STD InChIKey | YUKQRDCYNOVPGJ-UHFFFAOYAD | | Melting Points | | mp °C | source | |
|---|
| 112.00 | Alfa Aesar | | 115.00 | Oxford University MSDS | | 115.50 | PHYSPROP |
|
|
| | | thioacetamide C13H123, 4, 64 |
 | |
|
| | | thiobarbituric acid C4H4N2O2S61, 64 |
 | | Compound Data | | Melting point | 234.50 °C | 507.65 K | | CSID | 2005830 | H bond acceptors | 4 | Rule of 5 violations | 0 | | Molecular weight | 144.1518 | H bond donors | 2 | ACD/LogP | -0.52 | | Phase 25 °C | solid | Rotatable bonds | 0 | Predicted density | 1.57 g/cm3 | | SMILES | O=C1NC(=S)NC(=O)C1 | | STD InChIKey | RVBUGGBMJDPOST-UHFFFAOYAX | | Melting Points | | mp °C | source | |
|---|
| 234.00 | Oxford University MSDS | | 235.00 | PHYSPROP |
|
|
| | | thiodipropionic acid C6H10O4S3, 64 |
 | | Compound Data | | Melting point | 130.00 °C | 403.15 K | | CSID | 7805 | H bond acceptors | 4 | Rule of 5 violations | 0 | | Molecular weight | 178.2062 | H bond donors | 2 | ACD/LogP | 0.27 | | Phase 25 °C | solid | Rotatable bonds | 6 | Predicted density | 1.36 g/cm3 | | SMILES | O=C(O)CCSCCC(=O)O | | STD InChIKey | ODJQKYXPKWQWNK-UHFFFAOYAG | | Melting Points | | mp °C | source | |
|---|
| 131.00 | Alfa Aesar | | 129.00 | PHYSPROP |
|
|
| | | thiophene C4H4S1, 3, 28, 36, 50, 61, 64, 72 |
 | |
|
| | | thiophene-2-carboxamide C5H5NOS3, 64 |
 | | Compound Data | | Melting point | 181.50 °C | 454.65 K | | CSID | 20732 | H bond acceptors | 2 | Rule of 5 violations | 0 | | Molecular weight | 127.1643 | H bond donors | 2 | ACD/LogP | 0.52 | | Phase 25 °C | solid | Rotatable bonds | 1 | Predicted density | 1.30 g/cm3 | | SMILES | O=C(N)c1sccc1 | | STD InChIKey | DENPQNAWGQXKCU-UHFFFAOYAU | | Melting Points | | mp °C | source | |
|---|
| 181.00 | Alfa Aesar | | 182.00 | PHYSPROP |
|
|
| | | thiophene-2-carboxylic acid C5H4O2S3, 64 |
 | | Compound Data | | Melting point | 128.75 °C | 401.90 K | | CSID | 10250 | H bond acceptors | 2 | Rule of 5 violations | 0 | | Molecular weight | 128.1491 | H bond donors | 1 | ACD/LogP | 1.57 | | Phase 25 °C | solid | Rotatable bonds | 1 | Predicted density | 1.40 g/cm3 | | SMILES | O=C(O)c1sccc1 | | STD InChIKey | QERYCTSHXKAMIS-UHFFFAOYAX | | Melting Points | | mp °C | source | |
|---|
| 128.00 | Alfa Aesar | | 129.50 | PHYSPROP |
|
|
| | | thiophene-3-carboxylic acid C5H4O2S3, 64 |
 | | Compound Data | | Melting point | 138.50 °C | 411.65 K | | CSID | 6652 | H bond acceptors | 2 | Rule of 5 violations | 0 | | Molecular weight | 128.1491 | H bond donors | 1 | ACD/LogP | 1.48 | | Phase 25 °C | solid | Rotatable bonds | 1 | Predicted density | 1.40 g/cm3 | | SMILES | c1cscc1C(=O)O | | STD InChIKey | YNVOMSDITJMNET-UHFFFAOYAE | | Melting Points | | mp °C | source | |
|---|
| 139.00 | Alfa Aesar | | 138.00 | PHYSPROP |
|
|
| | | thymine C5H6N2O23, 44, 61, 64 |
 | |
|
| | | thymol C10H14O3, 61, 64 |
 | | Compound Data | | Melting point | 50.50 °C | 323.65 K | | CSID | 21105998 | H bond acceptors | 1 | Rule of 5 violations | 0 | | Molecular weight | 150.2176 | H bond donors | 1 | ACD/LogP | 3.28 | | Phase 25 °C | solid | Rotatable bonds | 2 | Predicted density | 0.97 g/cm3 | | SMILES | CC(C)c1ccc(C)cc1O | | STD InChIKey | MGSRCZKZVOBKFT-UHFFFAOYAS | | Melting Points | | mp °C | source | |
|---|
| 51.00 | Alfa Aesar | | 49.00 | Oxford University MSDS | | 51.50 | PHYSPROP |
|
|
| | | thymolphthalein C28H30O43, 61, 64 |
 | | Compound Data | | Melting point | 251.67 °C | 524.82 K | | CSID | 29054 | H bond acceptors | 4 | Rule of 5 violations | 1 | | Molecular weight | 430.5354 | H bond donors | 2 | ACD/LogP | 6.23 | | Phase 25 °C | solid | Rotatable bonds | 6 | Predicted density | 1.19 g/cm3 | | SMILES | O=C1OC(c2ccccc12)(c3cc(c(O)cc3C)C(C)C)c4cc(c(O)cc4C)C(C)C | | STD InChIKey | LDKDGDIWEUUXSH-UHFFFAOYAV | | Melting Points | | mp °C | source | |
|---|
| 252.00 | Alfa Aesar | | 250.00 | Oxford University MSDS | | 253.00 | PHYSPROP |
|
|
| | | tolazamide C14H21N3O3S9, 32, 64 |
 | | Compound Data | | Melting point | 171.00 °C | 444.15 K | | CSID | 5302 | H bond acceptors | 6 | Rule of 5 violations | 0 | | Molecular weight | 311.3998 | H bond donors | 2 | ACD/LogP | 1.71 | | Phase 25 °C | solid | Rotatable bonds | 2 | Predicted density | 1.29 g/cm3 | | SMILES | O=S(=O)(c1ccc(cc1)C)NC(=O)NN2CCCCCC2 | | STD InChIKey | OUDSBRTVNLOZBN-UHFFFAOYAL | | Melting Points | | mp °C | source | |
|---|
| 170.00 | Bergstrom C. A. S.; Norinder U.; Luthman K.; Artursson P. Mo... | | 171.50 | DrugBank | | 171.50 | PHYSPROP |
|
|
| | | toluene C7H83, 4, 61, 64 |
 | |
|
| | | torsemide C16H20N4O3S9, 32 |
 | | Compound Data | | Melting point | 163.50 °C | 436.65 K | | CSID | 38123 | H bond acceptors | 7 | Rule of 5 violations | 0 | | Molecular weight | 348.42 | H bond donors | 3 | ACD/LogP | 2.54 | | Phase 25 °C | solid | Rotatable bonds | 4 | Predicted density | 1.28 g/cm3 | | SMILES | O=S(=O)(c2c(Nc1cc(ccc1)C)ccnc2)NC(=O)NC(C)C | | STD InChIKey | NGBFQHCMQULJNZ-UHFFFAOYAL | | Melting Points | | mp °C | source | |
|---|
| 163.00 | Bergstrom C. A. S.; Norinder U.; Luthman K.; Artursson P. Mo... | | 164.00 | DrugBank |
|
|
| | | tosyl chloride C7H7ClO2S2, 3, 61, 64 |
 | |
|
| | | tri(4-tolyl)phosphine C21H21P3, 64 |
 | | Compound Data | | Melting point | 147.00 °C | 420.15 K | | CSID | 13352 | H bond acceptors | 0 | Rule of 5 violations | 1 | | Molecular weight | 304.3652 | H bond donors | 0 | ACD/LogP | 7.07 | | Phase 25 °C | solid | Rotatable bonds | 3 | Predicted density | 0.00 g/cm3 | | SMILES | c3c(P(c1ccc(cc1)C)c2ccc(cc2)C)ccc(c3)C | | STD InChIKey | WXAZIUYTQHYBFW-UHFFFAOYAP | | Melting Points | | mp °C | source | |
|---|
| 145.00 | Alfa Aesar | | 149.00 | PHYSPROP |
|
|
| | | triacontane C30H623, 61, 64 |
 | | Compound Data | | Melting point | 66.27 °C | 339.42 K | | CSID | 12018 | H bond acceptors | 0 | Rule of 5 violations | 1 | | Molecular weight | 422.8133 | H bond donors | 0 | ACD/LogP | 16.70 | | Phase 25 °C | solid | Rotatable bonds | 27 | Predicted density | 0.81 g/cm3 | | SMILES | C(CCCCCCCCCCCCCCCCCCCCCC)CCCCCCC | | STD InChIKey | JXTPJDDICSTXJX-UHFFFAOYAO | | Melting Points | | mp °C | source | |
|---|
| 67.00 | Alfa Aesar | | 66.00 | Oxford University MSDS | | 65.80 | PHYSPROP |
|
|
| | | tribenzylamine C21H21N3, 64 |
 | | Compound Data | | Melting point | 92.25 °C | 365.40 K | | CSID | 22739 | H bond acceptors | 1 | Rule of 5 violations | 1 | | Molecular weight | 287.3981 | H bond donors | 0 | ACD/LogP | 5.67 | | Phase 25 °C | solid | Rotatable bonds | 6 | Predicted density | 1.07 g/cm3 | | SMILES | N(Cc1ccccc1)(Cc2ccccc2)Cc3ccccc3 | | STD InChIKey | MXHTZQSKTCCMFG-UHFFFAOYAF | | Melting Points | | mp °C | source | |
|---|
| 93.00 | Alfa Aesar | | 91.50 | PHYSPROP |
|
|
| | | tribromoacetic acid C2HBr3O23, 61, 64 |
 | | Compound Data | | Melting point | 131.83 °C | 404.98 K | | CSID | 6175 | H bond acceptors | 2 | Rule of 5 violations | 0 | | Molecular weight | 296.7401 | H bond donors | 1 | ACD/LogP | 3.33 | | Phase 25 °C | solid | Rotatable bonds | 0 | Predicted density | 3.10 g/cm3 | | SMILES | BrC(Br)(Br)C(=O)O | | STD InChIKey | QIONYIKHPASLHO-UHFFFAOYAS | | Melting Points | | mp °C | source | |
|---|
| 132.00 | Alfa Aesar | | 131.50 | Oxford University MSDS | | 132.00 | PHYSPROP |
|
|
| | | tribromofluoromethane CBr3F3, 64 |
 | | Compound Data | | Melting point | -73.80 °C | 199.35 K | | CSID | 61026 | H bond acceptors | 0 | Rule of 5 violations | 0 | | Molecular weight | 270.7211 | H bond donors | 0 | ACD/LogP | 3.03 | | Phase 25 °C | liquid/gas | Rotatable bonds | 0 | Predicted density | 3.00 g/cm3 | | SMILES | BrC(Br)(Br)F | | STD InChIKey | IHZAEIHJPNTART-UHFFFAOYAI | | Melting Points | | mp °C | source | |
|---|
| -74.00 | Alfa Aesar | | -73.60 | PHYSPROP |
|
|
| | | tributyl phosphate C12H27O4P3, 61, 64 |
 | | Compound Data | | Melting point | -79.67 °C | 193.48 K | | CSID | 29090 | H bond acceptors | 4 | Rule of 5 violations | 0 | | Molecular weight | 266.3141 | H bond donors | 0 | ACD/LogP | 4.26 | | Phase 25 °C | liquid/gas | Rotatable bonds | 12 | Predicted density | 0.99 g/cm3 | | SMILES | O=P(OCCCC)(OCCCC)OCCCC | | STD InChIKey | STCOOQWBFONSKY-UHFFFAOYAN | | Melting Points | | mp °C | source | |
|---|
| -80.00 | Alfa Aesar | | -80.00 | Oxford University MSDS | | -79.00 | PHYSPROP |
|
|
| | | tributylphosphine C12H27P3, 61 |
 | | Compound Data | | Melting point | -62.50 °C | 210.65 K | | CSID | 13231 | H bond acceptors | 0 | Rule of 5 violations | 1 | | Molecular weight | 202.3165 | H bond donors | 0 | ACD/LogP | 5.60 | | Phase 25 °C | liquid/gas | Rotatable bonds | 9 | Predicted density | 0.00 g/cm3 | | SMILES | P(CCCC)(CCCC)CCCC | | STD InChIKey | TUQOTMZNTHZOKS-UHFFFAOYAQ | | Melting Points | | mp °C | source | |
|---|
| -65.00 | Alfa Aesar | | -60.00 | Oxford University MSDS |
|
|
| | | tributylphosphine oxide C12H27OP3, 64 |
 | | Compound Data | | Melting point | 65.50 °C | 338.65 K | | CSID | 12586 | H bond acceptors | 1 | Rule of 5 violations | 0 | | Molecular weight | 218.3159 | H bond donors | 0 | ACD/LogP | 4.14 | | Phase 25 °C | solid | Rotatable bonds | 9 | Predicted density | 0.87 g/cm3 | | SMILES | CCCCP(=O)(CCCC)CCCC | | STD InChIKey | MNZAKDODWSQONA-UHFFFAOYAW | | Melting Points | | mp °C | source | |
|---|
| 67.00 | Alfa Aesar | | 64.00 | PHYSPROP |
|
|
| | | trichloroacetic acid C2HCl3O23, 35, 61, 64 |
 | | Compound Data | | Melting point | 57.00 °C | 330.15 K | | CSID | 10772050 | H bond acceptors | 2 | Rule of 5 violations | 0 | | Molecular weight | 163.3871 | H bond donors | 1 | ACD/LogP | 1.67 | | Phase 25 °C | solid | Rotatable bonds | 0 | Predicted density | 1.81 g/cm3 | | SMILES | ClC(Cl)(Cl)C(O)=O | | STD InChIKey | YNJBWRMUSHSURL-UHFFFAOYAS | | Melting Points | | mp °C | source | |
|---|
| 56.00 | Alfa Aesar | | 57.50 | EPISuite-ChemSpider | | 57.00 | Oxford University MSDS | | 57.50 | PHYSPROP |
|
|
| | | trichloroacetonitrile C2Cl3N3, 61, 64 |
 | | Compound Data | | Melting point | -42.67 °C | 230.48 K | | CSID | 13861934 | H bond acceptors | 1 | Rule of 5 violations | 0 | | Molecular weight | 144.3871 | H bond donors | 0 | ACD/LogP | 2.54 | | Phase 25 °C | liquid/gas | Rotatable bonds | 0 | Predicted density | 1.62 g/cm3 | | SMILES | ClC(Cl)(Cl)C#N | | STD InChIKey | DRUIESSIVFYOMK-UHFFFAOYAZ | | Melting Points | | mp °C | source | |
|---|
| -44.00 | Alfa Aesar | | -42.00 | Oxford University MSDS | | -42.00 | PHYSPROP |
|
|
| | | trichloroacrylic acid C3HCl3O23, 64 |
 | | Compound Data | | Melting point | 74.50 °C | 347.65 K | | CSID | 10289059 | H bond acceptors | 2 | Rule of 5 violations | 0 | | Molecular weight | 175.3978 | H bond donors | 1 | ACD/LogP | 1.25 | | Phase 25 °C | solid | Rotatable bonds | 1 | Predicted density | 1.75 g/cm3 | | SMILES | Cl/C(Cl)=C(/Cl)C(O)=O | | STD InChIKey | WMUBNWIGNSIRDH-UHFFFAOYAR | | Melting Points | | mp °C | source | |
|---|
| 73.00 | Alfa Aesar | | 76.00 | PHYSPROP |
|
|
| | | trichlorofluoromethane CCl3F61, 64 |
 | | Compound Data | | Melting point | -110.80 °C | 162.35 K | | CSID | 6149 | H bond acceptors | 0 | Rule of 5 violations | 0 | | Molecular weight | 137.3681 | H bond donors | 0 | ACD/LogP | 2.56 | | Phase 25 °C | liquid/gas | Rotatable bonds | 0 | Predicted density | 1.62 g/cm3 | | SMILES | ClC(Cl)(Cl)F | | STD InChIKey | CYRMSUTZVYGINF-UHFFFAOYAT | | Melting Points | | mp °C | source | |
|---|
| -110.50 | Oxford University MSDS | | -111.10 | PHYSPROP |
|
|
| | | triclosan C12H7Cl3O23, 61, 64 |
 | | Compound Data | | Melting point | 56.55 °C | 329.70 K | | CSID | 5363 | H bond acceptors | 2 | Rule of 5 violations | 1 | | Molecular weight | 289.5418 | H bond donors | 1 | ACD/LogP | 5.17 | | Phase 25 °C | solid | Rotatable bonds | 3 | Predicted density | 1.49 g/cm3 | | SMILES | Clc2cc(Cl)ccc2Oc1ccc(Cl)cc1O | | STD InChIKey | XEFQLINVKFYRCS-UHFFFAOYAS | | Melting Points | | mp °C | source | |
|---|
| 57.00 | Alfa Aesar | | 57.00 | Oxford University MSDS | | 55.65 | PHYSPROP |
|
|
| | | triclosan C6H2Cl2O23, 61 |
 | | Compound Data | | Melting point | 160.75 °C | 433.90 K | | CSID | 11516 | H bond acceptors | 2 | Rule of 5 violations | 0 | | Molecular weight | 176.9849 | H bond donors | 0 | ACD/LogP | 0.65 | | Phase 25 °C | solid | Rotatable bonds | 0 | Predicted density | 1.56 g/cm3 | | SMILES | O=C\1C(\Cl)=C/C(=O)C(/Cl)=C/1 | | STD InChIKey | LNXVNZRYYHFMEY-UHFFFAOYAG | | Melting Points | | mp °C | source | |
|---|
| 160.00 | Alfa Aesar | | 161.50 | Oxford University MSDS |
|
|
| | | tricosane C23H483, 61, 64 |
 | | Compound Data | | Melting point | 48.53 °C | 321.68 K | | CSID | 12017 | H bond acceptors | 0 | Rule of 5 violations | 1 | | Molecular weight | 324.6272 | H bond donors | 0 | ACD/LogP | 12.98 | | Phase 25 °C | solid | Rotatable bonds | 20 | Predicted density | 0.80 g/cm3 | | SMILES | C(CCCCCCCCCCCCCCCCCCC)CCC | | STD InChIKey | FIGVVZUWCLSUEI-UHFFFAOYAW | | Melting Points | | mp °C | source | |
|---|
| 49.00 | Alfa Aesar | | 49.00 | Oxford University MSDS | | 47.60 | PHYSPROP |
|
|
| | | tridecanal C13H26O4, 64 |
 | | Compound Data | | Melting point | 14.50 °C | 287.65 K | | CSID | 23643 | H bond acceptors | 1 | Rule of 5 violations | 1 | | Molecular weight | 198.3449 | H bond donors | 0 | ACD/LogP | 5.69 | | Phase 25 °C | liquid/gas | Rotatable bonds | 11 | Predicted density | 0.82 g/cm3 | | SMILES | O=CCCCCCCCCCCCC | | STD InChIKey | BGEHHAVMRVXCGR-UHFFFAOYAF | | Melting Points | | mp °C | source | |
|---|
| 15.00 | American Petroleum Institute. Research Project 44; Selected ... | | 14.00 | PHYSPROP |
|
|
| | | tridecane C13H283, 4, 61, 64 |
 | |
|
| | | tridecanoic acid C13H26O232, 61, 64 |
 | | Compound Data | | Melting point | 43.50 °C | 316.65 K | | CSID | 12013 | H bond acceptors | 2 | Rule of 5 violations | 1 | | Molecular weight | 214.3443 | H bond donors | 1 | ACD/LogP | 5.56 | | Phase 25 °C | solid | Rotatable bonds | 11 | Predicted density | 0.90 g/cm3 | | SMILES | O=C(O)CCCCCCCCCCCC | | STD InChIKey | SZHOJFHSIKHZHA-UHFFFAOYAT | | Melting Points | | mp °C | source | |
|---|
| 44.50 | DrugBank | | 41.50 | Oxford University MSDS | | 44.50 | PHYSPROP |
|
|
| | | triethyl borate C6H15BO33, 64 |
 | | Compound Data | | Melting point | -84.90 °C | 188.25 K | | CSID | 8659 | H bond acceptors | 3 | Rule of 5 violations | 0 | | Molecular weight | 145.9925 | H bond donors | 0 | ACD/LogP | 3.04 | | Phase 25 °C | liquid/gas | Rotatable bonds | 6 | Predicted density | 0.86 g/cm3 | | SMILES | O(B(OCC)OCC)CC | | STD InChIKey | AJSTXXYNEIHPMD-UHFFFAOYAB | | Melting Points | | mp °C | source | |
|---|
| -85.00 | Alfa Aesar | | -84.80 | PHYSPROP |
|
|
| | | triethyl methanetricarboxylate C10H16O63, 64 |
 | | Compound Data | | Melting point | 28.50 °C | 301.65 K | | CSID | 72680 | H bond acceptors | 6 | Rule of 5 violations | 0 | | Molecular weight | 232.2304 | H bond donors | 0 | ACD/LogP | 1.09 | | Phase 25 °C | solid | Rotatable bonds | 9 | Predicted density | 1.14 g/cm3 | | SMILES | O=C(OCC)C(C(=O)OCC)C(=O)OCC | | STD InChIKey | AGZPNUZBDCYTBB-UHFFFAOYAQ | | Melting Points | | mp °C | source | |
|---|
| 28.00 | Alfa Aesar | | 29.00 | PHYSPROP |
|
|
| | | triethyl phosphate C6H15O4P61, 64 |
 | | Compound Data | | Melting point | -56.20 °C | 216.95 K | | CSID | 6287 | H bond acceptors | 4 | Rule of 5 violations | 0 | | Molecular weight | 182.1547 | H bond donors | 0 | ACD/LogP | 1.08 | | Phase 25 °C | liquid/gas | Rotatable bonds | 6 | Predicted density | 1.07 g/cm3 | | SMILES | O=P(OCC)(OCC)OCC | | STD InChIKey | DQWPFSLDHJDLRL-UHFFFAOYAA | | Melting Points | | mp °C | source | |
|---|
| -56.00 | Oxford University MSDS | | -56.40 | PHYSPROP |
|
|
| | | triethylamine C6H15N3, 3, 28, 31, 45, 61, 64, 81, 84 |
 | |
|
| | | triethylene glycol C6H14O43, 61, 64 |
 | | Compound Data | | Melting point | -6.00 °C | 267.15 K | | CSID | 13835895 | H bond acceptors | 4 | Rule of 5 violations | 0 | | Molecular weight | 150.173 | H bond donors | 2 | ACD/LogP | 0.00 | | Phase 25 °C | liquid/gas | Rotatable bonds | 9 | Predicted density | 1.11 g/cm3 | | SMILES | OCCOCCOCCO | | STD InChIKey | ZIBGPFATKBEMQZ-UHFFFAOYAS | | Melting Points | | mp °C | source | |
|---|
| -7.00 | Alfa Aesar | | -4.00 | Oxford University MSDS | | -7.00 | PHYSPROP |
|
|
| | | trifluoroacetic acid C2HF3O23, 61, 64 |
 | | Compound Data | | Melting point | -15.07 °C | 258.08 K | | CSID | 10239201 | H bond acceptors | 2 | Rule of 5 violations | 0 | | Molecular weight | 114.0233 | H bond donors | 1 | ACD/LogP | 1.35 | | Phase 25 °C | liquid/gas | Rotatable bonds | 0 | Predicted density | 1.57 g/cm3 | | SMILES | C(=O)(C(F)(F)F)O | | STD InChIKey | DTQVDTLACAAQTR-UHFFFAOYAP | | Melting Points | | mp °C | source | |
|---|
| -15.00 | Alfa Aesar | | -15.00 | Oxford University MSDS | | -15.20 | PHYSPROP |
|
|
| | | trifluoroacetic anhydride C4F6O33, 61, 64 |
 | | Compound Data | | Melting point | -64.33 °C | 208.82 K | | CSID | 21106178 | H bond acceptors | 3 | Rule of 5 violations | 0 | | Molecular weight | 210.0314 | H bond donors | 0 | ACD/LogP | 2.56 | | Phase 25 °C | liquid/gas | Rotatable bonds | 2 | Predicted density | 1.64 g/cm3 | | SMILES | FC(F)(F)C(=O)OC(=O)C(F)(F)F | | STD InChIKey | QAEDZJGFFMLHHQ-UHFFFAOYAX | | Melting Points | | mp °C | source | |
|---|
| -65.00 | Alfa Aesar | | -63.00 | Oxford University MSDS | | -65.00 | PHYSPROP |
|
|
| | | trifluoromethylbenzene C7H5F33, 61, 64 |
 | | Compound Data | | Melting point | -28.37 °C | 244.78 K | | CSID | 7090 | H bond acceptors | 0 | Rule of 5 violations | 0 | | Molecular weight | 146.1098 | H bond donors | 0 | ACD/LogP | 2.89 | | Phase 25 °C | liquid/gas | Rotatable bonds | 0 | Predicted density | 1.19 g/cm3 | | SMILES | c1ccc(cc1)C(F)(F)F | | STD InChIKey | GETTZEONDQJALK-UHFFFAOYAQ | | Melting Points | | mp °C | source | |
|---|
| -29.00 | Alfa Aesar | | -27.00 | Oxford University MSDS | | -29.10 | PHYSPROP |
|
|
| | | trimethoprim C14H18N4O332, 35, 44, 61, 64 |
 | |
|
| | | trimethyl borate C3H9BO33, 61, 64, 64 |
 | | Compound Data | | Melting point | -32.82 °C | 240.32 K | | CSID | 8157 | H bond acceptors | 3 | Rule of 5 violations | 0 | | Molecular weight | 103.9128 | H bond donors | 0 | ACD/LogP | 1.45 | | Phase 25 °C | liquid/gas | Rotatable bonds | 3 | Predicted density | 0.87 g/cm3 | | SMILES | O(B(OC)OC)C | | STD InChIKey | WRECIMRULFAWHA-UHFFFAOYAY | | Melting Points | | mp °C | source | |
|---|
| -34.00 | Alfa Aesar | | -34.00 | Oxford University MSDS | | -29.30 | PHYSPROP | | -34.00 | PHYSPROP |
|
|
| | | trimethylacetylacetonitrile C7H11NO3, 64 |
 | | Compound Data | | Melting point | 69.50 °C | 342.65 K | | CSID | 97904 | H bond acceptors | 2 | Rule of 5 violations | 0 | | Molecular weight | 125.1683 | H bond donors | 0 | ACD/LogP | 0.55 | | Phase 25 °C | solid | Rotatable bonds | 2 | Predicted density | 0.93 g/cm3 | | SMILES | N#CCC(=O)C(C)(C)C | | STD InChIKey | MXZMACXOMZKYHJ-UHFFFAOYAF | | Melting Points | | mp °C | source | |
|---|
| 68.00 | Alfa Aesar | | 71.00 | PHYSPROP |
|
|
| | | trimethylamine C3H9N61, 64 |
 | | Compound Data | | Melting point | -117.04 °C | 156.11 K | | CSID | 1114 | H bond acceptors | 1 | Rule of 5 violations | 0 | | Molecular weight | 59.1103 | H bond donors | 0 | ACD/LogP | 0.06 | | Phase 25 °C | liquid/gas | Rotatable bonds | 0 | Predicted density | 0.69 g/cm3 | | SMILES | N(C)(C)C | | STD InChIKey | GETQZCLCWQTVFV-UHFFFAOYAA | | Melting Points | | mp °C | source | |
|---|
| -117.00 | Oxford University MSDS | | -117.08 | PHYSPROP |
|
|
| | | trioctylphosphine oxide C24H51OP3, 61 |
 | | Compound Data | | Melting point | 53.50 °C | 326.65 K | | CSID | 59020 | H bond acceptors | 1 | Rule of 5 violations | 1 | | Molecular weight | 386.6349 | H bond donors | 0 | ACD/LogP | 10.25 | | Phase 25 °C | solid | Rotatable bonds | 21 | Predicted density | 0.86 g/cm3 | | SMILES | CCCCCCCCP(=O)(CCCCCCCC)CCCCCCCC | | STD InChIKey | ZMBHCYHQLYEYDV-UHFFFAOYAY | | Melting Points | | mp °C | source | |
|---|
| 55.00 | Alfa Aesar | | 52.00 | Oxford University MSDS |
|
|
| | | triphenyl phosphate C18H15O4P3, 61, 64 |
 | | Compound Data | | Melting point | 50.33 °C | 323.48 K | | CSID | 7988 | H bond acceptors | 4 | Rule of 5 violations | 0 | | Molecular weight | 326.2831 | H bond donors | 0 | ACD/LogP | 4.10 | | Phase 25 °C | solid | Rotatable bonds | 6 | Predicted density | 1.26 g/cm3 | | SMILES | O=P(Oc1ccccc1)(Oc2ccccc2)Oc3ccccc3 | | STD InChIKey | XZZNDPSIHUTMOC-UHFFFAOYAB | | Melting Points | | mp °C | source | |
|---|
| 50.00 | Alfa Aesar | | 50.50 | Oxford University MSDS | | 50.50 | PHYSPROP |
|
|
| | | triphenyl phosphite C18H15O3P3, 61, 64 |
 | | Compound Data | | Melting point | 23.67 °C | 296.82 K | | CSID | 7259 | H bond acceptors | 3 | Rule of 5 violations | 1 | | Molecular weight | 310.2837 | H bond donors | 0 | ACD/LogP | 7.43 | | Phase 25 °C | liquid/gas | Rotatable bonds | 6 | Predicted density | 0.00 g/cm3 | | SMILES | O(P(Oc1ccccc1)Oc2ccccc2)c3ccccc3 | | STD InChIKey | HVLLSGMXQDNUAL-UHFFFAOYAF | | Melting Points | | mp °C | source | |
|---|
| 23.00 | Alfa Aesar | | 23.00 | Oxford University MSDS | | 25.00 | PHYSPROP |
|
|
| | | triphenylene C18H123, 44, 48, 64, 70 |
 | |
|
| | | triphenylmethane C19H162, 3, 61, 64 |
 | |
|
| | | triphenylmethanol C19H16O2, 3, 61, 64 |
 | |
|
| | | triphenylphosphine C18H15P3, 61, 64 |
 | | Compound Data | | Melting point | 80.17 °C | 353.32 K | | CSID | 11283 | H bond acceptors | 0 | Rule of 5 violations | 1 | | Molecular weight | 262.2855 | H bond donors | 0 | ACD/LogP | 5.69 | | Phase 25 °C | solid | Rotatable bonds | 3 | Predicted density | 0.00 g/cm3 | | SMILES | c3c(P(c1ccccc1)c2ccccc2)cccc3 | | STD InChIKey | RIOQSEWOXXDEQQ-UHFFFAOYAH | | Melting Points | | mp °C | source | |
|---|
| 80.00 | Alfa Aesar | | 80.50 | Oxford University MSDS | | 80.00 | PHYSPROP |
|
|
| | | triphenylphosphine oxide C18H15OP3, 64 |
 | | Compound Data | | Melting point | 156.25 °C | 429.40 K | | CSID | 12549 | H bond acceptors | 1 | Rule of 5 violations | 0 | | Molecular weight | 278.2849 | H bond donors | 0 | ACD/LogP | 2.87 | | Phase 25 °C | solid | Rotatable bonds | 3 | Predicted density | 1.17 g/cm3 | | SMILES | O=P(c1ccccc1)(c2ccccc2)c3ccccc3 | | STD InChIKey | FIQMHBFVRAXMOP-UHFFFAOYAB | | Melting Points | | mp °C | source | |
|---|
| 156.00 | Alfa Aesar | | 156.50 | PHYSPROP |
|
|
| | | triphenylsilane C18H16Si3, 64 |
 | | Compound Data | | Melting point | 42.70 °C | 315.85 K | | CSID | 63117 | H bond acceptors | 0 | Rule of 5 violations | 1 | | Molecular weight | 260.4051 | H bond donors | 0 | ACD/LogP | 7.01 | | Phase 25 °C | solid | Rotatable bonds | 3 | Predicted density | 0.00 g/cm3 | | SMILES | c1c(cccc1)[SiH](c2ccccc2)c3ccccc3 | | STD InChIKey | AKQNYQDSIDKVJZ-UHFFFAOYAL | | Melting Points | | mp °C | source | |
|---|
| 43.00 | Alfa Aesar | | 42.40 | PHYSPROP |
|
|
| | | triphenylsilanol C18H16OSi3, 64 |
 | | Compound Data | | Melting point | 153.40 °C | 426.55 K | | CSID | 63119 | H bond acceptors | 1 | Rule of 5 violations | 1 | | Molecular weight | 276.4045 | H bond donors | 1 | ACD/LogP | 6.29 | | Phase 25 °C | solid | Rotatable bonds | 4 | Predicted density | 1.13 g/cm3 | | SMILES | O[Si](c1ccccc1)(c2ccccc2)c3ccccc3 | | STD InChIKey | NLSXASIDNWDYMI-UHFFFAOYAP | | Melting Points | | mp °C | source | |
|---|
| 152.00 | Alfa Aesar | | 154.80 | PHYSPROP |
|
|
| | | triphosgene C3Cl6O33, 64 |
 | | Compound Data | | Melting point | 81.50 °C | 354.65 K | | CSID | 85216 | H bond acceptors | 3 | Rule of 5 violations | 0 | | Molecular weight | 296.7483 | H bond donors | 0 | ACD/LogP | 4.02 | | Phase 25 °C | solid | Rotatable bonds | 2 | Predicted density | 1.90 g/cm3 | | SMILES | ClC(Cl)(Cl)OC(=O)OC(Cl)(Cl)Cl | | STD InChIKey | UCPYLLCMEDAXFR-UHFFFAOYAA | | Melting Points | | mp °C | source | |
|---|
| 84.00 | Alfa Aesar | | 79.00 | PHYSPROP |
|
|
| | | tripropylamine C9H21N3, 31, 61, 64 |
 | |
|
| | | tritylthiol C19H16S3, 64 |
 | | Compound Data | | Melting point | 105.50 °C | 378.65 K | | CSID | 69703 | H bond acceptors | 0 | Rule of 5 violations | 1 | | Molecular weight | 276.3953 | H bond donors | 0 | ACD/LogP | 6.83 | | Phase 25 °C | solid | Rotatable bonds | 4 | Predicted density | 1.12 g/cm3 | | SMILES | SC(c1ccccc1)(c2ccccc2)c3ccccc3 | | STD InChIKey | JQZIKLPHXXBMCA-UHFFFAOYAZ | | Melting Points | | mp °C | source | |
|---|
| 106.00 | Alfa Aesar | | 105.00 | PHYSPROP |
|
|
| | | tropolone C7H6O23, 64 |
 | | Compound Data | | Melting point | 51.90 °C | 325.05 K | | CSID | 10333 | H bond acceptors | 2 | Rule of 5 violations | 0 | | Molecular weight | 122.1213 | H bond donors | 1 | ACD/LogP | 0.00 | | Phase 25 °C | solid | Rotatable bonds | 1 | Predicted density | 1.28 g/cm3 | | SMILES | c1ccc(c(=O)cc1)O | | STD InChIKey | MDYOLVRUBBJPFM-UHFFFAOYAW | | Melting Points | | mp °C | source | |
|---|
| 53.00 | Alfa Aesar | | 50.80 | PHYSPROP |
|
|
| | | tryptamine C10H12N23, 64 |
 | | Compound Data | | Melting point | 116.00 °C | 389.15 K | | CSID | 1118 | H bond acceptors | 2 | Rule of 5 violations | 0 | | Molecular weight | 160.2157 | H bond donors | 3 | ACD/LogP | 1.54 | | Phase 25 °C | solid | Rotatable bonds | 3 | Predicted density | 1.16 g/cm3 | | SMILES | c1ccc2c(c1)c(c[nH]2)CCN | | STD InChIKey | APJYDQYYACXCRM-UHFFFAOYAU | | Melting Points | | mp °C | source | |
|---|
| 114.00 | Alfa Aesar | | 118.00 | PHYSPROP |
|
|
| | | tryptophol C10H11NO3, 64 |
 | | Compound Data | | Melting point | 58.50 °C | 331.65 K | | CSID | 10235 | H bond acceptors | 2 | Rule of 5 violations | 0 | | Molecular weight | 161.2004 | H bond donors | 2 | ACD/LogP | 1.64 | | Phase 25 °C | solid | Rotatable bonds | 3 | Predicted density | 1.22 g/cm3 | | SMILES | c1ccc2c(c1)c(c[nH]2)CCO | | STD InChIKey | MBBOMCVGYCRMEA-UHFFFAOYAB | | Melting Points | | mp °C | source | |
|---|
| 58.00 | Alfa Aesar | | 59.00 | PHYSPROP |
|
|
| | | tyramine C8H11NO9, 48, 64 |
 | |
|
| | | tyrosol C8H10O23, 64 |
 | | Compound Data | | Melting point | 90.50 °C | 363.65 K | | CSID | 9964 | H bond acceptors | 2 | Rule of 5 violations | 0 | | Molecular weight | 138.1638 | H bond donors | 2 | ACD/LogP | 0.62 | | Phase 25 °C | solid | Rotatable bonds | 4 | Predicted density | 1.17 g/cm3 | | SMILES | Oc1ccc(cc1)CCO | | STD InChIKey | YCCILVSKPBXVIP-UHFFFAOYAG | | Melting Points | | mp °C | source | |
|---|
| 91.00 | Alfa Aesar | | 90.00 | PHYSPROP |
|
|
| | | ubiquinone q0 C9H10O43, 61, 64 |
 | | Compound Data | | Melting point | 59.00 °C | 332.15 K | | CSID | 62289 | H bond acceptors | 4 | Rule of 5 violations | 0 | | Molecular weight | 182.1733 | H bond donors | 0 | ACD/LogP | 0.12 | | Phase 25 °C | solid | Rotatable bonds | 2 | Predicted density | 1.19 g/cm3 | | SMILES | O=C1/C=C(\C(=O)C(\OC)=C1\OC)C | | STD InChIKey | UIXPTCZPFCVOQF-UHFFFAOYAX | | Melting Points | | mp °C | source | |
|---|
| 59.00 | Alfa Aesar | | 58.50 | Oxford University MSDS | | 59.50 | PHYSPROP |
|
|
| | | undecanal C11H22O3, 4, 64 |
 | |
|
| | | undecane C11H243, 4, 61, 64 |
 | |
|
| | | undecanoic acid C11H22O23, 35, 61, 64 |
 | | Compound Data | | Melting point | 28.42 °C | 301.57 K | | CSID | 7888 | H bond acceptors | 2 | Rule of 5 violations | 0 | | Molecular weight | 186.2912 | H bond donors | 1 | ACD/LogP | 4.50 | | Phase 25 °C | solid | Rotatable bonds | 9 | Predicted density | 0.91 g/cm3 | | SMILES | O=C(O)CCCCCCCCCC | | STD InChIKey | ZDPHROOEEOARMN-UHFFFAOYAS | | Melting Points | | mp °C | source | |
|---|
| 28.00 | Alfa Aesar | | 28.60 | EPISuite-ChemSpider | | 28.50 | Oxford University MSDS | | 28.60 | PHYSPROP |
|
|
| | | unizole C5H7N3O23, 64, 70 |
 | |
|
| | | urapidil C20H29N5O39, 48, 64 |
 | |
|
| | | urea CH4N2O3, 35, 61, 64 |
 | | Compound Data | | Melting point | 133.85 °C | 407.00 K | | CSID | 1143 | H bond acceptors | 3 | Rule of 5 violations | 0 | | Molecular weight | 60.0553 | H bond donors | 4 | ACD/LogP | 0.00 | | Phase 25 °C | solid | Rotatable bonds | 0 | Predicted density | 1.21 g/cm3 | | SMILES | C(=O)(N)N | | STD InChIKey | XSQUKJJJFZCRTK-UHFFFAOYAF | | Melting Points | | mp °C | source | |
|---|
| 134.00 | Alfa Aesar | | 132.70 | EPISuite-ChemSpider | | 136.00 | Oxford University MSDS | | 132.70 | PHYSPROP |
|
|
| | | urethane C3H7NO23, 32, 61, 64 |
 | | Compound Data | | Melting point | 48.75 °C | 321.90 K | | CSID | 5439 | H bond acceptors | 3 | Rule of 5 violations | 0 | | Molecular weight | 89.0932 | H bond donors | 2 | ACD/LogP | -0.15 | | Phase 25 °C | solid | Rotatable bonds | 2 | Predicted density | 1.04 g/cm3 | | SMILES | O=C(OCC)N | | STD InChIKey | JOYRKODLDBILNP-UHFFFAOYAY | | Melting Points | | mp °C | source | |
|---|
| 49.00 | Alfa Aesar | | 49.00 | DrugBank | | 48.00 | Oxford University MSDS | | 49.00 | PHYSPROP |
|
|
| | | urox C9H11ClN2O3, 64, 70 |
 | |
|
| | | valeraldehyde C5H10O3, 4, 32, 61, 64 |
 | |
|
| | | valeramide C5H11NO3, 64 |
 | | Compound Data | | Melting point | 104.50 °C | 377.65 K | | CSID | 11795 | H bond acceptors | 2 | Rule of 5 violations | 0 | | Molecular weight | 101.1469 | H bond donors | 2 | ACD/LogP | 0.36 | | Phase 25 °C | solid | Rotatable bonds | 3 | Predicted density | 0.90 g/cm3 | | SMILES | O=C(N)CCCC | | STD InChIKey | IPWFJLQDVFKJDU-UHFFFAOYAM | | Melting Points | | mp °C | source | |
|---|
| 103.00 | Alfa Aesar | | 106.00 | PHYSPROP |
|
|
| | | valeric acid C5H10O23, 4, 30, 32, 35, 54, 64 |
 | |
|
| | | valeronitrile C5H9N3, 31, 61, 64 |
 | |
|
| | | valerophenone C11H14O3, 64 |
 | | Compound Data | | Melting point | -9.20 °C | 263.95 K | | CSID | 59482 | H bond acceptors | 1 | Rule of 5 violations | 0 | | Molecular weight | 162.2283 | H bond donors | 0 | ACD/LogP | 3.26 | | Phase 25 °C | liquid/gas | Rotatable bonds | 4 | Predicted density | 0.95 g/cm3 | | SMILES | O=C(c1ccccc1)CCCC | | STD InChIKey | XKGLSKVNOSHTAD-UHFFFAOYAK | | Melting Points | | mp °C | source | |
|---|
| -9.00 | Alfa Aesar | | -9.40 | PHYSPROP |
|
|
| | | vanillic acid C8H8O43, 61, 64 |
 | | Compound Data | | Melting point | 212.33 °C | 485.48 K | | CSID | 8155 | H bond acceptors | 4 | Rule of 5 violations | 0 | | Molecular weight | 168.1467 | H bond donors | 2 | ACD/LogP | 1.30 | | Phase 25 °C | solid | Rotatable bonds | 3 | Predicted density | 1.35 g/cm3 | | SMILES | COc1cc(ccc1O)C(=O)O | | STD InChIKey | WKOLLVMJNQIZCI-UHFFFAOYAH | | Melting Points | | mp °C | source | |
|---|
| 214.00 | Alfa Aesar | | 211.50 | Oxford University MSDS | | 211.50 | PHYSPROP |
|
|
| | | vanillin C8H8O33, 35, 61, 64 |
 | | Compound Data | | Melting point | 81.75 °C | 354.90 K | | CSID | 13860434 | H bond acceptors | 3 | Rule of 5 violations | 0 | | Molecular weight | 152.1473 | H bond donors | 1 | ACD/LogP | 1.19 | | Phase 25 °C | solid | Rotatable bonds | 3 | Predicted density | 1.23 g/cm3 | | SMILES | Oc1ccc(cc1OC)C=O | | STD InChIKey | MWOOGOJBHIARFG-UHFFFAOYAS | | Melting Points | | mp °C | source | |
|---|
| 82.00 | Alfa Aesar | | 81.50 | EPISuite-ChemSpider | | 82.00 | Oxford University MSDS | | 81.50 | PHYSPROP |
|
|
| | | vanillyl alcohol C8H10O33, 61, 64 |
 | | Compound Data | | Melting point | 114.33 °C | 387.48 K | | CSID | 56139 | H bond acceptors | 3 | Rule of 5 violations | 0 | | Molecular weight | 154.1632 | H bond donors | 2 | ACD/LogP | 0.00 | | Phase 25 °C | solid | Rotatable bonds | 4 | Predicted density | 1.23 g/cm3 | | SMILES | Oc1ccc(cc1OC)CO | | STD InChIKey | ZENOXNGFMSCLLL-UHFFFAOYAV | | Melting Points | | mp °C | source | |
|---|
| 114.00 | Alfa Aesar | | 114.00 | Oxford University MSDS | | 115.00 | PHYSPROP |
|
|
| | | vaumigan C15H183, 64 |
 | | Compound Data | | Melting point | 31.75 °C | 304.90 K | | CSID | 3395 | H bond acceptors | 0 | Rule of 5 violations | 1 | | Molecular weight | 198.3034 | H bond donors | 0 | ACD/LogP | 5.71 | | Phase 25 °C | solid | Rotatable bonds | 1 | Predicted density | 0.96 g/cm3 | | SMILES | CC(C)c2cc1c(ccc1C)c(C)cc2 | | STD InChIKey | FWKQNCXZGNBPFD-UHFFFAOYAG | | Melting Points | | mp °C | source | |
|---|
| 32.00 | Alfa Aesar | | 31.50 | PHYSPROP |
|
|
| | | veratraldehyde C9H10O32, 3, 35, 64 |
 | |
|
| | | vinylacetic acid C4H6O23, 64 |
 | | Compound Data | | Melting point | -37.00 °C | 236.15 K | | CSID | 30349 | H bond acceptors | 2 | Rule of 5 violations | 0 | | Molecular weight | 86.0892 | H bond donors | 1 | ACD/LogP | 0.54 | | Phase 25 °C | liquid/gas | Rotatable bonds | 2 | Predicted density | 1.02 g/cm3 | | SMILES | O=C(O)C\C=C | | STD InChIKey | PVEOYINWKBTPIZ-UHFFFAOYAG | | Melting Points | | mp °C | source | |
|---|
| -39.00 | Alfa Aesar | | -35.00 | PHYSPROP |
|
|
| | | xanthene C13H10O28, 35, 61, 64, 72 |
 | |
|
| | | xanthone C13H8O23, 61 |
 | | Compound Data | | Melting point | 175.50 °C | 448.65 K | | CSID | 6753 | H bond acceptors | 2 | Rule of 5 violations | 0 | | Molecular weight | 196.2014 | H bond donors | 0 | ACD/LogP | 3.39 | | Phase 25 °C | solid | Rotatable bonds | 0 | Predicted density | 1.28 g/cm3 | | SMILES | O=C1c3c(Oc2c1cccc2)cccc3 | | STD InChIKey | JNELGWHKGNBSMD-UHFFFAOYAA | | Melting Points | | mp °C | source | |
|---|
| 176.00 | Alfa Aesar | | 175.00 | Oxford University MSDS |
|
|
| | | xanthydrol C13H10O23, 61, 64 |
 | | Compound Data | | Melting point | 124.83 °C | 397.98 K | | CSID | 65693 | H bond acceptors | 2 | Rule of 5 violations | 0 | | Molecular weight | 198.2173 | H bond donors | 1 | ACD/LogP | 2.27 | | Phase 25 °C | solid | Rotatable bonds | 1 | Predicted density | 1.29 g/cm3 | | SMILES | OC2c3c(Oc1c2cccc1)cccc3 | | STD InChIKey | JFRMYMMIJXLMBB-UHFFFAOYAD | | Melting Points | | mp °C | source | |
|---|
| 124.00 | Alfa Aesar | | 123.00 | Oxford University MSDS | | 127.50 | PHYSPROP |
|
|
| | | xenalipin C14H9F3O23, 64 |
 | | Compound Data | | Melting point | 169.50 °C | 442.65 K | | CSID | 49895 | H bond acceptors | 2 | Rule of 5 violations | 0 | | Molecular weight | 266.2153 | H bond donors | 1 | ACD/LogP | 3.97 | | Phase 25 °C | solid | Rotatable bonds | 2 | Predicted density | 1.33 g/cm3 | | SMILES | FC(F)(F)c1ccc(cc1)c2ccccc2C(=O)O | | STD InChIKey | IQOMYCGTGFGDFN-UHFFFAOYAA | | Melting Points | | mp °C | source | |
|---|
| 169.00 | Alfa Aesar | | 170.00 | PHYSPROP |
|
|
| | | xylometazoline C16H24N29, 64 |
 | | Compound Data | | Melting point | 131.50 °C | 404.65 K | | CSID | 5507 | H bond acceptors | 2 | Rule of 5 violations | 1 | | Molecular weight | 244.3752 | H bond donors | 1 | ACD/LogP | 5.26 | | Phase 25 °C | solid | Rotatable bonds | 3 | Predicted density | 1.00 g/cm3 | | SMILES | N\1=C(\NCC/1)Cc2c(cc(cc2C)C(C)(C)C)C | | STD InChIKey | HUCJFAOMUPXHDK-UHFFFAOYAS | | Melting Points | | mp °C | source | |
|---|
| 131.00 | Bergstrom C. A. S.; Norinder U.; Luthman K.; Artursson P. Mo... | | 132.00 | PHYSPROP |
|
|
| | | zafirlukast C31H33N3O6S9, 32 |
 | | Compound Data | | Melting point | 138.50 °C | 411.65 K | | CSID | 5515 | H bond acceptors | 9 | Rule of 5 violations | 2 | | Molecular weight | 575.6752 | H bond donors | 2 | ACD/LogP | 6.15 | | Phase 25 °C | solid | Rotatable bonds | 8 | Predicted density | 1.32 g/cm3 | | SMILES | O=S(=O)(c1ccccc1C)NC(=O)c2ccc(c(OC)c2)Cc4c3cc(ccc3n(c4)C)NC(=O)OC5CCCC5 | | STD InChIKey | YEEZWCHGZNKEEK-UHFFFAOYAR | | Melting Points | | mp °C | source | |
|---|
| 138.00 | Bergstrom C. A. S.; Norinder U.; Luthman K.; Artursson P. Mo... | | 139.00 | DrugBank |
|
|
| | | zingerone C11H14O33, 64 |
 | | Compound Data | | Melting point | 40.75 °C | 313.90 K | | CSID | 28952 | H bond acceptors | 3 | Rule of 5 violations | 0 | | Molecular weight | 194.2271 | H bond donors | 1 | ACD/LogP | 0.64 | | Phase 25 °C | solid | Rotatable bonds | 5 | Predicted density | 1.11 g/cm3 | | SMILES | O=C(C)CCc1cc(OC)c(O)cc1 | | STD InChIKey | OJYLAHXKWMRDGS-UHFFFAOYAN | | Melting Points | | mp °C | source | |
|---|
| 41.00 | Alfa Aesar | | 40.50 | PHYSPROP |
|
|
| | | zolimidine C14H12N2O2S9, 64 |
 | | Compound Data | | Melting point | 242.50 °C | 515.65 K | | CSID | 13985 | H bond acceptors | 4 | Rule of 5 violations | 0 | | Molecular weight | 272.3223 | H bond donors | 0 | ACD/LogP | 2.13 | | Phase 25 °C | solid | Rotatable bonds | 2 | Predicted density | 1.31 g/cm3 | | SMILES | O=S(=O)(c3ccc(c1nc2ccccn2c1)cc3)C | | STD InChIKey | VSLIUWLPFRVCDL-UHFFFAOYAK | | Melting Points | | mp °C | source | |
|---|
| 242.00 | Bergstrom C. A. S.; Norinder U.; Luthman K.; Artursson P. Mo... | | 243.00 | PHYSPROP |
|
|
| | | zomepirac C15H14ClNO39, 32, 48, 64 |
 | |
|
| | | zonisamide C8H8N2O3S32, 64 |
 | | Compound Data | | Melting point | 161.75 °C | 434.90 K | | CSID | 5532 | H bond acceptors | 5 | Rule of 5 violations | 0 | | Molecular weight | 212.2257 | H bond donors | 2 | ACD/LogP | -0.10 | | Phase 25 °C | solid | Rotatable bonds | 2 | Predicted density | 1.51 g/cm3 | | SMILES | O=S(=O)(N)Cc2noc1ccccc12 | | STD InChIKey | UBQNRHZMVUUOMG-UHFFFAOYAZ | | Melting Points | | mp °C | source | |
|---|
| 162.00 | DrugBank | | 161.50 | PHYSPROP |
|
|
| | | zoxazolamine C7H5ClN2O9, 48, 64 |
 | |
|